Daten aus der Datenbank der Tabelle: Kategorien
+ +-
+
+
+
+
+
+
+
- Keine Daten vorhanden. + +
Routing Config matched request for /" . $ctrlName . "/" . $actionName . ":
routing config is
" . print_r($routingConfig, 1) . ''; + } + // important: overwriting controller and action name + $ctrlClass = $routingConfig[0]; + $actionName = $routingConfig[1]; + } elseif (array_key_exists($request['path'], $config)) { + // exact match on full path, this also means "/" + $routingConfig = explode('@', $config[$request['path']]); + if ($verbosity > 0) { + echo "
Routing Config matched for full path " . $request['path'] . ":
routing config is
" . print_r($routingConfig, 1) . ''; + } + // important: overwriting controller and action name + $ctrlClass = $routingConfig[0]; + $actionName = $routingConfig[1]; + } else { + if ($verbosity > 0) { + echo "Request $ctrlName/$actionName was not in \$config."; + } + + // fall back to filebased convention: match controller classes in directory + $ctrlClass = ucfirst($ctrlName . 'Controller'); + } + + $ctrlFile = ($ctrlClass . '.php'); + $validControllers = FrontController::getValidControllers($controllerDirectory); + if (!in_array($controllerDirectory . $ctrlFile, $validControllers)) { + if ($verbosity > 0) { + echo "
Controller: $ctrlFile not found in
" . print_r($validControllers, 1) . "
Config Array:
" . print_r($config, 1) . "
Web Software Error
" .
+ "Keine entspreche Zuordnung der Route für {$ctrlName}::{$actionName} gefunden. Tippfehler in der Route?" . + "
Es konnte keine Klasse " . $ctrlFile . " gefunden werden! Request fehlgeschlagen.
" . + " Prüfen Sie die Einträge in der Datei config/web.php und gleichen Sie den getätigten Aufruf damit ab.
Fehler in Controller " . get_class($controller) . "!
Stellen Sie sicher, dass die Action/der Controller existiert.
+Das Routing Config-Array hat " . count($config) . " Einträge.
+Exception text
" . $ex->getMessage() . "
{$text}
");
+ if ($die) exit($severity);
+ }
+
+ public static function getConfig($configPath)
+ {
+ try {
+ // load the $config Array from a file given in $configPath
+ $path_to_config = realpath($_SERVER['DOCUMENT_ROOT'] . DIRECTORY_SEPARATOR . $configPath);
+ // print("Path to config " . $path_to_config);
+ $config = include $path_to_config;
+ } catch (Exception $e) {
+ print_r($e);
+ $config = array('/' => 'HomeController@index');
+ } finally {
+ return $config;
+ }
+ }
+
+ public static function getValidControllers($path = '')
+ {
+ if ($path == '') {
+ $path = getcwd() . DIRECTORY_SEPARATOR . 'controllers' . DIRECTORY_SEPARATOR;
+ }
+ return glob($path . '*Controller.php');
+ }
+}
+
+function connectdb()
+{
+ $path_to_config_db = $_SERVER['DOCUMENT_ROOT'] . DIRECTORY_SEPARATOR . CONFIG_DB;
+ $config = include $path_to_config_db;
+ $link = mysqli_connect( // Daten aus config/db.php
+ $config['host'],
+ $config['user'],
+ $config['password'],
+ $config['database'], // Auswahl der Datenbank
+ $config['port'] ?? 3306);
+ if (!$link) {
+ FrontController::showErrorMessage("Verbindung mit der Datenbank nicht möglich
+Verbindung fehlgeschlagen: " . mysqli_connect_error() . ".
Prüfen Sie
- die Angaben in der Datei
config/db.php: + ( ist Benutzer{$config['user']}an Datenbank{$config['database']}auf Server{$config['host']}korrekt?)
+ - ob Ihre Datenbank unter der oben gezeigten Adresse läuft
Verbindung mit der Datenbank nicht möglich
+Fehlermeldung" . mysqli_connect_error() . "", 2, true); + exit(1); + } + + return $link; +} + +function view($viewname, $viewargs = array()) +{ + $views = dirname(__DIR__) . '/views'; + $cache = dirname(__DIR__) . '/storage/cache'; + $blade = new BladeOne($views, $cache, BladeOne::MODE_DEBUG); + + return $blade->run($viewname, $viewargs); +} + +/** + * let the script die if the php minimum version is not met. + * @param $minversion + * @return void + */ +function assert_php_version($minversion = '8.0.0') +{ + $version_too_low = 0; + $minver = explode('.', $minversion); + $version = explode('.', phpversion()); + + if (intval($minver[0]) > intval($version[0])) { + $version_too_low = 1; + } elseif (intval($minver[1]) > intval($version[1])) { + $version_too_low = 1; + } elseif (intval($minver[2]) > intval($version[2])) { + $version_too_low = 1; + } + + if ($version_too_low) { + FrontController::showErrorMessage("Diese PHP-Version wird nicht unterstützt: Minimum PHP Version " . $minversion . "
Sie betreiben gerade PHP Version " . phpversion()); + exit(1); + } + // version is okay, go on. +} + +/** + * let the script die if the path contains problematic characters. + * @return void + */ +function assert_path(): void +{ + static $chars = array("[", "]", "{", "}"); + $charsfound = 0; + str_ireplace($chars, '', $_SERVER['DOCUMENT_ROOT'], $charsfound); + if ($charsfound > 0) { + FrontController::showErrorMessage("
Bitte verwenden Sie einen anderen Ordner für das Projekt!
+Der Pfad " . $_SERVER['DOCUMENT_ROOT'] . " enthält " . $charsfound . " problematische Zeichen, die die korrekte Ausführung verhindern.
Bekannte problematische Zeichen sind
+ " . implode(" ", $chars) . " ");
+ exit(1);
+ }
+
+}
+
+function assert_blade(): void
+{
+ if (!class_exists('eftec\bladeone\BladeOne')) {
+ // #ERROR
+ FrontController::showErrorMessage("
+ Fehler: Blade wurde nicht gefunden
+Tipps für die Lösung:
+-
+
führen Sie im Terminal folgende Zeilen aus.
+-
+
php bin/composer.phar updateoderphp bin/composer.phar reinstall eftec/bladeone
+ php bin/composer.phar dump-autoload
+
Prüfen Sie im Anschluss: befindet sich in dem Ordner
vendor/eftec/bladeone/lib/die DateiBladeOne.php?
+ Starten Sie dann den Webserver neu.
+ Befragen Sie gerne auch das Forum in Ilias.
+
+
+
+yieldContent("jsextra"); ?>
+
+
+
diff --git a/M5/Dossier/emensa/storage/cache/.layouts.layout_933596b3f8bdab5243334e13bf36856f2a87605f.bladec b/M5/Dossier/emensa/storage/cache/.layouts.layout_933596b3f8bdab5243334e13bf36856f2a87605f.bladec
new file mode 100644
index 0000000..3ef70b4
--- /dev/null
+++ b/M5/Dossier/emensa/storage/cache/.layouts.layout_933596b3f8bdab5243334e13bf36856f2a87605f.bladec
@@ -0,0 +1,23 @@
+
+
+
+
+
+ yieldContent("content"); ?>
+
+
+
+
+yieldContent("jsextra"); ?>
+
+
+
diff --git a/M5/Dossier/emensa/storage/cache/.layouts.m4_7d_layout_ecc36cbad49aa38782cc08cc5e9ca6c7ae3590d0.bladec b/M5/Dossier/emensa/storage/cache/.layouts.m4_7d_layout_ecc36cbad49aa38782cc08cc5e9ca6c7ae3590d0.bladec
new file mode 100644
index 0000000..941fc86
--- /dev/null
+++ b/M5/Dossier/emensa/storage/cache/.layouts.m4_7d_layout_ecc36cbad49aa38782cc08cc5e9ca6c7ae3590d0.bladec
@@ -0,0 +1,21 @@
+
+
+
+
+
+
+ yieldContent("content"); ?>
+
+This is a blade view showing phpinfo();
+ + + \ No newline at end of file diff --git a/M5/Dossier/emensa/storage/cache/demo.demo_ce8d2fe4373603a01d84973e3d70c715b31a9f25.bladec b/M5/Dossier/emensa/storage/cache/demo.demo_ce8d2fe4373603a01d84973e3d70c715b31a9f25.bladec new file mode 100644 index 0000000..cc3f065 --- /dev/null +++ b/M5/Dossier/emensa/storage/cache/demo.demo_ce8d2fe4373603a01d84973e3d70c715b31a9f25.bladec @@ -0,0 +1,94 @@ + + +startSection("content"); ?> +
+
+stopSection(); ?>
+
+startSection("cssextra"); ?>
+
+stopSection(); ?>
+
+startSection("jsextra"); ?>
+
+stopSection(); ?>
+runChild(".layouts.layout"); } ?>
\ No newline at end of file
diff --git a/M5/Dossier/emensa/storage/cache/demo.demo_fc1036c569380dbc95c820cc4f5096087e39b268.bladec b/M5/Dossier/emensa/storage/cache/demo.demo_fc1036c569380dbc95c820cc4f5096087e39b268.bladec
new file mode 100644
index 0000000..cc3f065
--- /dev/null
+++ b/M5/Dossier/emensa/storage/cache/demo.demo_fc1036c569380dbc95c820cc4f5096087e39b268.bladec
@@ -0,0 +1,94 @@
+
+
+startSection("content"); ?>
+ Demo für
+Kurze Übersicht, wie die Arbeit mit dem Router und der Blade View-Engine funktioniert.
+ +Router
+Der Router nimmt den Request entgegen und zerlegt ihn in die einzelnen Teile der URI. Wichtig ist hier vor + allem der Pfad und der Querystring.
+Wenn der Pfad in der Routenkonfiguration (\$config Array aus der Datei
+ routes/web.php) gefunden wird, lädt der Router die angegebene Klasse.
Funktionsweise
+Im vorliegenden Beispiel sehen Sie diese Seite ...
+-
+
- weil der Pfad in der Routenkonfiguration gefunden wurde +
- und dort 'DemoController@howto' hinterlegt ist +
- und im Ordner controllers/ die Datei
DemoController.phpgefunden werden konnte +
+ - und mit ihr ein Objekt des Typs DemoController instanziiert werden konnte +
- und dieses Objekt die Funktion (Action) howto() ausgeführt hat +
Sie sehen: da muss einiges stimmen und vieles davon ist Konvention.
+Querystrings und Pfadsegmente
+Die Actions in den Controller-Klassen sollen per Konvention immer ein RequestData Objekt
+ entgegennehmen. Beispiel: howto(RequestData \$rd)
Dieses RequestData Objekt wird durch den Router befüllt, wenn Daten in der URL extrahiert werden konnten.
+Daten finden sich URLs...
+ +-
+
-
+
+ im Querystring
+
Beispiel: rufen Sie diese mit +:///demo?bgcolor=fefbd8&name=Remmy+ auf, werden bgcolor undnamemitsamt Werten als Query Array +$rd->query) übergeben +
+
Probieren Sie es aus ;)
+ args)): ?> +Argumente dieses Aufrufs:
+ + args as $a): $__empty_1 = false; ?> +
+
+
Keine weiteren Argumente im Request
+ + + query)): ?> +Daten aus der Query dieses Aufrufs:
+
+ query as $k => $v): $__empty_1 = false; ?>
+ $rd->query['']=
+
+
+ Keine Querydaten
+
+ Blade
+Blade muss installiert sein. + Die Installation ist bereits geschehen und die Bibliothek liegt unter /vendor. +
+Daten übergeben und View rendern
+Bei der Verwendung der View-Engine gelten einige Konventionen:
+ Die Dateien müssen <viewname>.blade.php heißen und im Ordner views liegen.
+
Sie können der View dann Daten mitgeben, indem Sie alle Daten in ein Array schreiben und dieses dann + übergeben.
+Beispiel:
+
+ view("viewtest",
+ array(
+ "texts"=>$textArray,
+ "persona"=>$persona,
+ "rd"=>$rd
+ )); // öffnet ../views/viewtest.blade.php
+
+
+stopSection(); ?>
+
+startSection("cssextra"); ?>
+
+stopSection(); ?>
+
+startSection("jsextra"); ?>
+
+stopSection(); ?>
+runChild(".layouts.layout"); } ?>
\ No newline at end of file
diff --git a/M5/Dossier/emensa/storage/cache/examples.m4_7a_queryparameter_964ef996681a5d33ee4d5aaa7f2b050eecc4776f.bladec b/M5/Dossier/emensa/storage/cache/examples.m4_7a_queryparameter_964ef996681a5d33ee4d5aaa7f2b050eecc4776f.bladec
new file mode 100644
index 0000000..b580eec
--- /dev/null
+++ b/M5/Dossier/emensa/storage/cache/examples.m4_7a_queryparameter_964ef996681a5d33ee4d5aaa7f2b050eecc4776f.bladec
@@ -0,0 +1,14 @@
+
+
+
+
+ Demo für
+Kurze Übersicht, wie die Arbeit mit dem Router und der Blade View-Engine funktioniert.
+ +Router
+Der Router nimmt den Request entgegen und zerlegt ihn in die einzelnen Teile der URI. Wichtig ist hier vor + allem der Pfad und der Querystring.
+Wenn der Pfad in der Routenkonfiguration (\$config Array aus der Datei
+ routes/web.php) gefunden wird, lädt der Router die angegebene Klasse.
Funktionsweise
+Im vorliegenden Beispiel sehen Sie diese Seite ...
+-
+
- weil der Pfad in der Routenkonfiguration gefunden wurde +
- und dort 'DemoController@howto' hinterlegt ist +
- und im Ordner controllers/ die Datei
DemoController.phpgefunden werden konnte +
+ - und mit ihr ein Objekt des Typs DemoController instanziiert werden konnte +
- und dieses Objekt die Funktion (Action) howto() ausgeführt hat +
Sie sehen: da muss einiges stimmen und vieles davon ist Konvention.
+Querystrings und Pfadsegmente
+Die Actions in den Controller-Klassen sollen per Konvention immer ein RequestData Objekt
+ entgegennehmen. Beispiel: howto(RequestData \$rd)
Dieses RequestData Objekt wird durch den Router befüllt, wenn Daten in der URL extrahiert werden konnten.
+Daten finden sich URLs...
+ +-
+
-
+
+ im Querystring
+
Beispiel: rufen Sie diese mit +:///demo?bgcolor=fefbd8&name=Remmy+ auf, werden bgcolor undnamemitsamt Werten als Query Array +$rd->query) übergeben +
+
Probieren Sie es aus ;)
+ args)): ?> +Argumente dieses Aufrufs:
+ + args as $a): $__empty_1 = false; ?> +
+
+
Keine weiteren Argumente im Request
+ + + query)): ?> +Daten aus der Query dieses Aufrufs:
+
+ query as $k => $v): $__empty_1 = false; ?>
+ $rd->query['']=
+
+
+ Keine Querydaten
+
+ Blade
+Blade muss installiert sein. + Die Installation ist bereits geschehen und die Bibliothek liegt unter /vendor. +
+Daten übergeben und View rendern
+Bei der Verwendung der View-Engine gelten einige Konventionen:
+ Die Dateien müssen <viewname>.blade.php heißen und im Ordner views liegen.
+
Sie können der View dann Daten mitgeben, indem Sie alle Daten in ein Array schreiben und dieses dann + übergeben.
+Beispiel:
+
+ view("viewtest",
+ array(
+ "texts"=>$textArray,
+ "persona"=>$persona,
+ "rd"=>$rd
+ )); // öffnet ../views/viewtest.blade.php
+ Es gab ein Problem mit der Datenbankverbindung
+Fehlermeldung
++ + + + +
Es gab ein Problem mit der Datenbankverbindung
+Fehlermeldung
++ + + +
Daten aus der Datenbank der Tabelle: Kategorien
+ +-
+
+
+
+
+
+
+
- Es sind keine Gerichte vorhanden + +
Es gab ein Problem mit der Datenbankverbindung
+Fehlermeldung
++ + + +
Daten aus der Datenbank der Tabelle: Kategorien
+ +-
+
+
+
+
+
+
+
- Es sind keine Gerichte vorhanden + +
Page 1
+stopSection(); ?> + +startSection("footer"); ?> +Footer of Page 1
+stopSection(); ?> +runChild(".layouts.m4_7d_layout",['title' => "Page 1"]); } ?> \ No newline at end of file diff --git a/M5/Dossier/emensa/storage/cache/examples.pages.m4_7d_page_2_ed122779e3e904882984750d979c216b1e98ea8d.bladec b/M5/Dossier/emensa/storage/cache/examples.pages.m4_7d_page_2_ed122779e3e904882984750d979c216b1e98ea8d.bladec new file mode 100644 index 0000000..961375a --- /dev/null +++ b/M5/Dossier/emensa/storage/cache/examples.pages.m4_7d_page_2_ed122779e3e904882984750d979c216b1e98ea8d.bladec @@ -0,0 +1,14 @@ + + +startSection("header"); ?> + +stopSection(); ?> + +startSection("body"); ?> +Page 2
+stopSection(); ?> + +startSection("footer"); ?> +Footer of Page 2
+stopSection(); ?> +runChild(".layouts.m4_7d_layout",['title' => "Page 2"]); } ?> \ No newline at end of file diff --git a/M5/Dossier/emensa/storage/cache/home_be3f101c28919ade210629435b0b22d1f6f23f27.bladec b/M5/Dossier/emensa/storage/cache/home_be3f101c28919ade210629435b0b22d1f6f23f27.bladec new file mode 100644 index 0000000..c54dc25 --- /dev/null +++ b/M5/Dossier/emensa/storage/cache/home_be3f101c28919ade210629435b0b22d1f6f23f27.bladec @@ -0,0 +1,36 @@ + + +startSection("content"); ?> +Hauptseite E-Mensa
+
+
+
+
+yieldContent("jsextra"); ?>
+
+
+
diff --git a/M5/Dossier/emensa/storage/cache/layouts.main_layout_3661f571e5a2129da3ca081fa828422117d3b345.bladec b/M5/Dossier/emensa/storage/cache/layouts.main_layout_3661f571e5a2129da3ca081fa828422117d3b345.bladec
new file mode 100644
index 0000000..aec0cb1
--- /dev/null
+++ b/M5/Dossier/emensa/storage/cache/layouts.main_layout_3661f571e5a2129da3ca081fa828422117d3b345.bladec
@@ -0,0 +1,30 @@
+
+
+
+
+
+
+ yieldContent("content"); ?>
+
++
+
+
+
+
+
\ No newline at end of file
diff --git a/M5/Dossier/emensa/storage/cache/layouts.main_layout_54314409e9b1b39431b6e14f05f203008160a8be.bladec b/M5/Dossier/emensa/storage/cache/layouts.main_layout_54314409e9b1b39431b6e14f05f203008160a8be.bladec
new file mode 100644
index 0000000..aec0cb1
--- /dev/null
+++ b/M5/Dossier/emensa/storage/cache/layouts.main_layout_54314409e9b1b39431b6e14f05f203008160a8be.bladec
@@ -0,0 +1,30 @@
+
+
+
+
+
+
+yieldContent("text"); ?>
+
+yieldContent("gerichte"); ?>
+
+
++
+
+
+
+
+
\ No newline at end of file
diff --git a/M5/Dossier/emensa/storage/cache/layouts.main_layout_9f099eee303f11c8c3f1b61e05a54e7376df8add.bladec b/M5/Dossier/emensa/storage/cache/layouts.main_layout_9f099eee303f11c8c3f1b61e05a54e7376df8add.bladec
new file mode 100644
index 0000000..aec0cb1
--- /dev/null
+++ b/M5/Dossier/emensa/storage/cache/layouts.main_layout_9f099eee303f11c8c3f1b61e05a54e7376df8add.bladec
@@ -0,0 +1,30 @@
+
+
+
+
+
+
+yieldContent("text"); ?>
+
+yieldContent("gerichte"); ?>
+
+
++
+
+
+
+
+
\ No newline at end of file
diff --git a/M5/Dossier/emensa/storage/cache/layouts.main_layout_ff0dbbbcc8c331f06acac2bd395c317de615c9d1.bladec b/M5/Dossier/emensa/storage/cache/layouts.main_layout_ff0dbbbcc8c331f06acac2bd395c317de615c9d1.bladec
new file mode 100644
index 0000000..aec0cb1
--- /dev/null
+++ b/M5/Dossier/emensa/storage/cache/layouts.main_layout_ff0dbbbcc8c331f06acac2bd395c317de615c9d1.bladec
@@ -0,0 +1,30 @@
+
+
+
+
+
+
+yieldContent("text"); ?>
+
+yieldContent("gerichte"); ?>
+
+
++
+
+
+
+
+
\ No newline at end of file
diff --git a/M5/Dossier/emensa/storage/cache/m5_a1.abmeldung_17f241c320c4a8a9a33bfe29835f14c33bd19626.bladec b/M5/Dossier/emensa/storage/cache/m5_a1.abmeldung_17f241c320c4a8a9a33bfe29835f14c33bd19626.bladec
new file mode 100644
index 0000000..f59bef6
--- /dev/null
+++ b/M5/Dossier/emensa/storage/cache/m5_a1.abmeldung_17f241c320c4a8a9a33bfe29835f14c33bd19626.bladec
@@ -0,0 +1,12 @@
+
+
+startSection("main"); ?>
+
+
+
+
+
+
+
+stopSection(); ?>
+runChild("m5_a1.layout_anmeldung"); } ?>
\ No newline at end of file
diff --git a/M5/Dossier/emensa/storage/cache/m5_a1.anmeldung_01c45fd41d095952aa184fb3fc764d18878732cb.bladec b/M5/Dossier/emensa/storage/cache/m5_a1.anmeldung_01c45fd41d095952aa184fb3fc764d18878732cb.bladec
new file mode 100644
index 0000000..bac6ca9
--- /dev/null
+++ b/M5/Dossier/emensa/storage/cache/m5_a1.anmeldung_01c45fd41d095952aa184fb3fc764d18878732cb.bladec
@@ -0,0 +1,25 @@
+
+
+startSection("main"); ?>
+
+
+
+ Bitte anmelden!
+
+
+
+ Anmeldung erlaubt!
+ Es ist ein Fehler aufgetretten!
+
+
+stopSection(); ?>
+runChild("m5_a1.layout_anmeldung"); } ?>
\ No newline at end of file
diff --git a/M5/Dossier/emensa/storage/cache/m5_a1.anmeldung_c24d33e917eb7ef9d14d646f11f37749504ff5c8.bladec b/M5/Dossier/emensa/storage/cache/m5_a1.anmeldung_c24d33e917eb7ef9d14d646f11f37749504ff5c8.bladec
new file mode 100644
index 0000000..bac6ca9
--- /dev/null
+++ b/M5/Dossier/emensa/storage/cache/m5_a1.anmeldung_c24d33e917eb7ef9d14d646f11f37749504ff5c8.bladec
@@ -0,0 +1,25 @@
+
+
+startSection("main"); ?>
+
+
+
+ Bitte anmelden!
+
+
+
+ Anmeldung erlaubt!
+ Es ist ein Fehler aufgetretten!
+
+
+stopSection(); ?>
+runChild("m5_a1.layout_anmeldung"); } ?>
\ No newline at end of file
diff --git a/M5/Dossier/emensa/storage/cache/m5_a1.anmeldung_verifizieren_06701b6bf7b5936abd21c6cfbe469b752d069cec.bladec b/M5/Dossier/emensa/storage/cache/m5_a1.anmeldung_verifizieren_06701b6bf7b5936abd21c6cfbe469b752d069cec.bladec
new file mode 100644
index 0000000..3ce0535
--- /dev/null
+++ b/M5/Dossier/emensa/storage/cache/m5_a1.anmeldung_verifizieren_06701b6bf7b5936abd21c6cfbe469b752d069cec.bladec
@@ -0,0 +1,51 @@
+
+
+startSection("main"); ?>
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+yieldContent("text"); ?>
+
+yieldContent("gerichte"); ?>
+
+
+
+ + Bitte warten! + +stopSection(); ?> +runChild("m5_a1.layout_anmeldung"); } ?> \ No newline at end of file diff --git a/M5/Dossier/emensa/storage/cache/m5_a1.layout_anmeldung_0bf7f1c53d4cd4970b2790535eaffcc9dddc4266.bladec b/M5/Dossier/emensa/storage/cache/m5_a1.layout_anmeldung_0bf7f1c53d4cd4970b2790535eaffcc9dddc4266.bladec new file mode 100644 index 0000000..5331778 --- /dev/null +++ b/M5/Dossier/emensa/storage/cache/m5_a1.layout_anmeldung_0bf7f1c53d4cd4970b2790535eaffcc9dddc4266.bladec @@ -0,0 +1,21 @@ + + + + +
+
+stopSection(); ?>
+
+startSection("text"); ?>
+
+
+ 
+
+
+
+ 
+ Bald gibt es auch Essen online ;)
+Lorem ipsum dolor sit amet, consetetur sadipscing elitr, sed diam nonumy eirmod tempor invidunt ut labore et + dolore magna aliquyam erat, sed diam voluptua. At vero eos et accusam et justo duo dolores et ea rebum. Stet + clita kasd gubergren, no sea takimata sanctus est Lorem ipsum dolor sit amet. Lorem ipsum dolor sit amet, + consetetur sadipscing elitr, sed diam nonumy eirmod tempor invidunt ut labore et dolore magna aliquyam erat, + sed diam voluptua. At vero eos et accusam et justo duo dolores et ea rebum. Stet clita kasd gubergren, no + sea takimata sanctus est Lorem ipsum dolor sit amet.
+Köstlichkeiten die Sie erwarten
+ +stopSection(); ?> + +startSection("gerichte"); ?> + + +Es gab ein Problem mit der Datenbankverbindung
+Fehlermeldung
++ + + + + +stopSection(); ?> + +startSection("footer"); ?> + +
+
+
+stopSection(); ?>
+
+startSection("text"); ?>
+
+
+
+
+
+
+
+
+ Bald gibt es auch Essen online ;)
+Lorem ipsum dolor sit amet, consetetur sadipscing elitr, sed diam nonumy eirmod tempor invidunt ut labore et + dolore magna aliquyam erat, sed diam voluptua. At vero eos et accusam et justo duo dolores et ea rebum. Stet + clita kasd gubergren, no sea takimata sanctus est Lorem ipsum dolor sit amet. Lorem ipsum dolor sit amet, + consetetur sadipscing elitr, sed diam nonumy eirmod tempor invidunt ut labore et dolore magna aliquyam erat, + sed diam voluptua. At vero eos et accusam et justo duo dolores et ea rebum. Stet clita kasd gubergren, no + sea takimata sanctus est Lorem ipsum dolor sit amet.
+Köstlichkeiten die Sie erwarten
+ +stopSection(); ?> + +startSection("gerichte"); ?> + + +Es gab ein Problem mit der Datenbankverbindung
+Fehlermeldung
++ + + + + +stopSection(); ?> + +startSection("footer"); ?> + +
+
+
+stopSection(); ?>
+
+startSection("text"); ?>
+
+
+
+
+
+
+
+
+ Bald gibt es auch Essen online ;)
+Lorem ipsum dolor sit amet, consetetur sadipscing elitr, sed diam nonumy eirmod tempor invidunt ut labore et + dolore magna aliquyam erat, sed diam voluptua. At vero eos et accusam et justo duo dolores et ea rebum. Stet + clita kasd gubergren, no sea takimata sanctus est Lorem ipsum dolor sit amet. Lorem ipsum dolor sit amet, + consetetur sadipscing elitr, sed diam nonumy eirmod tempor invidunt ut labore et dolore magna aliquyam erat, + sed diam voluptua. At vero eos et accusam et justo duo dolores et ea rebum. Stet clita kasd gubergren, no + sea takimata sanctus est Lorem ipsum dolor sit amet.
+Köstlichkeiten die Sie erwarten
+ +stopSection(); ?> + +startSection("gerichte"); ?> + + + +Es gab ein Problem mit der Datenbankverbindung
+Fehlermeldung
++ + +
+
+stopSection(); ?>
+
+startSection("text"); ?>
+
+
+
+
+
+
+
+ Bald gibt es auch Essen online ;)
+Lorem ipsum dolor sit amet, consetetur sadipscing elitr, sed diam nonumy eirmod tempor invidunt ut labore et + dolore magna aliquyam erat, sed diam voluptua. At vero eos et accusam et justo duo dolores et ea rebum. Stet + clita kasd gubergren, no sea takimata sanctus est Lorem ipsum dolor sit amet. Lorem ipsum dolor sit amet, + consetetur sadipscing elitr, sed diam nonumy eirmod tempor invidunt ut labore et dolore magna aliquyam erat, + sed diam voluptua. At vero eos et accusam et justo duo dolores et ea rebum. Stet clita kasd gubergren, no + sea takimata sanctus est Lorem ipsum dolor sit amet.
+Köstlichkeiten die Sie erwarten
+ +stopSection(); ?> + +startSection("gerichte"); ?> + + +Es gab ein Problem mit der Datenbankverbindung
+Fehlermeldung
++ + + + + +stopSection(); ?> + +startSection("footer"); ?> + +
This is a blade view showing phpinfo();
+ + +@php +phpinfo(); +@endphp \ No newline at end of file diff --git a/M5/Dossier/emensa/views/demo/demo.blade.php b/M5/Dossier/emensa/views/demo/demo.blade.php new file mode 100644 index 0000000..cb2c5fd --- /dev/null +++ b/M5/Dossier/emensa/views/demo/demo.blade.php @@ -0,0 +1,92 @@ +@extends(".layouts.layout") + +@section("content") +
+
+@endsection
+
+@section("cssextra")
+
+@endsection
+
+@section("jsextra")
+
+@endsection
\ No newline at end of file
diff --git a/M5/Dossier/emensa/views/demo/requestdata.blade.php b/M5/Dossier/emensa/views/demo/requestdata.blade.php
new file mode 100644
index 0000000..496af1b
--- /dev/null
+++ b/M5/Dossier/emensa/views/demo/requestdata.blade.php
@@ -0,0 +1,24 @@
+Demo für {{ $name }}
+Kurze Übersicht, wie die Arbeit mit dem Router und der Blade View-Engine funktioniert.
+ +Router
+Der Router nimmt den Request entgegen und zerlegt ihn in die einzelnen Teile der URI. Wichtig ist hier vor + allem der Pfad und der Querystring.
+Wenn der Pfad in der Routenkonfiguration (\$config Array aus der Datei
+ routes/web.php) gefunden wird, lädt der Router die angegebene Klasse.
Funktionsweise
+Im vorliegenden Beispiel sehen Sie diese Seite ...
+-
+
- weil der Pfad in der Routenkonfiguration gefunden wurde +
- und dort 'DemoController@howto' hinterlegt ist +
- und im Ordner controllers/ die Datei
DemoController.phpgefunden werden konnte +
+ - und mit ihr ein Objekt des Typs DemoController instanziiert werden konnte +
- und dieses Objekt die Funktion (Action) howto() ausgeführt hat +
Sie sehen: da muss einiges stimmen und vieles davon ist Konvention.
+Querystrings und Pfadsegmente
+Die Actions in den Controller-Klassen sollen per Konvention immer ein RequestData Objekt
+ entgegennehmen. Beispiel: howto(RequestData \$rd)
Dieses RequestData Objekt wird durch den Router befüllt, wenn Daten in der URL extrahiert werden konnten.
+Daten finden sich URLs...
+ +-
+
-
+
+ im Querystring
+
Beispiel: rufen Sie diese mit +{{strtolower(explode('/',$_SERVER["SERVER_PROTOCOL"])[0])}}://{{$_SERVER["HTTP_HOST"]}}/demo?bgcolor=fefbd8&name=Remmy+ auf, werden bgcolor undnamemitsamt Werten als Query Array +$rd->query) übergeben +
+
Probieren Sie es aus ;)
+ @if(count($rd->args)) +Argumente dieses Aufrufs:
+ + @forelse($rd->args as $a) +{{$a}}
+ @empty
+ Keine weiteren Argumente im Request
+ @endforelse + @endif + @if(count($rd->query)) +Daten aus der Query dieses Aufrufs:
+
+ @forelse($rd->query as $k => $v)
+ $rd->query['{{$k}}']={{$v}}
+ @empty
+ Keine Querydaten
+ @endforelse
+ Blade
+Blade muss installiert sein. + Die Installation ist bereits geschehen und die Bibliothek liegt unter /vendor. +
+Daten übergeben und View rendern
+Bei der Verwendung der View-Engine gelten einige Konventionen:
+ Die Dateien müssen <viewname>.blade.php heißen und im Ordner views liegen.
+
Sie können der View dann Daten mitgeben, indem Sie alle Daten in ein Array schreiben und dieses dann + übergeben.
+Beispiel:
+
+ view("viewtest",
+ array(
+ "texts"=>$textArray,
+ "persona"=>$persona,
+ "rd"=>$rd
+ )); // öffnet ../views/viewtest.blade.php
+ RequestData
+ +@if(count($rd->getData())) +combined request data
+
+ {{print_r($rd->getData(),1)}}
+
+@else
+ this request contained zero parameters
+@endif + +@if(count($rd->getGetData())) +GET request data
+ {{print_r($rd->getGetData(),1)}}
+
+@endif
+
+@if(count($rd->getPostData()))
+ POST request data
+ {{print_r($rd->getPostData(),1)}}
+
+@endif
\ No newline at end of file
diff --git a/M5/Dossier/emensa/views/examples/m4_7a_queryparameter.blade.php b/M5/Dossier/emensa/views/examples/m4_7a_queryparameter.blade.php
new file mode 100644
index 0000000..c094999
--- /dev/null
+++ b/M5/Dossier/emensa/views/examples/m4_7a_queryparameter.blade.php
@@ -0,0 +1,13 @@
+
+
+
+
+ Es gab ein Problem mit der Datenbankverbindung
+Fehlermeldung
+ {{$data['beschreibung']}}
+
+@else
+
+
+ Daten aus der Datenbank der Tabelle: Kategorien
+ +-
+ @forelse($data as $a)
+ @if($zweites)
- {{$a['name']}} + @else +
- {{$a['name']}} + @endif + @empty +
- Keine Daten vorhanden. + @endforelse +
Es gab ein Problem mit der Datenbankverbindung
+Fehlermeldung
+ {{$data['beschreibung']}}
+
+@else
+
+ Daten aus der Datenbank der Tabelle: Kategorien
+ +-
+ @forelse($data as $a)
+ @if(!empty($a['name']))
+
- {{$a['name']}} + @endif + + @empty +
- Es sind keine Gerichte vorhanden + @endforelse +
Page 1
+@endsection + +@section("footer") +Footer of Page 1
+@endsection \ No newline at end of file diff --git a/M5/Dossier/emensa/views/examples/pages/m4_7d_page_2.blade.php b/M5/Dossier/emensa/views/examples/pages/m4_7d_page_2.blade.php new file mode 100644 index 0000000..920a59a --- /dev/null +++ b/M5/Dossier/emensa/views/examples/pages/m4_7d_page_2.blade.php @@ -0,0 +1,13 @@ +@extends(".layouts.m4_7d_layout",['title' => "Page 2"]) + +@section("header") + +@endsection + +@section("body") +Page 2
+@endsection + +@section("footer") +Footer of Page 2
+@endsection \ No newline at end of file diff --git a/M5/Dossier/emensa/views/home.blade.php b/M5/Dossier/emensa/views/home.blade.php new file mode 100644 index 0000000..474d713 --- /dev/null +++ b/M5/Dossier/emensa/views/home.blade.php @@ -0,0 +1,34 @@ +@extends("layouts.layout") + +@section("content") +Hauptseite E-Mensa
+
+
+
+
+@yield("jsextra")
+
+
+
diff --git a/M5/Dossier/emensa/views/layouts/m4_7d_layout.blade.php b/M5/Dossier/emensa/views/layouts/m4_7d_layout.blade.php
new file mode 100644
index 0000000..2ae864d
--- /dev/null
+++ b/M5/Dossier/emensa/views/layouts/m4_7d_layout.blade.php
@@ -0,0 +1,21 @@
+
+
+
+
+
+
+ @yield("content")
+
++
+
+
+
+
+
\ No newline at end of file
diff --git a/M5/Dossier/emensa/views/m5_a1/layout_anmeldung.blade.php b/M5/Dossier/emensa/views/m5_a1/layout_anmeldung.blade.php
new file mode 100644
index 0000000..c230204
--- /dev/null
+++ b/M5/Dossier/emensa/views/m5_a1/layout_anmeldung.blade.php
@@ -0,0 +1,21 @@
+
+
+
+
+
+@yield("text")
+
+@yield("gerichte")
+
+
+
+
+
+@endsection
+
+@section("text")
+
+
+
+
+
+
+
+
+ Bald gibt es auch Essen online ;)
+Lorem ipsum dolor sit amet, consetetur sadipscing elitr, sed diam nonumy eirmod tempor invidunt ut labore et + dolore magna aliquyam erat, sed diam voluptua. At vero eos et accusam et justo duo dolores et ea rebum. Stet + clita kasd gubergren, no sea takimata sanctus est Lorem ipsum dolor sit amet. Lorem ipsum dolor sit amet, + consetetur sadipscing elitr, sed diam nonumy eirmod tempor invidunt ut labore et dolore magna aliquyam erat, + sed diam voluptua. At vero eos et accusam et justo duo dolores et ea rebum. Stet clita kasd gubergren, no + sea takimata sanctus est Lorem ipsum dolor sit amet.
+Köstlichkeiten die Sie erwarten
+ +@endsection + +@section("gerichte") + + + @if (isset($data['error'])) +Es gab ein Problem mit der Datenbankverbindung
+Fehlermeldung
+ {{$data['beschreibung']}}
+
+ @else
+ Nicht implementiert
+Sie haben eine Action aufgerufen, die zu dieser View führt.
+Vervollständigen Sie die Action, sodass die Aufgabe erfüllt wird.
+@endsection \ No newline at end of file diff --git a/M6/Dossier/AlterAndUpdate.txt b/M6/Dossier/AlterAndUpdate.txt new file mode 100644 index 0000000..a024ce0 --- /dev/null +++ b/M6/Dossier/AlterAndUpdate.txt @@ -0,0 +1,15 @@ +ALTER TABLE gericht ADD bildname varchar(200) + +UPDATE gericht SET bildname = '01_bratkartoffel.jpg' WHERE id=1; +UPDATE gericht SET bildname = '03_bratkartoffel.jpg' WHERE id=3; +UPDATE gericht SET bildname = '04_tofu.jpg' WHERE id=4; +UPDATE gericht SET bildname = '09_suppe.jpg' WHERE id=9; +UPDATE gericht SET bildname = '06_lasagne.jpg' WHERE id=6; +UPDATE gericht SET bildname = '10_forelle.jpg' WHERE id=10; +UPDATE gericht SET bildname = '11_soup.jpg' WHERE id=11; +UPDATE gericht SET bildname = '12_kassler.jpg' WHERE id=12; +UPDATE gericht SET bildname = '13_reibekuchen.jpg' WHERE id=13; +UPDATE gericht SET bildname = '15_pilze.jpg' WHERE id=15; +UPDATE gericht SET bildname = '17_broetchen.jpg' WHERE id=17; +UPDATE gericht SET bildname = '19_mousse.jpg' WHERE id=19; +UPDATE gericht SET bildname = '20_suppe.jpg' WHERE id=20; \ No newline at end of file diff --git a/M6/Dossier/M5.md b/M6/Dossier/M5.md new file mode 100644 index 0000000..60d8931 --- /dev/null +++ b/M6/Dossier/M5.md @@ -0,0 +1,144 @@ +# Aufgabe 1 +## 1. Tabelle Benutzer anlegen +``` sql +CREATE TABLE benutzer ( + id BIGINT AUTO_INCREMENT PRIMARY KEY, + name VARCHAR(200) NOT NULL, + email VARCHAR(100) NOT NULL UNIQUE, + passwort VARCHAR(200) NOT NULL, + admin TINYINT(1) NOT NULL DEFAULT 0, + anzahlfehler INT NOT NULL DEFAULT 0, + anzahlanmeldungen INT NOT NULL DEFAULT 0, + letzteanmeldung DATETIME DEFAULT NULL, + letzterfehler DATETIME DEFAULT NULL +); +``` +## 3. Admin anlegen +```sql +INSERT INTO benutzer (name, email, passwort, admin) +VALUES ('admin', 'admin@emensa.example', '2e2b6533a81bc15430cf65de46dc097eeb5ba70c', 1); +-- '2e2b6533a81bc15430cf65de46dc097eeb5ba70c' = 'passwort' +``` +## 9. Transaktion +`mysqli_begin_transaction` und `mysqli_commit` sind Funktionen, die im Zusammenhang mit Transaktionen in MySQL verwendet werden. Eine Transaktion ist eine Sequenz von Datenbankoperationen, die als eine einzige logische Einheit ausgeführt wird. Transaktionen gewährleisten, dass entweder alle Operationen erfolgreich durchgeführt werden oder keine von ihnen, wenn ein Fehler auftritt. Dieses Konzept wird als ACID-Eigenschaften bekannt: Atomarität, Konsistenz, Isolation und Dauerhaftigkeit. +- **`mysqli_begin_transaction`:** Diese Funktion startet eine neue Transaktion. Ab diesem Punkt können mehrere SQL-Operationen ausgeführt werden, die entweder alle gleichzeitig bestätigt (commited) oder abgebrochen (rolled back) werden. Das heißt, keine der Operationen ist für andere Verbindungen sichtbar, bis sie bestätigt werden. +- **`mysqli_commit`:** Diese Funktion wird verwendet, um alle Änderungen, die während der Transaktion gemacht wurden, zu bestätigen und dauerhaft in der Datenbank zu speichern. Nach dem Aufruf dieser Funktion werden alle Änderungen für andere Benutzer und Prozesse sichtbar. + +Im Kontext des gegebenen PHP-Codes wird eine Transaktion verwendet, um die Sicherheit und Integrität der Datenbank zu erhöhen, wenn die Informationen eines Benutzers aktualisiert werden. Hier ist ein Überblick über die Abläufe in der Funktion `anmelden`: +1. Eine Verbindung zur Datenbank wird hergestellt (`connectdb`). +2. Es wird ein SQL-Select-Statement ausgeführt, um den Benutzer mit der spezifizierten E-Mail zu finden. +3. Wenn kein Passwort für den Benutzer gesetzt ist, wird die Funktion frühzeitig mit einem Rückgabewert von 0 beendet. +4. Wenn das Passwort des Benutzers übereinstimmt, werden die folgenden Schritte innerhalb einer Transaktion durchgeführt: + - Die Transaktion wird mit `mysqli_begin_transaction` begonnen. + - Ein Update-Statement wird vorbereitet und ausgeführt, um die `letzteanmeldung` auf die aktuelle Zeit und `anzahlfehler` auf 0 zu setzen. + - Ein weiteres Update-Statement wird vorbereitet und ausgeführt, um die `anzahlanmeldungen` um eins zu erhöhen. + - Die Transaktion wird mit `mysqli_commit` abgeschlossen. + - Sitzungsvariablen werden gesetzt, und die Funktion gibt 1 zurück, was eine erfolgreiche Anmeldung bedeutet. +5. Wenn das Passwort nicht übereinstimmt, wird ebenfalls eine Transaktion durchgeführt: + - Die Transaktion wird mit `mysqli_begin_transaction` begonnen. + - Ein Update-Statement wird vorbereitet und ausgeführt, um `anzahlfehler` um eins zu erhöhen und `letzterfehler` auf die aktuelle Zeit zu setzen. + - Die Transaktion wird mit `mysqli_commit` abgeschlossen. + - Die Funktion gibt 0 zurück, was eine fehlgeschlagene Anmeldung bedeutet. + +Durch die Verwendung von Transaktionen wird sichergestellt, dass, wenn z.B. ein Fehler bei einer der Update-Operationen auftritt oder die Verbindung zur Datenbank verloren geht, keine teilweise aktualisierten Daten zurückbleiben, was zu Inkonsistenzen führen könnte. Stattdessen würde die gesamte Transaktion automatisch zurückgerollt oder abgebrochen werden (`rollback`), sodass die Datenbank in einem konsistenten Zustand bleibt. + +# Aufgabe 2 +```sql +ALTER TABLE gericht ADD bildname varchar(200); + +UPDATE gericht SET bildname = '01_bratkartoffel.jpg' WHERE id=1; +UPDATE gericht SET bildname = '03_bratkartoffel.jpg' WHERE id=3; +UPDATE gericht SET bildname = '04_tofu.jpg' WHERE id=4; +UPDATE gericht SET bildname = '09_suppe.jpg' WHERE id=9; +UPDATE gericht SET bildname = '06_lasagne.jpg' WHERE id=6; +UPDATE gericht SET bildname = '10_forelle.jpg' WHERE id=10; +UPDATE gericht SET bildname = '11_soup.jpg' WHERE id=11; +UPDATE gericht SET bildname = '12_kassler.jpg' WHERE id=12; +UPDATE gericht SET bildname = '13_reibekuchen.jpg' WHERE id=13; +UPDATE gericht SET bildname = '15_pilze.jpg' WHERE id=15; +UPDATE gericht SET bildname = '17_broetchen.jpg' WHERE id=17; +UPDATE gericht SET bildname = '19_mousse.jpg' WHERE id=19; +UPDATE gericht SET bildname = '20_suppe.jpg' WHERE id=20; +``` + +# Aufgabe 3 +1. Composer installieren + 1. **Download der Composer-Installer-EXE:** Gehen Sie zur offiziellen Composer-Website [getcomposer.org](https://getcomposer.org/) und klicken Sie auf den Button "Download" oder direkt auf "Composer-Setup.exe", um den Installer für Windows herunterzuladen. + 2. **Ausführen des Installers:** Führen Sie die heruntergeladene "Composer-Setup.exe"-Datei aus. Es wird ein Installationsassistent gestartet. + 3. **Installationsoptionen:** Folgen Sie den Anweisungen im Installationsassistenten. Der Assistent wird Sie nach dem Pfad zur PHP-Executable fragen. Wenn Sie PHP bereits installiert haben und die Umgebungsvariable `PATH` gesetzt ist, kann der Assistent PHP automatisch finden. Falls nicht, müssen Sie den Pfad zur PHP-Executable (`php.exe`) manuell angeben. + 4. **Abschluss der Installation:** Führen Sie den Installationsprozess durch. Am Ende können Sie die Option aktivieren, um die Befehlszeileneingabe zu ändern und den Pfad zu Composer in die Windows-Umgebungsvariable `PATH` aufzunehmen. Damit wird Composer global zugänglich gemacht. + 5. **Überprüfung der Installation:** Öffnen Sie nach Abschluss der Installation die Kommandozeile (CMD) oder PowerShell und geben Sie `composer` ein, um zu überprüfen, ob Composer erfolgreich installiert wurde. Wenn alles korrekt installiert wurde, sollten Informationen und verfügbare Befehle von Composer angezeigt werden. +2. Abhängigkeiten laden + 1. Verzeichnis `./emensa` wechseln + 2. `composer require monolog/monolog` ausführen + +# Aufgabe 4 + +```sql +-- a) +CREATE OR REPLACE + VIEW view_suppengerichte + AS select * from gericht + WHERE name LIKE '%suppe%'; + +-- b) +CREATE OR REPLACE + VIEW view_anmeldungen + AS select name,anzahlanmeldungen + from benutzer + ORDER BY anzahlanmeldungen DESC; + +-- c) +CREATE OR REPLACE VIEW view_kategoriegerichte_vegetarisch + AS select gericht.name as gericht_name, + vegetarisch, + kategorie.name as katergorie_name + from gericht, kategorie + WHERE vegetarisch = 1 ; +``` + +# Aufgabe 5 +## Was ist eine SQL-Prozedur +Eine SQL-Prozedur ist eine Sammlung von SQL-Anweisungen, die unter einem Namen gespeichert werden und bei Bedarf aufgerufen werden können. Die Struktur einer SQL-Prozedur umfasst in der Regel zusammengesetzte Anweisungen, die durch die Schlüsselwörter BEGIN und END begrenzt sind[1]. Gespeicherte Prozeduren ermöglichen es, komplexe Abläufe von Anweisungen vom Datenbank-Client auszuführen und sind somit ein eigenständiger Befehl, der eine Abfolge gespeicherter Befehle darstellt[2]. + +Diese Prozedur kann dann mithilfe des Befehls EXECUTE aufgerufen werden. + +Gespeicherte Prozeduren bieten Vorteile wie die Wiederverwendbarkeit von Code, die Verbesserung der Leistung und die Reduzierung von Netzwerkverkehr, da die gespeicherten Prozeduren einmal erstellt und dann mehrmals aufgerufen werden können[2]. + +Quellen: +1. https://www.ibm.com/docs/de/db2/11.1?topic=procedures-structure-sql +2. https://de.wikipedia.org/wiki/Gespeicherte_Prozedur +3. https://www.ibm.com/docs/de/SSEPGG_11.1.0/com.ibm.db2.luw.sql.ref.doc/doc/r0008329.html +4. https://learn.microsoft.com/de-de/sql/relational-databases/stored-procedures/create-a-stored-procedure?view=sql-server-ver16 +5. https://learn.microsoft.com/de-de/sql/relational-databases/stored-procedures/execute-a-stored-procedure?view=sql-server-ver16 + +## Lösung +### a) +``` sql +CREATE PROCEDURE incrementAnzahlAnmeldungen (IN benutzerid INT) +BEGIN + UPDATE benutzer + SET anzahlanmeldungen = anzahlanmeldungen + 1 + WHERE id = benutzerid; +END; +``` +Die Prozedur die in M5_5.sql hinterlegt ist, muss einmal manuell ausgeführt werden. + +### c) +Die Anwendung die am naheliegensten sind, wären das Incrementieren der `anzahlfehler` analog zu Teilaufgabe (a). +Darüber hinaus könnten alle Queries als Stored Procedures von der +Emensa-Werbeseite aufgerufen werden und dies hätte mehrere Vorteile. +Zum einen hätte es einen _Security-Vorteil_, wenn alle Queries der Werbeseiten als +Proceduren gespeichert werden würedn. Dadruch wäre es nähmlich möglich alle +erwarteten Queries abzuspeichern und der Werbeseite nur die _Berechtigung zum +Verwenden von Stored-Procedures_ zu geben. Dadurch kann nur noch in definierten +Schnittstellen mit der Dankenbank interagiert werden. +Darüber hinaus hat es wohl auch einen Vorteil gegenüber SQL-Injections. +Ein letzter Vorteil wäre, dass im PHP-Code einfach kurz die Prozedur aufgerufen +werdne kann statt lange Query-Strings zu haben. +Somit würde ich wahrscheinlich - alleine für die _Lesbarkeit_ - diese Query in +eine Stored Procedure auslagern. +Ein weiterer Vorteil wäre, dass Stored-Procedures _vor-opitimiert_ sind. +Darüber hinaus kann durch das Speichern der Queries in der Datenbank +Businesslogik "bewahren" unabhängig von git. +... Verkapselung.... diff --git a/M6/Dossier/emensa/README.md b/M6/Dossier/emensa/README.md new file mode 100644 index 0000000..1e7b904 --- /dev/null +++ b/M6/Dossier/emensa/README.md @@ -0,0 +1,22 @@ +# Routingscript MVC + +little routing script for use in DBWT + +intended to run with only one dependency (bladeone). + +## usage + +* start this script by either executing `start_server.bat` or running `php -S 127.0.0.1:9000 -t public` in a shell from the project´s root directory. + +* [open the website](http://127.0.0.1:9000/) + +## folder overview + +* `bin/` is only necessary if you need to use composer and dont have it installed already +* `config/` holds configuration files +* `controllers/` contains all Controller Classes +* `models/` contains the Model Classes +* `public/` is the web root for your http server and contains the routing script itself, next to resources that will be accessible by http clients (css, js, images, etc.) +* `storage/` is necessary to hold Blade Cache Files +* `views/` holds all View Files + diff --git a/M6/Dossier/emensa/bin/composer.phar b/M6/Dossier/emensa/bin/composer.phar new file mode 100644 index 0000000..e766506 Binary files /dev/null and b/M6/Dossier/emensa/bin/composer.phar differ diff --git a/M6/Dossier/emensa/composer.json b/M6/Dossier/emensa/composer.json new file mode 100644 index 0000000..5246984 --- /dev/null +++ b/M6/Dossier/emensa/composer.json @@ -0,0 +1,10 @@ +{ + "name": "emensa/mvc", + "description": "routing script for module Datenbanken und Webtechnologien MVC", + "license": "proprietary", + "require": { + "eftec/bladeone": "^4.1", + "ext-mysqli": "*", + "monolog/monolog": "^3.5" + } +} diff --git a/M6/Dossier/emensa/composer.lock b/M6/Dossier/emensa/composer.lock new file mode 100644 index 0000000..8536679 --- /dev/null +++ b/M6/Dossier/emensa/composer.lock @@ -0,0 +1,231 @@ +{ + "_readme": [ + "This file locks the dependencies of your project to a known state", + "Read more about it at https://getcomposer.org/doc/01-basic-usage.md#installing-dependencies", + "This file is @generated automatically" + ], + "content-hash": "56e35407c924fe62af5e2eb164530d54", + "packages": [ + { + "name": "eftec/bladeone", + "version": "4.9", + "source": { + "type": "git", + "url": "https://github.com/EFTEC/BladeOne.git", + "reference": "019036c226086fbe7591360d260067c5d82400ca" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/EFTEC/BladeOne/zipball/019036c226086fbe7591360d260067c5d82400ca", + "reference": "019036c226086fbe7591360d260067c5d82400ca", + "shasum": "" + }, + "require": { + "ext-json": "*", + "php": ">=7.2.5" + }, + "require-dev": { + "phpunit/phpunit": "^8.5.23" + }, + "suggest": { + "eftec/bladeonehtml": "Extension to create forms", + "ext-mbstring": "This extension is used if it's active" + }, + "bin": [ + "lib/bladeonecli" + ], + "type": "library", + "autoload": { + "psr-4": { + "eftec\\bladeone\\": "lib/" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Jorge Patricio Castro Castillo", + "email": "jcastro@eftec.cl" + } + ], + "description": "The standalone version Blade Template Engine from Laravel in a single php file", + "homepage": "https://github.com/EFTEC/BladeOne", + "keywords": [ + "blade", + "php", + "template", + "templating", + "view" + ], + "support": { + "issues": "https://github.com/EFTEC/BladeOne/issues", + "source": "https://github.com/EFTEC/BladeOne/tree/4.9" + }, + "time": "2023-05-01T12:48:42+00:00" + }, + { + "name": "monolog/monolog", + "version": "3.5.0", + "source": { + "type": "git", + "url": "https://github.com/Seldaek/monolog.git", + "reference": "c915e2634718dbc8a4a15c61b0e62e7a44e14448" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/Seldaek/monolog/zipball/c915e2634718dbc8a4a15c61b0e62e7a44e14448", + "reference": "c915e2634718dbc8a4a15c61b0e62e7a44e14448", + "shasum": "" + }, + "require": { + "php": ">=8.1", + "psr/log": "^2.0 || ^3.0" + }, + "provide": { + "psr/log-implementation": "3.0.0" + }, + "require-dev": { + "aws/aws-sdk-php": "^3.0", + "doctrine/couchdb": "~1.0@dev", + "elasticsearch/elasticsearch": "^7 || ^8", + "ext-json": "*", + "graylog2/gelf-php": "^1.4.2 || ^2.0", + "guzzlehttp/guzzle": "^7.4.5", + "guzzlehttp/psr7": "^2.2", + "mongodb/mongodb": "^1.8", + "php-amqplib/php-amqplib": "~2.4 || ^3", + "phpstan/phpstan": "^1.9", + "phpstan/phpstan-deprecation-rules": "^1.0", + "phpstan/phpstan-strict-rules": "^1.4", + "phpunit/phpunit": "^10.1", + "predis/predis": "^1.1 || ^2", + "ruflin/elastica": "^7", + "symfony/mailer": "^5.4 || ^6", + "symfony/mime": "^5.4 || ^6" + }, + "suggest": { + "aws/aws-sdk-php": "Allow sending log messages to AWS services like DynamoDB", + "doctrine/couchdb": "Allow sending log messages to a CouchDB server", + "elasticsearch/elasticsearch": "Allow sending log messages to an Elasticsearch server via official client", + "ext-amqp": "Allow sending log messages to an AMQP server (1.0+ required)", + "ext-curl": "Required to send log messages using the IFTTTHandler, the LogglyHandler, the SendGridHandler, the SlackWebhookHandler or the TelegramBotHandler", + "ext-mbstring": "Allow to work properly with unicode symbols", + "ext-mongodb": "Allow sending log messages to a MongoDB server (via driver)", + "ext-openssl": "Required to send log messages using SSL", + "ext-sockets": "Allow sending log messages to a Syslog server (via UDP driver)", + "graylog2/gelf-php": "Allow sending log messages to a GrayLog2 server", + "mongodb/mongodb": "Allow sending log messages to a MongoDB server (via library)", + "php-amqplib/php-amqplib": "Allow sending log messages to an AMQP server using php-amqplib", + "rollbar/rollbar": "Allow sending log messages to Rollbar", + "ruflin/elastica": "Allow sending log messages to an Elastic Search server" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-main": "3.x-dev" + } + }, + "autoload": { + "psr-4": { + "Monolog\\": "src/Monolog" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Jordi Boggiano", + "email": "j.boggiano@seld.be", + "homepage": "https://seld.be" + } + ], + "description": "Sends your logs to files, sockets, inboxes, databases and various web services", + "homepage": "https://github.com/Seldaek/monolog", + "keywords": [ + "log", + "logging", + "psr-3" + ], + "support": { + "issues": "https://github.com/Seldaek/monolog/issues", + "source": "https://github.com/Seldaek/monolog/tree/3.5.0" + }, + "funding": [ + { + "url": "https://github.com/Seldaek", + "type": "github" + }, + { + "url": "https://tidelift.com/funding/github/packagist/monolog/monolog", + "type": "tidelift" + } + ], + "time": "2023-10-27T15:32:31+00:00" + }, + { + "name": "psr/log", + "version": "3.0.0", + "source": { + "type": "git", + "url": "https://github.com/php-fig/log.git", + "reference": "fe5ea303b0887d5caefd3d431c3e61ad47037001" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/php-fig/log/zipball/fe5ea303b0887d5caefd3d431c3e61ad47037001", + "reference": "fe5ea303b0887d5caefd3d431c3e61ad47037001", + "shasum": "" + }, + "require": { + "php": ">=8.0.0" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "3.x-dev" + } + }, + "autoload": { + "psr-4": { + "Psr\\Log\\": "src" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "PHP-FIG", + "homepage": "https://www.php-fig.org/" + } + ], + "description": "Common interface for logging libraries", + "homepage": "https://github.com/php-fig/log", + "keywords": [ + "log", + "psr", + "psr-3" + ], + "support": { + "source": "https://github.com/php-fig/log/tree/3.0.0" + }, + "time": "2021-07-14T16:46:02+00:00" + } + ], + "packages-dev": [], + "aliases": [], + "minimum-stability": "stable", + "stability-flags": [], + "prefer-stable": false, + "prefer-lowest": false, + "platform": { + "ext-mysqli": "*" + }, + "platform-dev": [], + "plugin-api-version": "2.6.0" +} diff --git a/M6/Dossier/emensa/config/db.php b/M6/Dossier/emensa/config/db.php new file mode 100644 index 0000000..636415f --- /dev/null +++ b/M6/Dossier/emensa/config/db.php @@ -0,0 +1,9 @@ + 'localhost', // 'localhost' or '127.0.0.1' + 'user' => 'root', // 'DOCUMENT_ROOT: {$_SERVER['DOCUMENT_ROOT']}Datei nicht gefunden: {$_SERVER['DOCUMENT_ROOT']}/../vendor/autoload.php
"; + echo "Häufigste Ursache
-
+
- Das Verzeichnis
public/ist nicht als Wurzelverzeichnis verwendet worden.
+ - Die Abhängigkeiten wurden nicht mit
composer updateinstalliert.
+
DOCUMENT_ROOT{$_SERVER['DOCUMENT_ROOT']}Error" . $ex->getMessage() . ""; +} + +use eftec\bladeone\BladeOne; + +/* Routing Script for PHP Dev Server */ +$verbosity = VERBOSITY; +if (preg_match('/\.(?:css|js|png|jpg|jpeg|gif)$/', $_SERVER["REQUEST_URI"])) { + return false; +} else { + if ($verbosity > 1) { + echo + "
Verbosity-Level: {$verbosity}" .
+ "" . print_r($_SERVER, 1) . "
"; + } + FrontController::handleRequest("$_SERVER[HTTP_HOST]$_SERVER[REQUEST_URI]", $_SERVER['REQUEST_METHOD'], VERBOSITY); +} + +class RequestData +{ + /** + * @var array Request Querystring, broken down to key-value pairs + */ + public array $query; + /** + * @var array Request arguments from path, after cutting two segments out for controller and action names + */ + public array $args; + /** + * @var string HTTP Verb used + */ + public string $method; + + public function getData() + { + return array_merge($_GET, $_POST); + } + + /** + * @return array + */ + public function getPostData() + { + return $_POST; + } + + /** + * @return array + */ + public function getGetData() + { + return $_GET; + } + + /** + * RequestData is the way the Router will provide information, use it in your Action methods. + * @param $method string Verb used + * @param $args array Arguments + * @param $query array Key-Value Pairs + */ + public function __construct($method, $args, $query) + { + $this->query = $query; + $this->args = $args; + $this->method = $method; + } +} + +class FrontController +{ + + public static function handleRequest($url, $method = 'GET', $verbosity = 0, $configPath = CONFIG_WEBROUTES) + { + assert_blade(); // check if the class is found + + if (!str_contains($url, ':')) $url = $_SERVER['HTTP_HOST'] . ':' . $_SERVER['SERVER_PORT'] . $_SERVER['REQUEST_URI']; + + $scriptPath = dirname(__FILE__, 2) . '/'; + $controllerDirectory = $scriptPath . 'controllers/'; + + // get a router/web-like config array to override filebased convention + $config = FrontController::getConfig($configPath); + + // /Impressum/ --> ImpressumController->index() + $request = parse_url($url); + $ctrlName = $request['path']; + $actionName = 'index'; + $args = array(); + $query = array(); + parse_str($request['query'] ?? "", $query); + + // provide POST data + if ($method != 'GET') + $query = array_merge($query, $_REQUEST); + + + // check, if route has two levels + if (strpos($ctrlName, '/', 1) > 0) { + $path = explode('/', $request['path']); // Werbeseite/Speise/1/mobile?pretty=true&user=marcel + array_shift($path); // skip once + $ctrlName = array_shift($path); // Werbeseite + $actionName = array_shift($path); // Speise + $args = $path; // remainder of path-parts // [1][mobile] + if ($verbosity > 1) { + echo "
Request\n", print_r($request), ""; + echo "
Path\n", print_r($path), ""; + echo "
Query\n", print_r($query), ""; + } + } + + // fix: trim slashes + $ctrlName = trim($ctrlName, '/'); + $actionName = trim($actionName, '/'); + + // $config based renaming of Controller/Action, precedes filebased convention + // $config values must use syntax
Routing Config matched request for /" . $ctrlName . "/" . $actionName . ":
routing config is
" . print_r($routingConfig, 1) . ''; + } + // important: overwriting controller and action name + $ctrlClass = $routingConfig[0]; + $actionName = $routingConfig[1]; + } elseif (array_key_exists($request['path'], $config)) { + // exact match on full path, this also means "/" + $routingConfig = explode('@', $config[$request['path']]); + if ($verbosity > 0) { + echo "
Routing Config matched for full path " . $request['path'] . ":
routing config is
" . print_r($routingConfig, 1) . ''; + } + // important: overwriting controller and action name + $ctrlClass = $routingConfig[0]; + $actionName = $routingConfig[1]; + } else { + if ($verbosity > 0) { + echo "Request $ctrlName/$actionName was not in \$config."; + } + + // fall back to filebased convention: match controller classes in directory + $ctrlClass = ucfirst($ctrlName . 'Controller'); + } + + $ctrlFile = ($ctrlClass . '.php'); + $validControllers = FrontController::getValidControllers($controllerDirectory); + if (!in_array($controllerDirectory . $ctrlFile, $validControllers)) { + if ($verbosity > 0) { + echo "
Controller: $ctrlFile not found in
" . print_r($validControllers, 1) . "
Config Array:
" . print_r($config, 1) . "
Web Software Error
" .
+ "Keine entspreche Zuordnung der Route für {$ctrlName}::{$actionName} gefunden. Tippfehler in der Route?" . + "
Es konnte keine Klasse " . $ctrlFile . " gefunden werden! Request fehlgeschlagen.
" . + " Prüfen Sie die Einträge in der Datei config/web.php und gleichen Sie den getätigten Aufruf damit ab.
Fehler in Controller " . get_class($controller) . "!
Stellen Sie sicher, dass die Action/der Controller existiert.
+Das Routing Config-Array hat " . count($config) . " Einträge.
+Exception text
" . $ex->getMessage() . "
{$text}
");
+ if ($die) exit($severity);
+ }
+
+ public static function getConfig($configPath)
+ {
+ try {
+ // load the $config Array from a file given in $configPath
+ $path_to_config = realpath($_SERVER['DOCUMENT_ROOT'] . DIRECTORY_SEPARATOR . $configPath);
+ // print("Path to config " . $path_to_config);
+ $config = include $path_to_config;
+ } catch (Exception $e) {
+ print_r($e);
+ $config = array('/' => 'HomeController@index');
+ } finally {
+ return $config;
+ }
+ }
+
+ public static function getValidControllers($path = '')
+ {
+ if ($path == '') {
+ $path = getcwd() . DIRECTORY_SEPARATOR . 'controllers' . DIRECTORY_SEPARATOR;
+ }
+ return glob($path . '*Controller.php');
+ }
+}
+
+function connectdb()
+{
+ $path_to_config_db = $_SERVER['DOCUMENT_ROOT'] . DIRECTORY_SEPARATOR . CONFIG_DB;
+ $config = include $path_to_config_db;
+ $link = mysqli_connect( // Daten aus config/db.php
+ $config['host'],
+ $config['user'],
+ $config['password'],
+ $config['database'], // Auswahl der Datenbank
+ $config['port'] ?? 3306);
+ if (!$link) {
+ FrontController::showErrorMessage("Verbindung mit der Datenbank nicht möglich
+Verbindung fehlgeschlagen: " . mysqli_connect_error() . ".
Prüfen Sie
- die Angaben in der Datei
config/db.php: + ( ist Benutzer{$config['user']}an Datenbank{$config['database']}auf Server{$config['host']}korrekt?)
+ - ob Ihre Datenbank unter der oben gezeigten Adresse läuft
Verbindung mit der Datenbank nicht möglich
+Fehlermeldung" . mysqli_connect_error() . "", 2, true); + exit(1); + } + + return $link; +} + +function view($viewname, $viewargs = array()) +{ + $views = dirname(__DIR__) . '/views'; + $cache = dirname(__DIR__) . '/storage/cache'; + $blade = new BladeOne($views, $cache, BladeOne::MODE_DEBUG); + + return $blade->run($viewname, $viewargs); +} + +/** + * let the script die if the php minimum version is not met. + * @param $minversion + * @return void + */ +function assert_php_version($minversion = '8.0.0') +{ + $version_too_low = 0; + $minver = explode('.', $minversion); + $version = explode('.', phpversion()); + + if (intval($minver[0]) > intval($version[0])) { + $version_too_low = 1; + } elseif (intval($minver[1]) > intval($version[1])) { + $version_too_low = 1; + } elseif (intval($minver[2]) > intval($version[2])) { + $version_too_low = 1; + } + + if ($version_too_low) { + FrontController::showErrorMessage("Diese PHP-Version wird nicht unterstützt: Minimum PHP Version " . $minversion . "
Sie betreiben gerade PHP Version " . phpversion()); + exit(1); + } + // version is okay, go on. +} + +/** + * let the script die if the path contains problematic characters. + * @return void + */ +function assert_path(): void +{ + static $chars = array("[", "]", "{", "}"); + $charsfound = 0; + str_ireplace($chars, '', $_SERVER['DOCUMENT_ROOT'], $charsfound); + if ($charsfound > 0) { + FrontController::showErrorMessage("
Bitte verwenden Sie einen anderen Ordner für das Projekt!
+Der Pfad " . $_SERVER['DOCUMENT_ROOT'] . " enthält " . $charsfound . " problematische Zeichen, die die korrekte Ausführung verhindern.
Bekannte problematische Zeichen sind
+ " . implode(" ", $chars) . " ");
+ exit(1);
+ }
+
+}
+
+function assert_blade(): void
+{
+ if (!class_exists('eftec\bladeone\BladeOne')) {
+ // #ERROR
+ FrontController::showErrorMessage("
+ Fehler: Blade wurde nicht gefunden
+Tipps für die Lösung:
+-
+
führen Sie im Terminal folgende Zeilen aus.
+-
+
php bin/composer.phar updateoderphp bin/composer.phar reinstall eftec/bladeone
+ php bin/composer.phar dump-autoload
+
Prüfen Sie im Anschluss: befindet sich in dem Ordner
vendor/eftec/bladeone/lib/die DateiBladeOne.php?
+ Starten Sie dann den Webserver neu.
+ Befragen Sie gerne auch das Forum in Ilias.
+
+
+
+yieldContent("jsextra"); ?>
+
+
+
diff --git a/M6/Dossier/emensa/storage/cache/.layouts.layout_933596b3f8bdab5243334e13bf36856f2a87605f.bladec b/M6/Dossier/emensa/storage/cache/.layouts.layout_933596b3f8bdab5243334e13bf36856f2a87605f.bladec
new file mode 100644
index 0000000..3ef70b4
--- /dev/null
+++ b/M6/Dossier/emensa/storage/cache/.layouts.layout_933596b3f8bdab5243334e13bf36856f2a87605f.bladec
@@ -0,0 +1,23 @@
+
+
+
+
+
+ yieldContent("content"); ?>
+
+
+
+
+yieldContent("jsextra"); ?>
+
+
+
diff --git a/M6/Dossier/emensa/storage/cache/.layouts.m4_7d_layout_ecc36cbad49aa38782cc08cc5e9ca6c7ae3590d0.bladec b/M6/Dossier/emensa/storage/cache/.layouts.m4_7d_layout_ecc36cbad49aa38782cc08cc5e9ca6c7ae3590d0.bladec
new file mode 100644
index 0000000..941fc86
--- /dev/null
+++ b/M6/Dossier/emensa/storage/cache/.layouts.m4_7d_layout_ecc36cbad49aa38782cc08cc5e9ca6c7ae3590d0.bladec
@@ -0,0 +1,21 @@
+
+
+
+
+
+
+ yieldContent("content"); ?>
+
+This is a blade view showing phpinfo();
+ + + \ No newline at end of file diff --git a/M6/Dossier/emensa/storage/cache/demo.dbdata_371b3aba36aa73bbc6704e7ce839ac185b43f3a9.bladec b/M6/Dossier/emensa/storage/cache/demo.dbdata_371b3aba36aa73bbc6704e7ce839ac185b43f3a9.bladec new file mode 100644 index 0000000..b866e05 --- /dev/null +++ b/M6/Dossier/emensa/storage/cache/demo.dbdata_371b3aba36aa73bbc6704e7ce839ac185b43f3a9.bladec @@ -0,0 +1,32 @@ + + + + +Es gab ein Problem mit der Datenbankverbindung
+Fehlermeldung
++ + + + +
Daten aus der Datenbank der Tabelle: Gerichte
+Der Controller inkludiert das benötigte Model (gerichte.php in diesem Fall)
+ und ruft die benötigte Funktion db_gerichte_select_all() zum Laden der Daten auf
-
+
+
+
+
- Keine Daten vorhanden. + +
+
+stopSection(); ?>
+
+startSection("cssextra"); ?>
+
+stopSection(); ?>
+
+startSection("jsextra"); ?>
+
+stopSection(); ?>
+runChild(".layouts.layout"); } ?>
\ No newline at end of file
diff --git a/M6/Dossier/emensa/storage/cache/demo.demo_fc1036c569380dbc95c820cc4f5096087e39b268.bladec b/M6/Dossier/emensa/storage/cache/demo.demo_fc1036c569380dbc95c820cc4f5096087e39b268.bladec
new file mode 100644
index 0000000..cc3f065
--- /dev/null
+++ b/M6/Dossier/emensa/storage/cache/demo.demo_fc1036c569380dbc95c820cc4f5096087e39b268.bladec
@@ -0,0 +1,94 @@
+
+
+startSection("content"); ?>
+ Demo für
+Kurze Übersicht, wie die Arbeit mit dem Router und der Blade View-Engine funktioniert.
+ +Router
+Der Router nimmt den Request entgegen und zerlegt ihn in die einzelnen Teile der URI. Wichtig ist hier vor + allem der Pfad und der Querystring.
+Wenn der Pfad in der Routenkonfiguration (\$config Array aus der Datei
+ routes/web.php) gefunden wird, lädt der Router die angegebene Klasse.
Funktionsweise
+Im vorliegenden Beispiel sehen Sie diese Seite ...
+-
+
- weil der Pfad in der Routenkonfiguration gefunden wurde +
- und dort 'DemoController@howto' hinterlegt ist +
- und im Ordner controllers/ die Datei
DemoController.phpgefunden werden konnte +
+ - und mit ihr ein Objekt des Typs DemoController instanziiert werden konnte +
- und dieses Objekt die Funktion (Action) howto() ausgeführt hat +
Sie sehen: da muss einiges stimmen und vieles davon ist Konvention.
+Querystrings und Pfadsegmente
+Die Actions in den Controller-Klassen sollen per Konvention immer ein RequestData Objekt
+ entgegennehmen. Beispiel: howto(RequestData \$rd)
Dieses RequestData Objekt wird durch den Router befüllt, wenn Daten in der URL extrahiert werden konnten.
+Daten finden sich URLs...
+ +-
+
-
+
+ im Querystring
+
Beispiel: rufen Sie diese mit +:///demo?bgcolor=fefbd8&name=Remmy+ auf, werden bgcolor undnamemitsamt Werten als Query Array +$rd->query) übergeben +
+
Probieren Sie es aus ;)
+ args)): ?> +Argumente dieses Aufrufs:
+ + args as $a): $__empty_1 = false; ?> +
+
+
Keine weiteren Argumente im Request
+ + + query)): ?> +Daten aus der Query dieses Aufrufs:
+
+ query as $k => $v): $__empty_1 = false; ?>
+ $rd->query['']=
+
+
+ Keine Querydaten
+
+ Blade
+Blade muss installiert sein. + Die Installation ist bereits geschehen und die Bibliothek liegt unter /vendor. +
+Daten übergeben und View rendern
+Bei der Verwendung der View-Engine gelten einige Konventionen:
+ Die Dateien müssen <viewname>.blade.php heißen und im Ordner views liegen.
+
Sie können der View dann Daten mitgeben, indem Sie alle Daten in ein Array schreiben und dieses dann + übergeben.
+Beispiel:
+
+ view("viewtest",
+ array(
+ "texts"=>$textArray,
+ "persona"=>$persona,
+ "rd"=>$rd
+ )); // öffnet ../views/viewtest.blade.php
+
+
+stopSection(); ?>
+
+startSection("cssextra"); ?>
+
+stopSection(); ?>
+
+startSection("jsextra"); ?>
+
+stopSection(); ?>
+runChild(".layouts.layout"); } ?>
\ No newline at end of file
diff --git a/M6/Dossier/emensa/storage/cache/examples.m4_7a_queryparameter_964ef996681a5d33ee4d5aaa7f2b050eecc4776f.bladec b/M6/Dossier/emensa/storage/cache/examples.m4_7a_queryparameter_964ef996681a5d33ee4d5aaa7f2b050eecc4776f.bladec
new file mode 100644
index 0000000..b580eec
--- /dev/null
+++ b/M6/Dossier/emensa/storage/cache/examples.m4_7a_queryparameter_964ef996681a5d33ee4d5aaa7f2b050eecc4776f.bladec
@@ -0,0 +1,14 @@
+
+
+
+
+ Demo für
+Kurze Übersicht, wie die Arbeit mit dem Router und der Blade View-Engine funktioniert.
+ +Router
+Der Router nimmt den Request entgegen und zerlegt ihn in die einzelnen Teile der URI. Wichtig ist hier vor + allem der Pfad und der Querystring.
+Wenn der Pfad in der Routenkonfiguration (\$config Array aus der Datei
+ routes/web.php) gefunden wird, lädt der Router die angegebene Klasse.
Funktionsweise
+Im vorliegenden Beispiel sehen Sie diese Seite ...
+-
+
- weil der Pfad in der Routenkonfiguration gefunden wurde +
- und dort 'DemoController@howto' hinterlegt ist +
- und im Ordner controllers/ die Datei
DemoController.phpgefunden werden konnte +
+ - und mit ihr ein Objekt des Typs DemoController instanziiert werden konnte +
- und dieses Objekt die Funktion (Action) howto() ausgeführt hat +
Sie sehen: da muss einiges stimmen und vieles davon ist Konvention.
+Querystrings und Pfadsegmente
+Die Actions in den Controller-Klassen sollen per Konvention immer ein RequestData Objekt
+ entgegennehmen. Beispiel: howto(RequestData \$rd)
Dieses RequestData Objekt wird durch den Router befüllt, wenn Daten in der URL extrahiert werden konnten.
+Daten finden sich URLs...
+ +-
+
-
+
+ im Querystring
+
Beispiel: rufen Sie diese mit +:///demo?bgcolor=fefbd8&name=Remmy+ auf, werden bgcolor undnamemitsamt Werten als Query Array +$rd->query) übergeben +
+
Probieren Sie es aus ;)
+ args)): ?> +Argumente dieses Aufrufs:
+ + args as $a): $__empty_1 = false; ?> +
+
+
Keine weiteren Argumente im Request
+ + + query)): ?> +Daten aus der Query dieses Aufrufs:
+
+ query as $k => $v): $__empty_1 = false; ?>
+ $rd->query['']=
+
+
+ Keine Querydaten
+
+ Blade
+Blade muss installiert sein. + Die Installation ist bereits geschehen und die Bibliothek liegt unter /vendor. +
+Daten übergeben und View rendern
+Bei der Verwendung der View-Engine gelten einige Konventionen:
+ Die Dateien müssen <viewname>.blade.php heißen und im Ordner views liegen.
+
Sie können der View dann Daten mitgeben, indem Sie alle Daten in ein Array schreiben und dieses dann + übergeben.
+Beispiel:
+
+ view("viewtest",
+ array(
+ "texts"=>$textArray,
+ "persona"=>$persona,
+ "rd"=>$rd
+ )); // öffnet ../views/viewtest.blade.php
+ Es gab ein Problem mit der Datenbankverbindung
+Fehlermeldung
++ + + + +
Daten aus der Datenbank der Tabelle: Kategorien
+ +-
+
+
+
+
+
+
+
- Keine Daten vorhanden. + +
Es gab ein Problem mit der Datenbankverbindung
+Fehlermeldung
++ + + +
Daten aus der Datenbank der Tabelle: Kategorien
+ +-
+
+
+
+
+
+
+
- Es sind keine Gerichte vorhanden + +
Es gab ein Problem mit der Datenbankverbindung
+Fehlermeldung
++ + + +
Daten aus der Datenbank der Tabelle: Kategorien
+ +-
+
+
+
+
+
+
+
- Es sind keine Gerichte vorhanden + +
Page 1
+stopSection(); ?> + +startSection("footer"); ?> +Footer of Page 1
+stopSection(); ?> +runChild(".layouts.m4_7d_layout",['title' => "Page 1"]); } ?> \ No newline at end of file diff --git a/M6/Dossier/emensa/storage/cache/examples.pages.m4_7d_page_2_ed122779e3e904882984750d979c216b1e98ea8d.bladec b/M6/Dossier/emensa/storage/cache/examples.pages.m4_7d_page_2_ed122779e3e904882984750d979c216b1e98ea8d.bladec new file mode 100644 index 0000000..961375a --- /dev/null +++ b/M6/Dossier/emensa/storage/cache/examples.pages.m4_7d_page_2_ed122779e3e904882984750d979c216b1e98ea8d.bladec @@ -0,0 +1,14 @@ + + +startSection("header"); ?> + +stopSection(); ?> + +startSection("body"); ?> +Page 2
+stopSection(); ?> + +startSection("footer"); ?> +Footer of Page 2
+stopSection(); ?> +runChild(".layouts.m4_7d_layout",['title' => "Page 2"]); } ?> \ No newline at end of file diff --git a/M6/Dossier/emensa/storage/cache/home_be3f101c28919ade210629435b0b22d1f6f23f27.bladec b/M6/Dossier/emensa/storage/cache/home_be3f101c28919ade210629435b0b22d1f6f23f27.bladec new file mode 100644 index 0000000..c54dc25 --- /dev/null +++ b/M6/Dossier/emensa/storage/cache/home_be3f101c28919ade210629435b0b22d1f6f23f27.bladec @@ -0,0 +1,36 @@ + + +startSection("content"); ?> +Hauptseite E-Mensa
+
+
+
+
+yieldContent("jsextra"); ?>
+
+
+
diff --git a/M6/Dossier/emensa/storage/cache/layouts.main_layout_3661f571e5a2129da3ca081fa828422117d3b345.bladec b/M6/Dossier/emensa/storage/cache/layouts.main_layout_3661f571e5a2129da3ca081fa828422117d3b345.bladec
new file mode 100644
index 0000000..aec0cb1
--- /dev/null
+++ b/M6/Dossier/emensa/storage/cache/layouts.main_layout_3661f571e5a2129da3ca081fa828422117d3b345.bladec
@@ -0,0 +1,30 @@
+
+
+
+
+
+
+ yieldContent("content"); ?>
+
++
+
+
+
+
+
\ No newline at end of file
diff --git a/M6/Dossier/emensa/storage/cache/layouts.main_layout_54314409e9b1b39431b6e14f05f203008160a8be.bladec b/M6/Dossier/emensa/storage/cache/layouts.main_layout_54314409e9b1b39431b6e14f05f203008160a8be.bladec
new file mode 100644
index 0000000..aec0cb1
--- /dev/null
+++ b/M6/Dossier/emensa/storage/cache/layouts.main_layout_54314409e9b1b39431b6e14f05f203008160a8be.bladec
@@ -0,0 +1,30 @@
+
+
+
+
+
+
+yieldContent("text"); ?>
+
+yieldContent("gerichte"); ?>
+
+
++
+
+
+
+
+
\ No newline at end of file
diff --git a/M6/Dossier/emensa/storage/cache/layouts.main_layout_9f099eee303f11c8c3f1b61e05a54e7376df8add.bladec b/M6/Dossier/emensa/storage/cache/layouts.main_layout_9f099eee303f11c8c3f1b61e05a54e7376df8add.bladec
new file mode 100644
index 0000000..aec0cb1
--- /dev/null
+++ b/M6/Dossier/emensa/storage/cache/layouts.main_layout_9f099eee303f11c8c3f1b61e05a54e7376df8add.bladec
@@ -0,0 +1,30 @@
+
+
+
+
+
+
+yieldContent("text"); ?>
+
+yieldContent("gerichte"); ?>
+
+
++
+
+
+
+
+
\ No newline at end of file
diff --git a/M6/Dossier/emensa/storage/cache/layouts.main_layout_ff0dbbbcc8c331f06acac2bd395c317de615c9d1.bladec b/M6/Dossier/emensa/storage/cache/layouts.main_layout_ff0dbbbcc8c331f06acac2bd395c317de615c9d1.bladec
new file mode 100644
index 0000000..aec0cb1
--- /dev/null
+++ b/M6/Dossier/emensa/storage/cache/layouts.main_layout_ff0dbbbcc8c331f06acac2bd395c317de615c9d1.bladec
@@ -0,0 +1,30 @@
+
+
+
+
+
+
+yieldContent("text"); ?>
+
+yieldContent("gerichte"); ?>
+
+
++
+
+
+
+
+
\ No newline at end of file
diff --git a/M6/Dossier/emensa/storage/cache/m5_a1.abmeldung_17f241c320c4a8a9a33bfe29835f14c33bd19626.bladec b/M6/Dossier/emensa/storage/cache/m5_a1.abmeldung_17f241c320c4a8a9a33bfe29835f14c33bd19626.bladec
new file mode 100644
index 0000000..f59bef6
--- /dev/null
+++ b/M6/Dossier/emensa/storage/cache/m5_a1.abmeldung_17f241c320c4a8a9a33bfe29835f14c33bd19626.bladec
@@ -0,0 +1,12 @@
+
+
+startSection("main"); ?>
+
+
+
+
+
+
+
+stopSection(); ?>
+runChild("m5_a1.layout_anmeldung"); } ?>
\ No newline at end of file
diff --git a/M6/Dossier/emensa/storage/cache/m5_a1.anmeldung_01c45fd41d095952aa184fb3fc764d18878732cb.bladec b/M6/Dossier/emensa/storage/cache/m5_a1.anmeldung_01c45fd41d095952aa184fb3fc764d18878732cb.bladec
new file mode 100644
index 0000000..bac6ca9
--- /dev/null
+++ b/M6/Dossier/emensa/storage/cache/m5_a1.anmeldung_01c45fd41d095952aa184fb3fc764d18878732cb.bladec
@@ -0,0 +1,25 @@
+
+
+startSection("main"); ?>
+
+
+
+ Bitte anmelden!
+
+
+
+ Anmeldung erlaubt!
+ Es ist ein Fehler aufgetretten!
+
+
+stopSection(); ?>
+runChild("m5_a1.layout_anmeldung"); } ?>
\ No newline at end of file
diff --git a/M6/Dossier/emensa/storage/cache/m5_a1.anmeldung_c24d33e917eb7ef9d14d646f11f37749504ff5c8.bladec b/M6/Dossier/emensa/storage/cache/m5_a1.anmeldung_c24d33e917eb7ef9d14d646f11f37749504ff5c8.bladec
new file mode 100644
index 0000000..bac6ca9
--- /dev/null
+++ b/M6/Dossier/emensa/storage/cache/m5_a1.anmeldung_c24d33e917eb7ef9d14d646f11f37749504ff5c8.bladec
@@ -0,0 +1,25 @@
+
+
+startSection("main"); ?>
+
+
+
+ Bitte anmelden!
+
+
+
+ Anmeldung erlaubt!
+ Es ist ein Fehler aufgetretten!
+
+
+stopSection(); ?>
+runChild("m5_a1.layout_anmeldung"); } ?>
\ No newline at end of file
diff --git a/M6/Dossier/emensa/storage/cache/m5_a1.anmeldung_verifizieren_06701b6bf7b5936abd21c6cfbe469b752d069cec.bladec b/M6/Dossier/emensa/storage/cache/m5_a1.anmeldung_verifizieren_06701b6bf7b5936abd21c6cfbe469b752d069cec.bladec
new file mode 100644
index 0000000..3ce0535
--- /dev/null
+++ b/M6/Dossier/emensa/storage/cache/m5_a1.anmeldung_verifizieren_06701b6bf7b5936abd21c6cfbe469b752d069cec.bladec
@@ -0,0 +1,51 @@
+
+
+startSection("main"); ?>
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+yieldContent("text"); ?>
+
+yieldContent("gerichte"); ?>
+
+
+
+ + Bitte warten! + +stopSection(); ?> +runChild("m5_a1.layout_anmeldung"); } ?> \ No newline at end of file diff --git a/M6/Dossier/emensa/storage/cache/m5_a1.layout_anmeldung_0bf7f1c53d4cd4970b2790535eaffcc9dddc4266.bladec b/M6/Dossier/emensa/storage/cache/m5_a1.layout_anmeldung_0bf7f1c53d4cd4970b2790535eaffcc9dddc4266.bladec new file mode 100644 index 0000000..5331778 --- /dev/null +++ b/M6/Dossier/emensa/storage/cache/m5_a1.layout_anmeldung_0bf7f1c53d4cd4970b2790535eaffcc9dddc4266.bladec @@ -0,0 +1,21 @@ + + + + +
+
+stopSection(); ?>
+
+startSection("text"); ?>
+
+
+
+
+
+
+
+ Bald gibt es auch Essen online ;)
+Lorem ipsum dolor sit amet, consetetur sadipscing elitr, sed diam nonumy eirmod tempor invidunt ut labore et + dolore magna aliquyam erat, sed diam voluptua. At vero eos et accusam et justo duo dolores et ea rebum. Stet + clita kasd gubergren, no sea takimata sanctus est Lorem ipsum dolor sit amet. Lorem ipsum dolor sit amet, + consetetur sadipscing elitr, sed diam nonumy eirmod tempor invidunt ut labore et dolore magna aliquyam erat, + sed diam voluptua. At vero eos et accusam et justo duo dolores et ea rebum. Stet clita kasd gubergren, no + sea takimata sanctus est Lorem ipsum dolor sit amet.
+Köstlichkeiten die Sie erwarten
+ +stopSection(); ?> + +startSection("gerichte"); ?> + + +Es gab ein Problem mit der Datenbankverbindung
+Fehlermeldung
++ + + + + +stopSection(); ?> + +startSection("footer"); ?> + +
+
+
+stopSection(); ?>
+
+startSection("text"); ?>
+
+
+
+
+
+
+
+
+ Bald gibt es auch Essen online ;)
+Lorem ipsum dolor sit amet, consetetur sadipscing elitr, sed diam nonumy eirmod tempor invidunt ut labore et + dolore magna aliquyam erat, sed diam voluptua. At vero eos et accusam et justo duo dolores et ea rebum. Stet + clita kasd gubergren, no sea takimata sanctus est Lorem ipsum dolor sit amet. Lorem ipsum dolor sit amet, + consetetur sadipscing elitr, sed diam nonumy eirmod tempor invidunt ut labore et dolore magna aliquyam erat, + sed diam voluptua. At vero eos et accusam et justo duo dolores et ea rebum. Stet clita kasd gubergren, no + sea takimata sanctus est Lorem ipsum dolor sit amet.
+Köstlichkeiten die Sie erwarten
+ +stopSection(); ?> + +startSection("gerichte"); ?> + + +Es gab ein Problem mit der Datenbankverbindung
+Fehlermeldung
++ + + + + +stopSection(); ?> + +startSection("footer"); ?> + +
+
+
+stopSection(); ?>
+
+startSection("text"); ?>
+
+
+
+
+
+
+
+
+ Bald gibt es auch Essen online ;)
+Lorem ipsum dolor sit amet, consetetur sadipscing elitr, sed diam nonumy eirmod tempor invidunt ut labore et + dolore magna aliquyam erat, sed diam voluptua. At vero eos et accusam et justo duo dolores et ea rebum. Stet + clita kasd gubergren, no sea takimata sanctus est Lorem ipsum dolor sit amet. Lorem ipsum dolor sit amet, + consetetur sadipscing elitr, sed diam nonumy eirmod tempor invidunt ut labore et dolore magna aliquyam erat, + sed diam voluptua. At vero eos et accusam et justo duo dolores et ea rebum. Stet clita kasd gubergren, no + sea takimata sanctus est Lorem ipsum dolor sit amet.
+Köstlichkeiten die Sie erwarten
+ +stopSection(); ?> + +startSection("gerichte"); ?> + + + +Es gab ein Problem mit der Datenbankverbindung
+Fehlermeldung
++ + +
+
+stopSection(); ?>
+
+startSection("text"); ?>
+
+
+
+
+
+
+
+ Bald gibt es auch Essen online ;)
+Lorem ipsum dolor sit amet, consetetur sadipscing elitr, sed diam nonumy eirmod tempor invidunt ut labore et + dolore magna aliquyam erat, sed diam voluptua. At vero eos et accusam et justo duo dolores et ea rebum. Stet + clita kasd gubergren, no sea takimata sanctus est Lorem ipsum dolor sit amet. Lorem ipsum dolor sit amet, + consetetur sadipscing elitr, sed diam nonumy eirmod tempor invidunt ut labore et dolore magna aliquyam erat, + sed diam voluptua. At vero eos et accusam et justo duo dolores et ea rebum. Stet clita kasd gubergren, no + sea takimata sanctus est Lorem ipsum dolor sit amet.
+Köstlichkeiten die Sie erwarten
+ +stopSection(); ?> + +startSection("gerichte"); ?> + + +Es gab ein Problem mit der Datenbankverbindung
+Fehlermeldung
++ + + + + +stopSection(); ?> + +startSection("footer"); ?> + +
+ * Example: (includeScope=false)
+ *
+ * @include("template",['a1'=>'abc']) // a1 is equals to abc
+ * @include("template",[]) // a1 is equals to abc
+ *
+ * Example: (includeScope=true)+ *
+ * @include("template",['a1'=>'abc']) // a1 is equals to abc
+ * @include("template",[]) // a1 is not defined
+ *
+ */
+ public $includeScope = false;
+ /**
+ * @var callable[] It allows to parse the compiled output using a function.
+ * This function doesn't require to return a value+ * Example: this converts all compiled result in uppercase (note, content is a ref) + *
+ * $this->compileCallbacks[]= static function (&$content, $templatename=null) {
+ * $content=strtoupper($content);
+ * };
+ *
+ */
+ public $compileCallbacks = [];
+ /** @var array All the registered extensions. */
+ protected $extensions = [];
+ /** @var array All the finished, captured sections. */
+ protected $sections = [];
+ /** @var string The template currently being compiled. For example "folder.template" */
+ protected $fileName;
+ protected $currentView;
+ protected $notFoundPath;
+ /** @var string File extension for the template files. */
+ protected $fileExtension = '.blade.php';
+ /** @var array The stack of in-progress sections. */
+ protected $sectionStack = [];
+ /** @var array The stack of in-progress loops. */
+ protected $loopsStack = [];
+ /** @var array Dictionary of variables */
+ protected $variables = [];
+ /** @var array Dictionary of global variables */
+ protected $variablesGlobal = [];
+ /** @var array All the available compiler functions. */
+ protected $compilers = [
+ 'Extensions',
+ 'Statements',
+ 'Comments',
+ 'Echos',
+ ];
+ /** @var string|null it allows to set the stack */
+ protected $viewStack;
+ /** @var array used by $this->composer() */
+ protected $composerStack = [];
+ /** @var array The stack of in-progress push sections. */
+ protected $pushStack = [];
+ /** @var array All the finished, captured push sections. */
+ protected $pushes = [];
+ /** @var int The number of active rendering operations. */
+ protected $renderCount = 0;
+ /** @var string[] Get the template path for the compiled views. */
+ protected $templatePath;
+ /** @var string Get the compiled path for the compiled views. If null then it uses the default path */
+ protected $compiledPath;
+ /** @var string the extension of the compiled file. */
+ protected $compileExtension = '.bladec';
+ /**
+ * @var string=['auto','sha1','md5'][$i] It determines how the compiled filename will be called.+ * auto (default mode) the mode is "sha1"
+ * sha1 the filename is converted into a sha1 hash
+ * md5 the filename is converted into a md5 hash
+ */ + protected $compileTypeFileName='auto'; + + + /** @var array Custom "directive" dictionary. Those directives run at compile time. */ + protected $customDirectives = []; + /** @var bool[] Custom directive dictionary. Those directives run at runtime. */ + protected $customDirectivesRT = []; + /** @var callable Function used for resolving injected classes. */ + protected $injectResolver; + /** @var array Used for conditional if. */ + protected $conditions = []; + /** @var int Unique counter. It's used for extends */ + protected $uidCounter = 0; + /** @var string The main url of the system. Don't use raw $_SERVER values unless the value is sanitized */ + protected $baseUrl = '.'; + /** @var string|null The base domain of the system */ + protected $baseDomain; + /** @var string|null It stores the current canonical url. */ + protected $canonicalUrl; + /** @var string|null It stores the current url including arguments */ + protected $currentUrl; + /** @var string it is a relative path calculated between baseUrl and the current url. Example ../../ */ + protected $relativePath = ''; + /** @var string[] Dictionary of assets */ + protected $assetDict; + /** @var bool if true then it removes tabs and unneeded spaces */ + protected $optimize = true; + /** @var bool if false, then the template is not compiled (but executed on memory). */ + protected $isCompiled = true; + /** @var bool */ + protected $isRunFast = false; // stored for historical purpose. + /** @var array Array of opening and closing tags for raw echos. */ + protected $rawTags = ['{!!', '!!}']; + /** @var array Array of opening and closing tags for regular echos. */ + protected $contentTags = ['{{', '}}']; + /** @var array Array of opening and closing tags for escaped echos. */ + protected $escapedTags = ['{{{', '}}}']; + /** @var string The "regular" / legacy echo string format. */ + protected $echoFormat = '\htmlentities(%s??\'\', ENT_QUOTES, \'UTF-8\', false)'; + /** @var string */ + protected $echoFormatOld = 'static::e(%s)'; + /** @var array Lines that will be added at the footer of the template */ + protected $footer = []; + /** @var string Placeholder to temporary mark the position of verbatim blocks. */ + protected $verbatimPlaceholder = '$__verbatim__$'; + /** @var array Array to temporary store the verbatim blocks found in the template. */ + protected $verbatimBlocks = []; + /** @var int Counter to keep track of nested forelse statements. */ + protected $forelseCounter = 0; + /** @var array The components being rendered. */ + protected $componentStack = []; + /** @var array The original data passed to the component. */ + protected $componentData = []; + /** @var array The slot contents for the component. */ + protected $slots = []; + /** @var array The names of the slots being rendered. */ + protected $slotStack = []; + /** @var string tag unique */ + protected $PARENTKEY = '@parentXYZABC'; + /** + * Indicates the compile mode. + * if the constant BLADEONE_MODE is defined, then it is used instead of this field. + * + * @var int=[BladeOne::MODE_AUTO,BladeOne::MODE_DEBUG,BladeOne::MODE_SLOW,BladeOne::MODE_FAST][$i] + */ + protected $mode; + /** @var int Indicates the number of open switches */ + protected $switchCount = 0; + /** @var bool Indicates if the switch is recently open */ + protected $firstCaseInSwitch = true; + + //
";
+ $msg .= "BladeOne Error [$id]:
"; + $msg .= "$text
\n";
+ echo $msg;
+ if ($critic) {
+ die(1);
+ }
+ return $msg;
+ }
+
+ /**
+ * Escape HTML entities in a string.
+ *
+ * @param int|string|null $value
+ * @return string
+ */
+ public static function e($value): string
+ {
+ // Prevent "Deprecated: htmlentities(): Passing null to parameter #1 ($string) of type string is deprecated" message
+ if (\is_null($value)) {
+ return '';
+ }
+ if (\is_array($value) || \is_object($value)) {
+ return \htmlentities(\print_r($value, true), ENT_QUOTES, 'UTF-8', false);
+ }
+ if (\is_numeric($value)) {
+ $value=(string)$value;
+ }
+ return \htmlentities($value, ENT_QUOTES, 'UTF-8', false);
+ }
+
+ protected static function convertArgCallBack($k, $v): string
+ {
+ return $k . "='$v' ";
+ }
+
+ /**
+ * @param mixed|\DateTime $variable
+ * @param string|null $format
+ * @return string
+ */
+ public function format($variable, $format = null): string
+ {
+ if ($variable instanceof \DateTime) {
+ $format = $format ?? 'Y/m/d';
+ return $variable->format($format);
+ }
+ $format = $format ?? '%s';
+ return sprintf($format, $variable);
+ }
+
+ /**
+ * It converts a text into a php code with echo"; + $msg .= "$text
+ * Example:
+ *
+ * $this->wrapPHP('$hello'); // "< ?php echo $this->e($hello); ? >"
+ * $this->wrapPHP('$hello',''); // < ?php echo $this->e($hello); ? >
+ * $this->wrapPHP('$hello','',false); // < ?php echo $hello; ? >
+ * $this->wrapPHP('"hello"'); // "< ?php echo $this->e("hello"); ? >"
+ * $this->wrapPHP('hello()'); // "< ?php echo $this->e(hello()); ? >"
+ *
+ *
+ * @param ?string $input The input value
+ * @param string $quote The quote used (to quote the result)
+ * @param bool $parse If the result will be parsed or not. If false then it's returned without $this->e
+ * @return string
+ */
+ public function wrapPHP($input, $quote = '"', $parse = true): string
+ {
+ if($input===null) {
+ return 'null';
+ }
+ if (strpos($input, '(') !== false && !$this->isQuoted($input)) {
+ if ($parse) {
+ return $quote . $this->phpTagEcho . '$this->e(' . $input . ');?>' . $quote;
+ }
+
+ return $quote . $this->phpTagEcho . $input . ';?>' . $quote;
+ }
+ if (strpos($input, '$') === false) {
+ if ($parse) {
+ return self::enq($input);
+ }
+
+ return $input;
+ }
+ if ($parse) {
+ return $quote . $this->phpTagEcho . '$this->e(' . $input . ');?>' . $quote;
+ }
+ return $quote . $this->phpTagEcho . $input . ';?>' . $quote;
+ }
+
+ /**
+ * Returns true if the text is surrounded by quotes (double or single quote)
+ *
+ * @param string|null $text
+ * @return bool
+ */
+ public function isQuoted($text): bool
+ {
+ if (!$text || strlen($text) < 2) {
+ return false;
+ }
+ if ($text[0] === '"' && substr($text, -1) === '"') {
+ return true;
+ }
+ return ($text[0] === "'" && substr($text, -1) === "'");
+ }
+
+ /**
+ * Escape HTML entities in a string.
+ *
+ * @param string $value
+ * @return string
+ */
+ public static function enq($value): string
+ {
+ if (\is_array($value) || \is_object($value)) {
+ return \htmlentities(\print_r($value, true), ENT_NOQUOTES, 'UTF-8', false);
+ }
+ return \htmlentities($value??'', ENT_NOQUOTES, 'UTF-8', false);
+ }
+
+ /**
+ * @param string $view example "folder.template"
+ * @param string|null $alias example "mynewop". If null then it uses the name of the template.
+ */
+ public function addInclude($view, $alias = null): void
+ {
+ if (!isset($alias)) {
+ $alias = \explode('.', $view);
+ $alias = \end($alias);
+ }
+ $this->directive($alias, function ($expression) use ($view) {
+ $expression = $this->stripParentheses($expression) ?: '[]';
+ return "$this->phpTag echo \$this->runChild('$view', $expression); ?>";
+ });
+ }
+
+ /**
+ * Register a handler for custom directives.
+ *
+ * @param string $name
+ * @param callable $handler
+ * @return void
+ */
+ public function directive($name, callable $handler): void
+ {
+ $this->customDirectives[$name] = $handler;
+ $this->customDirectivesRT[$name] = false;
+ }
+
+ /**
+ * Strip the parentheses from the given expression.
+ *
+ * @param string|null $expression
+ * @return string
+ */
+ public function stripParentheses($expression): string
+ {
+ if (\is_null($expression)) {
+ return '';
+ }
+
+ if (static::startsWith($expression, '(')) {
+ $expression = \substr($expression, 1, -1);
+ }
+
+ return $expression;
+ }
+
+ /**
+ * Determine if a given string starts with a given substring.
+ *
+ * @param string $haystack
+ * @param string|array $needles
+ * @return bool
+ */
+ public static function startsWith($haystack, $needles): bool
+ {
+ foreach ((array)$needles as $needle) {
+ if ($needle != '') {
+ if (\function_exists('mb_strpos')) {
+ if ($haystack !== null && \mb_strpos($haystack, $needle) === 0) {
+ return true;
+ }
+ } elseif ($haystack !== null && \strpos($haystack, $needle) === 0) {
+ return true;
+ }
+ }
+ }
+
+ return false;
+ }
+
+ /**
+ * If false then the file is not compiled, and it is executed directly from the memory.+ * By default the value is true
+ * It also sets the mode to MODE_SLOW + * + * @param bool $bool + * @return BladeOne + * @see BladeOne::setMode + */ + public function setIsCompiled($bool = false): BladeOne + { + $this->isCompiled = $bool; + if (!$bool) { + $this->setMode(self::MODE_SLOW); + } + return $this; + } + + /** + * It sets the template and compile path (without trailing slash). + *
Example:setPath("somefolder","otherfolder"); + * + * @param null|string|string[] $templatePath If null then it uses the current path /views folder + * @param null|string $compiledPath If null then it uses the current path /views folder + */ + public function setPath($templatePath, $compiledPath): void + { + if ($templatePath === null) { + $templatePath = \getcwd() . '/views'; + } + if ($compiledPath === null) { + $compiledPath = \getcwd() . '/compiles'; + } + $this->templatePath = (is_array($templatePath)) ? $templatePath : [$templatePath]; + $this->compiledPath = $compiledPath; + } + + /** + * @return array + */ + public function getAliasClasses(): array + { + return $this->aliasClasses; + } + + /** + * @param array $aliasClasses + */ + public function setAliasClasses($aliasClasses): void + { + $this->aliasClasses = $aliasClasses; + } + + /** + * @param string $aliasName + * @param string $classWithNS + */ + public function addAliasClasses($aliasName, $classWithNS): void + { + $this->aliasClasses[$aliasName] = $classWithNS; + } + //
+ * This function uses the current url and the baseurl + * + * @param string $relativeWeb . Example img/images.jpg + * @return string Example ../../img/images.jpg + */ + public function relative($relativeWeb): string + { + return $this->assetDict[$relativeWeb] ?? ($this->relativePath . $relativeWeb); + } + + /** + * It adds an alias to the link of the resources.
+ * addAssetDict('name','url/res.jpg')
+ * addAssetDict(['name'=>'url/res.jpg','name2'=>'url/res2.jpg']); + * + * @param string|array $name example 'css/style.css', you could also add an array + * @param string $url example https://www.web.com/style.css' + */ + public function addAssetDict($name, $url = ''): void + { + if (\is_array($name)) { + if ($this->assetDict === null) { + $this->assetDict = $name; + } else { + $this->assetDict = \array_merge($this->assetDict, $name); + } + } else { + $this->assetDict[$name] = $url; + } + } + + /** + * Compile the push statements into valid PHP. + * + * @param string $expression + * @return string + * @see BladeOne::startPush + */ + public function compilePush($expression): string + { + return $this->phpTag . "\$this->startPush$expression; ?>"; + } + + /** + * Compile the push statements into valid PHP. + * + * @param string $expression + * @return string + * @see BladeOne::startPush + */ + public function compilePushOnce($expression): string + { + $key = '$__pushonce__' . \trim(\substr($expression, 2, -2)); + return $this->phpTag . "if(!isset($key)): $key=1; \$this->startPush$expression; ?>"; + } + + /** + * Compile the push statements into valid PHP. + * + * @param string $expression + * @return string + * @see BladeOne::startPush + */ + public function compilePrepend($expression): string + { + return $this->phpTag . "\$this->startPush$expression; ?>"; + } + + /** + * Start injecting content into a push section. + * + * @param string $section + * @param string $content + * @return void + */ + public function startPush($section, $content = ''): void + { + if ($content === '') { + if (\ob_start()) { + $this->pushStack[] = $section; + } + } else { + $this->extendPush($section, $content); + } + } + + /* + * endswitch tag + */ + + /** + * Append content to a given push section. + * + * @param string $section + * @param string $content + * @return void + */ + protected function extendPush($section, $content): void + { + if (!isset($this->pushes[$section])) { + $this->pushes[$section] = []; // start an empty section + } + if (!isset($this->pushes[$section][$this->renderCount])) { + $this->pushes[$section][$this->renderCount] = $content; + } else { + $this->pushes[$section][$this->renderCount] .= $content; + } + } + + /** + * Start injecting content into a push section. + * + * @param string $section + * @param string $content + * @return void + */ + public function startPrepend($section, $content = ''): void + { + if ($content === '') { + if (\ob_start()) { + \array_unshift($this->pushStack[], $section); + } + } else { + $this->extendPush($section, $content); + } + } + + /** + * Stop injecting content into a push section. + * + * @return string + */ + public function stopPush(): string + { + if (empty($this->pushStack)) { + $this->showError('stopPush', 'Cannot end a section without first starting one', true); + } + $last = \array_pop($this->pushStack); + $this->extendPush($last, \ob_get_clean()); + return $last; + } + + /** + * Stop injecting content into a push section. + * + * @return string + */ + public function stopPrepend(): string + { + if (empty($this->pushStack)) { + $this->showError('stopPrepend', 'Cannot end a section without first starting one', true); + } + $last = \array_shift($this->pushStack); + $this->extendStartPush($last, \ob_get_clean()); + return $last; + } + + /** + * Append content to a given push section. + * + * @param string $section + * @param string $content + * @return void + */ + protected function extendStartPush($section, $content): void + { + if (!isset($this->pushes[$section])) { + $this->pushes[$section] = []; // start an empty section + } + if (!isset($this->pushes[$section][$this->renderCount])) { + $this->pushes[$section][$this->renderCount] = $content; + } else { + $this->pushes[$section][$this->renderCount] = $content . $this->pushes[$section][$this->renderCount]; + } + } + + /** + * Get the string contents of a push section. + * + * @param string $section the name of the section + * @param string $default the default name of the section is not found. + * @return string + */ + public function yieldPushContent($section, $default = ''): string + { + if($section===null || $section==='') { + return $default; + } + if($section[-1]==='*') { + $keys=array_keys($this->pushes); + $findme=rtrim($section,'*'); + $result=""; + foreach($keys as $key) { + if(strpos($key,$findme)===0) { + $result.=\implode(\array_reverse($this->pushes[$key])); + } + } + return $result; + } + if (!isset($this->pushes[$section])) { + return $default; + } + return \implode(\array_reverse($this->pushes[$section])); + } + + /** + * Get the string contents of a push section. + * + * @param int|string $each if "int", then it split the foreach every $each numbers.
+ * if "string" or "c3", then it means that it will split in 3 columns
+ * @param string $splitText + * @param string $splitEnd + * @return string + */ + public function splitForeach($each = 1, $splitText = ',', $splitEnd = ''): string + { + $loopStack = static::last($this->loopsStack); // array(7) { ["index"]=> int(0) ["remaining"]=> int(6) ["count"]=> int(5) ["first"]=> bool(true) ["last"]=> bool(false) ["depth"]=> int(1) ["parent"]=> NULL } + if (($loopStack['index']) == $loopStack['count'] - 1) { + return $splitEnd; + } + $eachN = 0; + if (is_numeric($each)) { + $eachN = $each; + } elseif (strlen($each) > 1) { + if ($each[0] === 'c') { + $eachN = $loopStack['count'] / substr($each, 1); + } + } else { + $eachN = PHP_INT_MAX; + } + + if (($loopStack['index'] + 1) % $eachN === 0) { + return $splitText; + } + return ''; + } + + /** + * Return the last element in an array passing a given truth test. + * + * @param array $array + * @param callable|null $callback + * @param mixed $default + * @return mixed + */ + public static function last($array, callable $callback = null, $default = null) + { + if (\is_null($callback)) { + return empty($array) ? static::value($default) : \end($array); + } + return static::first(\array_reverse($array), $callback, $default); + } + + /** + * Return the default value of the given value. + * + * @param mixed $value + * @return mixed + */ + public static function value($value) + { + return $value instanceof Closure ? $value() : $value; + } + + /** + * Return the first element in an array passing a given truth test. + * + * @param array $array + * @param callable|null $callback + * @param mixed $default + * @return mixed + */ + public static function first($array, callable $callback = null, $default = null) + { + if (\is_null($callback)) { + return empty($array) ? static::value($default) : \reset($array); + } + foreach ($array as $key => $value) { + if ($callback($key, $value)) { + return $value; + } + } + return static::value($default); + } + + /** + * @param string $name + * @param $args [] + * @return string + * @throws BadMethodCallException + */ + public function __call($name, $args) + { + if ($name === 'if') { + return $this->registerIfStatement($args[0] ?? null, $args[1] ?? null); + } + $this->showError('call', "function $name is not defined
", true, true); + return ''; + } + + /** + * Register an "if" statement directive. + * + * @param string $name + * @param callable $callback + * @return string + */ + public function registerIfStatement($name, callable $callback): string + { + $this->conditions[$name] = $callback; + + $this->directive($name, function ($expression) use ($name) { + $tmp = $this->stripParentheses($expression); + return $expression !== '' + ? $this->phpTag . " if (\$this->check('$name', $tmp)): ?>" + : $this->phpTag . " if (\$this->check('$name')): ?>"; + }); + + $this->directive('else' . $name, function ($expression) use ($name) { + $tmp = $this->stripParentheses($expression); + return $expression !== '' + ? $this->phpTag . " elseif (\$this->check('$name', $tmp)): ?>" + : $this->phpTag . " elseif (\$this->check('$name')): ?>"; + }); + + $this->directive('end' . $name, function () { + return $this->phpTag . ' endif; ?>'; + }); + return ''; + } + + /** + * Check the result of a condition. + * + * @param string $name + * @param array $parameters + * @return bool + */ + public function check($name, ...$parameters): bool + { + return \call_user_func($this->conditions[$name], ...$parameters); + } + + /** + * @param bool $bool + * @param string $view name of the view + * @param array $value arrays of values + * @return string + * @throws Exception + */ + public function includeWhen($bool = false, $view = '', $value = []): string + { + if ($bool) { + return $this->runChild($view, $value); + } + return ''; + } + + /** + * Macro of function run + * + * @param $view + * @param array $variables + * @return string + * @throws Exception + */ + public function runChild($view, $variables = []): string + { + if (\is_array($variables)) { + if ($this->includeScope) { + $backup = $this->variables; + } else { + $backup = null; + } + $newVariables = \array_merge($this->variables, $variables); + } else { + if ($variables === null) { + $newVariables = $this->variables; + var_dump($newVariables); + die(1); + } + + $this->showError('run/include', "RunChild: Include/run variables should be defined as array ['idx'=>'value']", true); + return ''; + } + $r = $this->runInternal($view, $newVariables, false, $this->isRunFast); + if ($backup !== null) { + $this->variables = $backup; + } + return $r; + } + + /** + * run the blade engine. It returns the result of the code. + * + * @param string $view + * @param array $variables + * @param bool $forced if true then it recompiles no matter if the compiled file exists or not. + * @param bool $runFast if true then the code is not compiled neither checked, and it runs directly the compiled + * version. + * @return string + * @throws Exception + * @noinspection PhpUnusedParameterInspection + */ + protected function runInternal($view, $variables = [], $forced = false, $runFast = false): string + { + $this->currentView = $view; + if (@\count($this->composerStack)) { + $this->evalComposer($view); + } + if (@\count($this->variablesGlobal) > 0) { + $this->variables = \array_merge($variables, $this->variablesGlobal); + //$this->variablesGlobal = []; // used so we delete it. + } else { + $this->variables = $variables; + } + if (!$runFast) { + // a) if the "compile" is forced then we compile the original file, then save the file. + // b) if the "compile" is not forced then we read the datetime of both file, and we compared. + // c) in both cases, if the compiled doesn't exist then we compile. + if ($view) { + $this->fileName = $view; + } + $result = $this->compile($view, $forced); + if (!$this->isCompiled) { + return $this->evaluateText($result, $this->variables); + } + } elseif ($view) { + $this->fileName = $view; + } + $this->isRunFast = $runFast; + return $this->evaluatePath($this->getCompiledFile(), $this->variables); + } + + protected function evalComposer($view): void + { + foreach ($this->composerStack as $viewKey => $fn) { + if ($this->wildCardComparison($view, $viewKey)) { + if (is_callable($fn)) { + $fn($this); + } elseif ($this->methodExistsStatic($fn, 'composer')) { + // if the method exists statically then $fn is the class and 'composer' is the name of the method + $fn::composer($this); + } elseif (is_object($fn) || class_exists($fn)) { + // if $fn is an object, or it is a class and the class exists. + $instance = (is_object($fn)) ? $fn : new $fn(); + if (method_exists($instance, 'composer')) { + // and the method exists inside the instance. + $instance->composer($this); + } else { + if ($this->mode === self::MODE_DEBUG) { + $this->showError('evalComposer', "BladeOne: composer() added an incorrect method [$fn]", true, true); + return; + } + $this->showError('evalComposer', 'BladeOne: composer() added an incorrect method', true, true); + return; + } + } else { + $this->showError('evalComposer', 'BladeOne: composer() added an incorrect method', true, true); + } + } + } + } + + /** + * It compares with wildcards (*) and returns true if both strings are equals
+ * The wildcards only works at the beginning and/or at the end of the string.
+ * Example:
+ *
+ * Text::wildCardComparison('abcdef','abc*'); // true
+ * Text::wildCardComparison('abcdef','*def'); // true
+ * Text::wildCardComparison('abcdef','*abc*'); // true
+ * Text::wildCardComparison('abcdef','*cde*'); // true
+ * Text::wildCardComparison('abcdef','*cde'); // false
+ *
+ *
+ *
+ * @param string $text
+ * @param string|null $textWithWildcard
+ *
+ * @return bool
+ */
+ protected function wildCardComparison($text, $textWithWildcard): bool
+ {
+ if (($textWithWildcard === null || $textWithWildcard === '')
+ || strpos($textWithWildcard, '*') === false
+ ) {
+ // if the text with wildcard is null or empty, or it contains two ** or it contains no * then..
+ return $text == $textWithWildcard;
+ }
+ if ($textWithWildcard === '*' || $textWithWildcard === '**') {
+ return true;
+ }
+ $c0 = $textWithWildcard[0];
+ $c1 = substr($textWithWildcard, -1);
+ $textWithWildcardClean = str_replace('*', '', $textWithWildcard);
+ $p0 = strpos($text, $textWithWildcardClean);
+ if ($p0 === false) {
+ // no matches.
+ return false;
+ }
+ if ($c0 === '*' && $c1 === '*') {
+ // $textWithWildcard='*asasasas*'
+ return true;
+ }
+ if ($c1 === '*') {
+ // $textWithWildcard='asasasas*'
+ return $p0 === 0;
+ }
+ // $textWithWildcard='*asasasas'
+ $len = strlen($textWithWildcardClean);
+ return (substr($text, -$len) === $textWithWildcardClean);
+ }
+
+ protected function methodExistsStatic($class, $method): bool
+ {
+ try {
+ return (new \ReflectionMethod($class, $method))->isStatic();
+ } catch (\ReflectionException $e) {
+ return false;
+ }
+ }
+
+ /**
+ * Compile the view at the given path.
+ *
+ * @param string $templateName The name of the template. Example folder.template
+ * @param bool $forced If the compilation will be forced (always compile) or not.
+ * @return boolean|string True if the operation was correct, or false (if not exception)
+ * if it fails. It returns a string (the content compiled) if isCompiled=false
+ * @throws Exception
+ */
+ public function compile($templateName = null, $forced = false)
+ {
+ $compiled = $this->getCompiledFile($templateName);
+ $template = $this->getTemplateFile($templateName);
+ if (!$this->isCompiled) {
+ $contents = $this->compileString($this->getFile($template));
+ $this->compileCallBacks($contents, $templateName);
+ return $contents;
+ }
+ if ($forced || $this->isExpired($templateName)) {
+ // compile the original file
+ $contents = $this->compileString($this->getFile($template));
+ $this->compileCallBacks($contents, $templateName);
+ if ($this->optimize) {
+ // removes space and tabs and replaces by a single space
+ $contents = \preg_replace('/^ {2,}/m', ' ', $contents);
+ $contents = \preg_replace('/^\t{2,}/m', ' ', $contents);
+ }
+ $ok = @\file_put_contents($compiled, $contents);
+ if ($ok === false) {
+ $this->showError(
+ 'Compiling',
+ "Unable to save the file [$compiled]. Check the compile folder is defined and has the right permission"
+ );
+ return false;
+ }
+ }
+ return true;
+ }
+
+ /**
+ * Get the full path of the compiled file.
+ *
+ * @param string $templateName
+ * @return string
+ */
+ public function getCompiledFile($templateName = ''): string
+ {
+ $templateName = (empty($templateName)) ? $this->fileName : $templateName;
+
+ $fullPath = $this->getTemplateFile($templateName);
+ if($fullPath == '') {
+ throw new \RuntimeException('Template not found: ' . $templateName);
+ }
+
+ $style=$this->compileTypeFileName;
+ if ($style==='auto') {
+ $style='sha1';
+ }
+ $hash = $style === 'md5' ? \md5($fullPath) : \sha1($fullPath);
+ return $this->compiledPath . '/' . basename($templateName) . '_' . $hash . $this->compileExtension;
+ }
+
+
+
+ /**
+ * Get the mode of the engine.See BladeOne::MODE_* constants
+ *
+ * @return int=[self::MODE_AUTO,self::MODE_DEBUG,self::MODE_FAST,self::MODE_SLOW][$i]
+ */
+ public function getMode(): int
+ {
+ if (\defined('BLADEONE_MODE')) {
+ $this->mode = BLADEONE_MODE;
+ }
+ return $this->mode;
+ }
+
+ /**
+ * Set the compile mode+ * + * @param $mode int=[self::MODE_AUTO,self::MODE_DEBUG,self::MODE_FAST,self::MODE_SLOW][$i] + * @return void + */ + public function setMode($mode): void + { + $this->mode = $mode; + } + + /** + * Get the full path of the template file. + *
Example: getTemplateFile('.abc.def')
+ * + * @param string $templateName template name. If not template is set then it uses the base template. + * @return string + */ + public function getTemplateFile($templateName = ''): string + { + $templateName = (empty($templateName)) ? $this->fileName : $templateName; + if (\strpos($templateName, '/') !== false) { + return $this->locateTemplate($templateName); // it's a literal + } + $arr = \explode('.', $templateName); + $c = \count($arr); + if ($c == 1) { + // it's in the root of the template folder. + return $this->locateTemplate($templateName . $this->fileExtension); + } + + $file = $arr[$c - 1]; + \array_splice($arr, $c - 1, $c - 1); // delete the last element + $path = \implode('/', $arr); + return $this->locateTemplate($path . '/' . $file . $this->fileExtension); + } + + /** + * Find template file with the given name in all template paths in the order the paths were written + * + * @param string $name Filename of the template (without path) + * @return string template file + */ + protected function locateTemplate($name): string + { + $this->notFoundPath = ''; + foreach ($this->templatePath as $dir) { + $path = $dir . '/' . $name; + if (\is_file($path)) { + return $path; + } + + $this->notFoundPath .= $path . ","; + } + return ''; + } + + /** + * Get the contents of a file. + * + * @param string $fullFileName It gets the content of a filename or returns ''. + * + * @return string + */ + public function getFile($fullFileName): string + { + if (\is_file($fullFileName)) { + return \file_get_contents($fullFileName); + } + $this->showError('getFile', "File does not exist at paths (separated by comma) [$this->notFoundPath] or permission denied"); + return ''; + } + + protected function compileCallBacks(&$contents, $templateName): void + { + if (!empty($this->compileCallbacks)) { + foreach ($this->compileCallbacks as $callback) { + if (is_callable($callback)) { + $callback($contents, $templateName); + } + } + } + } + + /** + * Determine if the view has expired. + * + * @param string|null $fileName + * @return bool + */ + public function isExpired($fileName): bool + { + $compiled = $this->getCompiledFile($fileName); + $template = $this->getTemplateFile($fileName); + if (!\is_file($template)) { + if ($this->mode == self::MODE_DEBUG) { + $this->showError('Read file', 'Template not found :' . $this->fileName . " on file: $template", true); + } else { + $this->showError('Read file', 'Template not found :' . $this->fileName, true); + } + } + // If the compiled file doesn't exist we will indicate that the view is expired + // so that it can be re-compiled. Else, we will verify the last modification + // of the views is less than the modification times of the compiled views. + if (!$this->compiledPath || !\is_file($compiled)) { + return true; + } + return \filemtime($compiled) < \filemtime($template); + } + + /** + * Evaluates a text (string) using the current variables + * + * @param string $content + * @param array $variables + * @return string + * @throws Exception + */ + protected function evaluateText($content, $variables): string + { + \ob_start(); + \extract($variables); + // We'll evaluate the contents of the view inside a try/catch block, so we can + // flush out any stray output that might get out before an error occurs or + // an exception is thrown. This prevents any partial views from leaking. + try { + eval(' ?>' . $content . $this->phpTag); + } catch (Exception $e) { + $this->handleViewException($e); + } + return \ltrim(\ob_get_clean()); + } + + /** + * Handle a view exception. + * + * @param Exception $e + * @return void + * @throws $e + */ + protected function handleViewException($e): void + { + \ob_get_clean(); + throw $e; + } + + /** + * Evaluates a compiled file using the current variables + * + * @param string $compiledFile full path of the compile file. + * @param array $variables + * @return string + * @throws Exception + */ + protected function evaluatePath($compiledFile, $variables): string + { + \ob_start(); + // note, the variables are extracted locally inside this method, + // they are not global variables :-3 + \extract($variables); + // We'll evaluate the contents of the view inside a try/catch block, so we can + // flush out any stray output that might get out before an error occurs or + // an exception is thrown. This prevents any partial views from leaking. + try { + include $compiledFile; + } catch (Exception $e) { + $this->handleViewException($e); + } + return \ltrim(\ob_get_clean()); + } + + /** + * @param array $views array of views + * @param array $value + * @return string + * @throws Exception + */ + public function includeFirst($views = [], $value = []): string + { + foreach ($views as $view) { + if ($this->templateExist($view)) { + return $this->runChild($view, $value); + } + } + return ''; + } + + /** + * Returns true if the template exists. Otherwise, it returns false + * + * @param $templateName + * @return bool + */ + protected function templateExist($templateName): bool + { + $file = $this->getTemplateFile($templateName); + return \is_file($file); + } + + /** + * Convert an array such as ["class1"=>"myclass","style="mystyle"] to class1='myclass' style='mystyle' string + * + * @param array|string $array array to convert + * @return string + */ + public function convertArg($array): string + { + if (!\is_array($array)) { + return $array; // nothing to convert. + } + return \implode(' ', \array_map('static::convertArgCallBack', \array_keys($array), $array)); + } + + /** + * Returns the current token. if there is not a token then it generates a new one. + * It could require an open session. + * + * @param bool $fullToken It returns a token with the current ip. + * @param string $tokenId [optional] Name of the token. + * + * @return string + */ + public function getCsrfToken($fullToken = false, $tokenId = '_token'): string + { + if ($this->csrf_token == '') { + $this->regenerateToken($tokenId); + } + if ($fullToken) { + return $this->csrf_token . '|' . $this->ipClient(); + } + return $this->csrf_token; + } + + /** + * Regenerates the csrf token and stores in the session. + * It requires an open session. + * + * @param string $tokenId [optional] Name of the token. + */ + public function regenerateToken($tokenId = '_token'): void + { + try { + $this->csrf_token = \bin2hex(\random_bytes(10)); + } catch (Exception $e) { + $this->csrf_token = '123456789012345678901234567890'; // unable to generates a random token. + } + @$_SESSION[$tokenId] = $this->csrf_token . '|' . $this->ipClient(); + } + + public function ipClient() + { + if ( + isset($_SERVER['HTTP_X_FORWARDED_FOR']) + && \preg_match('/^(d{1,3}).(d{1,3}).(d{1,3}).(d{1,3})$/', $_SERVER['HTTP_X_FORWARDED_FOR']) + ) { + return $_SERVER['HTTP_X_FORWARDED_FOR']; + } + return $_SERVER['REMOTE_ADDR'] ?? ''; + } + + /** + * Validates if the csrf token is valid or not.+ * It requires an open session. + * + * @param bool $alwaysRegenerate [optional] Default is false.
+ * If true then it will generate a new token regardless + * of the method.
+ * If false, then it will generate only if the method is POST.
+ * Note: You must not use true if you want to use csrf with AJAX. + * + * @param string $tokenId [optional] Name of the token. + * + * @return bool It returns true if the token is valid, or it is generated. Otherwise, false. + */ + public function csrfIsValid($alwaysRegenerate = false, $tokenId = '_token'): bool + { + if (@$_SERVER['REQUEST_METHOD'] === 'POST' && $alwaysRegenerate === false) { + $this->csrf_token = $_POST[$tokenId] ?? null; // ping pong the token. + return $this->csrf_token . '|' . $this->ipClient() === ($_SESSION[$tokenId] ?? null); + } + + if ($this->csrf_token == '' || $alwaysRegenerate) { + // if not token then we generate a new one + $this->regenerateToken($tokenId); + } + return true; + } + + /** + * Stop injecting content into a section and return its contents. + * + * @return string + */ + public function yieldSection(): ?string + { + $sc = $this->stopSection(); + return $this->sections[$sc] ?? null; + } + + /** + * Stop injecting content into a section. + * + * @param bool $overwrite + * @return string + */ + public function stopSection($overwrite = false): string + { + if (empty($this->sectionStack)) { + $this->showError('stopSection', 'Cannot end a section without first starting one.', true, true); + } + $last = \array_pop($this->sectionStack); + if ($overwrite) { + $this->sections[$last] = \ob_get_clean(); + } else { + $this->extendSection($last, \ob_get_clean()); + } + return $last; + } + + /** + * Append content to a given section. + * + * @param string $section + * @param string $content + * @return void + */ + protected function extendSection($section, $content): void + { + if (isset($this->sections[$section])) { + $content = \str_replace($this->PARENTKEY, $content, $this->sections[$section]); + } + $this->sections[$section] = $content; + } + + public function dump($object, $jsconsole = false): void + { + if (!$jsconsole) { + echo '
'; + \var_dump($object); + echo ''; + } else { + /** @noinspection BadExpressionStatementJS */ + /** @noinspection JSVoidFunctionReturnValueUsed */ + echo ''; + } + } + + /** + * Start injecting content into a section. + * + * @param string $section + * @param string $content + * @return void + */ + public function startSection($section, $content = ''): void + { + if ($content === '') { + \ob_start() && $this->sectionStack[] = $section; + } else { + $this->extendSection($section, $content); + } + } + + /** + * Stop injecting content into a section and append it. + * + * @return string + * @throws InvalidArgumentException + */ + public function appendSection(): string + { + if (empty($this->sectionStack)) { + $this->showError('appendSection', 'Cannot end a section without first starting one.', true, true); + } + $last = \array_pop($this->sectionStack); + if (isset($this->sections[$last])) { + $this->sections[$last] .= \ob_get_clean(); + } else { + $this->sections[$last] = \ob_get_clean(); + } + return $last; + } + + /** + * Adds a global variable. If $varname is an array then it merges all the values. + * Example: + *
+ * $this->share('variable',10.5);
+ * $this->share('variable2','hello');
+ * // or we could add the two variables as:
+ * $this->share(['variable'=>10.5,'variable2'=>'hello']);
+ *
+ *
+ * @param string|array $varname It is the name of the variable or, it is an associative array
+ * @param mixed $value
+ * @return $this
+ * @see BladeOne::share
+ */
+ public function with($varname, $value = null): BladeOne
+ {
+ return $this->share($varname, $value);
+ }
+
+ /**
+ * Adds a global variable. If $varname is an array then it merges all the values.
+ * Example:
+ *
+ * $this->share('variable',10.5);
+ * $this->share('variable2','hello');
+ * // or we could add the two variables as:
+ * $this->share(['variable'=>10.5,'variable2'=>'hello']);
+ *
+ *
+ * @param string|array $varname It is the name of the variable, or it is an associative array
+ * @param mixed $value
+ * @return $this
+ */
+ public function share($varname, $value = null): BladeOne
+ {
+ if (is_array($varname)) {
+ $this->variablesGlobal = \array_merge($this->variablesGlobal, $varname);
+ } else {
+ $this->variablesGlobal[$varname] = $value;
+ }
+ return $this;
+ }
+
+ /**
+ * Get the string contents of a section.
+ *
+ * @param string $section
+ * @param string $default
+ * @return string
+ */
+ public function yieldContent($section, $default = ''): string
+ {
+ if (isset($this->sections[$section])) {
+ return \str_replace($this->PARENTKEY, $default, $this->sections[$section]);
+ }
+
+ return $default;
+ }
+
+ /**
+ * Register a custom Blade compiler.
+ *
+ * @param callable $compiler
+ * @return void
+ */
+ public function extend(callable $compiler): void
+ {
+ $this->extensions[] = $compiler;
+ }
+
+ /**
+ * Register a handler for custom directives for run at runtime
+ *
+ * @param string $name
+ * @param callable $handler
+ * @return void
+ */
+ public function directiveRT($name, callable $handler): void
+ {
+ $this->customDirectives[$name] = $handler;
+ $this->customDirectivesRT[$name] = true;
+ }
+
+ /**
+ * Sets the escaped content tags used for the compiler.
+ *
+ * @param string $openTag
+ * @param string $closeTag
+ * @return void
+ */
+ public function setEscapedContentTags($openTag, $closeTag): void
+ {
+ $this->setContentTags($openTag, $closeTag, true);
+ }
+
+ /**
+ * Gets the content tags used for the compiler.
+ *
+ * @return array
+ */
+ public function getContentTags(): array
+ {
+ return $this->getTags();
+ }
+
+ /**
+ * Sets the content tags used for the compiler.
+ *
+ * @param string $openTag
+ * @param string $closeTag
+ * @param bool $escaped
+ * @return void
+ */
+ public function setContentTags($openTag, $closeTag, $escaped = false): void
+ {
+ $property = ($escaped === true) ? 'escapedTags' : 'contentTags';
+ $this->{$property} = [\preg_quote($openTag), \preg_quote($closeTag)];
+ }
+
+ /**
+ * Gets the tags used for the compiler.
+ *
+ * @param bool $escaped
+ * @return array
+ */
+ protected function getTags($escaped = false): array
+ {
+ $tags = $escaped ? $this->escapedTags : $this->contentTags;
+ return \array_map('stripcslashes', $tags);
+ }
+
+ /**
+ * Gets the escaped content tags used for the compiler.
+ *
+ * @return array
+ */
+ public function getEscapedContentTags(): array
+ {
+ return $this->getTags(true);
+ }
+
+ /**
+ * Sets the function used for resolving classes with inject.
+ *
+ * @param callable $function
+ */
+ public function setInjectResolver(callable $function): void
+ {
+ $this->injectResolver = $function;
+ }
+
+ /**
+ * Get the file extension for template files.
+ *
+ * @return string
+ */
+ public function getFileExtension(): string
+ {
+ return $this->fileExtension;
+ }
+
+ /**
+ * Set the file extension for the template files.
+ * It must include the leading dot e.g. ".blade.php"
+ *
+ * @param string $fileExtension Example: .prefix.ext
+ */
+ public function setFileExtension($fileExtension): void
+ {
+ $this->fileExtension = $fileExtension;
+ }
+
+ /**
+ * Get the file extension for template files.
+ *
+ * @return string
+ */
+ public function getCompiledExtension(): string
+ {
+ return $this->compileExtension;
+ }
+
+ /**
+ * Set the file extension for the compiled files.
+ * Including the leading dot for the extension is required, e.g. ".bladec"
+ *
+ * @param $fileExtension
+ */
+ public function setCompiledExtension($fileExtension): void
+ {
+ $this->compileExtension = $fileExtension;
+ }
+ /**
+ * @return string
+ * @see BladeOne::setCompileTypeFileName
+ */
+ public function getCompileTypeFileName(): string
+ {
+ return $this->compileTypeFileName;
+ }
+
+ /**
+ * It determines how the compiled filename will be called.+ * auto (default mode) the mode is "sha1"
+ * sha1 the filename is converted into a sha1 hash (it's the slow method, but it is safest)
+ * md5 the filename is converted into a md5 hash (it's faster than sha1, and it uses less space)
+ * @param string $compileTypeFileName=['auto','sha1','md5'][$i] + * @return BladeOne + */ + public function setCompileTypeFileName(string $compileTypeFileName): BladeOne + { + $this->compileTypeFileName = $compileTypeFileName; + return $this; + } + /** + * Add new loop to the stack. + * + * @param array|Countable $data + * @return void + */ + public function addLoop($data): void + { + $length = \is_array($data) || $data instanceof Countable ? \count($data) : null; + $parent = static::last($this->loopsStack); + $this->loopsStack[] = [ + 'index' => -1, + 'iteration' => 0, + 'remaining' => isset($length) ? $length + 1 : null, + 'count' => $length, + 'first' => true, + 'even' => true, + 'odd' => false, + 'last' => isset($length) ? $length == 1 : null, + 'depth' => \count($this->loopsStack) + 1, + 'parent' => $parent ? (object)$parent : null, + ]; + } + + /** + * Increment the top loop's indices. + * + * @return object + */ + public function incrementLoopIndices(): object + { + $c = \count($this->loopsStack) - 1; + $loop = &$this->loopsStack[$c]; + + $loop['index']++; + $loop['iteration']++; + $loop['first'] = $loop['index'] == 0; + $loop['even'] = $loop['index'] % 2 == 0; + $loop['odd'] = !$loop['even']; + if (isset($loop['count'])) { + $loop['remaining']--; + $loop['last'] = $loop['index'] == $loop['count'] - 1; + } + return (object)$loop; + } + + /** + * Pop a loop from the top of the loop stack. + * + * @return void + */ + public function popLoop(): void + { + \array_pop($this->loopsStack); + } + + /** + * Get an instance of the first loop in the stack. + * + * @return object|null + */ + public function getFirstLoop(): ?object + { + return ($last = static::last($this->loopsStack)) ? (object)$last : null; + } + + /** + * Get the rendered contents of a partial from a loop. + * + * @param string $view + * @param array $data + * @param string $iterator + * @param string $empty + * @return string + * @throws Exception + */ + public function renderEach($view, $data, $iterator, $empty = 'raw|'): string + { + $result = ''; + + if (\count($data) > 0) { + // If is actually data in the array, we will loop through the data and append + // an instance of the partial view to the final result HTML passing in the + // iterated value of this data array, allowing the views to access them. + foreach ($data as $key => $value) { + $data = ['key' => $key, $iterator => $value]; + $result .= $this->runChild($view, $data); + } + } elseif (static::startsWith($empty, 'raw|')) { + $result = \substr($empty, 4); + } else { + $result = $this->run($empty); + } + return $result; + } + + /** + * Run the blade engine. It returns the result of the code. + * + * @param string|null $view The name of the cache. Ex: "folder.folder.view" ("/folder/folder/view.blade") + * @param array $variables An associative arrays with the values to display. + * @return string + * @throws Exception + */ + public function run($view = null, $variables = []): string + { + $mode = $this->getMode(); + + if ($view === null) { + $view = $this->viewStack; + } + $this->viewStack = null; + if ($view === null) { + $this->showError('run', 'BladeOne: view not set', true); + return ''; + } + + $forced = ($mode & 1)!==0; // mode=1 forced:it recompiles no matter if the compiled file exists or not. + $runFast = ($mode & 2)!==0; // mode=2 runfast: the code is not compiled neither checked, and it runs directly the compiled + $this->sections = []; + if ($mode == 3) { + $this->showError('run', "we can't force and run fast at the same time", true); + } + return $this->runInternal($view, $variables, $forced, $runFast); + } + + /** + * It sets the current view
+ * This value is cleared when it is used (method run).
+ * Example:
+ *
+ * $this->setView('folder.view')->share(['var1'=>20])->run(); // or $this->run('folder.view',['var1'=>20]);
+ *
+ *
+ * @param string $view
+ * @return BladeOne
+ */
+ public function setView($view): BladeOne
+ {
+ $this->viewStack = $view;
+ return $this;
+ }
+
+ /**
+ * It injects a function, an instance, or a method class when a view is called.+ * It could be stacked. If it sets null then it clears all definitions. + * Example:
+ *
+ * $this->composer('folder.view',function($bladeOne) { $bladeOne->share('newvalue','hi there'); });
+ * $this->composer('folder.view','namespace1\namespace2\SomeClass'); // SomeClass must exist, and it must have the
+ * // method 'composer'
+ * $this->composer('folder.*',$instance); // $instance must have the method called 'composer'
+ * $this->composer(); // clear all composer.
+ *
+ *
+ * @param string|array|null $view It could contain wildcards (*). Example: 'aa.bb.cc','*.bb.cc','aa.bb.*','*.bb.*'
+ *
+ * @param callable|string|null $functionOrClass
+ * @return BladeOne
+ */
+ public function composer($view = null, $functionOrClass = null): BladeOne
+ {
+ if ($view === null && $functionOrClass === null) {
+ $this->composerStack = [];
+ return $this;
+ }
+ if (is_array($view)) {
+ foreach ($view as $v) {
+ $this->composerStack[$v] = $functionOrClass;
+ }
+ } else {
+ $this->composerStack[$view] = $functionOrClass;
+ }
+
+ return $this;
+ }
+
+ /**
+ * Start a component rendering process.
+ *
+ * @param string $name
+ * @param array $data
+ * @return void
+ */
+ public function startComponent($name, array $data = []): void
+ {
+ if (\ob_start()) {
+ $this->componentStack[] = $name;
+
+ $this->componentData[$this->currentComponent()] = $data;
+
+ $this->slots[$this->currentComponent()] = [];
+ }
+ }
+
+ /**
+ * Get the index for the current component.
+ *
+ * @return int
+ */
+ protected function currentComponent(): int
+ {
+ return \count($this->componentStack) - 1;
+ }
+
+ /**
+ * Render the current component.
+ *
+ * @return string
+ * @throws Exception
+ */
+ public function renderComponent(): string
+ {
+ //echo "render
"; + $name = \array_pop($this->componentStack); + //return $this->runChild($name, $this->componentData()); + $cd = $this->componentData(); + $clean = array_keys($cd); + $r = $this->runChild($name, $cd); + // we clean variables defined inside the component (so they are garbaged when the component is used) + foreach ($clean as $key) { + unset($this->variables[$key]); + } + return $r; + } + + /** + * Get the data for the given component. + * + * @return array + */ + protected function componentData(): array + { + $cs = count($this->componentStack); + //echo "
"; + //echo "
data:
"; + //var_dump($this->componentData); + //echo "
datac:
"; + //var_dump(count($this->componentStack)); + return array_merge( + $this->componentData[$cs], + ['slot' => trim(ob_get_clean())], + $this->slots[$cs] + ); + } + + /** + * Start the slot rendering process. + * + * @param string $name + * @param string|null $content + * @return void + */ + public function slot($name, $content = null): void + { + if (\count(\func_get_args()) === 2) { + $this->slots[$this->currentComponent()][$name] = $content; + } elseif (\ob_start()) { + $this->slots[$this->currentComponent()][$name] = ''; + + $this->slotStack[$this->currentComponent()][] = $name; + } + } + + /** + * Save the slot content for rendering. + * + * @return void + */ + public function endSlot(): void + { + static::last($this->componentStack); + + $currentSlot = \array_pop( + $this->slotStack[$this->currentComponent()] + ); + + $this->slots[$this->currentComponent()][$currentSlot] = \trim(\ob_get_clean()); + } + + /** + * @return string + */ + public function getPhpTag(): string + { + return $this->phpTag; + } + + /** + * @param string $phpTag + */ + public function setPhpTag($phpTag): void + { + $this->phpTag = $phpTag; + } + + /** + * @return string + */ + public function getCurrentUser(): string + { + return $this->currentUser; + } + + /** + * @param string $currentUser + */ + public function setCurrentUser($currentUser): void + { + $this->currentUser = $currentUser; + } + + /** + * @return string + */ + public function getCurrentRole(): string + { + return $this->currentRole; + } + + /** + * @param string $currentRole + */ + public function setCurrentRole($currentRole): void + { + $this->currentRole = $currentRole; + } + + /** + * @return string[] + */ + public function getCurrentPermission(): array + { + return $this->currentPermission; + } + + /** + * @param string[] $currentPermission + */ + public function setCurrentPermission($currentPermission): void + { + $this->currentPermission = $currentPermission; + } + + /** + * Returns the current base url without trailing slash. + * + * @return string + */ + public function getBaseUrl(): string + { + return $this->baseUrl; + } + + /** + * It sets the base url and, it also calculates the relative path.
+ * The base url defines the "root" of the project, not always the level of the domain, but it could be + * any folder.
+ * This value is used to calculate the relativity of the resources, but it is also used to set the domain.
+ * Note: The trailing slash is removed automatically if it's present.
+ * Note: We should not use arguments or name of the script.
+ * Examples:
+ *
+ * $this->setBaseUrl('http://domain.dom/myblog');
+ * $this->setBaseUrl('http://domain.dom/corporate/erp');
+ * $this->setBaseUrl('http://domain.dom/blog.php?args=20'); // avoid this one.
+ * $this->setBaseUrl('http://another.dom');
+ *
+ *
+ * @param string $baseUrl Example http://www.web.com/folder https://www.web.com/folder/anotherfolder
+ * @return BladeOne
+ */
+ public function setBaseUrl($baseUrl): BladeOne
+ {
+ $this->baseUrl = \rtrim($baseUrl, '/'); // base with the url trimmed
+ $this->baseDomain = @parse_url($this->baseUrl)['host'];
+ $currentUrl = $this->getCurrentUrlCalculated();
+ if ($currentUrl === '') {
+ $this->relativePath = '';
+ return $this;
+ }
+ if (\strpos($currentUrl, $this->baseUrl) === 0) {
+ $part = \str_replace($this->baseUrl, '', $currentUrl);
+ $numf = \substr_count($part, '/') - 1;
+ $numf = ($numf > 10) ? 10 : $numf; // avoid overflow
+ $this->relativePath = ($numf < 0) ? '' : \str_repeat('../', $numf);
+ } else {
+ $this->relativePath = '';
+ }
+ return $this;
+ }
+
+ /**
+ * It gets the full current url calculated with the information sends by the user.+ * Note: If we set baseurl, then it always uses the baseurl as domain (it's safe).
+ * Note: This information could be forged/faked by the end-user.
+ * Note: It returns empty '' if it is called in a command line interface / non-web.
+ * Note: It doesn't return the user and password.
+ * @param bool $noArgs if true then it excludes the arguments. + * @return string + */ + public function getCurrentUrlCalculated($noArgs = false): string + { + if (!isset($_SERVER['HTTP_HOST'], $_SERVER['REQUEST_URI'])) { + return ''; + } + $host = $this->baseDomain ?? $_SERVER['HTTP_HOST']; // <-- it could be forged! + $link = (isset($_SERVER['HTTPS']) && $_SERVER['HTTPS'] === 'on' ? 'https' : 'http'); + $port = $_SERVER['SERVER_PORT']; + $port2 = (($link === 'http' && $port === '80') || ($link === 'https' && $port === '443')) ? '' : ':' . $port; + $link .= "://$host$port2$_SERVER[REQUEST_URI]"; + if ($noArgs) { + $link = @explode('?', $link)[0]; + } + return $link; + } + + /** + * It returns the relative path to the base url or empty if not set
+ * Example:
+ *
+ * // current url='http://domain.dom/page/subpage/web.php?aaa=2
+ * $this->setBaseUrl('http://domain.dom/');
+ * $this->getRelativePath(); // '../../'
+ * $this->setBaseUrl('http://domain.dom/');
+ * $this->getRelativePath(); // '../../'
+ *
+ * Note:The relative path is calculated when we set the base url.
+ *
+ * @return string
+ * @see BladeOne::setBaseUrl
+ */
+ public function getRelativePath(): string
+ {
+ return $this->relativePath;
+ }
+
+ /**
+ * It gets the full current canonical url.+ * Example: https://www.mysite.com/aaa/bb/php.php?aa=bb + *
-
+ *
- It returns the $this->canonicalUrl value if is not null + *
- Otherwise, it returns the $this->currentUrl if not null + *
- Otherwise, the url is calculated with the information sends by the user + *
+ * Example: https://www.mysite.com/aaa/bb/php.php?aa=bb + * + * @param string|null $canonUrl + * @return BladeOne + */ + public function setCanonicalUrl($canonUrl = null): BladeOne + { + $this->canonicalUrl = $canonUrl; + return $this; + } + + /** + * It gets the full current url
+ * Example: https://www.mysite.com/aaa/bb/php.php?aa=bb + *
-
+ *
- It returns the $this->currentUrl if not null + *
- Otherwise, the url is calculated with the information sends by the user + *
+ * Example: https://www.mysite.com/aaa/bb/php.php?aa=bb + * Note: If the current url is not set, then the system could calculate the current url. + * + * @param string|null $currentUrl + * @return BladeOne + */ + public function setCurrentUrl($currentUrl = null): BladeOne + { + $this->currentUrl = $currentUrl; + return $this; + } + + /** + * If true then it optimizes the result (it removes tab and extra spaces). + * + * @param bool $bool + * @return BladeOne + */ + public function setOptimize($bool = false): BladeOne + { + $this->optimize = $bool; + return $this; + } + + /** + * It sets the callback function for authentication. It is used by @can and @cannot + * + * @param callable $fn + */ + public function setCanFunction(callable $fn): void + { + $this->authCallBack = $fn; + } + + /** + * It sets the callback function for authentication. It is used by @canany + * + * @param callable $fn + */ + public function setAnyFunction(callable $fn): void + { + $this->authAnyCallBack = $fn; + } + + /** + * It sets the callback function for errors. It is used by @error + * + * @param callable $fn + */ + public function setErrorFunction(callable $fn): void + { + $this->errorCallBack = $fn; + } + + //
+ * example:
+ *
+ * $this->addInsideQuote("'hello'"," world"); // 'hello world'
+ * $this->addInsideQuote("hello"," world"); // hello world
+ *
+ *
+ * @param $quoted
+ * @param $newFragment
+ * @return string
+ */
+ public function addInsideQuote($quoted, $newFragment): string
+ {
+ if ($this->isQuoted($quoted)) {
+ return substr($quoted, 0, -1) . $newFragment . substr($quoted, -1);
+ }
+ return $quoted . $newFragment;
+ }
+
+ /**
+ * Return true if the string is a php variable (it starts with $)
+ *
+ * @param string|null $text
+ * @return bool
+ */
+ public function isVariablePHP($text): bool
+ {
+ if (!$text || strlen($text) < 2) {
+ return false;
+ }
+ return $text[0] === '$';
+ }
+
+ /**
+ * It's the same as "@_e", however it parses the text (using sprintf).
+ * If the operation fails then, it returns the original expression without translation.
+ *
+ * @param $phrase
+ *
+ * @return string
+ */
+ public function _ef($phrase): string
+ {
+ $argv = \func_get_args();
+ $r = $this->_e($phrase);
+ $argv[0] = $r; // replace the first argument with the translation.
+ $result = @sprintf(...$argv);
+ return !$result ? $r : $result;
+ }
+
+ /**
+ * Tries to translate the word if it's in the array defined by BladeOneLang::$dictionary
+ * If the operation fails then, it returns the original expression without translation.
+ *
+ * @param $phrase
+ *
+ * @return string
+ */
+ public function _e($phrase): string
+ {
+ if ((!\array_key_exists($phrase, static::$dictionary))) {
+ $this->missingTranslation($phrase);
+ return $phrase;
+ }
+
+ return static::$dictionary[$phrase];
+ }
+
+ /**
+ * Log a missing translation into the file $this->missingLog.+ * If the file is not defined, then it doesn't write the log. + * + * @param string $txt Message to write on. + */ + protected function missingTranslation($txt): void + { + if (!$this->missingLog) { + return; // if there is not a file assigned then it skips saving. + } + $fz = @\filesize($this->missingLog); + if (\is_object($txt) || \is_array($txt)) { + $txt = \print_r($txt, true); + } + // Rewrite file if more than 100000 bytes + $mode = ($fz > 100000) ? 'w' : 'a'; + $fp = \fopen($this->missingLog, $mode); + \fwrite($fp, $txt . "\n"); + \fclose($fp); + } + + /** + * if num is more than one then it returns the phrase in plural, otherwise the phrase in singular. + * Note: the translation should be as follows: $msg['Person']='Person' $msg=['Person']['p']='People' + * + * @param string $phrase + * @param string $phrases + * @param int $num + * + * @return string + */ + public function _n($phrase, $phrases, $num = 0): string + { + if ((!\array_key_exists($phrase, static::$dictionary))) { + $this->missingTranslation($phrase); + return ($num <= 1) ? $phrase : $phrases; + } + + return ($num <= 1) ? $this->_e($phrase) : $this->_e($phrases); + } + + /** + * @param $expression + * @return string + * @see BladeOne::getCanonicalUrl + */ + public function compileCanonical($expression = null): string + { + return ''; + } + + /** + * @param $expression + * @return string + * @see BladeOne::getBaseUrl + */ + public function compileBase($expression = null): string + { + return '
'; var_dump$expression; echo '';?>"; + } + + /** + * Execute the case tag. + * + * @param $expression + * @return string + */ + protected function compileCase($expression): string + { + if ($this->firstCaseInSwitch) { + $this->firstCaseInSwitch = false; + return 'case ' . $expression . ': ?>'; + } + return $this->phpTag . "case $expression: ?>"; + } + + /** + * Compile the while statements into valid PHP. + * + * @param string $expression + * @return string + */ + protected function compileWhile($expression): string + { + return $this->phpTag . "while$expression: ?>"; + } + + /** + * default tag used for switch/case + * + * @return string + */ + protected function compileDefault(): string + { + if ($this->firstCaseInSwitch) { + return $this->showError('@default', '@switch without any @case', true); + } + return $this->phpTag . 'default: ?>'; + } + + protected function compileEndSwitch(): string + { + --$this->switchCount; + if ($this->switchCount < 0) { + return $this->showError('@endswitch', 'Missing @switch', true); + } + return $this->phpTag . '} // end switch ?>'; + } + + /** + * Compile while statements into valid PHP. + * + * @param string $expression + * @return string + */ + protected function compileInject($expression): string + { + $ex = $this->stripParentheses($expression); + $p0 = \strpos($ex, ','); + if (!$p0) { + $var = $this->stripQuotes($ex); + $namespace = ''; + } else { + $var = $this->stripQuotes(\substr($ex, 0, $p0)); + $namespace = $this->stripQuotes(\substr($ex, $p0 + 1)); + } + return $this->phpTag . "\$$var = \$this->injectClass('$namespace', '$var'); ?>"; + } + + /** + * Remove first and end quote from a quoted string of text + * + * @param mixed $text + * @return null|string|string[] + */ + public function stripQuotes($text) + { + if (!$text || strlen($text) < 2) { + return $text; + } + $text = trim($text); + $p0 = $text[0]; + $p1 = \substr($text, -1); + if ($p0 === $p1 && ($p0 === '"' || $p0 === "'")) { + return \substr($text, 1, -1); + } + return $text; + } + + /** + * Execute the user defined extensions. + * + * @param string $value + * @return string + */ + protected function compileExtensions($value): string + { + foreach ($this->extensions as $compiler) { + $value = $compiler($value, $this); + } + return $value; + } + + /** + * Compile Blade comments into valid PHP. + * + * @param string $value + * @return string + */ + protected function compileComments($value): string + { + $pattern = \sprintf('/%s--(.*?)--%s/s', $this->contentTags[0], $this->contentTags[1]); + return \preg_replace($pattern, $this->phpTag . '/*$1*/ ?>', $value); + } + + /** + * Compile Blade echos into valid PHP. + * + * @param string $value + * @return string + * @throws Exception + */ + protected function compileEchos($value): string + { + foreach ($this->getEchoMethods() as $method => $length) { + $value = $this->$method($value); + } + return $value; + } + + /** + * Get the echo methods in the proper order for compilation. + * + * @return array + */ + protected function getEchoMethods(): array + { + $methods = [ + 'compileRawEchos' => \strlen(\stripcslashes($this->rawTags[0])), + 'compileEscapedEchos' => \strlen(\stripcslashes($this->escapedTags[0])), + 'compileRegularEchos' => \strlen(\stripcslashes($this->contentTags[0])), + ]; + \uksort($methods, static function ($method1, $method2) use ($methods) { + // Ensure the longest tags are processed first + if ($methods[$method1] > $methods[$method2]) { + return -1; + } + if ($methods[$method1] < $methods[$method2]) { + return 1; + } + // Otherwise, give preference to raw tags (assuming they've overridden) + if ($method1 === 'compileRawEchos') { + return -1; + } + if ($method2 === 'compileRawEchos') { + return 1; + } + if ($method1 === 'compileEscapedEchos') { + return -1; + } + if ($method2 === 'compileEscapedEchos') { + return 1; + } + throw new BadMethodCallException("Method [$method1] not defined"); + }); + return $methods; + } + + /** + * Compile Blade statements that start with "@". + * + * @param string $value + * + * @return array|string|string[]|null + */ + protected function compileStatements($value) + { + /** + * @param array $match + * [0]=full expression with @ and parenthesis + * [1]=expression without @ and argument + * [2]=???? + * [3]=argument with parenthesis and without the first @ + * [4]=argument without parenthesis. + * + * @return mixed|string + */ + $callback = function ($match) { + if (static::contains($match[1], '@')) { + // @@escaped tag + $match[0] = isset($match[3]) ? $match[1] . $match[3] : $match[1]; + } else { + if (strpos($match[1], '::') !== false) { + // Someclass::method + return $this->compileStatementClass($match); + } + if (isset($this->customDirectivesRT[$match[1]])) { + if ($this->customDirectivesRT[$match[1]]) { + $match[0] = $this->compileStatementCustom($match); + } else { + $match[0] = \call_user_func( + $this->customDirectives[$match[1]], + $this->stripParentheses(static::get($match, 3)) + ); + } + } elseif (\method_exists($this, $method = 'compile' . \ucfirst($match[1]))) { + // it calls the function compile
+ * Example: "SomeClass::method()" -> "\namespace\SomeClass::method()"
+ * + * @param string $text + * + * @return string + * @see BladeOne + */ + protected function fixNamespaceClass($text): string + { + if (strpos($text, '::') === false) { + return $text; + } + $classPart = explode('::', $text, 2); + if (isset($this->aliasClasses[$classPart[0]])) { + $classPart[0] = $this->aliasClasses[$classPart[0]]; + } + return $classPart[0] . '::' . $classPart[1]; + } + + /** + * For compile custom directive at runtime. + * + * @param $match + * @return string + */ + protected function compileStatementCustom($match): string + { + $v = $this->stripParentheses(static::get($match, 3)); + $v = ($v == '') ? '' : ',' . $v; + return $this->phpTag . 'call_user_func($this->customDirectives[\'' . $match[1] . '\']' . $v . '); ?>'; + } + + /** + * Get an item from an array using "dot" notation. + * + * @param ArrayAccess|array $array + * @param string $key + * @param mixed $default + * @return mixed + */ + public static function get($array, $key, $default = null) + { + $accesible = \is_array($array) || $array instanceof ArrayAccess; + if (!$accesible) { + return static::value($default); + } + if (\is_null($key)) { + return $array; + } + if (static::exists($array, $key)) { + return $array[$key]; + } + foreach (\explode('.', $key) as $segment) { + if (static::exists($array, $segment)) { + $array = $array[$segment]; + } else { + return static::value($default); + } + } + return $array; + } + + /** + * Determine if the given key exists in the provided array. + * + * @param ArrayAccess|array $array + * @param string|int $key + * @return bool + */ + public static function exists($array, $key): bool + { + if ($array instanceof ArrayAccess) { + return $array->offsetExists($key); + } + return \array_key_exists($key, $array); + } + + /** + * This method removes the parenthesis of the expression and parse the arguments. + * @param string $expression + * @return array + */ + protected function getArgs($expression): array + { + return $this->parseArgs($this->stripParentheses($expression), ' '); + } + + /** + * It separates a string using a separator and an identifier
+ * It excludes quotes,double quotes and the "¬" symbol.
+ * Example
+ *
+ * $this->parseArgs('a=2,b='a,b,c',d'); // ['a'=>'2','b'=>'a,b,c','d'=>null]
+ * $this->parseArgs('a=2,b=c,d'); // ['a'=>'2','b'=>'c','d'=>null]
+ * $this->parseArgs('a=2 b=c',' '); // ['a'=>'2','b'=>'c']
+ * $this->parseArgs('a:2 b:c',' ',':'); // ['a'=>'2','b'=>'c']
+ *
+ * Note: parseArgs('a = 2 b = c',' '); with return 4 values instead of 2.
+ *
+ * @param string $text the text to separate
+ * @param string $separator the separator of arguments
+ * @param string $assigment the character used to assign a new value
+ * @param bool $emptyKey if the argument is without value, we return it as key (true) or value (false) ?
+ * @return array
+ */
+ public function parseArgs($text, $separator = ',', $assigment = '=', $emptyKey = true): array
+ {
+ if ($text === null || $text === '') {
+ return []; //nothing to convert.
+ }
+ $chars = $text; // str_split($text);
+ $parts = [];
+ $nextpart = '';
+ $strL = strlen($chars);
+ $stringArr = '"\'¬';
+ $parenthesis = '([{';
+ $parenthesisClose = ')]}';
+ $insidePar = false;
+ for ($i = 0; $i < $strL; $i++) {
+ $char = $chars[$i];
+ // we check if the character is a parenthesis.
+ $pp = strpos($parenthesis, $char);
+ if ($pp !== false) {
+ // is a parenthesis, so we mark as inside a parenthesis.
+ $insidePar = $parenthesisClose[$pp];
+ }
+ if ($char === $insidePar) {
+ // we close the parenthesis.
+ $insidePar = false;
+ }
+ if (strpos($stringArr, $char) !== false) { // if ($char === '"' || $char === "'" || $char === "¬") {
+ // we found a string initializer
+ $inext = strpos($text, $char, $i + 1);
+ $inext = $inext === false ? $strL : $inext;
+ $nextpart .= substr($text, $i, $inext - $i + 1);
+ $i = $inext;
+ } else {
+ $nextpart .= $char;
+ }
+ if ($char === $separator && !$insidePar) {
+ $parts[] = substr($nextpart, 0, -1);
+ $nextpart = '';
+ }
+ }
+ if ($nextpart !== '') {
+ $parts[] = $nextpart;
+ }
+ $result = [];
+ // duct taping for key= argument (it has a space). however, it doesn't work with key =argument
+ /*
+ foreach ($parts as $k=>$part) {
+ if(substr($part,-1)===$assigment && isset($parts[$k+1])) {
+ var_dump('ok');
+ $parts[$k].=$parts[$k+1];
+ unset($parts[$k+1]);
+ }
+ }
+ */
+ foreach ($parts as $part) {
+ $part = trim($part);
+ if ($part) {
+ $char = $part[0];
+ if (strpos($stringArr, $char) !== false) { // if ($char === '"' || $char === "'" || $char === "¬") {
+ if ($emptyKey) {
+ $result[$part] = null;
+ } else {
+ $result[] = $part;
+ }
+ } else {
+ $r = explode($assigment, $part, 2);
+ if (count($r) === 2) {
+ // key=value.
+ $result[trim($r[0])] = trim($r[1]);
+ } elseif ($emptyKey) {
+ $result[trim($r[0])] = null;
+ } else {
+ $result[] = trim($r[0]);
+ }
+ }
+ }
+ }
+ return $result;
+ }
+
+ public function parseArgsOld($text, $separator = ','): array
+ {
+ if ($text === null || $text === '') {
+ return []; //nothing to convert.
+ }
+ $chars = str_split($text);
+ $parts = [];
+ $nextpart = '';
+ $strL = count($chars);
+ /** @noinspection ForeachInvariantsInspection */
+ for ($i = 0; $i < $strL; $i++) {
+ $char = $chars[$i];
+ if ($char === '"' || $char === "'") {
+ $inext = strpos($text, $char, $i + 1);
+ $inext = $inext === false ? $strL : $inext;
+ $nextpart .= substr($text, $i, $inext - $i + 1);
+ $i = $inext;
+ } else {
+ $nextpart .= $char;
+ }
+ if ($char === $separator) {
+ $parts[] = substr($nextpart, 0, -1);
+ $nextpart = '';
+ }
+ }
+ if ($nextpart !== '') {
+ $parts[] = $nextpart;
+ }
+ $result = [];
+ foreach ($parts as $part) {
+ $r = explode('=', $part, 2);
+ $result[trim($r[0])] = count($r) === 2 ? trim($r[1]) : null;
+ }
+ return $result;
+ }
+
+ /**
+ * Compile the "raw" echo statements.
+ *
+ * @param string $value
+ * @return string
+ */
+ protected function compileRawEchos($value): string
+ {
+ $pattern = \sprintf('/(@)?%s\s*(.+?)\s*%s(\r?\n)?/s', $this->rawTags[0], $this->rawTags[1]);
+ $callback = function ($matches) {
+ $whitespace = empty($matches[3]) ? '' : $matches[3] . $matches[3];
+ return $matches[1] ? \substr(
+ $matches[0],
+ 1
+ ) : $this->phpTagEcho . $this->compileEchoDefaults($matches[2]) . '; ?>' . $whitespace;
+ };
+ return \preg_replace_callback($pattern, $callback, $value);
+ }
+
+ /**
+ * Compile the default values for the echo statement.
+ * Example:
+ * {{ $test or 'test2' }} compiles to {{ isset($test) ? $test : 'test2' }}
+ *
+ * @param string $value
+ * @return string
+ */
+ protected function compileEchoDefaults($value): string
+ {
+ // Source: https://www.php.net/manual/en/language.variables.basics.php
+ $patternPHPVariableName = '\$[a-zA-Z_\x80-\xff][a-zA-Z0-9_\x80-\xff]*';
+
+ $result = \preg_replace('/^(' . $patternPHPVariableName . ')\s+or\s+(.+?)$/s', 'isset($1) ? $1 : $2', $value);
+ if (!$this->pipeEnable) {
+ return $this->fixNamespaceClass($result);
+ }
+ return $this->pipeDream($this->fixNamespaceClass($result));
+ }
+
+ /**
+ * It converts a string separated by pipes | into a filtered expression.+ * If the method exists (as directive), then it is used
+ * If the method exists (in this class) then it is used
+ * Otherwise, it uses a global function.
+ * If you want to escape the "|", then you could use "/|"
+ * Note: It only works if $this->pipeEnable=true and by default it is false
+ * Example:
+ *
+ * $this->pipeDream('$name | strtolower | substr:0,4'); // strtolower(substr($name ,0,4)
+ * $this->pipeDream('$name| getMode') // $this->getMode($name)
+ *
+ *
+ * @param string $result
+ * @return string
+ * @\eftec\bladeone\BladeOne::$pipeEnable
+ */
+ protected function pipeDream($result): string
+ {
+ $array = preg_split('~\\\\.(*SKIP)(*FAIL)|\|~s', $result);
+ $c = count($array) - 1; // base zero.
+ if ($c === 0) {
+ return $result;
+ }
+ $prev = '';
+ for ($i = 1; $i <=$c; $i++) {
+ $r = @explode(':', $array[$i], 2);
+ $fnName = trim($r[0]);
+ $fnNameF = $fnName[0]; // first character
+ if ($fnNameF === '"' || $fnNameF === '\'' || $fnNameF === '$' || is_numeric($fnNameF)) {
+ $fnName = '!isset(' . $array[0] . ') ? ' . $fnName . ' : ';
+ } elseif (isset($this->customDirectives[$fnName])) {
+ $fnName = '$this->customDirectives[\'' . $fnName . '\']';
+ } elseif (method_exists($this, $fnName)) {
+ $fnName = '$this->' . $fnName;
+ }
+ $hasArgument=count($r) === 2;
+ if ($i === 1) {
+ $prev = $fnName . '(' . $array[0];
+ if ($hasArgument) {
+ $prev .= ',' . $r[1];
+ }
+ $prev .= ')';
+ } else {
+ $prev = $fnName . '(' . $prev;
+ if ($hasArgument) {
+ $prev .=','. $r[1] . ')';
+ } else {
+ $prev.=')';
+ }
+ }
+ }
+
+ return $prev;
+ }
+
+ /**
+ * Compile the "regular" echo statements. {{ }}
+ *
+ * @param string $value
+ * @return string
+ */
+ protected function compileRegularEchos($value): string
+ {
+ $pattern = \sprintf('/(@)?%s\s*(.+?)\s*%s(\r?\n)?/s', $this->contentTags[0], $this->contentTags[1]);
+ $callback = function ($matches) {
+ $whitespace = empty($matches[3]) ? '' : $matches[3] . $matches[3];
+ $wrapped = \sprintf($this->echoFormat, $this->compileEchoDefaults($matches[2]));
+ return $matches[1] ? \substr($matches[0], 1) : $this->phpTagEcho . $wrapped . '; ?>' . $whitespace;
+ };
+ return \preg_replace_callback($pattern, $callback, $value);
+ }
+
+ /**
+ * Compile the escaped echo statements. {!! !!}
+ *
+ * @param string $value
+ * @return string
+ */
+ protected function compileEscapedEchos($value): string
+ {
+ $pattern = \sprintf('/(@)?%s\s*(.+?)\s*%s(\r?\n)?/s', $this->escapedTags[0], $this->escapedTags[1]);
+ $callback = function ($matches) {
+ $whitespace = empty($matches[3]) ? '' : $matches[3] . $matches[3];
+
+ return $matches[1] ? $matches[0] : $this->phpTag
+ . \sprintf($this->echoFormat, $this->compileEchoDefaults($matches[2])) . '; ?>'
+ . $whitespace;
+ //return $matches[1] ? $matches[0] : $this->phpTag
+ // . 'echo static::e(' . $this->compileEchoDefaults($matches[2]) . '); ? >' . $whitespace;
+ };
+ return \preg_replace_callback($pattern, $callback, $value);
+ }
+
+ /**
+ * Compile the "@each" tag into valid PHP.
+ *
+ * @param string $expression
+ * @return string
+ */
+ protected function compileEach($expression): string
+ {
+ return $this->phpTagEcho . "\$this->renderEach$expression; ?>";
+ }
+
+ protected function compileSet($expression): string
+ {
+ //$segments = \explode('=', \preg_replace("/[()\\\']/", '', $expression));
+ $segments = \explode('=', $this->stripParentheses($expression));
+ $value = (\count($segments) >= 2) ? '=@' . implode('=', array_slice($segments, 1)) : '++';
+ return $this->phpTag . \trim($segments[0]) . $value . ';?>';
+ }
+
+ /**
+ * Compile the yield statements into valid PHP.
+ *
+ * @param string $expression
+ * @return string
+ */
+ protected function compileYield($expression): string
+ {
+ return $this->phpTagEcho . "\$this->yieldContent$expression; ?>";
+ }
+
+ /**
+ * Compile the show statements into valid PHP.
+ *
+ * @return string
+ */
+ protected function compileShow(): string
+ {
+ return $this->phpTagEcho . '$this->yieldSection(); ?>';
+ }
+
+ /**
+ * Compile the section statements into valid PHP.
+ *
+ * @param string $expression
+ * @return string
+ */
+ protected function compileSection($expression): string
+ {
+ return $this->phpTag . "\$this->startSection$expression; ?>";
+ }
+
+ /**
+ * Compile the append statements into valid PHP.
+ *
+ * @return string
+ */
+ protected function compileAppend(): string
+ {
+ return $this->phpTag . '$this->appendSection(); ?>';
+ }
+
+ /**
+ * Compile the auth statements into valid PHP.
+ *
+ * @param string $expression
+ * @return string
+ */
+ protected function compileAuth($expression = ''): string
+ {
+ $role = $this->stripParentheses($expression);
+ if ($role == '') {
+ return $this->phpTag . 'if(isset($this->currentUser)): ?>';
+ }
+
+ return $this->phpTag . "if(isset(\$this->currentUser) && \$this->currentRole==$role): ?>";
+ }
+
+ /**
+ * Compile the elseauth statements into valid PHP.
+ *
+ * @param string $expression
+ * @return string
+ */
+ protected function compileElseAuth($expression = ''): string
+ {
+ $role = $this->stripParentheses($expression);
+ if ($role == '') {
+ return $this->phpTag . 'else: ?>';
+ }
+
+ return $this->phpTag . "elseif(isset(\$this->currentUser) && \$this->currentRole==$role): ?>";
+ }
+
+ /**
+ * Compile the end-auth statements into valid PHP.
+ *
+ * @return string
+ */
+ protected function compileEndAuth(): string
+ {
+ return $this->phpTag . 'endif; ?>';
+ }
+
+ protected function compileCan($expression): string
+ {
+ $v = $this->stripParentheses($expression);
+ return $this->phpTag . 'if (call_user_func($this->authCallBack,' . $v . ')): ?>';
+ }
+
+ /**
+ * Compile the else statements into valid PHP.
+ *
+ * @param string $expression
+ * @return string
+ */
+ protected function compileElseCan($expression = ''): string
+ {
+ $v = $this->stripParentheses($expression);
+ if ($v) {
+ return $this->phpTag . 'elseif (call_user_func($this->authCallBack,' . $v . ')): ?>';
+ }
+
+ return $this->phpTag . 'else: ?>';
+ }
+ //+ * It uses more disk space, but it decreases the number of includes
+ * + * @param $expression + * @return string + * @throws Exception + */ + protected function compileIncludeFast($expression): string + { + $expression = $this->stripParentheses($expression); + $ex = $this->stripParentheses($expression); + $exp = \explode(',', $ex); + $file = $this->stripQuotes($exp[0] ?? null); + $fileC = $this->getCompiledFile($file); + if (!@\is_file($fileC)) { + // if the file doesn't exist then it's created + $this->compile($file, true); + } + return $this->getFile($fileC); + } + + /** + * Compile the include statements into valid PHP. + * + * @param string $expression + * @return string + */ + protected function compileIncludeIf($expression): string + { + return $this->phpTag . 'if ($this->templateExist' . $expression . ') echo $this->runChild' . $expression . '; ?>'; + } + + /** + * Compile the include statements into valid PHP. + * + * @param string $expression + * @return string + */ + protected function compileIncludeWhen($expression): string + { + $expression = $this->stripParentheses($expression); + return $this->phpTagEcho . '$this->includeWhen(' . $expression . '); ?>'; + } + + /** + * Compile the includefirst statement + * + * @param string $expression + * @return string + */ + protected function compileIncludeFirst($expression): string + { + $expression = $this->stripParentheses($expression); + return $this->phpTagEcho . '$this->includeFirst(' . $expression . '); ?>'; + } + + /** + * Compile the {@}compilestamp statement. + * + * @param string $expression + * + * @return false|string + */ + protected function compileCompileStamp($expression) + { + $expression = $this->stripQuotes($this->stripParentheses($expression)); + $expression = ($expression === '') ? 'Y-m-d H:i:s' : $expression; + return date($expression); + } + + /** + * compile the {@}viewname statement
+ * {@}viewname('compiled') returns the full compiled path + * {@}viewname('template') returns the full template path + * {@}viewname('') returns the view name. + * + * @param mixed $expression + * + * @return string + */ + protected function compileViewName($expression): string + { + $expression = $this->stripQuotes($this->stripParentheses($expression)); + switch ($expression) { + case 'compiled': + return $this->getCompiledFile($this->fileName); + case 'template': + return $this->getTemplateFile($this->fileName); + default: + return $this->fileName; + } + } + + /** + * Compile the stack statements into the content. + * + * @param string $expression + * @return string + * @see BladeOne::yieldPushContent + */ + protected function compileStack($expression): string + { + return $this->phpTagEcho . "\$this->yieldPushContent$expression; ?>"; + } + + /** + * Compile the endpush statements into valid PHP. + * + * @return string + */ + protected function compileEndpush(): string + { + return $this->phpTag . '$this->stopPush(); ?>'; + } + + /** + * Compile the endpushonce statements into valid PHP. + * + * @return string + */ + protected function compileEndpushOnce(): string + { + return $this->phpTag . '$this->stopPush(); endif; ?>'; + } + + /** + * Compile the endpush statements into valid PHP. + * + * @return string + */ + protected function compileEndPrepend(): string + { + return $this->phpTag . '$this->stopPrepend(); ?>'; + } + + /** + * Compile the component statements into valid PHP. + * + * @param string $expression + * @return string + */ + protected function compileComponent($expression): string + { + return $this->phpTag . " \$this->startComponent$expression; ?>"; + } + + /** + * Compile the end-component statements into valid PHP. + * + * @return string + */ + protected function compileEndComponent(): string + { + return $this->phpTagEcho . '$this->renderComponent(); ?>'; + } + + /** + * Compile the slot statements into valid PHP. + * + * @param string $expression + * @return string + */ + protected function compileSlot($expression): string + { + return $this->phpTag . " \$this->slot$expression; ?>"; + } + + /** + * Compile the end-slot statements into valid PHP. + * + * @return string + */ + protected function compileEndSlot(): string + { + return $this->phpTag . ' $this->endSlot(); ?>'; + } + + protected function compileAsset($expression): string + { + return $this->phpTagEcho . "(isset(\$this->assetDict[$expression]))?\$this->assetDict[$expression]:\$this->baseUrl.'/'.$expression; ?>"; + } + + protected function compileJSon($expression): string + { + $parts = \explode(',', $this->stripParentheses($expression)); + $options = isset($parts[1]) ? \trim($parts[1]) : JSON_HEX_TAG | JSON_HEX_APOS | JSON_HEX_AMP | JSON_HEX_QUOT; + $depth = isset($parts[2]) ? \trim($parts[2]) : 512; + return $this->phpTagEcho . "json_encode($parts[0], $options, $depth); ?>"; + } + //
+ * if ($blade->cacheExpired('hellocache',1,5)) { //'helloonecache' =template, =1 id cache, 5=duration (seconds)
+ * // cache expired, so we should do some stuff (such as read from the database)
+ * }
+ *
+ *
+ * @package BladeOneCache
+ * @version 3.42 2020-04-25
+ * @link https://github.com/EFTEC/BladeOne
+ * @author Jorge Patricio Castro Castillo + * The cache log stores each time a template is creates or expired.
+ * + * @param string $file + */ + public function setCacheLog($file): void + { + $this->cacheLog=$file; + } + + public function writeCacheLog($txt, $nivel): void + { + if (!$this->cacheLog) { + return; // if there is not a file assigned then it skips saving. + } + $fz = @filesize($this->cacheLog); + if (is_object($txt) || is_array($txt)) { + $txt = print_r($txt, true); + } + // Rewrite file if more than 100000 bytes + $mode=($fz > 100000) ? 'w':'a'; + $fp = fopen($this->cacheLog, $mode); + if ($fp === false) { + return; + } + switch ($nivel) { + case 1: + $txtNivel='expired'; + break; + case 2: + $txtNivel='new'; + break; + default: + $txtNivel='other'; + } + $txtarg=json_encode($this->cacheUniqueGUID(false)); + fwrite($fp, date('c') . "\t$txt\t$txtNivel\t$txtarg\n"); + fclose($fp); + } + + /** + * It sets the strategy of the cache page. + * + * @param null|string $cacheStrategy =['get','post','getpost','request',null][$i] + * @param array|null $index if null then it reads all indexes. If not, it reads an indexes. + */ + public function setCacheStrategy($cacheStrategy, $index = null): void + { + $this->cacheStrategy = $cacheStrategy; + $this->cacheStrategyIndex = $index; + } + + /** + * It obtains a unique GUID based in:
+ * get= parameters from the url
+ * post= parameters sends via post
+ * getpost = a mix between get and post
+ * request = get, post and cookies (including sessions)
+ * MD5 could generate colisions (2^64 = 18,446,744,073,709,551,616) but the end hash is the sum of the hash of + * the page + this GUID. + * + * @param bool $serialize if true then it serializes using md5 + * @return string|null + */ + private function cacheUniqueGUID($serialize = true): ?string + { + switch ($this->cacheStrategy) { + case 'get': + $r = $_GET; + break; + case 'post': + $r = $_POST; + break; + case 'getpost': + $arr = array_merge($_GET, $_POST); + $r = $arr; + break; + case 'request': + $r = $_REQUEST; + break; + default: + $r = null; + } + if ($this->cacheStrategyIndex === null || !is_array($r)) { + $r= serialize($r); + } else { + $copy=[]; + foreach ($r as $key => $item) { + if (in_array($key, $this->cacheStrategyIndex, true)) { + $copy[$key]=$item; + } + } + $r=serialize($copy); + } + return $serialize===true ? md5($r): $r; + } + + public function compileCache($expression): string + { + // get id of template + // if the file exists then + // compare date. + // if the date is too old then re-save. + // else + // save for the first time. + + return $this->phpTag . "echo \$this->cacheStart$expression; if(!\$this->cacheRunning) { ?>"; + } + + public function compileEndCache($expression): string + { + return $this->phpTag . "} // if cacheRunning\necho \$this->cacheEnd$expression; ?>"; + } + + /** + * It gets the filename of the compiled file (cached). If cache is not enabled, then it + * returns the regular file. + * + * @param string $view + * @return string The full filename + */ + private function getCompiledFileCache($view): string + { + $id = $this->cacheUniqueGUID(); + if ($id !== null) { + return str_replace($this->compileExtension, '_cache' . $id + . $this->compileExtension, $this->getCompiledFile($view)); + } + return $this->getCompiledFile($view); + } + + /** + * run the blade engine. It returns the result of the code. + * + * @param string $view The name of the cache. Ex: "folder.folder.view" ("/folder/folder/view.blade") + * @param array $variables An associative arrays with the values to display. + * @param int $ttl time to live (in second). + * @return string + * @throws Exception + */ + public function runCache($view, $variables = [], $ttl = 86400): string + { + $this->cachePageRunning = true; + $cacheStatus=$this->cachePageExpired($view, $ttl); + if ($cacheStatus!==0) { + $this->writeCacheLog($view, $cacheStatus); + $this->cacheStart('_page_', $ttl); + $content = $this->run($view, $variables); // if no cache, then it runs normally. + $this->fileName = $view; // sometimes the filename is replaced (@include), so we restore it + $this->cacheEnd($content); // and it stores as a cache paged. + } else { + $content = $this->getFile($this->getCompiledFileCache($view)); + } + $this->cachePageRunning = false; + return $content; + } + + /** + * Returns true if the block cache expired (or doesn't exist), otherwise false. + * + * @param string $templateName name of the template to use (such hello for template hello.blade.php) + * @param string $id (id of cache, optional, if not id then it adds automatically a number) + * @param int $cacheDuration (duration of the cache in seconds) + * @return int 0=cache exists, 1= cache expired, 2=not exists, string= the cache file (if any) + */ + public function cacheExpired($templateName, $id, $cacheDuration): int + { + if ($this->getMode() & 1) { + return 2; // forced mode, hence it always expires. (fast mode is ignored). + } + $compiledFile = $this->getCompiledFile($templateName) . '_cache' . $id; + return $this->cacheExpiredInt($compiledFile, $cacheDuration); + } + + /** + * It returns true if the whole page expired. + * + * @param string $templateName + * @param int $cacheDuration is seconds. + * @return int 0=cache exists, 1= cache expired, 2=not exists, string= the cache content (if any) + */ + public function cachePageExpired($templateName, $cacheDuration): int + { + if ($this->getMode() & 1) { + return 2; // forced mode, hence it always expires. (fast mode is ignored). + } + $compiledFile = $this->getCompiledFileCache($templateName); + return $this->CacheExpiredInt($compiledFile, $cacheDuration); + } + + /** + * This method is used by cacheExpired() and cachePageExpired() + * + * @param string $compiledFile + * @param int $cacheDuration is seconds. + * @return int|mixed 0=cache exists, 1= cache expired, 2=not exists, string= the cache content (if any) + */ + private function cacheExpiredInt($compiledFile, $cacheDuration) + { + if (isset($this->cacheExpired[$compiledFile])) { + // if the information is already in the array then returns it. + return $this->cacheExpired[$compiledFile]; + } + $date = @filemtime($compiledFile); + if ($date) { + if ($date + $cacheDuration < time()) { + $this->cacheExpired[$compiledFile] = 1; + return 2; // time-out. + } + } else { + $this->cacheExpired[$compiledFile] = 2; + return 1; // no file + } + $this->cacheExpired[$compiledFile] = 0; + return 0; // cache active. + } + + public function cacheStart($id = '', $cacheDuration = 86400): void + { + $this->curCacheId = ($id == '') ? ($this->curCacheId + 1) : $id; + $this->curCacheDuration = $cacheDuration; + $this->curCachePosition = strlen(ob_get_contents()); + if ($this->cachePageRunning) { + $compiledFile = $this->getCompiledFileCache($this->fileName); + } else { + $compiledFile = $this->getCompiledFile() . '_cache' . $this->curCacheId; + } + + if ($this->cacheExpired('', $id, $cacheDuration) !==0) { + $this->cacheRunning = false; + } else { + $this->cacheRunning = true; + $content = $this->getFile($compiledFile); + echo $content; + } + } + + public function cacheEnd($txt = null): void + { + if (!$this->cacheRunning) { + $txt = $txt ?? substr(ob_get_contents(), $this->curCachePosition); + if ($this->cachePageRunning) { + $compiledFile = $this->getCompiledFileCache($this->fileName); + } else { + $compiledFile = $this->getCompiledFile() . '_cache' . $this->curCacheId; + } + file_put_contents($compiledFile, $txt); + } + $this->cacheRunning = false; + } +} diff --git a/M6/Dossier/emensa/vendor/eftec/bladeone/lib/BladeOneCacheRedis.php b/M6/Dossier/emensa/vendor/eftec/bladeone/lib/BladeOneCacheRedis.php new file mode 100644 index 0000000..42fe6db --- /dev/null +++ b/M6/Dossier/emensa/vendor/eftec/bladeone/lib/BladeOneCacheRedis.php @@ -0,0 +1,160 @@ + + * @ cache([cacheid],[duration=86400]). The id is optional. The duration of the cache is in seconds + * // content here + * @ endcache() + * + * It also adds a new function (optional) to the business or logic layer + *
+ * if ($blade->cacheExpired('hellocache',1,5)) { //'helloonecache' =template, =1 id cache, 5=duration (seconds)
+ * // cache expired, so we should do some stuff (such as read from the database)
+ * }
+ *
+ *
+ * @package BladeOneCacheRedis
+ * @version 0.1 2017-12-15 NOT YET IMPLEMENTED, ITS A WIP!!!!!!!!
+ * @link https://github.com/EFTEC/BladeOne
+ * @author Jorge Patricio Castro Castillo $title
+";
+ }
+ //
+}
diff --git a/M6/Dossier/emensa/vendor/eftec/bladeone/lib/bladeonecli b/M6/Dossier/emensa/vendor/eftec/bladeone/lib/bladeonecli
new file mode 100644
index 0000000..bb45532
--- /dev/null
+++ b/M6/Dossier/emensa/vendor/eftec/bladeone/lib/bladeonecli
@@ -0,0 +1,29 @@
+cliEngine();
+} else {
+ @http_response_code(404);
+}
+
diff --git a/M6/Dossier/emensa/views/anmeldung/anmeldung.blade.php b/M6/Dossier/emensa/views/anmeldung/anmeldung.blade.php
new file mode 100644
index 0000000..761eca9
--- /dev/null
+++ b/M6/Dossier/emensa/views/anmeldung/anmeldung.blade.php
@@ -0,0 +1,31 @@
+@extends("layouts.main_layout", ['title' => "E-Mensa"])
+
+@section("header")
+
+@endsection
+
+@section("nav")
+
+ (c) E-Mensa GmbH
+ Şafak Hazinedar & Robert Joel
+ Impressum
+
+
+@endsection
\ No newline at end of file
diff --git a/M6/Dossier/emensa/views/debug.blade.php b/M6/Dossier/emensa/views/debug.blade.php
new file mode 100644
index 0000000..b6eab46
--- /dev/null
+++ b/M6/Dossier/emensa/views/debug.blade.php
@@ -0,0 +1,6 @@
+Beispiel: Daten aus der Datenbank
+
+
+
+
+@if (isset($data['error']))
+
+
+@endif
+
+
\ No newline at end of file
diff --git a/M6/Dossier/emensa/views/demo/demo.blade.php b/M6/Dossier/emensa/views/demo/demo.blade.php
new file mode 100644
index 0000000..cb2c5fd
--- /dev/null
+++ b/M6/Dossier/emensa/views/demo/demo.blade.php
@@ -0,0 +1,92 @@
+@extends(".layouts.layout")
+
+@section("content")
+ 7a
+
+
+
+Der Wert von name lautet: {{$request}}
+
+
+
+
\ No newline at end of file
diff --git a/M6/Dossier/emensa/views/examples/m4_7b_kategorie.blade.php b/M6/Dossier/emensa/views/examples/m4_7b_kategorie.blade.php
new file mode 100644
index 0000000..1d4946d
--- /dev/null
+++ b/M6/Dossier/emensa/views/examples/m4_7b_kategorie.blade.php
@@ -0,0 +1,41 @@
+
+
+
+
+ Beispiel: Daten aus der Datenbank
+
+
+
+
+
+@if (isset($data['error']))
+
+
+@endif
+
+
+
\ No newline at end of file
diff --git a/M6/Dossier/emensa/views/examples/m4_7c_gerichte.blade.php b/M6/Dossier/emensa/views/examples/m4_7c_gerichte.blade.php
new file mode 100644
index 0000000..2f9c073
--- /dev/null
+++ b/M6/Dossier/emensa/views/examples/m4_7c_gerichte.blade.php
@@ -0,0 +1,34 @@
+
+
+
+
+ Beispiel: Daten aus der Datenbank
+
+
+
+
+@if (isset($data['error']))
+
+
+@endif
+
+
+
\ No newline at end of file
diff --git a/M6/Dossier/emensa/views/examples/pages/m4_7d_page_1.blade.php b/M6/Dossier/emensa/views/examples/pages/m4_7d_page_1.blade.php
new file mode 100644
index 0000000..75af2b7
--- /dev/null
+++ b/M6/Dossier/emensa/views/examples/pages/m4_7d_page_1.blade.php
@@ -0,0 +1,13 @@
+@extends(".layouts.m4_7d_layout",['title' => "Page 1"])
+
+@section("header")
+
+@endsection
+
+@section("body")
+
+
+
+
+
+@endsection
+
+@section("cssextra")
+
+@endsection
+
+@section("jsextra")
+
+@endsection
\ No newline at end of file
diff --git a/M6/Dossier/emensa/views/layouts/layout.blade.php b/M6/Dossier/emensa/views/layouts/layout.blade.php
new file mode 100644
index 0000000..fa03e70
--- /dev/null
+++ b/M6/Dossier/emensa/views/layouts/layout.blade.php
@@ -0,0 +1,23 @@
+
+
+
+
+ E-Mensa Routing Script
+
+
+
+ @yield("cssextra")
+
+
+
+
+{{ $title }}
+
+ @yield("header")
+
+
+
+
+ @yield("body")
+
+
+
+
\ No newline at end of file
diff --git a/M6/Dossier/emensa/views/layouts/main_layout.blade.php b/M6/Dossier/emensa/views/layouts/main_layout.blade.php
new file mode 100644
index 0000000..aba28e5
--- /dev/null
+++ b/M6/Dossier/emensa/views/layouts/main_layout.blade.php
@@ -0,0 +1,30 @@
+
+
+
+
+
+ {{ $title }}
+
+ @yield("header")
+
+
+
+
+@yield("nav")
+
+
+
+ Bitte warten! + +@endsection \ No newline at end of file diff --git a/M6/Dossier/emensa/views/m5_a1/layout_anmeldung.blade.php b/M6/Dossier/emensa/views/m5_a1/layout_anmeldung.blade.php new file mode 100644 index 0000000..c230204 --- /dev/null +++ b/M6/Dossier/emensa/views/m5_a1/layout_anmeldung.blade.php @@ -0,0 +1,21 @@ + + + + +Layout-m5-a1
+
+
+
+ @yield("header")
+
+
+
+ @yield("main")
+
+
+
+
+
+
\ No newline at end of file
diff --git a/M6/Dossier/emensa/views/main/index.blade.php b/M6/Dossier/emensa/views/main/index.blade.php
new file mode 100644
index 0000000..60c90b2
--- /dev/null
+++ b/M6/Dossier/emensa/views/main/index.blade.php
@@ -0,0 +1,111 @@
+@extends("layouts.main_layout", ['title' => "E-Mensa"])
+
+@section("header")
+
+@endsection
+
+@section("nav")
+
+ Gerichte Preis intern Preis extern Bild ";
+
+
+
+ while ($row_gerichte = mysqli_fetch_assoc($result_sql_gerichte)) {
+
+ $preisintern = number_format($row_gerichte['preisintern'], 2, ',', '.');
+ $preisextern = number_format($row_gerichte['preisextern'], 2, ',', '.');
+
+ $bildname = $row_gerichte['bildname'];
+
+ if ($bildname == Null) {
+ $bildname = "00_image_missing.jpg";
+ }
+
+ $bildname = "/img/gerichte/" . $bildname;
+
+ $tabelle .= "" . htmlspecialchars($row_gerichte['name']) . " " . htmlspecialchars($allergene) . " " . htmlspecialchars($preisintern) . "€ " . htmlspecialchars($preisextern) . "€ ![\"Bild](\"")
+ (c) E-Mensa GmbH
+ Şafak Hazinedar & Robert Joel
+ Impressum
+
+
+@endsection
\ No newline at end of file
diff --git a/M6/Dossier/emensa/views/notimplemented.blade.php b/M6/Dossier/emensa/views/notimplemented.blade.php
new file mode 100644
index 0000000..0834730
--- /dev/null
+++ b/M6/Dossier/emensa/views/notimplemented.blade.php
@@ -0,0 +1,7 @@
+@extends("layouts.layout")
+
+@section("content")
+'
+ 'password' => 'admin', // ''
+ 'database' => 'emensawerbeseite',
+ // optionally: set port below if it differs from the default 3306
+ // 'port' => 13306 // !! this is not your webserver port, but the mariadb port
+];
diff --git a/M6/emensa/controllers/AnmeldungController.php b/M6/emensa/controllers/AnmeldungController.php
new file mode 100644
index 0000000..d921f3a
--- /dev/null
+++ b/M6/emensa/controllers/AnmeldungController.php
@@ -0,0 +1,75 @@
+getPostData();
+
+ $email = $data["email"] ?? NULL;
+ $passwort = $data["passwort"] ?? NULL;
+
+ $anmeldung = anmelden($email, sha1($passwort));
+
+ if($anmeldung){
+
+ $log = logger('anmeldung', '../storage/logs');
+ $log->info('Anmeldung erfolgreich!');
+ }
+ else{
+
+ $log = logger('anmeldung', '../storage/logs');
+ $log->warning('Anmeldung fehlgeschlagen!');
+ }
+
+ return view(
+ 'm5_a1.anmeldung_verifizieren',
+ [
+ 'email' => $email,
+ 'passwort' => $passwort,
+ 'anmeldung' => $anmeldung
+ ]
+ );
+ }
+
+ public function check(RequestData $rd){
+
+ $data = $rd->getPostData();
+
+ $email = $data["email"] ?? NULL;
+ $passwort = $data["passwort"] ?? NULL;
+ $anmeldung = $data["anmeldung"] ?? NULL;
+
+ return view(
+ 'm5_a1.anmeldung',
+ [
+ 'email' => $email,
+ 'passwort' => $passwort,
+ 'anmeldung' => $anmeldung,
+ 'data' => $data
+ ]
+ );
+ }
+
+
+ function abmelden(){
+
+ session_unset();
+ session_destroy();
+
+ $log = logger('anmeldung', '../storage/logs');
+ $log->info('Abmeldung erfolgreich!');
+
+ return view('m5_a1.abmeldung', []);
+ }
+}
\ No newline at end of file
diff --git a/M6/emensa/controllers/DemoController.php b/M6/emensa/controllers/DemoController.php
new file mode 100644
index 0000000..e6dc313
--- /dev/null
+++ b/M6/emensa/controllers/DemoController.php
@@ -0,0 +1,36 @@
+ $data]);
+ }
+
+ public function demo(RequestData $rd) {
+ $vars = [
+ 'bgcolor' => $rd->query['bgcolor'] ?? 'ffffff',
+ 'name' => $rd->query['name'] ?? 'Dich',
+ 'rd' => $rd
+ ];
+ return view('demo.demo', $vars);
+ }
+
+ /**
+ * error action for debug purposes
+ * @throws Exception
+ * @noinspection PhpUnusedLocalVariableInspection
+ */
+ public function error(RequestData $rd) {
+ $test = $rd;
+ throw new Exception("Not implemented");
+ }
+
+ public function requestdata(RequestData $rd) {
+ return view('demo.requestdata', ['rd' => $rd]);
+ }
+}
\ No newline at end of file
diff --git a/M6/emensa/controllers/ExampleController.php b/M6/emensa/controllers/ExampleController.php
new file mode 100644
index 0000000..24f78f9
--- /dev/null
+++ b/M6/emensa/controllers/ExampleController.php
@@ -0,0 +1,47 @@
+query['name'] ?? 'Kein Name angegeben';
+
+ return view('examples.m4_7a_queryparameter', [
+ 'request'=>$rd,
+ 'url' => 'http' . (isset($_SERVER['HTTPS']) ? 's' : '') . '://' . "{$_SERVER['HTTP_HOST']}{$_SERVER['REQUEST_URI']}"
+ ]);
+ }
+
+
+ public function m4_7b_kategorie() {
+ $data = db_kategorie_select_all();
+
+ return view('examples.m4_7b_kategorie', [
+ 'data'=>$data,
+ ]);
+ }
+
+
+ public function m4_7c_gerichte() {
+ $data = db_gericht_select_intern();
+
+ return view('examples.m4_7c_gerichte', [
+ 'data'=>$data,
+ ]);
+ }
+
+ public function m4_7d(RequestData $rd) {
+
+ $rd = $rd->query['no'] ?? 1;
+ if ($rd == 1)
+ return view('examples.pages.m4_7d_page_1', []);
+ elseif ($rd == 2)
+ return view('examples.pages.m4_7d_page_2', []);
+ }
+}
\ No newline at end of file
diff --git a/M6/emensa/controllers/HomeController.php b/M6/emensa/controllers/HomeController.php
new file mode 100644
index 0000000..966a622
--- /dev/null
+++ b/M6/emensa/controllers/HomeController.php
@@ -0,0 +1,14 @@
+ $request ]);
+ }
+
+ public function debug(RequestData $request) {
+ return view('debug');
+ }
+}
\ No newline at end of file
diff --git a/M6/emensa/controllers/MainController.php b/M6/emensa/controllers/MainController.php
new file mode 100644
index 0000000..ff882a1
--- /dev/null
+++ b/M6/emensa/controllers/MainController.php
@@ -0,0 +1,23 @@
+$data,
+ 'url' => 'http' . (isset($_SERVER['HTTPS']) ? 's' : '') . '://' . "{$_SERVER['HTTP_HOST']}{$_SERVER['REQUEST_URI']}"
+ ]);
+ }
+
+}
\ No newline at end of file
diff --git a/M6/emensa/models/benutzer.php b/M6/emensa/models/benutzer.php
new file mode 100644
index 0000000..263b19d
--- /dev/null
+++ b/M6/emensa/models/benutzer.php
@@ -0,0 +1,51 @@
+query($sql);
+ $row = $result->fetch_assoc();
+
+ if ($row['passwort'] == NULL) {
+ $row = 0;
+ } elseif ($row['passwort'] == $passwort) {
+ session_start();
+
+ mysqli_begin_transaction($link);
+ $sql = "UPDATE benutzer
+ SET letzteanmeldung = current_time, anzahlfehler = 0
+ WHERE email = '$email'";
+ $link->query($sql);
+
+
+ // $sql = "UPDATE benutzer SET anzahlanmeldungen = anzahlanmeldungen + 1 WHERE id = " . $row['id'];
+ $sql = "CALL incrementAnzahlAnmeldungen(" . ($row['id']) . ")";
+ $link->query($sql);
+
+ mysqli_commit($link);
+
+ $_SESSION['uid'] = session_id();
+ $_SESSION['login'] = 1;
+ $_SESSION['name'] = $row['name'];
+ $_SESSION['email'] = $row['email'];
+ return 1;
+ } else {
+
+ mysqli_begin_transaction($link);
+
+ $sql = "UPDATE benutzer
+ SET anzahlfehler = anzahlfehler+1, letzterfehler = current_time
+ WHERE email = '$email'";
+ $link->query($sql);
+
+ mysqli_commit($link);
+
+ }
+ return 0;
+}
\ No newline at end of file
diff --git a/M6/emensa/models/gericht.php b/M6/emensa/models/gericht.php
new file mode 100644
index 0000000..e6ee37f
--- /dev/null
+++ b/M6/emensa/models/gericht.php
@@ -0,0 +1,27 @@
+'-1',
+ 'error'=>true,
+ 'name' => 'Datenbankfehler '.$ex->getCode(),
+ 'beschreibung' => $ex->getMessage());
+ }
+ finally {
+ return $data;
+ }
+
+}
diff --git a/M6/emensa/models/gerichte_main.php b/M6/emensa/models/gerichte_main.php
new file mode 100644
index 0000000..db2c87a
--- /dev/null
+++ b/M6/emensa/models/gerichte_main.php
@@ -0,0 +1,61 @@
+ $verwendete_allergene_string,
+ "result_sql_allergen" => $result_sql_allergen,
+ "verwendete_allergene_code" => $verwendete_allergene_code,
+ "result_sql_gerichte" => $result_sql_gerichte1,
+ "allergene1" => $allergene
+ ];
+
+
+ mysqli_close($link);
+
+ return $data;
+ } catch (Exception $ex) {
+ $data = array(
+ 'id' => '-1',
+ 'error' => true,
+ 'name' => 'Datenbankfehler ' . $ex->getCode(),
+ 'beschreibung' => $ex->getMessage());
+ return $data;
+ }
+}
\ No newline at end of file
diff --git a/M6/emensa/models/gerichte_self.php b/M6/emensa/models/gerichte_self.php
new file mode 100644
index 0000000..c9bc76c
--- /dev/null
+++ b/M6/emensa/models/gerichte_self.php
@@ -0,0 +1,23 @@
+ 2 ORDER BY name DESC';
+ $result = mysqli_query($link, $sql);
+
+ $data = mysqli_fetch_all($result, MYSQLI_BOTH);
+
+ mysqli_close($link);
+ } catch (Exception $ex) {
+ $data = array(
+ 'id' => '-1',
+ 'error' => true,
+ 'name' => 'Datenbankfehler ' . $ex->getCode(),
+ 'beschreibung' => $ex->getMessage());
+ } finally {
+ return $data;
+ }
+}
\ No newline at end of file
diff --git a/M6/emensa/models/kategorie.php b/M6/emensa/models/kategorie.php
new file mode 100644
index 0000000..f9bc3c3
--- /dev/null
+++ b/M6/emensa/models/kategorie.php
@@ -0,0 +1,15 @@
+code{color:inherit}kbd{padding:.1875rem .375rem;font-size:.875em;color:var(--bs-body-bg);background-color:var(--bs-body-color);border-radius:.25rem}kbd kbd{padding:0;font-size:1em}figure{margin:0 0 1rem}img,svg{vertical-align:middle}table{caption-side:bottom;border-collapse:collapse}caption{padding-top:.5rem;padding-bottom:.5rem;color:var(--bs-secondary-color);text-align:left}th{text-align:inherit;text-align:-webkit-match-parent}tbody,td,tfoot,th,thead,tr{border-color:inherit;border-style:solid;border-width:0}label{display:inline-block}button{border-radius:0}button:focus:not(:focus-visible){outline:0}button,input,optgroup,select,textarea{margin:0;font-family:inherit;font-size:inherit;line-height:inherit}button,select{text-transform:none}[role=button]{cursor:pointer}select{word-wrap:normal}select:disabled{opacity:1}[list]:not([type=date]):not([type=datetime-local]):not([type=month]):not([type=week]):not([type=time])::-webkit-calendar-picker-indicator{display:none!important}[type=button],[type=reset],[type=submit],button{-webkit-appearance:button}[type=button]:not(:disabled),[type=reset]:not(:disabled),[type=submit]:not(:disabled),button:not(:disabled){cursor:pointer}::-moz-focus-inner{padding:0;border-style:none}textarea{resize:vertical}fieldset{min-width:0;padding:0;margin:0;border:0}legend{float:left;width:100%;padding:0;margin-bottom:.5rem;font-size:calc(1.275rem + .3vw);line-height:inherit}@media (min-width:1200px){legend{font-size:1.5rem}}legend+*{clear:left}::-webkit-datetime-edit-day-field,::-webkit-datetime-edit-fields-wrapper,::-webkit-datetime-edit-hour-field,::-webkit-datetime-edit-minute,::-webkit-datetime-edit-month-field,::-webkit-datetime-edit-text,::-webkit-datetime-edit-year-field{padding:0}::-webkit-inner-spin-button{height:auto}[type=search]{-webkit-appearance:textfield;outline-offset:-2px}::-webkit-search-decoration{-webkit-appearance:none}::-webkit-color-swatch-wrapper{padding:0}::-webkit-file-upload-button{font:inherit;-webkit-appearance:button}::file-selector-button{font:inherit;-webkit-appearance:button}output{display:inline-block}iframe{border:0}summary{display:list-item;cursor:pointer}progress{vertical-align:baseline}[hidden]{display:none!important}.lead{font-size:1.25rem;font-weight:300}.display-1{font-size:calc(1.625rem + 4.5vw);font-weight:300;line-height:1.2}@media (min-width:1200px){.display-1{font-size:5rem}}.display-2{font-size:calc(1.575rem + 3.9vw);font-weight:300;line-height:1.2}@media (min-width:1200px){.display-2{font-size:4.5rem}}.display-3{font-size:calc(1.525rem + 3.3vw);font-weight:300;line-height:1.2}@media (min-width:1200px){.display-3{font-size:4rem}}.display-4{font-size:calc(1.475rem + 2.7vw);font-weight:300;line-height:1.2}@media (min-width:1200px){.display-4{font-size:3.5rem}}.display-5{font-size:calc(1.425rem + 2.1vw);font-weight:300;line-height:1.2}@media (min-width:1200px){.display-5{font-size:3rem}}.display-6{font-size:calc(1.375rem + 1.5vw);font-weight:300;line-height:1.2}@media (min-width:1200px){.display-6{font-size:2.5rem}}.list-unstyled{padding-left:0;list-style:none}.list-inline{padding-left:0;list-style:none}.list-inline-item{display:inline-block}.list-inline-item:not(:last-child){margin-right:.5rem}.initialism{font-size:.875em;text-transform:uppercase}.blockquote{margin-bottom:1rem;font-size:1.25rem}.blockquote>:last-child{margin-bottom:0}.blockquote-footer{margin-top:-1rem;margin-bottom:1rem;font-size:.875em;color:#6c757d}.blockquote-footer::before{content:"— "}.img-fluid{max-width:100%;height:auto}.img-thumbnail{padding:.25rem;background-color:var(--bs-body-bg);border:var(--bs-border-width) solid var(--bs-border-color);border-radius:var(--bs-border-radius);max-width:100%;height:auto}.figure{display:inline-block}.figure-img{margin-bottom:.5rem;line-height:1}.figure-caption{font-size:.875em;color:var(--bs-secondary-color)}.container,.container-fluid,.container-lg,.container-md,.container-sm,.container-xl,.container-xxl{--bs-gutter-x:1.5rem;--bs-gutter-y:0;width:100%;padding-right:calc(var(--bs-gutter-x) * .5);padding-left:calc(var(--bs-gutter-x) * .5);margin-right:auto;margin-left:auto}@media (min-width:576px){.container,.container-sm{max-width:540px}}@media (min-width:768px){.container,.container-md,.container-sm{max-width:720px}}@media (min-width:992px){.container,.container-lg,.container-md,.container-sm{max-width:960px}}@media (min-width:1200px){.container,.container-lg,.container-md,.container-sm,.container-xl{max-width:1140px}}@media (min-width:1400px){.container,.container-lg,.container-md,.container-sm,.container-xl,.container-xxl{max-width:1320px}}:root{--bs-breakpoint-xs:0;--bs-breakpoint-sm:576px;--bs-breakpoint-md:768px;--bs-breakpoint-lg:992px;--bs-breakpoint-xl:1200px;--bs-breakpoint-xxl:1400px}.row{--bs-gutter-x:1.5rem;--bs-gutter-y:0;display:flex;flex-wrap:wrap;margin-top:calc(-1 * var(--bs-gutter-y));margin-right:calc(-.5 * var(--bs-gutter-x));margin-left:calc(-.5 * var(--bs-gutter-x))}.row>*{flex-shrink:0;width:100%;max-width:100%;padding-right:calc(var(--bs-gutter-x) * .5);padding-left:calc(var(--bs-gutter-x) * .5);margin-top:var(--bs-gutter-y)}.col{flex:1 0 0%}.row-cols-auto>*{flex:0 0 auto;width:auto}.row-cols-1>*{flex:0 0 auto;width:100%}.row-cols-2>*{flex:0 0 auto;width:50%}.row-cols-3>*{flex:0 0 auto;width:33.33333333%}.row-cols-4>*{flex:0 0 auto;width:25%}.row-cols-5>*{flex:0 0 auto;width:20%}.row-cols-6>*{flex:0 0 auto;width:16.66666667%}.col-auto{flex:0 0 auto;width:auto}.col-1{flex:0 0 auto;width:8.33333333%}.col-2{flex:0 0 auto;width:16.66666667%}.col-3{flex:0 0 auto;width:25%}.col-4{flex:0 0 auto;width:33.33333333%}.col-5{flex:0 0 auto;width:41.66666667%}.col-6{flex:0 0 auto;width:50%}.col-7{flex:0 0 auto;width:58.33333333%}.col-8{flex:0 0 auto;width:66.66666667%}.col-9{flex:0 0 auto;width:75%}.col-10{flex:0 0 auto;width:83.33333333%}.col-11{flex:0 0 auto;width:91.66666667%}.col-12{flex:0 0 auto;width:100%}.offset-1{margin-left:8.33333333%}.offset-2{margin-left:16.66666667%}.offset-3{margin-left:25%}.offset-4{margin-left:33.33333333%}.offset-5{margin-left:41.66666667%}.offset-6{margin-left:50%}.offset-7{margin-left:58.33333333%}.offset-8{margin-left:66.66666667%}.offset-9{margin-left:75%}.offset-10{margin-left:83.33333333%}.offset-11{margin-left:91.66666667%}.g-0,.gx-0{--bs-gutter-x:0}.g-0,.gy-0{--bs-gutter-y:0}.g-1,.gx-1{--bs-gutter-x:0.25rem}.g-1,.gy-1{--bs-gutter-y:0.25rem}.g-2,.gx-2{--bs-gutter-x:0.5rem}.g-2,.gy-2{--bs-gutter-y:0.5rem}.g-3,.gx-3{--bs-gutter-x:1rem}.g-3,.gy-3{--bs-gutter-y:1rem}.g-4,.gx-4{--bs-gutter-x:1.5rem}.g-4,.gy-4{--bs-gutter-y:1.5rem}.g-5,.gx-5{--bs-gutter-x:3rem}.g-5,.gy-5{--bs-gutter-y:3rem}@media (min-width:576px){.col-sm{flex:1 0 0%}.row-cols-sm-auto>*{flex:0 0 auto;width:auto}.row-cols-sm-1>*{flex:0 0 auto;width:100%}.row-cols-sm-2>*{flex:0 0 auto;width:50%}.row-cols-sm-3>*{flex:0 0 auto;width:33.33333333%}.row-cols-sm-4>*{flex:0 0 auto;width:25%}.row-cols-sm-5>*{flex:0 0 auto;width:20%}.row-cols-sm-6>*{flex:0 0 auto;width:16.66666667%}.col-sm-auto{flex:0 0 auto;width:auto}.col-sm-1{flex:0 0 auto;width:8.33333333%}.col-sm-2{flex:0 0 auto;width:16.66666667%}.col-sm-3{flex:0 0 auto;width:25%}.col-sm-4{flex:0 0 auto;width:33.33333333%}.col-sm-5{flex:0 0 auto;width:41.66666667%}.col-sm-6{flex:0 0 auto;width:50%}.col-sm-7{flex:0 0 auto;width:58.33333333%}.col-sm-8{flex:0 0 auto;width:66.66666667%}.col-sm-9{flex:0 0 auto;width:75%}.col-sm-10{flex:0 0 auto;width:83.33333333%}.col-sm-11{flex:0 0 auto;width:91.66666667%}.col-sm-12{flex:0 0 auto;width:100%}.offset-sm-0{margin-left:0}.offset-sm-1{margin-left:8.33333333%}.offset-sm-2{margin-left:16.66666667%}.offset-sm-3{margin-left:25%}.offset-sm-4{margin-left:33.33333333%}.offset-sm-5{margin-left:41.66666667%}.offset-sm-6{margin-left:50%}.offset-sm-7{margin-left:58.33333333%}.offset-sm-8{margin-left:66.66666667%}.offset-sm-9{margin-left:75%}.offset-sm-10{margin-left:83.33333333%}.offset-sm-11{margin-left:91.66666667%}.g-sm-0,.gx-sm-0{--bs-gutter-x:0}.g-sm-0,.gy-sm-0{--bs-gutter-y:0}.g-sm-1,.gx-sm-1{--bs-gutter-x:0.25rem}.g-sm-1,.gy-sm-1{--bs-gutter-y:0.25rem}.g-sm-2,.gx-sm-2{--bs-gutter-x:0.5rem}.g-sm-2,.gy-sm-2{--bs-gutter-y:0.5rem}.g-sm-3,.gx-sm-3{--bs-gutter-x:1rem}.g-sm-3,.gy-sm-3{--bs-gutter-y:1rem}.g-sm-4,.gx-sm-4{--bs-gutter-x:1.5rem}.g-sm-4,.gy-sm-4{--bs-gutter-y:1.5rem}.g-sm-5,.gx-sm-5{--bs-gutter-x:3rem}.g-sm-5,.gy-sm-5{--bs-gutter-y:3rem}}@media (min-width:768px){.col-md{flex:1 0 0%}.row-cols-md-auto>*{flex:0 0 auto;width:auto}.row-cols-md-1>*{flex:0 0 auto;width:100%}.row-cols-md-2>*{flex:0 0 auto;width:50%}.row-cols-md-3>*{flex:0 0 auto;width:33.33333333%}.row-cols-md-4>*{flex:0 0 auto;width:25%}.row-cols-md-5>*{flex:0 0 auto;width:20%}.row-cols-md-6>*{flex:0 0 auto;width:16.66666667%}.col-md-auto{flex:0 0 auto;width:auto}.col-md-1{flex:0 0 auto;width:8.33333333%}.col-md-2{flex:0 0 auto;width:16.66666667%}.col-md-3{flex:0 0 auto;width:25%}.col-md-4{flex:0 0 auto;width:33.33333333%}.col-md-5{flex:0 0 auto;width:41.66666667%}.col-md-6{flex:0 0 auto;width:50%}.col-md-7{flex:0 0 auto;width:58.33333333%}.col-md-8{flex:0 0 auto;width:66.66666667%}.col-md-9{flex:0 0 auto;width:75%}.col-md-10{flex:0 0 auto;width:83.33333333%}.col-md-11{flex:0 0 auto;width:91.66666667%}.col-md-12{flex:0 0 auto;width:100%}.offset-md-0{margin-left:0}.offset-md-1{margin-left:8.33333333%}.offset-md-2{margin-left:16.66666667%}.offset-md-3{margin-left:25%}.offset-md-4{margin-left:33.33333333%}.offset-md-5{margin-left:41.66666667%}.offset-md-6{margin-left:50%}.offset-md-7{margin-left:58.33333333%}.offset-md-8{margin-left:66.66666667%}.offset-md-9{margin-left:75%}.offset-md-10{margin-left:83.33333333%}.offset-md-11{margin-left:91.66666667%}.g-md-0,.gx-md-0{--bs-gutter-x:0}.g-md-0,.gy-md-0{--bs-gutter-y:0}.g-md-1,.gx-md-1{--bs-gutter-x:0.25rem}.g-md-1,.gy-md-1{--bs-gutter-y:0.25rem}.g-md-2,.gx-md-2{--bs-gutter-x:0.5rem}.g-md-2,.gy-md-2{--bs-gutter-y:0.5rem}.g-md-3,.gx-md-3{--bs-gutter-x:1rem}.g-md-3,.gy-md-3{--bs-gutter-y:1rem}.g-md-4,.gx-md-4{--bs-gutter-x:1.5rem}.g-md-4,.gy-md-4{--bs-gutter-y:1.5rem}.g-md-5,.gx-md-5{--bs-gutter-x:3rem}.g-md-5,.gy-md-5{--bs-gutter-y:3rem}}@media (min-width:992px){.col-lg{flex:1 0 0%}.row-cols-lg-auto>*{flex:0 0 auto;width:auto}.row-cols-lg-1>*{flex:0 0 auto;width:100%}.row-cols-lg-2>*{flex:0 0 auto;width:50%}.row-cols-lg-3>*{flex:0 0 auto;width:33.33333333%}.row-cols-lg-4>*{flex:0 0 auto;width:25%}.row-cols-lg-5>*{flex:0 0 auto;width:20%}.row-cols-lg-6>*{flex:0 0 auto;width:16.66666667%}.col-lg-auto{flex:0 0 auto;width:auto}.col-lg-1{flex:0 0 auto;width:8.33333333%}.col-lg-2{flex:0 0 auto;width:16.66666667%}.col-lg-3{flex:0 0 auto;width:25%}.col-lg-4{flex:0 0 auto;width:33.33333333%}.col-lg-5{flex:0 0 auto;width:41.66666667%}.col-lg-6{flex:0 0 auto;width:50%}.col-lg-7{flex:0 0 auto;width:58.33333333%}.col-lg-8{flex:0 0 auto;width:66.66666667%}.col-lg-9{flex:0 0 auto;width:75%}.col-lg-10{flex:0 0 auto;width:83.33333333%}.col-lg-11{flex:0 0 auto;width:91.66666667%}.col-lg-12{flex:0 0 auto;width:100%}.offset-lg-0{margin-left:0}.offset-lg-1{margin-left:8.33333333%}.offset-lg-2{margin-left:16.66666667%}.offset-lg-3{margin-left:25%}.offset-lg-4{margin-left:33.33333333%}.offset-lg-5{margin-left:41.66666667%}.offset-lg-6{margin-left:50%}.offset-lg-7{margin-left:58.33333333%}.offset-lg-8{margin-left:66.66666667%}.offset-lg-9{margin-left:75%}.offset-lg-10{margin-left:83.33333333%}.offset-lg-11{margin-left:91.66666667%}.g-lg-0,.gx-lg-0{--bs-gutter-x:0}.g-lg-0,.gy-lg-0{--bs-gutter-y:0}.g-lg-1,.gx-lg-1{--bs-gutter-x:0.25rem}.g-lg-1,.gy-lg-1{--bs-gutter-y:0.25rem}.g-lg-2,.gx-lg-2{--bs-gutter-x:0.5rem}.g-lg-2,.gy-lg-2{--bs-gutter-y:0.5rem}.g-lg-3,.gx-lg-3{--bs-gutter-x:1rem}.g-lg-3,.gy-lg-3{--bs-gutter-y:1rem}.g-lg-4,.gx-lg-4{--bs-gutter-x:1.5rem}.g-lg-4,.gy-lg-4{--bs-gutter-y:1.5rem}.g-lg-5,.gx-lg-5{--bs-gutter-x:3rem}.g-lg-5,.gy-lg-5{--bs-gutter-y:3rem}}@media (min-width:1200px){.col-xl{flex:1 0 0%}.row-cols-xl-auto>*{flex:0 0 auto;width:auto}.row-cols-xl-1>*{flex:0 0 auto;width:100%}.row-cols-xl-2>*{flex:0 0 auto;width:50%}.row-cols-xl-3>*{flex:0 0 auto;width:33.33333333%}.row-cols-xl-4>*{flex:0 0 auto;width:25%}.row-cols-xl-5>*{flex:0 0 auto;width:20%}.row-cols-xl-6>*{flex:0 0 auto;width:16.66666667%}.col-xl-auto{flex:0 0 auto;width:auto}.col-xl-1{flex:0 0 auto;width:8.33333333%}.col-xl-2{flex:0 0 auto;width:16.66666667%}.col-xl-3{flex:0 0 auto;width:25%}.col-xl-4{flex:0 0 auto;width:33.33333333%}.col-xl-5{flex:0 0 auto;width:41.66666667%}.col-xl-6{flex:0 0 auto;width:50%}.col-xl-7{flex:0 0 auto;width:58.33333333%}.col-xl-8{flex:0 0 auto;width:66.66666667%}.col-xl-9{flex:0 0 auto;width:75%}.col-xl-10{flex:0 0 auto;width:83.33333333%}.col-xl-11{flex:0 0 auto;width:91.66666667%}.col-xl-12{flex:0 0 auto;width:100%}.offset-xl-0{margin-left:0}.offset-xl-1{margin-left:8.33333333%}.offset-xl-2{margin-left:16.66666667%}.offset-xl-3{margin-left:25%}.offset-xl-4{margin-left:33.33333333%}.offset-xl-5{margin-left:41.66666667%}.offset-xl-6{margin-left:50%}.offset-xl-7{margin-left:58.33333333%}.offset-xl-8{margin-left:66.66666667%}.offset-xl-9{margin-left:75%}.offset-xl-10{margin-left:83.33333333%}.offset-xl-11{margin-left:91.66666667%}.g-xl-0,.gx-xl-0{--bs-gutter-x:0}.g-xl-0,.gy-xl-0{--bs-gutter-y:0}.g-xl-1,.gx-xl-1{--bs-gutter-x:0.25rem}.g-xl-1,.gy-xl-1{--bs-gutter-y:0.25rem}.g-xl-2,.gx-xl-2{--bs-gutter-x:0.5rem}.g-xl-2,.gy-xl-2{--bs-gutter-y:0.5rem}.g-xl-3,.gx-xl-3{--bs-gutter-x:1rem}.g-xl-3,.gy-xl-3{--bs-gutter-y:1rem}.g-xl-4,.gx-xl-4{--bs-gutter-x:1.5rem}.g-xl-4,.gy-xl-4{--bs-gutter-y:1.5rem}.g-xl-5,.gx-xl-5{--bs-gutter-x:3rem}.g-xl-5,.gy-xl-5{--bs-gutter-y:3rem}}@media (min-width:1400px){.col-xxl{flex:1 0 0%}.row-cols-xxl-auto>*{flex:0 0 auto;width:auto}.row-cols-xxl-1>*{flex:0 0 auto;width:100%}.row-cols-xxl-2>*{flex:0 0 auto;width:50%}.row-cols-xxl-3>*{flex:0 0 auto;width:33.33333333%}.row-cols-xxl-4>*{flex:0 0 auto;width:25%}.row-cols-xxl-5>*{flex:0 0 auto;width:20%}.row-cols-xxl-6>*{flex:0 0 auto;width:16.66666667%}.col-xxl-auto{flex:0 0 auto;width:auto}.col-xxl-1{flex:0 0 auto;width:8.33333333%}.col-xxl-2{flex:0 0 auto;width:16.66666667%}.col-xxl-3{flex:0 0 auto;width:25%}.col-xxl-4{flex:0 0 auto;width:33.33333333%}.col-xxl-5{flex:0 0 auto;width:41.66666667%}.col-xxl-6{flex:0 0 auto;width:50%}.col-xxl-7{flex:0 0 auto;width:58.33333333%}.col-xxl-8{flex:0 0 auto;width:66.66666667%}.col-xxl-9{flex:0 0 auto;width:75%}.col-xxl-10{flex:0 0 auto;width:83.33333333%}.col-xxl-11{flex:0 0 auto;width:91.66666667%}.col-xxl-12{flex:0 0 auto;width:100%}.offset-xxl-0{margin-left:0}.offset-xxl-1{margin-left:8.33333333%}.offset-xxl-2{margin-left:16.66666667%}.offset-xxl-3{margin-left:25%}.offset-xxl-4{margin-left:33.33333333%}.offset-xxl-5{margin-left:41.66666667%}.offset-xxl-6{margin-left:50%}.offset-xxl-7{margin-left:58.33333333%}.offset-xxl-8{margin-left:66.66666667%}.offset-xxl-9{margin-left:75%}.offset-xxl-10{margin-left:83.33333333%}.offset-xxl-11{margin-left:91.66666667%}.g-xxl-0,.gx-xxl-0{--bs-gutter-x:0}.g-xxl-0,.gy-xxl-0{--bs-gutter-y:0}.g-xxl-1,.gx-xxl-1{--bs-gutter-x:0.25rem}.g-xxl-1,.gy-xxl-1{--bs-gutter-y:0.25rem}.g-xxl-2,.gx-xxl-2{--bs-gutter-x:0.5rem}.g-xxl-2,.gy-xxl-2{--bs-gutter-y:0.5rem}.g-xxl-3,.gx-xxl-3{--bs-gutter-x:1rem}.g-xxl-3,.gy-xxl-3{--bs-gutter-y:1rem}.g-xxl-4,.gx-xxl-4{--bs-gutter-x:1.5rem}.g-xxl-4,.gy-xxl-4{--bs-gutter-y:1.5rem}.g-xxl-5,.gx-xxl-5{--bs-gutter-x:3rem}.g-xxl-5,.gy-xxl-5{--bs-gutter-y:3rem}}.table{--bs-table-color-type:initial;--bs-table-bg-type:initial;--bs-table-color-state:initial;--bs-table-bg-state:initial;--bs-table-color:var(--bs-emphasis-color);--bs-table-bg:var(--bs-body-bg);--bs-table-border-color:var(--bs-border-color);--bs-table-accent-bg:transparent;--bs-table-striped-color:var(--bs-emphasis-color);--bs-table-striped-bg:rgba(var(--bs-emphasis-color-rgb), 0.05);--bs-table-active-color:var(--bs-emphasis-color);--bs-table-active-bg:rgba(var(--bs-emphasis-color-rgb), 0.1);--bs-table-hover-color:var(--bs-emphasis-color);--bs-table-hover-bg:rgba(var(--bs-emphasis-color-rgb), 0.075);width:100%;margin-bottom:1rem;vertical-align:top;border-color:var(--bs-table-border-color)}.table>:not(caption)>*>*{padding:.5rem .5rem;color:var(--bs-table-color-state,var(--bs-table-color-type,var(--bs-table-color)));background-color:var(--bs-table-bg);border-bottom-width:var(--bs-border-width);box-shadow:inset 0 0 0 9999px var(--bs-table-bg-state,var(--bs-table-bg-type,var(--bs-table-accent-bg)))}.table>tbody{vertical-align:inherit}.table>thead{vertical-align:bottom}.table-group-divider{border-top:calc(var(--bs-border-width) * 2) solid currentcolor}.caption-top{caption-side:top}.table-sm>:not(caption)>*>*{padding:.25rem .25rem}.table-bordered>:not(caption)>*{border-width:var(--bs-border-width) 0}.table-bordered>:not(caption)>*>*{border-width:0 var(--bs-border-width)}.table-borderless>:not(caption)>*>*{border-bottom-width:0}.table-borderless>:not(:first-child){border-top-width:0}.table-striped>tbody>tr:nth-of-type(odd)>*{--bs-table-color-type:var(--bs-table-striped-color);--bs-table-bg-type:var(--bs-table-striped-bg)}.table-striped-columns>:not(caption)>tr>:nth-child(2n){--bs-table-color-type:var(--bs-table-striped-color);--bs-table-bg-type:var(--bs-table-striped-bg)}.table-active{--bs-table-color-state:var(--bs-table-active-color);--bs-table-bg-state:var(--bs-table-active-bg)}.table-hover>tbody>tr:hover>*{--bs-table-color-state:var(--bs-table-hover-color);--bs-table-bg-state:var(--bs-table-hover-bg)}.table-primary{--bs-table-color:#000;--bs-table-bg:#cfe2ff;--bs-table-border-color:#a6b5cc;--bs-table-striped-bg:#c5d7f2;--bs-table-striped-color:#000;--bs-table-active-bg:#bacbe6;--bs-table-active-color:#000;--bs-table-hover-bg:#bfd1ec;--bs-table-hover-color:#000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-secondary{--bs-table-color:#000;--bs-table-bg:#e2e3e5;--bs-table-border-color:#b5b6b7;--bs-table-striped-bg:#d7d8da;--bs-table-striped-color:#000;--bs-table-active-bg:#cbccce;--bs-table-active-color:#000;--bs-table-hover-bg:#d1d2d4;--bs-table-hover-color:#000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-success{--bs-table-color:#000;--bs-table-bg:#d1e7dd;--bs-table-border-color:#a7b9b1;--bs-table-striped-bg:#c7dbd2;--bs-table-striped-color:#000;--bs-table-active-bg:#bcd0c7;--bs-table-active-color:#000;--bs-table-hover-bg:#c1d6cc;--bs-table-hover-color:#000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-info{--bs-table-color:#000;--bs-table-bg:#cff4fc;--bs-table-border-color:#a6c3ca;--bs-table-striped-bg:#c5e8ef;--bs-table-striped-color:#000;--bs-table-active-bg:#badce3;--bs-table-active-color:#000;--bs-table-hover-bg:#bfe2e9;--bs-table-hover-color:#000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-warning{--bs-table-color:#000;--bs-table-bg:#fff3cd;--bs-table-border-color:#ccc2a4;--bs-table-striped-bg:#f2e7c3;--bs-table-striped-color:#000;--bs-table-active-bg:#e6dbb9;--bs-table-active-color:#000;--bs-table-hover-bg:#ece1be;--bs-table-hover-color:#000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-danger{--bs-table-color:#000;--bs-table-bg:#f8d7da;--bs-table-border-color:#c6acae;--bs-table-striped-bg:#eccccf;--bs-table-striped-color:#000;--bs-table-active-bg:#dfc2c4;--bs-table-active-color:#000;--bs-table-hover-bg:#e5c7ca;--bs-table-hover-color:#000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-light{--bs-table-color:#000;--bs-table-bg:#f8f9fa;--bs-table-border-color:#c6c7c8;--bs-table-striped-bg:#ecedee;--bs-table-striped-color:#000;--bs-table-active-bg:#dfe0e1;--bs-table-active-color:#000;--bs-table-hover-bg:#e5e6e7;--bs-table-hover-color:#000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-dark{--bs-table-color:#fff;--bs-table-bg:#212529;--bs-table-border-color:#4d5154;--bs-table-striped-bg:#2c3034;--bs-table-striped-color:#fff;--bs-table-active-bg:#373b3e;--bs-table-active-color:#fff;--bs-table-hover-bg:#323539;--bs-table-hover-color:#fff;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-responsive{overflow-x:auto;-webkit-overflow-scrolling:touch}@media (max-width:575.98px){.table-responsive-sm{overflow-x:auto;-webkit-overflow-scrolling:touch}}@media (max-width:767.98px){.table-responsive-md{overflow-x:auto;-webkit-overflow-scrolling:touch}}@media (max-width:991.98px){.table-responsive-lg{overflow-x:auto;-webkit-overflow-scrolling:touch}}@media (max-width:1199.98px){.table-responsive-xl{overflow-x:auto;-webkit-overflow-scrolling:touch}}@media (max-width:1399.98px){.table-responsive-xxl{overflow-x:auto;-webkit-overflow-scrolling:touch}}.form-label{margin-bottom:.5rem}.col-form-label{padding-top:calc(.375rem + var(--bs-border-width));padding-bottom:calc(.375rem + var(--bs-border-width));margin-bottom:0;font-size:inherit;line-height:1.5}.col-form-label-lg{padding-top:calc(.5rem + var(--bs-border-width));padding-bottom:calc(.5rem + var(--bs-border-width));font-size:1.25rem}.col-form-label-sm{padding-top:calc(.25rem + var(--bs-border-width));padding-bottom:calc(.25rem + var(--bs-border-width));font-size:.875rem}.form-text{margin-top:.25rem;font-size:.875em;color:var(--bs-secondary-color)}.form-control{display:block;width:100%;padding:.375rem .75rem;font-size:1rem;font-weight:400;line-height:1.5;color:var(--bs-body-color);-webkit-appearance:none;-moz-appearance:none;appearance:none;background-color:var(--bs-body-bg);background-clip:padding-box;border:var(--bs-border-width) solid var(--bs-border-color);border-radius:var(--bs-border-radius);transition:border-color .15s ease-in-out,box-shadow .15s ease-in-out}@media (prefers-reduced-motion:reduce){.form-control{transition:none}}.form-control[type=file]{overflow:hidden}.form-control[type=file]:not(:disabled):not([readonly]){cursor:pointer}.form-control:focus{color:var(--bs-body-color);background-color:var(--bs-body-bg);border-color:#86b7fe;outline:0;box-shadow:0 0 0 .25rem rgba(13,110,253,.25)}.form-control::-webkit-date-and-time-value{min-width:85px;height:1.5em;margin:0}.form-control::-webkit-datetime-edit{display:block;padding:0}.form-control::-moz-placeholder{color:var(--bs-secondary-color);opacity:1}.form-control::placeholder{color:var(--bs-secondary-color);opacity:1}.form-control:disabled{background-color:var(--bs-secondary-bg);opacity:1}.form-control::-webkit-file-upload-button{padding:.375rem .75rem;margin:-.375rem -.75rem;-webkit-margin-end:.75rem;margin-inline-end:.75rem;color:var(--bs-body-color);background-color:var(--bs-tertiary-bg);pointer-events:none;border-color:inherit;border-style:solid;border-width:0;border-inline-end-width:var(--bs-border-width);border-radius:0;-webkit-transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out;transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out}.form-control::file-selector-button{padding:.375rem .75rem;margin:-.375rem -.75rem;-webkit-margin-end:.75rem;margin-inline-end:.75rem;color:var(--bs-body-color);background-color:var(--bs-tertiary-bg);pointer-events:none;border-color:inherit;border-style:solid;border-width:0;border-inline-end-width:var(--bs-border-width);border-radius:0;transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out}@media (prefers-reduced-motion:reduce){.form-control::-webkit-file-upload-button{-webkit-transition:none;transition:none}.form-control::file-selector-button{transition:none}}.form-control:hover:not(:disabled):not([readonly])::-webkit-file-upload-button{background-color:var(--bs-secondary-bg)}.form-control:hover:not(:disabled):not([readonly])::file-selector-button{background-color:var(--bs-secondary-bg)}.form-control-plaintext{display:block;width:100%;padding:.375rem 0;margin-bottom:0;line-height:1.5;color:var(--bs-body-color);background-color:transparent;border:solid transparent;border-width:var(--bs-border-width) 0}.form-control-plaintext:focus{outline:0}.form-control-plaintext.form-control-lg,.form-control-plaintext.form-control-sm{padding-right:0;padding-left:0}.form-control-sm{min-height:calc(1.5em + .5rem + calc(var(--bs-border-width) * 2));padding:.25rem .5rem;font-size:.875rem;border-radius:var(--bs-border-radius-sm)}.form-control-sm::-webkit-file-upload-button{padding:.25rem .5rem;margin:-.25rem -.5rem;-webkit-margin-end:.5rem;margin-inline-end:.5rem}.form-control-sm::file-selector-button{padding:.25rem .5rem;margin:-.25rem -.5rem;-webkit-margin-end:.5rem;margin-inline-end:.5rem}.form-control-lg{min-height:calc(1.5em + 1rem + calc(var(--bs-border-width) * 2));padding:.5rem 1rem;font-size:1.25rem;border-radius:var(--bs-border-radius-lg)}.form-control-lg::-webkit-file-upload-button{padding:.5rem 1rem;margin:-.5rem -1rem;-webkit-margin-end:1rem;margin-inline-end:1rem}.form-control-lg::file-selector-button{padding:.5rem 1rem;margin:-.5rem -1rem;-webkit-margin-end:1rem;margin-inline-end:1rem}textarea.form-control{min-height:calc(1.5em + .75rem + calc(var(--bs-border-width) * 2))}textarea.form-control-sm{min-height:calc(1.5em + .5rem + calc(var(--bs-border-width) * 2))}textarea.form-control-lg{min-height:calc(1.5em + 1rem + calc(var(--bs-border-width) * 2))}.form-control-color{width:3rem;height:calc(1.5em + .75rem + calc(var(--bs-border-width) * 2));padding:.375rem}.form-control-color:not(:disabled):not([readonly]){cursor:pointer}.form-control-color::-moz-color-swatch{border:0!important;border-radius:var(--bs-border-radius)}.form-control-color::-webkit-color-swatch{border:0!important;border-radius:var(--bs-border-radius)}.form-control-color.form-control-sm{height:calc(1.5em + .5rem + calc(var(--bs-border-width) * 2))}.form-control-color.form-control-lg{height:calc(1.5em + 1rem + calc(var(--bs-border-width) * 2))}.form-select{--bs-form-select-bg-img:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16'%3e%3cpath fill='none' stroke='%23343a40' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' d='m2 5 6 6 6-6'/%3e%3c/svg%3e");display:block;width:100%;padding:.375rem 2.25rem .375rem .75rem;font-size:1rem;font-weight:400;line-height:1.5;color:var(--bs-body-color);-webkit-appearance:none;-moz-appearance:none;appearance:none;background-color:var(--bs-body-bg);background-image:var(--bs-form-select-bg-img),var(--bs-form-select-bg-icon,none);background-repeat:no-repeat;background-position:right .75rem center;background-size:16px 12px;border:var(--bs-border-width) solid var(--bs-border-color);border-radius:var(--bs-border-radius);transition:border-color .15s ease-in-out,box-shadow .15s ease-in-out}@media (prefers-reduced-motion:reduce){.form-select{transition:none}}.form-select:focus{border-color:#86b7fe;outline:0;box-shadow:0 0 0 .25rem rgba(13,110,253,.25)}.form-select[multiple],.form-select[size]:not([size="1"]){padding-right:.75rem;background-image:none}.form-select:disabled{background-color:var(--bs-secondary-bg)}.form-select:-moz-focusring{color:transparent;text-shadow:0 0 0 var(--bs-body-color)}.form-select-sm{padding-top:.25rem;padding-bottom:.25rem;padding-left:.5rem;font-size:.875rem;border-radius:var(--bs-border-radius-sm)}.form-select-lg{padding-top:.5rem;padding-bottom:.5rem;padding-left:1rem;font-size:1.25rem;border-radius:var(--bs-border-radius-lg)}[data-bs-theme=dark] .form-select{--bs-form-select-bg-img:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16'%3e%3cpath fill='none' stroke='%23dee2e6' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' d='m2 5 6 6 6-6'/%3e%3c/svg%3e")}.form-check{display:block;min-height:1.5rem;padding-left:1.5em;margin-bottom:.125rem}.form-check .form-check-input{float:left;margin-left:-1.5em}.form-check-reverse{padding-right:1.5em;padding-left:0;text-align:right}.form-check-reverse .form-check-input{float:right;margin-right:-1.5em;margin-left:0}.form-check-input{--bs-form-check-bg:var(--bs-body-bg);flex-shrink:0;width:1em;height:1em;margin-top:.25em;vertical-align:top;-webkit-appearance:none;-moz-appearance:none;appearance:none;background-color:var(--bs-form-check-bg);background-image:var(--bs-form-check-bg-image);background-repeat:no-repeat;background-position:center;background-size:contain;border:var(--bs-border-width) solid var(--bs-border-color);-webkit-print-color-adjust:exact;color-adjust:exact;print-color-adjust:exact}.form-check-input[type=checkbox]{border-radius:.25em}.form-check-input[type=radio]{border-radius:50%}.form-check-input:active{filter:brightness(90%)}.form-check-input:focus{border-color:#86b7fe;outline:0;box-shadow:0 0 0 .25rem rgba(13,110,253,.25)}.form-check-input:checked{background-color:#0d6efd;border-color:#0d6efd}.form-check-input:checked[type=checkbox]{--bs-form-check-bg-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 20 20'%3e%3cpath fill='none' stroke='%23fff' stroke-linecap='round' stroke-linejoin='round' stroke-width='3' d='m6 10 3 3 6-6'/%3e%3c/svg%3e")}.form-check-input:checked[type=radio]{--bs-form-check-bg-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='2' fill='%23fff'/%3e%3c/svg%3e")}.form-check-input[type=checkbox]:indeterminate{background-color:#0d6efd;border-color:#0d6efd;--bs-form-check-bg-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 20 20'%3e%3cpath fill='none' stroke='%23fff' stroke-linecap='round' stroke-linejoin='round' stroke-width='3' d='M6 10h8'/%3e%3c/svg%3e")}.form-check-input:disabled{pointer-events:none;filter:none;opacity:.5}.form-check-input:disabled~.form-check-label,.form-check-input[disabled]~.form-check-label{cursor:default;opacity:.5}.form-switch{padding-left:2.5em}.form-switch .form-check-input{--bs-form-switch-bg:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='3' fill='rgba%280, 0, 0, 0.25%29'/%3e%3c/svg%3e");width:2em;margin-left:-2.5em;background-image:var(--bs-form-switch-bg);background-position:left center;border-radius:2em;transition:background-position .15s ease-in-out}@media (prefers-reduced-motion:reduce){.form-switch .form-check-input{transition:none}}.form-switch .form-check-input:focus{--bs-form-switch-bg:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='3' fill='%2386b7fe'/%3e%3c/svg%3e")}.form-switch .form-check-input:checked{background-position:right center;--bs-form-switch-bg:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='3' fill='%23fff'/%3e%3c/svg%3e")}.form-switch.form-check-reverse{padding-right:2.5em;padding-left:0}.form-switch.form-check-reverse .form-check-input{margin-right:-2.5em;margin-left:0}.form-check-inline{display:inline-block;margin-right:1rem}.btn-check{position:absolute;clip:rect(0,0,0,0);pointer-events:none}.btn-check:disabled+.btn,.btn-check[disabled]+.btn{pointer-events:none;filter:none;opacity:.65}[data-bs-theme=dark] .form-switch .form-check-input:not(:checked):not(:focus){--bs-form-switch-bg:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='3' fill='rgba%28255, 255, 255, 0.25%29'/%3e%3c/svg%3e")}.form-range{width:100%;height:1.5rem;padding:0;-webkit-appearance:none;-moz-appearance:none;appearance:none;background-color:transparent}.form-range:focus{outline:0}.form-range:focus::-webkit-slider-thumb{box-shadow:0 0 0 1px #fff,0 0 0 .25rem rgba(13,110,253,.25)}.form-range:focus::-moz-range-thumb{box-shadow:0 0 0 1px #fff,0 0 0 .25rem rgba(13,110,253,.25)}.form-range::-moz-focus-outer{border:0}.form-range::-webkit-slider-thumb{width:1rem;height:1rem;margin-top:-.25rem;-webkit-appearance:none;appearance:none;background-color:#0d6efd;border:0;border-radius:1rem;-webkit-transition:background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out;transition:background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out}@media (prefers-reduced-motion:reduce){.form-range::-webkit-slider-thumb{-webkit-transition:none;transition:none}}.form-range::-webkit-slider-thumb:active{background-color:#b6d4fe}.form-range::-webkit-slider-runnable-track{width:100%;height:.5rem;color:transparent;cursor:pointer;background-color:var(--bs-secondary-bg);border-color:transparent;border-radius:1rem}.form-range::-moz-range-thumb{width:1rem;height:1rem;-moz-appearance:none;appearance:none;background-color:#0d6efd;border:0;border-radius:1rem;-moz-transition:background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out;transition:background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out}@media (prefers-reduced-motion:reduce){.form-range::-moz-range-thumb{-moz-transition:none;transition:none}}.form-range::-moz-range-thumb:active{background-color:#b6d4fe}.form-range::-moz-range-track{width:100%;height:.5rem;color:transparent;cursor:pointer;background-color:var(--bs-secondary-bg);border-color:transparent;border-radius:1rem}.form-range:disabled{pointer-events:none}.form-range:disabled::-webkit-slider-thumb{background-color:var(--bs-secondary-color)}.form-range:disabled::-moz-range-thumb{background-color:var(--bs-secondary-color)}.form-floating{position:relative}.form-floating>.form-control,.form-floating>.form-control-plaintext,.form-floating>.form-select{height:calc(3.5rem + calc(var(--bs-border-width) * 2));min-height:calc(3.5rem + calc(var(--bs-border-width) * 2));line-height:1.25}.form-floating>label{position:absolute;top:0;left:0;z-index:2;height:100%;padding:1rem .75rem;overflow:hidden;text-align:start;text-overflow:ellipsis;white-space:nowrap;pointer-events:none;border:var(--bs-border-width) solid transparent;transform-origin:0 0;transition:opacity .1s ease-in-out,transform .1s ease-in-out}@media (prefers-reduced-motion:reduce){.form-floating>label{transition:none}}.form-floating>.form-control,.form-floating>.form-control-plaintext{padding:1rem .75rem}.form-floating>.form-control-plaintext::-moz-placeholder,.form-floating>.form-control::-moz-placeholder{color:transparent}.form-floating>.form-control-plaintext::placeholder,.form-floating>.form-control::placeholder{color:transparent}.form-floating>.form-control-plaintext:not(:-moz-placeholder-shown),.form-floating>.form-control:not(:-moz-placeholder-shown){padding-top:1.625rem;padding-bottom:.625rem}.form-floating>.form-control-plaintext:focus,.form-floating>.form-control-plaintext:not(:placeholder-shown),.form-floating>.form-control:focus,.form-floating>.form-control:not(:placeholder-shown){padding-top:1.625rem;padding-bottom:.625rem}.form-floating>.form-control-plaintext:-webkit-autofill,.form-floating>.form-control:-webkit-autofill{padding-top:1.625rem;padding-bottom:.625rem}.form-floating>.form-select{padding-top:1.625rem;padding-bottom:.625rem}.form-floating>.form-control:not(:-moz-placeholder-shown)~label{color:rgba(var(--bs-body-color-rgb),.65);transform:scale(.85) translateY(-.5rem) translateX(.15rem)}.form-floating>.form-control-plaintext~label,.form-floating>.form-control:focus~label,.form-floating>.form-control:not(:placeholder-shown)~label,.form-floating>.form-select~label{color:rgba(var(--bs-body-color-rgb),.65);transform:scale(.85) translateY(-.5rem) translateX(.15rem)}.form-floating>.form-control:not(:-moz-placeholder-shown)~label::after{position:absolute;inset:1rem 0.375rem;z-index:-1;height:1.5em;content:"";background-color:var(--bs-body-bg);border-radius:var(--bs-border-radius)}.form-floating>.form-control-plaintext~label::after,.form-floating>.form-control:focus~label::after,.form-floating>.form-control:not(:placeholder-shown)~label::after,.form-floating>.form-select~label::after{position:absolute;inset:1rem 0.375rem;z-index:-1;height:1.5em;content:"";background-color:var(--bs-body-bg);border-radius:var(--bs-border-radius)}.form-floating>.form-control:-webkit-autofill~label{color:rgba(var(--bs-body-color-rgb),.65);transform:scale(.85) translateY(-.5rem) translateX(.15rem)}.form-floating>.form-control-plaintext~label{border-width:var(--bs-border-width) 0}.form-floating>.form-control:disabled~label,.form-floating>:disabled~label{color:#6c757d}.form-floating>.form-control:disabled~label::after,.form-floating>:disabled~label::after{background-color:var(--bs-secondary-bg)}.input-group{position:relative;display:flex;flex-wrap:wrap;align-items:stretch;width:100%}.input-group>.form-control,.input-group>.form-floating,.input-group>.form-select{position:relative;flex:1 1 auto;width:1%;min-width:0}.input-group>.form-control:focus,.input-group>.form-floating:focus-within,.input-group>.form-select:focus{z-index:5}.input-group .btn{position:relative;z-index:2}.input-group .btn:focus{z-index:5}.input-group-text{display:flex;align-items:center;padding:.375rem .75rem;font-size:1rem;font-weight:400;line-height:1.5;color:var(--bs-body-color);text-align:center;white-space:nowrap;background-color:var(--bs-tertiary-bg);border:var(--bs-border-width) solid var(--bs-border-color);border-radius:var(--bs-border-radius)}.input-group-lg>.btn,.input-group-lg>.form-control,.input-group-lg>.form-select,.input-group-lg>.input-group-text{padding:.5rem 1rem;font-size:1.25rem;border-radius:var(--bs-border-radius-lg)}.input-group-sm>.btn,.input-group-sm>.form-control,.input-group-sm>.form-select,.input-group-sm>.input-group-text{padding:.25rem .5rem;font-size:.875rem;border-radius:var(--bs-border-radius-sm)}.input-group-lg>.form-select,.input-group-sm>.form-select{padding-right:3rem}.input-group:not(.has-validation)>.dropdown-toggle:nth-last-child(n+3),.input-group:not(.has-validation)>.form-floating:not(:last-child)>.form-control,.input-group:not(.has-validation)>.form-floating:not(:last-child)>.form-select,.input-group:not(.has-validation)>:not(:last-child):not(.dropdown-toggle):not(.dropdown-menu):not(.form-floating){border-top-right-radius:0;border-bottom-right-radius:0}.input-group.has-validation>.dropdown-toggle:nth-last-child(n+4),.input-group.has-validation>.form-floating:nth-last-child(n+3)>.form-control,.input-group.has-validation>.form-floating:nth-last-child(n+3)>.form-select,.input-group.has-validation>:nth-last-child(n+3):not(.dropdown-toggle):not(.dropdown-menu):not(.form-floating){border-top-right-radius:0;border-bottom-right-radius:0}.input-group>:not(:first-child):not(.dropdown-menu):not(.valid-tooltip):not(.valid-feedback):not(.invalid-tooltip):not(.invalid-feedback){margin-left:calc(var(--bs-border-width) * -1);border-top-left-radius:0;border-bottom-left-radius:0}.input-group>.form-floating:not(:first-child)>.form-control,.input-group>.form-floating:not(:first-child)>.form-select{border-top-left-radius:0;border-bottom-left-radius:0}.valid-feedback{display:none;width:100%;margin-top:.25rem;font-size:.875em;color:var(--bs-form-valid-color)}.valid-tooltip{position:absolute;top:100%;z-index:5;display:none;max-width:100%;padding:.25rem .5rem;margin-top:.1rem;font-size:.875rem;color:#fff;background-color:var(--bs-success);border-radius:var(--bs-border-radius)}.is-valid~.valid-feedback,.is-valid~.valid-tooltip,.was-validated :valid~.valid-feedback,.was-validated :valid~.valid-tooltip{display:block}.form-control.is-valid,.was-validated .form-control:valid{border-color:var(--bs-form-valid-border-color);padding-right:calc(1.5em + .75rem);background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 8 8'%3e%3cpath fill='%23198754' d='M2.3 6.73.6 4.53c-.4-1.04.46-1.4 1.1-.8l1.1 1.4 3.4-3.8c.6-.63 1.6-.27 1.2.7l-4 4.6c-.43.5-.8.4-1.1.1z'/%3e%3c/svg%3e");background-repeat:no-repeat;background-position:right calc(.375em + .1875rem) center;background-size:calc(.75em + .375rem) calc(.75em + .375rem)}.form-control.is-valid:focus,.was-validated .form-control:valid:focus{border-color:var(--bs-form-valid-border-color);box-shadow:0 0 0 .25rem rgba(var(--bs-success-rgb),.25)}.was-validated textarea.form-control:valid,textarea.form-control.is-valid{padding-right:calc(1.5em + .75rem);background-position:top calc(.375em + .1875rem) right calc(.375em + .1875rem)}.form-select.is-valid,.was-validated .form-select:valid{border-color:var(--bs-form-valid-border-color)}.form-select.is-valid:not([multiple]):not([size]),.form-select.is-valid:not([multiple])[size="1"],.was-validated .form-select:valid:not([multiple]):not([size]),.was-validated .form-select:valid:not([multiple])[size="1"]{--bs-form-select-bg-icon:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 8 8'%3e%3cpath fill='%23198754' d='M2.3 6.73.6 4.53c-.4-1.04.46-1.4 1.1-.8l1.1 1.4 3.4-3.8c.6-.63 1.6-.27 1.2.7l-4 4.6c-.43.5-.8.4-1.1.1z'/%3e%3c/svg%3e");padding-right:4.125rem;background-position:right .75rem center,center right 2.25rem;background-size:16px 12px,calc(.75em + .375rem) calc(.75em + .375rem)}.form-select.is-valid:focus,.was-validated .form-select:valid:focus{border-color:var(--bs-form-valid-border-color);box-shadow:0 0 0 .25rem rgba(var(--bs-success-rgb),.25)}.form-control-color.is-valid,.was-validated .form-control-color:valid{width:calc(3rem + calc(1.5em + .75rem))}.form-check-input.is-valid,.was-validated .form-check-input:valid{border-color:var(--bs-form-valid-border-color)}.form-check-input.is-valid:checked,.was-validated .form-check-input:valid:checked{background-color:var(--bs-form-valid-color)}.form-check-input.is-valid:focus,.was-validated .form-check-input:valid:focus{box-shadow:0 0 0 .25rem rgba(var(--bs-success-rgb),.25)}.form-check-input.is-valid~.form-check-label,.was-validated .form-check-input:valid~.form-check-label{color:var(--bs-form-valid-color)}.form-check-inline .form-check-input~.valid-feedback{margin-left:.5em}.input-group>.form-control:not(:focus).is-valid,.input-group>.form-floating:not(:focus-within).is-valid,.input-group>.form-select:not(:focus).is-valid,.was-validated .input-group>.form-control:not(:focus):valid,.was-validated .input-group>.form-floating:not(:focus-within):valid,.was-validated .input-group>.form-select:not(:focus):valid{z-index:3}.invalid-feedback{display:none;width:100%;margin-top:.25rem;font-size:.875em;color:var(--bs-form-invalid-color)}.invalid-tooltip{position:absolute;top:100%;z-index:5;display:none;max-width:100%;padding:.25rem .5rem;margin-top:.1rem;font-size:.875rem;color:#fff;background-color:var(--bs-danger);border-radius:var(--bs-border-radius)}.is-invalid~.invalid-feedback,.is-invalid~.invalid-tooltip,.was-validated :invalid~.invalid-feedback,.was-validated :invalid~.invalid-tooltip{display:block}.form-control.is-invalid,.was-validated .form-control:invalid{border-color:var(--bs-form-invalid-border-color);padding-right:calc(1.5em + .75rem);background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 12 12' width='12' height='12' fill='none' stroke='%23dc3545'%3e%3ccircle cx='6' cy='6' r='4.5'/%3e%3cpath stroke-linejoin='round' d='M5.8 3.6h.4L6 6.5z'/%3e%3ccircle cx='6' cy='8.2' r='.6' fill='%23dc3545' stroke='none'/%3e%3c/svg%3e");background-repeat:no-repeat;background-position:right calc(.375em + .1875rem) center;background-size:calc(.75em + .375rem) calc(.75em + .375rem)}.form-control.is-invalid:focus,.was-validated .form-control:invalid:focus{border-color:var(--bs-form-invalid-border-color);box-shadow:0 0 0 .25rem rgba(var(--bs-danger-rgb),.25)}.was-validated textarea.form-control:invalid,textarea.form-control.is-invalid{padding-right:calc(1.5em + .75rem);background-position:top calc(.375em + .1875rem) right calc(.375em + .1875rem)}.form-select.is-invalid,.was-validated .form-select:invalid{border-color:var(--bs-form-invalid-border-color)}.form-select.is-invalid:not([multiple]):not([size]),.form-select.is-invalid:not([multiple])[size="1"],.was-validated .form-select:invalid:not([multiple]):not([size]),.was-validated .form-select:invalid:not([multiple])[size="1"]{--bs-form-select-bg-icon:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 12 12' width='12' height='12' fill='none' stroke='%23dc3545'%3e%3ccircle cx='6' cy='6' r='4.5'/%3e%3cpath stroke-linejoin='round' d='M5.8 3.6h.4L6 6.5z'/%3e%3ccircle cx='6' cy='8.2' r='.6' fill='%23dc3545' stroke='none'/%3e%3c/svg%3e");padding-right:4.125rem;background-position:right .75rem center,center right 2.25rem;background-size:16px 12px,calc(.75em + .375rem) calc(.75em + .375rem)}.form-select.is-invalid:focus,.was-validated .form-select:invalid:focus{border-color:var(--bs-form-invalid-border-color);box-shadow:0 0 0 .25rem rgba(var(--bs-danger-rgb),.25)}.form-control-color.is-invalid,.was-validated .form-control-color:invalid{width:calc(3rem + calc(1.5em + .75rem))}.form-check-input.is-invalid,.was-validated .form-check-input:invalid{border-color:var(--bs-form-invalid-border-color)}.form-check-input.is-invalid:checked,.was-validated .form-check-input:invalid:checked{background-color:var(--bs-form-invalid-color)}.form-check-input.is-invalid:focus,.was-validated .form-check-input:invalid:focus{box-shadow:0 0 0 .25rem rgba(var(--bs-danger-rgb),.25)}.form-check-input.is-invalid~.form-check-label,.was-validated .form-check-input:invalid~.form-check-label{color:var(--bs-form-invalid-color)}.form-check-inline .form-check-input~.invalid-feedback{margin-left:.5em}.input-group>.form-control:not(:focus).is-invalid,.input-group>.form-floating:not(:focus-within).is-invalid,.input-group>.form-select:not(:focus).is-invalid,.was-validated .input-group>.form-control:not(:focus):invalid,.was-validated .input-group>.form-floating:not(:focus-within):invalid,.was-validated .input-group>.form-select:not(:focus):invalid{z-index:4}.btn{--bs-btn-padding-x:0.75rem;--bs-btn-padding-y:0.375rem;--bs-btn-font-family: ;--bs-btn-font-size:1rem;--bs-btn-font-weight:400;--bs-btn-line-height:1.5;--bs-btn-color:var(--bs-body-color);--bs-btn-bg:transparent;--bs-btn-border-width:var(--bs-border-width);--bs-btn-border-color:transparent;--bs-btn-border-radius:var(--bs-border-radius);--bs-btn-hover-border-color:transparent;--bs-btn-box-shadow:inset 0 1px 0 rgba(255, 255, 255, 0.15),0 1px 1px rgba(0, 0, 0, 0.075);--bs-btn-disabled-opacity:0.65;--bs-btn-focus-box-shadow:0 0 0 0.25rem rgba(var(--bs-btn-focus-shadow-rgb), .5);display:inline-block;padding:var(--bs-btn-padding-y) var(--bs-btn-padding-x);font-family:var(--bs-btn-font-family);font-size:var(--bs-btn-font-size);font-weight:var(--bs-btn-font-weight);line-height:var(--bs-btn-line-height);color:var(--bs-btn-color);text-align:center;text-decoration:none;vertical-align:middle;cursor:pointer;-webkit-user-select:none;-moz-user-select:none;user-select:none;border:var(--bs-btn-border-width) solid var(--bs-btn-border-color);border-radius:var(--bs-btn-border-radius);background-color:var(--bs-btn-bg);transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out}@media (prefers-reduced-motion:reduce){.btn{transition:none}}.btn:hover{color:var(--bs-btn-hover-color);background-color:var(--bs-btn-hover-bg);border-color:var(--bs-btn-hover-border-color)}.btn-check+.btn:hover{color:var(--bs-btn-color);background-color:var(--bs-btn-bg);border-color:var(--bs-btn-border-color)}.btn:focus-visible{color:var(--bs-btn-hover-color);background-color:var(--bs-btn-hover-bg);border-color:var(--bs-btn-hover-border-color);outline:0;box-shadow:var(--bs-btn-focus-box-shadow)}.btn-check:focus-visible+.btn{border-color:var(--bs-btn-hover-border-color);outline:0;box-shadow:var(--bs-btn-focus-box-shadow)}.btn-check:checked+.btn,.btn.active,.btn.show,.btn:first-child:active,:not(.btn-check)+.btn:active{color:var(--bs-btn-active-color);background-color:var(--bs-btn-active-bg);border-color:var(--bs-btn-active-border-color)}.btn-check:checked+.btn:focus-visible,.btn.active:focus-visible,.btn.show:focus-visible,.btn:first-child:active:focus-visible,:not(.btn-check)+.btn:active:focus-visible{box-shadow:var(--bs-btn-focus-box-shadow)}.btn.disabled,.btn:disabled,fieldset:disabled .btn{color:var(--bs-btn-disabled-color);pointer-events:none;background-color:var(--bs-btn-disabled-bg);border-color:var(--bs-btn-disabled-border-color);opacity:var(--bs-btn-disabled-opacity)}.btn-primary{--bs-btn-color:#fff;--bs-btn-bg:#0d6efd;--bs-btn-border-color:#0d6efd;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#0b5ed7;--bs-btn-hover-border-color:#0a58ca;--bs-btn-focus-shadow-rgb:49,132,253;--bs-btn-active-color:#fff;--bs-btn-active-bg:#0a58ca;--bs-btn-active-border-color:#0a53be;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#fff;--bs-btn-disabled-bg:#0d6efd;--bs-btn-disabled-border-color:#0d6efd}.btn-secondary{--bs-btn-color:#fff;--bs-btn-bg:#6c757d;--bs-btn-border-color:#6c757d;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#5c636a;--bs-btn-hover-border-color:#565e64;--bs-btn-focus-shadow-rgb:130,138,145;--bs-btn-active-color:#fff;--bs-btn-active-bg:#565e64;--bs-btn-active-border-color:#51585e;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#fff;--bs-btn-disabled-bg:#6c757d;--bs-btn-disabled-border-color:#6c757d}.btn-success{--bs-btn-color:#fff;--bs-btn-bg:#198754;--bs-btn-border-color:#198754;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#157347;--bs-btn-hover-border-color:#146c43;--bs-btn-focus-shadow-rgb:60,153,110;--bs-btn-active-color:#fff;--bs-btn-active-bg:#146c43;--bs-btn-active-border-color:#13653f;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#fff;--bs-btn-disabled-bg:#198754;--bs-btn-disabled-border-color:#198754}.btn-info{--bs-btn-color:#000;--bs-btn-bg:#0dcaf0;--bs-btn-border-color:#0dcaf0;--bs-btn-hover-color:#000;--bs-btn-hover-bg:#31d2f2;--bs-btn-hover-border-color:#25cff2;--bs-btn-focus-shadow-rgb:11,172,204;--bs-btn-active-color:#000;--bs-btn-active-bg:#3dd5f3;--bs-btn-active-border-color:#25cff2;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#000;--bs-btn-disabled-bg:#0dcaf0;--bs-btn-disabled-border-color:#0dcaf0}.btn-warning{--bs-btn-color:#000;--bs-btn-bg:#ffc107;--bs-btn-border-color:#ffc107;--bs-btn-hover-color:#000;--bs-btn-hover-bg:#ffca2c;--bs-btn-hover-border-color:#ffc720;--bs-btn-focus-shadow-rgb:217,164,6;--bs-btn-active-color:#000;--bs-btn-active-bg:#ffcd39;--bs-btn-active-border-color:#ffc720;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#000;--bs-btn-disabled-bg:#ffc107;--bs-btn-disabled-border-color:#ffc107}.btn-danger{--bs-btn-color:#fff;--bs-btn-bg:#dc3545;--bs-btn-border-color:#dc3545;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#bb2d3b;--bs-btn-hover-border-color:#b02a37;--bs-btn-focus-shadow-rgb:225,83,97;--bs-btn-active-color:#fff;--bs-btn-active-bg:#b02a37;--bs-btn-active-border-color:#a52834;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#fff;--bs-btn-disabled-bg:#dc3545;--bs-btn-disabled-border-color:#dc3545}.btn-light{--bs-btn-color:#000;--bs-btn-bg:#f8f9fa;--bs-btn-border-color:#f8f9fa;--bs-btn-hover-color:#000;--bs-btn-hover-bg:#d3d4d5;--bs-btn-hover-border-color:#c6c7c8;--bs-btn-focus-shadow-rgb:211,212,213;--bs-btn-active-color:#000;--bs-btn-active-bg:#c6c7c8;--bs-btn-active-border-color:#babbbc;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#000;--bs-btn-disabled-bg:#f8f9fa;--bs-btn-disabled-border-color:#f8f9fa}.btn-dark{--bs-btn-color:#fff;--bs-btn-bg:#212529;--bs-btn-border-color:#212529;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#424649;--bs-btn-hover-border-color:#373b3e;--bs-btn-focus-shadow-rgb:66,70,73;--bs-btn-active-color:#fff;--bs-btn-active-bg:#4d5154;--bs-btn-active-border-color:#373b3e;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#fff;--bs-btn-disabled-bg:#212529;--bs-btn-disabled-border-color:#212529}.btn-outline-primary{--bs-btn-color:#0d6efd;--bs-btn-border-color:#0d6efd;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#0d6efd;--bs-btn-hover-border-color:#0d6efd;--bs-btn-focus-shadow-rgb:13,110,253;--bs-btn-active-color:#fff;--bs-btn-active-bg:#0d6efd;--bs-btn-active-border-color:#0d6efd;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#0d6efd;--bs-btn-disabled-bg:transparent;--bs-btn-disabled-border-color:#0d6efd;--bs-gradient:none}.btn-outline-secondary{--bs-btn-color:#6c757d;--bs-btn-border-color:#6c757d;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#6c757d;--bs-btn-hover-border-color:#6c757d;--bs-btn-focus-shadow-rgb:108,117,125;--bs-btn-active-color:#fff;--bs-btn-active-bg:#6c757d;--bs-btn-active-border-color:#6c757d;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#6c757d;--bs-btn-disabled-bg:transparent;--bs-btn-disabled-border-color:#6c757d;--bs-gradient:none}.btn-outline-success{--bs-btn-color:#198754;--bs-btn-border-color:#198754;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#198754;--bs-btn-hover-border-color:#198754;--bs-btn-focus-shadow-rgb:25,135,84;--bs-btn-active-color:#fff;--bs-btn-active-bg:#198754;--bs-btn-active-border-color:#198754;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#198754;--bs-btn-disabled-bg:transparent;--bs-btn-disabled-border-color:#198754;--bs-gradient:none}.btn-outline-info{--bs-btn-color:#0dcaf0;--bs-btn-border-color:#0dcaf0;--bs-btn-hover-color:#000;--bs-btn-hover-bg:#0dcaf0;--bs-btn-hover-border-color:#0dcaf0;--bs-btn-focus-shadow-rgb:13,202,240;--bs-btn-active-color:#000;--bs-btn-active-bg:#0dcaf0;--bs-btn-active-border-color:#0dcaf0;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#0dcaf0;--bs-btn-disabled-bg:transparent;--bs-btn-disabled-border-color:#0dcaf0;--bs-gradient:none}.btn-outline-warning{--bs-btn-color:#ffc107;--bs-btn-border-color:#ffc107;--bs-btn-hover-color:#000;--bs-btn-hover-bg:#ffc107;--bs-btn-hover-border-color:#ffc107;--bs-btn-focus-shadow-rgb:255,193,7;--bs-btn-active-color:#000;--bs-btn-active-bg:#ffc107;--bs-btn-active-border-color:#ffc107;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#ffc107;--bs-btn-disabled-bg:transparent;--bs-btn-disabled-border-color:#ffc107;--bs-gradient:none}.btn-outline-danger{--bs-btn-color:#dc3545;--bs-btn-border-color:#dc3545;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#dc3545;--bs-btn-hover-border-color:#dc3545;--bs-btn-focus-shadow-rgb:220,53,69;--bs-btn-active-color:#fff;--bs-btn-active-bg:#dc3545;--bs-btn-active-border-color:#dc3545;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#dc3545;--bs-btn-disabled-bg:transparent;--bs-btn-disabled-border-color:#dc3545;--bs-gradient:none}.btn-outline-light{--bs-btn-color:#f8f9fa;--bs-btn-border-color:#f8f9fa;--bs-btn-hover-color:#000;--bs-btn-hover-bg:#f8f9fa;--bs-btn-hover-border-color:#f8f9fa;--bs-btn-focus-shadow-rgb:248,249,250;--bs-btn-active-color:#000;--bs-btn-active-bg:#f8f9fa;--bs-btn-active-border-color:#f8f9fa;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#f8f9fa;--bs-btn-disabled-bg:transparent;--bs-btn-disabled-border-color:#f8f9fa;--bs-gradient:none}.btn-outline-dark{--bs-btn-color:#212529;--bs-btn-border-color:#212529;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#212529;--bs-btn-hover-border-color:#212529;--bs-btn-focus-shadow-rgb:33,37,41;--bs-btn-active-color:#fff;--bs-btn-active-bg:#212529;--bs-btn-active-border-color:#212529;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#212529;--bs-btn-disabled-bg:transparent;--bs-btn-disabled-border-color:#212529;--bs-gradient:none}.btn-link{--bs-btn-font-weight:400;--bs-btn-color:var(--bs-link-color);--bs-btn-bg:transparent;--bs-btn-border-color:transparent;--bs-btn-hover-color:var(--bs-link-hover-color);--bs-btn-hover-border-color:transparent;--bs-btn-active-color:var(--bs-link-hover-color);--bs-btn-active-border-color:transparent;--bs-btn-disabled-color:#6c757d;--bs-btn-disabled-border-color:transparent;--bs-btn-box-shadow:0 0 0 #000;--bs-btn-focus-shadow-rgb:49,132,253;text-decoration:underline}.btn-link:focus-visible{color:var(--bs-btn-color)}.btn-link:hover{color:var(--bs-btn-hover-color)}.btn-group-lg>.btn,.btn-lg{--bs-btn-padding-y:0.5rem;--bs-btn-padding-x:1rem;--bs-btn-font-size:1.25rem;--bs-btn-border-radius:var(--bs-border-radius-lg)}.btn-group-sm>.btn,.btn-sm{--bs-btn-padding-y:0.25rem;--bs-btn-padding-x:0.5rem;--bs-btn-font-size:0.875rem;--bs-btn-border-radius:var(--bs-border-radius-sm)}.fade{transition:opacity .15s linear}@media (prefers-reduced-motion:reduce){.fade{transition:none}}.fade:not(.show){opacity:0}.collapse:not(.show){display:none}.collapsing{height:0;overflow:hidden;transition:height .35s ease}@media (prefers-reduced-motion:reduce){.collapsing{transition:none}}.collapsing.collapse-horizontal{width:0;height:auto;transition:width .35s ease}@media (prefers-reduced-motion:reduce){.collapsing.collapse-horizontal{transition:none}}.dropdown,.dropdown-center,.dropend,.dropstart,.dropup,.dropup-center{position:relative}.dropdown-toggle{white-space:nowrap}.dropdown-toggle::after{display:inline-block;margin-left:.255em;vertical-align:.255em;content:"";border-top:.3em solid;border-right:.3em solid transparent;border-bottom:0;border-left:.3em solid transparent}.dropdown-toggle:empty::after{margin-left:0}.dropdown-menu{--bs-dropdown-zindex:1000;--bs-dropdown-min-width:10rem;--bs-dropdown-padding-x:0;--bs-dropdown-padding-y:0.5rem;--bs-dropdown-spacer:0.125rem;--bs-dropdown-font-size:1rem;--bs-dropdown-color:var(--bs-body-color);--bs-dropdown-bg:var(--bs-body-bg);--bs-dropdown-border-color:var(--bs-border-color-translucent);--bs-dropdown-border-radius:var(--bs-border-radius);--bs-dropdown-border-width:var(--bs-border-width);--bs-dropdown-inner-border-radius:calc(var(--bs-border-radius) - var(--bs-border-width));--bs-dropdown-divider-bg:var(--bs-border-color-translucent);--bs-dropdown-divider-margin-y:0.5rem;--bs-dropdown-box-shadow:var(--bs-box-shadow);--bs-dropdown-link-color:var(--bs-body-color);--bs-dropdown-link-hover-color:var(--bs-body-color);--bs-dropdown-link-hover-bg:var(--bs-tertiary-bg);--bs-dropdown-link-active-color:#fff;--bs-dropdown-link-active-bg:#0d6efd;--bs-dropdown-link-disabled-color:var(--bs-tertiary-color);--bs-dropdown-item-padding-x:1rem;--bs-dropdown-item-padding-y:0.25rem;--bs-dropdown-header-color:#6c757d;--bs-dropdown-header-padding-x:1rem;--bs-dropdown-header-padding-y:0.5rem;position:absolute;z-index:var(--bs-dropdown-zindex);display:none;min-width:var(--bs-dropdown-min-width);padding:var(--bs-dropdown-padding-y) var(--bs-dropdown-padding-x);margin:0;font-size:var(--bs-dropdown-font-size);color:var(--bs-dropdown-color);text-align:left;list-style:none;background-color:var(--bs-dropdown-bg);background-clip:padding-box;border:var(--bs-dropdown-border-width) solid var(--bs-dropdown-border-color);border-radius:var(--bs-dropdown-border-radius)}.dropdown-menu[data-bs-popper]{top:100%;left:0;margin-top:var(--bs-dropdown-spacer)}.dropdown-menu-start{--bs-position:start}.dropdown-menu-start[data-bs-popper]{right:auto;left:0}.dropdown-menu-end{--bs-position:end}.dropdown-menu-end[data-bs-popper]{right:0;left:auto}@media (min-width:576px){.dropdown-menu-sm-start{--bs-position:start}.dropdown-menu-sm-start[data-bs-popper]{right:auto;left:0}.dropdown-menu-sm-end{--bs-position:end}.dropdown-menu-sm-end[data-bs-popper]{right:0;left:auto}}@media (min-width:768px){.dropdown-menu-md-start{--bs-position:start}.dropdown-menu-md-start[data-bs-popper]{right:auto;left:0}.dropdown-menu-md-end{--bs-position:end}.dropdown-menu-md-end[data-bs-popper]{right:0;left:auto}}@media (min-width:992px){.dropdown-menu-lg-start{--bs-position:start}.dropdown-menu-lg-start[data-bs-popper]{right:auto;left:0}.dropdown-menu-lg-end{--bs-position:end}.dropdown-menu-lg-end[data-bs-popper]{right:0;left:auto}}@media (min-width:1200px){.dropdown-menu-xl-start{--bs-position:start}.dropdown-menu-xl-start[data-bs-popper]{right:auto;left:0}.dropdown-menu-xl-end{--bs-position:end}.dropdown-menu-xl-end[data-bs-popper]{right:0;left:auto}}@media (min-width:1400px){.dropdown-menu-xxl-start{--bs-position:start}.dropdown-menu-xxl-start[data-bs-popper]{right:auto;left:0}.dropdown-menu-xxl-end{--bs-position:end}.dropdown-menu-xxl-end[data-bs-popper]{right:0;left:auto}}.dropup .dropdown-menu[data-bs-popper]{top:auto;bottom:100%;margin-top:0;margin-bottom:var(--bs-dropdown-spacer)}.dropup .dropdown-toggle::after{display:inline-block;margin-left:.255em;vertical-align:.255em;content:"";border-top:0;border-right:.3em solid transparent;border-bottom:.3em solid;border-left:.3em solid transparent}.dropup .dropdown-toggle:empty::after{margin-left:0}.dropend .dropdown-menu[data-bs-popper]{top:0;right:auto;left:100%;margin-top:0;margin-left:var(--bs-dropdown-spacer)}.dropend .dropdown-toggle::after{display:inline-block;margin-left:.255em;vertical-align:.255em;content:"";border-top:.3em solid transparent;border-right:0;border-bottom:.3em solid transparent;border-left:.3em solid}.dropend .dropdown-toggle:empty::after{margin-left:0}.dropend .dropdown-toggle::after{vertical-align:0}.dropstart .dropdown-menu[data-bs-popper]{top:0;right:100%;left:auto;margin-top:0;margin-right:var(--bs-dropdown-spacer)}.dropstart .dropdown-toggle::after{display:inline-block;margin-left:.255em;vertical-align:.255em;content:""}.dropstart .dropdown-toggle::after{display:none}.dropstart .dropdown-toggle::before{display:inline-block;margin-right:.255em;vertical-align:.255em;content:"";border-top:.3em solid transparent;border-right:.3em solid;border-bottom:.3em solid transparent}.dropstart .dropdown-toggle:empty::after{margin-left:0}.dropstart .dropdown-toggle::before{vertical-align:0}.dropdown-divider{height:0;margin:var(--bs-dropdown-divider-margin-y) 0;overflow:hidden;border-top:1px solid var(--bs-dropdown-divider-bg);opacity:1}.dropdown-item{display:block;width:100%;padding:var(--bs-dropdown-item-padding-y) var(--bs-dropdown-item-padding-x);clear:both;font-weight:400;color:var(--bs-dropdown-link-color);text-align:inherit;text-decoration:none;white-space:nowrap;background-color:transparent;border:0;border-radius:var(--bs-dropdown-item-border-radius,0)}.dropdown-item:focus,.dropdown-item:hover{color:var(--bs-dropdown-link-hover-color);background-color:var(--bs-dropdown-link-hover-bg)}.dropdown-item.active,.dropdown-item:active{color:var(--bs-dropdown-link-active-color);text-decoration:none;background-color:var(--bs-dropdown-link-active-bg)}.dropdown-item.disabled,.dropdown-item:disabled{color:var(--bs-dropdown-link-disabled-color);pointer-events:none;background-color:transparent}.dropdown-menu.show{display:block}.dropdown-header{display:block;padding:var(--bs-dropdown-header-padding-y) var(--bs-dropdown-header-padding-x);margin-bottom:0;font-size:.875rem;color:var(--bs-dropdown-header-color);white-space:nowrap}.dropdown-item-text{display:block;padding:var(--bs-dropdown-item-padding-y) var(--bs-dropdown-item-padding-x);color:var(--bs-dropdown-link-color)}.dropdown-menu-dark{--bs-dropdown-color:#dee2e6;--bs-dropdown-bg:#343a40;--bs-dropdown-border-color:var(--bs-border-color-translucent);--bs-dropdown-box-shadow: ;--bs-dropdown-link-color:#dee2e6;--bs-dropdown-link-hover-color:#fff;--bs-dropdown-divider-bg:var(--bs-border-color-translucent);--bs-dropdown-link-hover-bg:rgba(255, 255, 255, 0.15);--bs-dropdown-link-active-color:#fff;--bs-dropdown-link-active-bg:#0d6efd;--bs-dropdown-link-disabled-color:#adb5bd;--bs-dropdown-header-color:#adb5bd}.btn-group,.btn-group-vertical{position:relative;display:inline-flex;vertical-align:middle}.btn-group-vertical>.btn,.btn-group>.btn{position:relative;flex:1 1 auto}.btn-group-vertical>.btn-check:checked+.btn,.btn-group-vertical>.btn-check:focus+.btn,.btn-group-vertical>.btn.active,.btn-group-vertical>.btn:active,.btn-group-vertical>.btn:focus,.btn-group-vertical>.btn:hover,.btn-group>.btn-check:checked+.btn,.btn-group>.btn-check:focus+.btn,.btn-group>.btn.active,.btn-group>.btn:active,.btn-group>.btn:focus,.btn-group>.btn:hover{z-index:1}.btn-toolbar{display:flex;flex-wrap:wrap;justify-content:flex-start}.btn-toolbar .input-group{width:auto}.btn-group{border-radius:var(--bs-border-radius)}.btn-group>.btn-group:not(:first-child),.btn-group>:not(.btn-check:first-child)+.btn{margin-left:calc(var(--bs-border-width) * -1)}.btn-group>.btn-group:not(:last-child)>.btn,.btn-group>.btn.dropdown-toggle-split:first-child,.btn-group>.btn:not(:last-child):not(.dropdown-toggle){border-top-right-radius:0;border-bottom-right-radius:0}.btn-group>.btn-group:not(:first-child)>.btn,.btn-group>.btn:nth-child(n+3),.btn-group>:not(.btn-check)+.btn{border-top-left-radius:0;border-bottom-left-radius:0}.dropdown-toggle-split{padding-right:.5625rem;padding-left:.5625rem}.dropdown-toggle-split::after,.dropend .dropdown-toggle-split::after,.dropup .dropdown-toggle-split::after{margin-left:0}.dropstart .dropdown-toggle-split::before{margin-right:0}.btn-group-sm>.btn+.dropdown-toggle-split,.btn-sm+.dropdown-toggle-split{padding-right:.375rem;padding-left:.375rem}.btn-group-lg>.btn+.dropdown-toggle-split,.btn-lg+.dropdown-toggle-split{padding-right:.75rem;padding-left:.75rem}.btn-group-vertical{flex-direction:column;align-items:flex-start;justify-content:center}.btn-group-vertical>.btn,.btn-group-vertical>.btn-group{width:100%}.btn-group-vertical>.btn-group:not(:first-child),.btn-group-vertical>.btn:not(:first-child){margin-top:calc(var(--bs-border-width) * -1)}.btn-group-vertical>.btn-group:not(:last-child)>.btn,.btn-group-vertical>.btn:not(:last-child):not(.dropdown-toggle){border-bottom-right-radius:0;border-bottom-left-radius:0}.btn-group-vertical>.btn-group:not(:first-child)>.btn,.btn-group-vertical>.btn~.btn{border-top-left-radius:0;border-top-right-radius:0}.nav{--bs-nav-link-padding-x:1rem;--bs-nav-link-padding-y:0.5rem;--bs-nav-link-font-weight: ;--bs-nav-link-color:var(--bs-link-color);--bs-nav-link-hover-color:var(--bs-link-hover-color);--bs-nav-link-disabled-color:var(--bs-secondary-color);display:flex;flex-wrap:wrap;padding-left:0;margin-bottom:0;list-style:none}.nav-link{display:block;padding:var(--bs-nav-link-padding-y) var(--bs-nav-link-padding-x);font-size:var(--bs-nav-link-font-size);font-weight:var(--bs-nav-link-font-weight);color:var(--bs-nav-link-color);text-decoration:none;background:0 0;border:0;transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out}@media (prefers-reduced-motion:reduce){.nav-link{transition:none}}.nav-link:focus,.nav-link:hover{color:var(--bs-nav-link-hover-color)}.nav-link:focus-visible{outline:0;box-shadow:0 0 0 .25rem rgba(13,110,253,.25)}.nav-link.disabled,.nav-link:disabled{color:var(--bs-nav-link-disabled-color);pointer-events:none;cursor:default}.nav-tabs{--bs-nav-tabs-border-width:var(--bs-border-width);--bs-nav-tabs-border-color:var(--bs-border-color);--bs-nav-tabs-border-radius:var(--bs-border-radius);--bs-nav-tabs-link-hover-border-color:var(--bs-secondary-bg) var(--bs-secondary-bg) var(--bs-border-color);--bs-nav-tabs-link-active-color:var(--bs-emphasis-color);--bs-nav-tabs-link-active-bg:var(--bs-body-bg);--bs-nav-tabs-link-active-border-color:var(--bs-border-color) var(--bs-border-color) var(--bs-body-bg);border-bottom:var(--bs-nav-tabs-border-width) solid var(--bs-nav-tabs-border-color)}.nav-tabs .nav-link{margin-bottom:calc(-1 * var(--bs-nav-tabs-border-width));border:var(--bs-nav-tabs-border-width) solid transparent;border-top-left-radius:var(--bs-nav-tabs-border-radius);border-top-right-radius:var(--bs-nav-tabs-border-radius)}.nav-tabs .nav-link:focus,.nav-tabs .nav-link:hover{isolation:isolate;border-color:var(--bs-nav-tabs-link-hover-border-color)}.nav-tabs .nav-item.show .nav-link,.nav-tabs .nav-link.active{color:var(--bs-nav-tabs-link-active-color);background-color:var(--bs-nav-tabs-link-active-bg);border-color:var(--bs-nav-tabs-link-active-border-color)}.nav-tabs .dropdown-menu{margin-top:calc(-1 * var(--bs-nav-tabs-border-width));border-top-left-radius:0;border-top-right-radius:0}.nav-pills{--bs-nav-pills-border-radius:var(--bs-border-radius);--bs-nav-pills-link-active-color:#fff;--bs-nav-pills-link-active-bg:#0d6efd}.nav-pills .nav-link{border-radius:var(--bs-nav-pills-border-radius)}.nav-pills .nav-link.active,.nav-pills .show>.nav-link{color:var(--bs-nav-pills-link-active-color);background-color:var(--bs-nav-pills-link-active-bg)}.nav-underline{--bs-nav-underline-gap:1rem;--bs-nav-underline-border-width:0.125rem;--bs-nav-underline-link-active-color:var(--bs-emphasis-color);gap:var(--bs-nav-underline-gap)}.nav-underline .nav-link{padding-right:0;padding-left:0;border-bottom:var(--bs-nav-underline-border-width) solid transparent}.nav-underline .nav-link:focus,.nav-underline .nav-link:hover{border-bottom-color:currentcolor}.nav-underline .nav-link.active,.nav-underline .show>.nav-link{font-weight:700;color:var(--bs-nav-underline-link-active-color);border-bottom-color:currentcolor}.nav-fill .nav-item,.nav-fill>.nav-link{flex:1 1 auto;text-align:center}.nav-justified .nav-item,.nav-justified>.nav-link{flex-basis:0;flex-grow:1;text-align:center}.nav-fill .nav-item .nav-link,.nav-justified .nav-item .nav-link{width:100%}.tab-content>.tab-pane{display:none}.tab-content>.active{display:block}.navbar{--bs-navbar-padding-x:0;--bs-navbar-padding-y:0.5rem;--bs-navbar-color:rgba(var(--bs-emphasis-color-rgb), 0.65);--bs-navbar-hover-color:rgba(var(--bs-emphasis-color-rgb), 0.8);--bs-navbar-disabled-color:rgba(var(--bs-emphasis-color-rgb), 0.3);--bs-navbar-active-color:rgba(var(--bs-emphasis-color-rgb), 1);--bs-navbar-brand-padding-y:0.3125rem;--bs-navbar-brand-margin-end:1rem;--bs-navbar-brand-font-size:1.25rem;--bs-navbar-brand-color:rgba(var(--bs-emphasis-color-rgb), 1);--bs-navbar-brand-hover-color:rgba(var(--bs-emphasis-color-rgb), 1);--bs-navbar-nav-link-padding-x:0.5rem;--bs-navbar-toggler-padding-y:0.25rem;--bs-navbar-toggler-padding-x:0.75rem;--bs-navbar-toggler-font-size:1.25rem;--bs-navbar-toggler-icon-bg:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 30 30'%3e%3cpath stroke='rgba%2833, 37, 41, 0.75%29' stroke-linecap='round' stroke-miterlimit='10' stroke-width='2' d='M4 7h22M4 15h22M4 23h22'/%3e%3c/svg%3e");--bs-navbar-toggler-border-color:rgba(var(--bs-emphasis-color-rgb), 0.15);--bs-navbar-toggler-border-radius:var(--bs-border-radius);--bs-navbar-toggler-focus-width:0.25rem;--bs-navbar-toggler-transition:box-shadow 0.15s ease-in-out;position:relative;display:flex;flex-wrap:wrap;align-items:center;justify-content:space-between;padding:var(--bs-navbar-padding-y) var(--bs-navbar-padding-x)}.navbar>.container,.navbar>.container-fluid,.navbar>.container-lg,.navbar>.container-md,.navbar>.container-sm,.navbar>.container-xl,.navbar>.container-xxl{display:flex;flex-wrap:inherit;align-items:center;justify-content:space-between}.navbar-brand{padding-top:var(--bs-navbar-brand-padding-y);padding-bottom:var(--bs-navbar-brand-padding-y);margin-right:var(--bs-navbar-brand-margin-end);font-size:var(--bs-navbar-brand-font-size);color:var(--bs-navbar-brand-color);text-decoration:none;white-space:nowrap}.navbar-brand:focus,.navbar-brand:hover{color:var(--bs-navbar-brand-hover-color)}.navbar-nav{--bs-nav-link-padding-x:0;--bs-nav-link-padding-y:0.5rem;--bs-nav-link-font-weight: ;--bs-nav-link-color:var(--bs-navbar-color);--bs-nav-link-hover-color:var(--bs-navbar-hover-color);--bs-nav-link-disabled-color:var(--bs-navbar-disabled-color);display:flex;flex-direction:column;padding-left:0;margin-bottom:0;list-style:none}.navbar-nav .nav-link.active,.navbar-nav .nav-link.show{color:var(--bs-navbar-active-color)}.navbar-nav .dropdown-menu{position:static}.navbar-text{padding-top:.5rem;padding-bottom:.5rem;color:var(--bs-navbar-color)}.navbar-text a,.navbar-text a:focus,.navbar-text a:hover{color:var(--bs-navbar-active-color)}.navbar-collapse{flex-basis:100%;flex-grow:1;align-items:center}.navbar-toggler{padding:var(--bs-navbar-toggler-padding-y) var(--bs-navbar-toggler-padding-x);font-size:var(--bs-navbar-toggler-font-size);line-height:1;color:var(--bs-navbar-color);background-color:transparent;border:var(--bs-border-width) solid var(--bs-navbar-toggler-border-color);border-radius:var(--bs-navbar-toggler-border-radius);transition:var(--bs-navbar-toggler-transition)}@media (prefers-reduced-motion:reduce){.navbar-toggler{transition:none}}.navbar-toggler:hover{text-decoration:none}.navbar-toggler:focus{text-decoration:none;outline:0;box-shadow:0 0 0 var(--bs-navbar-toggler-focus-width)}.navbar-toggler-icon{display:inline-block;width:1.5em;height:1.5em;vertical-align:middle;background-image:var(--bs-navbar-toggler-icon-bg);background-repeat:no-repeat;background-position:center;background-size:100%}.navbar-nav-scroll{max-height:var(--bs-scroll-height,75vh);overflow-y:auto}@media (min-width:576px){.navbar-expand-sm{flex-wrap:nowrap;justify-content:flex-start}.navbar-expand-sm .navbar-nav{flex-direction:row}.navbar-expand-sm .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-sm .navbar-nav .nav-link{padding-right:var(--bs-navbar-nav-link-padding-x);padding-left:var(--bs-navbar-nav-link-padding-x)}.navbar-expand-sm .navbar-nav-scroll{overflow:visible}.navbar-expand-sm .navbar-collapse{display:flex!important;flex-basis:auto}.navbar-expand-sm .navbar-toggler{display:none}.navbar-expand-sm .offcanvas{position:static;z-index:auto;flex-grow:1;width:auto!important;height:auto!important;visibility:visible!important;background-color:transparent!important;border:0!important;transform:none!important;transition:none}.navbar-expand-sm .offcanvas .offcanvas-header{display:none}.navbar-expand-sm .offcanvas .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible}}@media (min-width:768px){.navbar-expand-md{flex-wrap:nowrap;justify-content:flex-start}.navbar-expand-md .navbar-nav{flex-direction:row}.navbar-expand-md .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-md .navbar-nav .nav-link{padding-right:var(--bs-navbar-nav-link-padding-x);padding-left:var(--bs-navbar-nav-link-padding-x)}.navbar-expand-md .navbar-nav-scroll{overflow:visible}.navbar-expand-md .navbar-collapse{display:flex!important;flex-basis:auto}.navbar-expand-md .navbar-toggler{display:none}.navbar-expand-md .offcanvas{position:static;z-index:auto;flex-grow:1;width:auto!important;height:auto!important;visibility:visible!important;background-color:transparent!important;border:0!important;transform:none!important;transition:none}.navbar-expand-md .offcanvas .offcanvas-header{display:none}.navbar-expand-md .offcanvas .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible}}@media (min-width:992px){.navbar-expand-lg{flex-wrap:nowrap;justify-content:flex-start}.navbar-expand-lg .navbar-nav{flex-direction:row}.navbar-expand-lg .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-lg .navbar-nav .nav-link{padding-right:var(--bs-navbar-nav-link-padding-x);padding-left:var(--bs-navbar-nav-link-padding-x)}.navbar-expand-lg .navbar-nav-scroll{overflow:visible}.navbar-expand-lg .navbar-collapse{display:flex!important;flex-basis:auto}.navbar-expand-lg .navbar-toggler{display:none}.navbar-expand-lg .offcanvas{position:static;z-index:auto;flex-grow:1;width:auto!important;height:auto!important;visibility:visible!important;background-color:transparent!important;border:0!important;transform:none!important;transition:none}.navbar-expand-lg .offcanvas .offcanvas-header{display:none}.navbar-expand-lg .offcanvas .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible}}@media (min-width:1200px){.navbar-expand-xl{flex-wrap:nowrap;justify-content:flex-start}.navbar-expand-xl .navbar-nav{flex-direction:row}.navbar-expand-xl .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-xl .navbar-nav .nav-link{padding-right:var(--bs-navbar-nav-link-padding-x);padding-left:var(--bs-navbar-nav-link-padding-x)}.navbar-expand-xl .navbar-nav-scroll{overflow:visible}.navbar-expand-xl .navbar-collapse{display:flex!important;flex-basis:auto}.navbar-expand-xl .navbar-toggler{display:none}.navbar-expand-xl .offcanvas{position:static;z-index:auto;flex-grow:1;width:auto!important;height:auto!important;visibility:visible!important;background-color:transparent!important;border:0!important;transform:none!important;transition:none}.navbar-expand-xl .offcanvas .offcanvas-header{display:none}.navbar-expand-xl .offcanvas .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible}}@media (min-width:1400px){.navbar-expand-xxl{flex-wrap:nowrap;justify-content:flex-start}.navbar-expand-xxl .navbar-nav{flex-direction:row}.navbar-expand-xxl .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-xxl .navbar-nav .nav-link{padding-right:var(--bs-navbar-nav-link-padding-x);padding-left:var(--bs-navbar-nav-link-padding-x)}.navbar-expand-xxl .navbar-nav-scroll{overflow:visible}.navbar-expand-xxl .navbar-collapse{display:flex!important;flex-basis:auto}.navbar-expand-xxl .navbar-toggler{display:none}.navbar-expand-xxl .offcanvas{position:static;z-index:auto;flex-grow:1;width:auto!important;height:auto!important;visibility:visible!important;background-color:transparent!important;border:0!important;transform:none!important;transition:none}.navbar-expand-xxl .offcanvas .offcanvas-header{display:none}.navbar-expand-xxl .offcanvas .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible}}.navbar-expand{flex-wrap:nowrap;justify-content:flex-start}.navbar-expand .navbar-nav{flex-direction:row}.navbar-expand .navbar-nav .dropdown-menu{position:absolute}.navbar-expand .navbar-nav .nav-link{padding-right:var(--bs-navbar-nav-link-padding-x);padding-left:var(--bs-navbar-nav-link-padding-x)}.navbar-expand .navbar-nav-scroll{overflow:visible}.navbar-expand .navbar-collapse{display:flex!important;flex-basis:auto}.navbar-expand .navbar-toggler{display:none}.navbar-expand .offcanvas{position:static;z-index:auto;flex-grow:1;width:auto!important;height:auto!important;visibility:visible!important;background-color:transparent!important;border:0!important;transform:none!important;transition:none}.navbar-expand .offcanvas .offcanvas-header{display:none}.navbar-expand .offcanvas .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible}.navbar-dark,.navbar[data-bs-theme=dark]{--bs-navbar-color:rgba(255, 255, 255, 0.55);--bs-navbar-hover-color:rgba(255, 255, 255, 0.75);--bs-navbar-disabled-color:rgba(255, 255, 255, 0.25);--bs-navbar-active-color:#fff;--bs-navbar-brand-color:#fff;--bs-navbar-brand-hover-color:#fff;--bs-navbar-toggler-border-color:rgba(255, 255, 255, 0.1);--bs-navbar-toggler-icon-bg:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 30 30'%3e%3cpath stroke='rgba%28255, 255, 255, 0.55%29' stroke-linecap='round' stroke-miterlimit='10' stroke-width='2' d='M4 7h22M4 15h22M4 23h22'/%3e%3c/svg%3e")}[data-bs-theme=dark] .navbar-toggler-icon{--bs-navbar-toggler-icon-bg:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 30 30'%3e%3cpath stroke='rgba%28255, 255, 255, 0.55%29' stroke-linecap='round' stroke-miterlimit='10' stroke-width='2' d='M4 7h22M4 15h22M4 23h22'/%3e%3c/svg%3e")}.card{--bs-card-spacer-y:1rem;--bs-card-spacer-x:1rem;--bs-card-title-spacer-y:0.5rem;--bs-card-title-color: ;--bs-card-subtitle-color: ;--bs-card-border-width:var(--bs-border-width);--bs-card-border-color:var(--bs-border-color-translucent);--bs-card-border-radius:var(--bs-border-radius);--bs-card-box-shadow: ;--bs-card-inner-border-radius:calc(var(--bs-border-radius) - (var(--bs-border-width)));--bs-card-cap-padding-y:0.5rem;--bs-card-cap-padding-x:1rem;--bs-card-cap-bg:rgba(var(--bs-body-color-rgb), 0.03);--bs-card-cap-color: ;--bs-card-height: ;--bs-card-color: ;--bs-card-bg:var(--bs-body-bg);--bs-card-img-overlay-padding:1rem;--bs-card-group-margin:0.75rem;position:relative;display:flex;flex-direction:column;min-width:0;height:var(--bs-card-height);color:var(--bs-body-color);word-wrap:break-word;background-color:var(--bs-card-bg);background-clip:border-box;border:var(--bs-card-border-width) solid var(--bs-card-border-color);border-radius:var(--bs-card-border-radius)}.card>hr{margin-right:0;margin-left:0}.card>.list-group{border-top:inherit;border-bottom:inherit}.card>.list-group:first-child{border-top-width:0;border-top-left-radius:var(--bs-card-inner-border-radius);border-top-right-radius:var(--bs-card-inner-border-radius)}.card>.list-group:last-child{border-bottom-width:0;border-bottom-right-radius:var(--bs-card-inner-border-radius);border-bottom-left-radius:var(--bs-card-inner-border-radius)}.card>.card-header+.list-group,.card>.list-group+.card-footer{border-top:0}.card-body{flex:1 1 auto;padding:var(--bs-card-spacer-y) var(--bs-card-spacer-x);color:var(--bs-card-color)}.card-title{margin-bottom:var(--bs-card-title-spacer-y);color:var(--bs-card-title-color)}.card-subtitle{margin-top:calc(-.5 * var(--bs-card-title-spacer-y));margin-bottom:0;color:var(--bs-card-subtitle-color)}.card-text:last-child{margin-bottom:0}.card-link+.card-link{margin-left:var(--bs-card-spacer-x)}.card-header{padding:var(--bs-card-cap-padding-y) var(--bs-card-cap-padding-x);margin-bottom:0;color:var(--bs-card-cap-color);background-color:var(--bs-card-cap-bg);border-bottom:var(--bs-card-border-width) solid var(--bs-card-border-color)}.card-header:first-child{border-radius:var(--bs-card-inner-border-radius) var(--bs-card-inner-border-radius) 0 0}.card-footer{padding:var(--bs-card-cap-padding-y) var(--bs-card-cap-padding-x);color:var(--bs-card-cap-color);background-color:var(--bs-card-cap-bg);border-top:var(--bs-card-border-width) solid var(--bs-card-border-color)}.card-footer:last-child{border-radius:0 0 var(--bs-card-inner-border-radius) var(--bs-card-inner-border-radius)}.card-header-tabs{margin-right:calc(-.5 * var(--bs-card-cap-padding-x));margin-bottom:calc(-1 * var(--bs-card-cap-padding-y));margin-left:calc(-.5 * var(--bs-card-cap-padding-x));border-bottom:0}.card-header-tabs .nav-link.active{background-color:var(--bs-card-bg);border-bottom-color:var(--bs-card-bg)}.card-header-pills{margin-right:calc(-.5 * var(--bs-card-cap-padding-x));margin-left:calc(-.5 * var(--bs-card-cap-padding-x))}.card-img-overlay{position:absolute;top:0;right:0;bottom:0;left:0;padding:var(--bs-card-img-overlay-padding);border-radius:var(--bs-card-inner-border-radius)}.card-img,.card-img-bottom,.card-img-top{width:100%}.card-img,.card-img-top{border-top-left-radius:var(--bs-card-inner-border-radius);border-top-right-radius:var(--bs-card-inner-border-radius)}.card-img,.card-img-bottom{border-bottom-right-radius:var(--bs-card-inner-border-radius);border-bottom-left-radius:var(--bs-card-inner-border-radius)}.card-group>.card{margin-bottom:var(--bs-card-group-margin)}@media (min-width:576px){.card-group{display:flex;flex-flow:row wrap}.card-group>.card{flex:1 0 0%;margin-bottom:0}.card-group>.card+.card{margin-left:0;border-left:0}.card-group>.card:not(:last-child){border-top-right-radius:0;border-bottom-right-radius:0}.card-group>.card:not(:last-child) .card-header,.card-group>.card:not(:last-child) .card-img-top{border-top-right-radius:0}.card-group>.card:not(:last-child) .card-footer,.card-group>.card:not(:last-child) .card-img-bottom{border-bottom-right-radius:0}.card-group>.card:not(:first-child){border-top-left-radius:0;border-bottom-left-radius:0}.card-group>.card:not(:first-child) .card-header,.card-group>.card:not(:first-child) .card-img-top{border-top-left-radius:0}.card-group>.card:not(:first-child) .card-footer,.card-group>.card:not(:first-child) .card-img-bottom{border-bottom-left-radius:0}}.accordion{--bs-accordion-color:var(--bs-body-color);--bs-accordion-bg:var(--bs-body-bg);--bs-accordion-transition:color 0.15s ease-in-out,background-color 0.15s ease-in-out,border-color 0.15s ease-in-out,box-shadow 0.15s ease-in-out,border-radius 0.15s ease;--bs-accordion-border-color:var(--bs-border-color);--bs-accordion-border-width:var(--bs-border-width);--bs-accordion-border-radius:var(--bs-border-radius);--bs-accordion-inner-border-radius:calc(var(--bs-border-radius) - (var(--bs-border-width)));--bs-accordion-btn-padding-x:1.25rem;--bs-accordion-btn-padding-y:1rem;--bs-accordion-btn-color:var(--bs-body-color);--bs-accordion-btn-bg:var(--bs-accordion-bg);--bs-accordion-btn-icon:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%23212529'%3e%3cpath fill-rule='evenodd' d='M1.646 4.646a.5.5 0 0 1 .708 0L8 10.293l5.646-5.647a.5.5 0 0 1 .708.708l-6 6a.5.5 0 0 1-.708 0l-6-6a.5.5 0 0 1 0-.708z'/%3e%3c/svg%3e");--bs-accordion-btn-icon-width:1.25rem;--bs-accordion-btn-icon-transform:rotate(-180deg);--bs-accordion-btn-icon-transition:transform 0.2s ease-in-out;--bs-accordion-btn-active-icon:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%23052c65'%3e%3cpath fill-rule='evenodd' d='M1.646 4.646a.5.5 0 0 1 .708 0L8 10.293l5.646-5.647a.5.5 0 0 1 .708.708l-6 6a.5.5 0 0 1-.708 0l-6-6a.5.5 0 0 1 0-.708z'/%3e%3c/svg%3e");--bs-accordion-btn-focus-border-color:#86b7fe;--bs-accordion-btn-focus-box-shadow:0 0 0 0.25rem rgba(13, 110, 253, 0.25);--bs-accordion-body-padding-x:1.25rem;--bs-accordion-body-padding-y:1rem;--bs-accordion-active-color:var(--bs-primary-text-emphasis);--bs-accordion-active-bg:var(--bs-primary-bg-subtle)}.accordion-button{position:relative;display:flex;align-items:center;width:100%;padding:var(--bs-accordion-btn-padding-y) var(--bs-accordion-btn-padding-x);font-size:1rem;color:var(--bs-accordion-btn-color);text-align:left;background-color:var(--bs-accordion-btn-bg);border:0;border-radius:0;overflow-anchor:none;transition:var(--bs-accordion-transition)}@media (prefers-reduced-motion:reduce){.accordion-button{transition:none}}.accordion-button:not(.collapsed){color:var(--bs-accordion-active-color);background-color:var(--bs-accordion-active-bg);box-shadow:inset 0 calc(-1 * var(--bs-accordion-border-width)) 0 var(--bs-accordion-border-color)}.accordion-button:not(.collapsed)::after{background-image:var(--bs-accordion-btn-active-icon);transform:var(--bs-accordion-btn-icon-transform)}.accordion-button::after{flex-shrink:0;width:var(--bs-accordion-btn-icon-width);height:var(--bs-accordion-btn-icon-width);margin-left:auto;content:"";background-image:var(--bs-accordion-btn-icon);background-repeat:no-repeat;background-size:var(--bs-accordion-btn-icon-width);transition:var(--bs-accordion-btn-icon-transition)}@media (prefers-reduced-motion:reduce){.accordion-button::after{transition:none}}.accordion-button:hover{z-index:2}.accordion-button:focus{z-index:3;border-color:var(--bs-accordion-btn-focus-border-color);outline:0;box-shadow:var(--bs-accordion-btn-focus-box-shadow)}.accordion-header{margin-bottom:0}.accordion-item{color:var(--bs-accordion-color);background-color:var(--bs-accordion-bg);border:var(--bs-accordion-border-width) solid var(--bs-accordion-border-color)}.accordion-item:first-of-type{border-top-left-radius:var(--bs-accordion-border-radius);border-top-right-radius:var(--bs-accordion-border-radius)}.accordion-item:first-of-type .accordion-button{border-top-left-radius:var(--bs-accordion-inner-border-radius);border-top-right-radius:var(--bs-accordion-inner-border-radius)}.accordion-item:not(:first-of-type){border-top:0}.accordion-item:last-of-type{border-bottom-right-radius:var(--bs-accordion-border-radius);border-bottom-left-radius:var(--bs-accordion-border-radius)}.accordion-item:last-of-type .accordion-button.collapsed{border-bottom-right-radius:var(--bs-accordion-inner-border-radius);border-bottom-left-radius:var(--bs-accordion-inner-border-radius)}.accordion-item:last-of-type .accordion-collapse{border-bottom-right-radius:var(--bs-accordion-border-radius);border-bottom-left-radius:var(--bs-accordion-border-radius)}.accordion-body{padding:var(--bs-accordion-body-padding-y) var(--bs-accordion-body-padding-x)}.accordion-flush .accordion-collapse{border-width:0}.accordion-flush .accordion-item{border-right:0;border-left:0;border-radius:0}.accordion-flush .accordion-item:first-child{border-top:0}.accordion-flush .accordion-item:last-child{border-bottom:0}.accordion-flush .accordion-item .accordion-button,.accordion-flush .accordion-item .accordion-button.collapsed{border-radius:0}[data-bs-theme=dark] .accordion-button::after{--bs-accordion-btn-icon:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%236ea8fe'%3e%3cpath fill-rule='evenodd' d='M1.646 4.646a.5.5 0 0 1 .708 0L8 10.293l5.646-5.647a.5.5 0 0 1 .708.708l-6 6a.5.5 0 0 1-.708 0l-6-6a.5.5 0 0 1 0-.708z'/%3e%3c/svg%3e");--bs-accordion-btn-active-icon:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%236ea8fe'%3e%3cpath fill-rule='evenodd' d='M1.646 4.646a.5.5 0 0 1 .708 0L8 10.293l5.646-5.647a.5.5 0 0 1 .708.708l-6 6a.5.5 0 0 1-.708 0l-6-6a.5.5 0 0 1 0-.708z'/%3e%3c/svg%3e")}.breadcrumb{--bs-breadcrumb-padding-x:0;--bs-breadcrumb-padding-y:0;--bs-breadcrumb-margin-bottom:1rem;--bs-breadcrumb-bg: ;--bs-breadcrumb-border-radius: ;--bs-breadcrumb-divider-color:var(--bs-secondary-color);--bs-breadcrumb-item-padding-x:0.5rem;--bs-breadcrumb-item-active-color:var(--bs-secondary-color);display:flex;flex-wrap:wrap;padding:var(--bs-breadcrumb-padding-y) var(--bs-breadcrumb-padding-x);margin-bottom:var(--bs-breadcrumb-margin-bottom);font-size:var(--bs-breadcrumb-font-size);list-style:none;background-color:var(--bs-breadcrumb-bg);border-radius:var(--bs-breadcrumb-border-radius)}.breadcrumb-item+.breadcrumb-item{padding-left:var(--bs-breadcrumb-item-padding-x)}.breadcrumb-item+.breadcrumb-item::before{float:left;padding-right:var(--bs-breadcrumb-item-padding-x);color:var(--bs-breadcrumb-divider-color);content:var(--bs-breadcrumb-divider, "/")}.breadcrumb-item.active{color:var(--bs-breadcrumb-item-active-color)}.pagination{--bs-pagination-padding-x:0.75rem;--bs-pagination-padding-y:0.375rem;--bs-pagination-font-size:1rem;--bs-pagination-color:var(--bs-link-color);--bs-pagination-bg:var(--bs-body-bg);--bs-pagination-border-width:var(--bs-border-width);--bs-pagination-border-color:var(--bs-border-color);--bs-pagination-border-radius:var(--bs-border-radius);--bs-pagination-hover-color:var(--bs-link-hover-color);--bs-pagination-hover-bg:var(--bs-tertiary-bg);--bs-pagination-hover-border-color:var(--bs-border-color);--bs-pagination-focus-color:var(--bs-link-hover-color);--bs-pagination-focus-bg:var(--bs-secondary-bg);--bs-pagination-focus-box-shadow:0 0 0 0.25rem rgba(13, 110, 253, 0.25);--bs-pagination-active-color:#fff;--bs-pagination-active-bg:#0d6efd;--bs-pagination-active-border-color:#0d6efd;--bs-pagination-disabled-color:var(--bs-secondary-color);--bs-pagination-disabled-bg:var(--bs-secondary-bg);--bs-pagination-disabled-border-color:var(--bs-border-color);display:flex;padding-left:0;list-style:none}.page-link{position:relative;display:block;padding:var(--bs-pagination-padding-y) var(--bs-pagination-padding-x);font-size:var(--bs-pagination-font-size);color:var(--bs-pagination-color);text-decoration:none;background-color:var(--bs-pagination-bg);border:var(--bs-pagination-border-width) solid var(--bs-pagination-border-color);transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out}@media (prefers-reduced-motion:reduce){.page-link{transition:none}}.page-link:hover{z-index:2;color:var(--bs-pagination-hover-color);background-color:var(--bs-pagination-hover-bg);border-color:var(--bs-pagination-hover-border-color)}.page-link:focus{z-index:3;color:var(--bs-pagination-focus-color);background-color:var(--bs-pagination-focus-bg);outline:0;box-shadow:var(--bs-pagination-focus-box-shadow)}.active>.page-link,.page-link.active{z-index:3;color:var(--bs-pagination-active-color);background-color:var(--bs-pagination-active-bg);border-color:var(--bs-pagination-active-border-color)}.disabled>.page-link,.page-link.disabled{color:var(--bs-pagination-disabled-color);pointer-events:none;background-color:var(--bs-pagination-disabled-bg);border-color:var(--bs-pagination-disabled-border-color)}.page-item:not(:first-child) .page-link{margin-left:calc(var(--bs-border-width) * -1)}.page-item:first-child .page-link{border-top-left-radius:var(--bs-pagination-border-radius);border-bottom-left-radius:var(--bs-pagination-border-radius)}.page-item:last-child .page-link{border-top-right-radius:var(--bs-pagination-border-radius);border-bottom-right-radius:var(--bs-pagination-border-radius)}.pagination-lg{--bs-pagination-padding-x:1.5rem;--bs-pagination-padding-y:0.75rem;--bs-pagination-font-size:1.25rem;--bs-pagination-border-radius:var(--bs-border-radius-lg)}.pagination-sm{--bs-pagination-padding-x:0.5rem;--bs-pagination-padding-y:0.25rem;--bs-pagination-font-size:0.875rem;--bs-pagination-border-radius:var(--bs-border-radius-sm)}.badge{--bs-badge-padding-x:0.65em;--bs-badge-padding-y:0.35em;--bs-badge-font-size:0.75em;--bs-badge-font-weight:700;--bs-badge-color:#fff;--bs-badge-border-radius:var(--bs-border-radius);display:inline-block;padding:var(--bs-badge-padding-y) var(--bs-badge-padding-x);font-size:var(--bs-badge-font-size);font-weight:var(--bs-badge-font-weight);line-height:1;color:var(--bs-badge-color);text-align:center;white-space:nowrap;vertical-align:baseline;border-radius:var(--bs-badge-border-radius)}.badge:empty{display:none}.btn .badge{position:relative;top:-1px}.alert{--bs-alert-bg:transparent;--bs-alert-padding-x:1rem;--bs-alert-padding-y:1rem;--bs-alert-margin-bottom:1rem;--bs-alert-color:inherit;--bs-alert-border-color:transparent;--bs-alert-border:var(--bs-border-width) solid var(--bs-alert-border-color);--bs-alert-border-radius:var(--bs-border-radius);--bs-alert-link-color:inherit;position:relative;padding:var(--bs-alert-padding-y) var(--bs-alert-padding-x);margin-bottom:var(--bs-alert-margin-bottom);color:var(--bs-alert-color);background-color:var(--bs-alert-bg);border:var(--bs-alert-border);border-radius:var(--bs-alert-border-radius)}.alert-heading{color:inherit}.alert-link{font-weight:700;color:var(--bs-alert-link-color)}.alert-dismissible{padding-right:3rem}.alert-dismissible .btn-close{position:absolute;top:0;right:0;z-index:2;padding:1.25rem 1rem}.alert-primary{--bs-alert-color:var(--bs-primary-text-emphasis);--bs-alert-bg:var(--bs-primary-bg-subtle);--bs-alert-border-color:var(--bs-primary-border-subtle);--bs-alert-link-color:var(--bs-primary-text-emphasis)}.alert-secondary{--bs-alert-color:var(--bs-secondary-text-emphasis);--bs-alert-bg:var(--bs-secondary-bg-subtle);--bs-alert-border-color:var(--bs-secondary-border-subtle);--bs-alert-link-color:var(--bs-secondary-text-emphasis)}.alert-success{--bs-alert-color:var(--bs-success-text-emphasis);--bs-alert-bg:var(--bs-success-bg-subtle);--bs-alert-border-color:var(--bs-success-border-subtle);--bs-alert-link-color:var(--bs-success-text-emphasis)}.alert-info{--bs-alert-color:var(--bs-info-text-emphasis);--bs-alert-bg:var(--bs-info-bg-subtle);--bs-alert-border-color:var(--bs-info-border-subtle);--bs-alert-link-color:var(--bs-info-text-emphasis)}.alert-warning{--bs-alert-color:var(--bs-warning-text-emphasis);--bs-alert-bg:var(--bs-warning-bg-subtle);--bs-alert-border-color:var(--bs-warning-border-subtle);--bs-alert-link-color:var(--bs-warning-text-emphasis)}.alert-danger{--bs-alert-color:var(--bs-danger-text-emphasis);--bs-alert-bg:var(--bs-danger-bg-subtle);--bs-alert-border-color:var(--bs-danger-border-subtle);--bs-alert-link-color:var(--bs-danger-text-emphasis)}.alert-light{--bs-alert-color:var(--bs-light-text-emphasis);--bs-alert-bg:var(--bs-light-bg-subtle);--bs-alert-border-color:var(--bs-light-border-subtle);--bs-alert-link-color:var(--bs-light-text-emphasis)}.alert-dark{--bs-alert-color:var(--bs-dark-text-emphasis);--bs-alert-bg:var(--bs-dark-bg-subtle);--bs-alert-border-color:var(--bs-dark-border-subtle);--bs-alert-link-color:var(--bs-dark-text-emphasis)}@keyframes progress-bar-stripes{0%{background-position-x:1rem}}.progress,.progress-stacked{--bs-progress-height:1rem;--bs-progress-font-size:0.75rem;--bs-progress-bg:var(--bs-secondary-bg);--bs-progress-border-radius:var(--bs-border-radius);--bs-progress-box-shadow:var(--bs-box-shadow-inset);--bs-progress-bar-color:#fff;--bs-progress-bar-bg:#0d6efd;--bs-progress-bar-transition:width 0.6s ease;display:flex;height:var(--bs-progress-height);overflow:hidden;font-size:var(--bs-progress-font-size);background-color:var(--bs-progress-bg);border-radius:var(--bs-progress-border-radius)}.progress-bar{display:flex;flex-direction:column;justify-content:center;overflow:hidden;color:var(--bs-progress-bar-color);text-align:center;white-space:nowrap;background-color:var(--bs-progress-bar-bg);transition:var(--bs-progress-bar-transition)}@media (prefers-reduced-motion:reduce){.progress-bar{transition:none}}.progress-bar-striped{background-image:linear-gradient(45deg,rgba(255,255,255,.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,.15) 50%,rgba(255,255,255,.15) 75%,transparent 75%,transparent);background-size:var(--bs-progress-height) var(--bs-progress-height)}.progress-stacked>.progress{overflow:visible}.progress-stacked>.progress>.progress-bar{width:100%}.progress-bar-animated{animation:1s linear infinite progress-bar-stripes}@media (prefers-reduced-motion:reduce){.progress-bar-animated{animation:none}}.list-group{--bs-list-group-color:var(--bs-body-color);--bs-list-group-bg:var(--bs-body-bg);--bs-list-group-border-color:var(--bs-border-color);--bs-list-group-border-width:var(--bs-border-width);--bs-list-group-border-radius:var(--bs-border-radius);--bs-list-group-item-padding-x:1rem;--bs-list-group-item-padding-y:0.5rem;--bs-list-group-action-color:var(--bs-secondary-color);--bs-list-group-action-hover-color:var(--bs-emphasis-color);--bs-list-group-action-hover-bg:var(--bs-tertiary-bg);--bs-list-group-action-active-color:var(--bs-body-color);--bs-list-group-action-active-bg:var(--bs-secondary-bg);--bs-list-group-disabled-color:var(--bs-secondary-color);--bs-list-group-disabled-bg:var(--bs-body-bg);--bs-list-group-active-color:#fff;--bs-list-group-active-bg:#0d6efd;--bs-list-group-active-border-color:#0d6efd;display:flex;flex-direction:column;padding-left:0;margin-bottom:0;border-radius:var(--bs-list-group-border-radius)}.list-group-numbered{list-style-type:none;counter-reset:section}.list-group-numbered>.list-group-item::before{content:counters(section, ".") ". ";counter-increment:section}.list-group-item-action{width:100%;color:var(--bs-list-group-action-color);text-align:inherit}.list-group-item-action:focus,.list-group-item-action:hover{z-index:1;color:var(--bs-list-group-action-hover-color);text-decoration:none;background-color:var(--bs-list-group-action-hover-bg)}.list-group-item-action:active{color:var(--bs-list-group-action-active-color);background-color:var(--bs-list-group-action-active-bg)}.list-group-item{position:relative;display:block;padding:var(--bs-list-group-item-padding-y) var(--bs-list-group-item-padding-x);color:var(--bs-list-group-color);text-decoration:none;background-color:var(--bs-list-group-bg);border:var(--bs-list-group-border-width) solid var(--bs-list-group-border-color)}.list-group-item:first-child{border-top-left-radius:inherit;border-top-right-radius:inherit}.list-group-item:last-child{border-bottom-right-radius:inherit;border-bottom-left-radius:inherit}.list-group-item.disabled,.list-group-item:disabled{color:var(--bs-list-group-disabled-color);pointer-events:none;background-color:var(--bs-list-group-disabled-bg)}.list-group-item.active{z-index:2;color:var(--bs-list-group-active-color);background-color:var(--bs-list-group-active-bg);border-color:var(--bs-list-group-active-border-color)}.list-group-item+.list-group-item{border-top-width:0}.list-group-item+.list-group-item.active{margin-top:calc(-1 * var(--bs-list-group-border-width));border-top-width:var(--bs-list-group-border-width)}.list-group-horizontal{flex-direction:row}.list-group-horizontal>.list-group-item:first-child:not(:last-child){border-bottom-left-radius:var(--bs-list-group-border-radius);border-top-right-radius:0}.list-group-horizontal>.list-group-item:last-child:not(:first-child){border-top-right-radius:var(--bs-list-group-border-radius);border-bottom-left-radius:0}.list-group-horizontal>.list-group-item.active{margin-top:0}.list-group-horizontal>.list-group-item+.list-group-item{border-top-width:var(--bs-list-group-border-width);border-left-width:0}.list-group-horizontal>.list-group-item+.list-group-item.active{margin-left:calc(-1 * var(--bs-list-group-border-width));border-left-width:var(--bs-list-group-border-width)}@media (min-width:576px){.list-group-horizontal-sm{flex-direction:row}.list-group-horizontal-sm>.list-group-item:first-child:not(:last-child){border-bottom-left-radius:var(--bs-list-group-border-radius);border-top-right-radius:0}.list-group-horizontal-sm>.list-group-item:last-child:not(:first-child){border-top-right-radius:var(--bs-list-group-border-radius);border-bottom-left-radius:0}.list-group-horizontal-sm>.list-group-item.active{margin-top:0}.list-group-horizontal-sm>.list-group-item+.list-group-item{border-top-width:var(--bs-list-group-border-width);border-left-width:0}.list-group-horizontal-sm>.list-group-item+.list-group-item.active{margin-left:calc(-1 * var(--bs-list-group-border-width));border-left-width:var(--bs-list-group-border-width)}}@media (min-width:768px){.list-group-horizontal-md{flex-direction:row}.list-group-horizontal-md>.list-group-item:first-child:not(:last-child){border-bottom-left-radius:var(--bs-list-group-border-radius);border-top-right-radius:0}.list-group-horizontal-md>.list-group-item:last-child:not(:first-child){border-top-right-radius:var(--bs-list-group-border-radius);border-bottom-left-radius:0}.list-group-horizontal-md>.list-group-item.active{margin-top:0}.list-group-horizontal-md>.list-group-item+.list-group-item{border-top-width:var(--bs-list-group-border-width);border-left-width:0}.list-group-horizontal-md>.list-group-item+.list-group-item.active{margin-left:calc(-1 * var(--bs-list-group-border-width));border-left-width:var(--bs-list-group-border-width)}}@media (min-width:992px){.list-group-horizontal-lg{flex-direction:row}.list-group-horizontal-lg>.list-group-item:first-child:not(:last-child){border-bottom-left-radius:var(--bs-list-group-border-radius);border-top-right-radius:0}.list-group-horizontal-lg>.list-group-item:last-child:not(:first-child){border-top-right-radius:var(--bs-list-group-border-radius);border-bottom-left-radius:0}.list-group-horizontal-lg>.list-group-item.active{margin-top:0}.list-group-horizontal-lg>.list-group-item+.list-group-item{border-top-width:var(--bs-list-group-border-width);border-left-width:0}.list-group-horizontal-lg>.list-group-item+.list-group-item.active{margin-left:calc(-1 * var(--bs-list-group-border-width));border-left-width:var(--bs-list-group-border-width)}}@media (min-width:1200px){.list-group-horizontal-xl{flex-direction:row}.list-group-horizontal-xl>.list-group-item:first-child:not(:last-child){border-bottom-left-radius:var(--bs-list-group-border-radius);border-top-right-radius:0}.list-group-horizontal-xl>.list-group-item:last-child:not(:first-child){border-top-right-radius:var(--bs-list-group-border-radius);border-bottom-left-radius:0}.list-group-horizontal-xl>.list-group-item.active{margin-top:0}.list-group-horizontal-xl>.list-group-item+.list-group-item{border-top-width:var(--bs-list-group-border-width);border-left-width:0}.list-group-horizontal-xl>.list-group-item+.list-group-item.active{margin-left:calc(-1 * var(--bs-list-group-border-width));border-left-width:var(--bs-list-group-border-width)}}@media (min-width:1400px){.list-group-horizontal-xxl{flex-direction:row}.list-group-horizontal-xxl>.list-group-item:first-child:not(:last-child){border-bottom-left-radius:var(--bs-list-group-border-radius);border-top-right-radius:0}.list-group-horizontal-xxl>.list-group-item:last-child:not(:first-child){border-top-right-radius:var(--bs-list-group-border-radius);border-bottom-left-radius:0}.list-group-horizontal-xxl>.list-group-item.active{margin-top:0}.list-group-horizontal-xxl>.list-group-item+.list-group-item{border-top-width:var(--bs-list-group-border-width);border-left-width:0}.list-group-horizontal-xxl>.list-group-item+.list-group-item.active{margin-left:calc(-1 * var(--bs-list-group-border-width));border-left-width:var(--bs-list-group-border-width)}}.list-group-flush{border-radius:0}.list-group-flush>.list-group-item{border-width:0 0 var(--bs-list-group-border-width)}.list-group-flush>.list-group-item:last-child{border-bottom-width:0}.list-group-item-primary{--bs-list-group-color:var(--bs-primary-text-emphasis);--bs-list-group-bg:var(--bs-primary-bg-subtle);--bs-list-group-border-color:var(--bs-primary-border-subtle);--bs-list-group-action-hover-color:var(--bs-emphasis-color);--bs-list-group-action-hover-bg:var(--bs-primary-border-subtle);--bs-list-group-action-active-color:var(--bs-emphasis-color);--bs-list-group-action-active-bg:var(--bs-primary-border-subtle);--bs-list-group-active-color:var(--bs-primary-bg-subtle);--bs-list-group-active-bg:var(--bs-primary-text-emphasis);--bs-list-group-active-border-color:var(--bs-primary-text-emphasis)}.list-group-item-secondary{--bs-list-group-color:var(--bs-secondary-text-emphasis);--bs-list-group-bg:var(--bs-secondary-bg-subtle);--bs-list-group-border-color:var(--bs-secondary-border-subtle);--bs-list-group-action-hover-color:var(--bs-emphasis-color);--bs-list-group-action-hover-bg:var(--bs-secondary-border-subtle);--bs-list-group-action-active-color:var(--bs-emphasis-color);--bs-list-group-action-active-bg:var(--bs-secondary-border-subtle);--bs-list-group-active-color:var(--bs-secondary-bg-subtle);--bs-list-group-active-bg:var(--bs-secondary-text-emphasis);--bs-list-group-active-border-color:var(--bs-secondary-text-emphasis)}.list-group-item-success{--bs-list-group-color:var(--bs-success-text-emphasis);--bs-list-group-bg:var(--bs-success-bg-subtle);--bs-list-group-border-color:var(--bs-success-border-subtle);--bs-list-group-action-hover-color:var(--bs-emphasis-color);--bs-list-group-action-hover-bg:var(--bs-success-border-subtle);--bs-list-group-action-active-color:var(--bs-emphasis-color);--bs-list-group-action-active-bg:var(--bs-success-border-subtle);--bs-list-group-active-color:var(--bs-success-bg-subtle);--bs-list-group-active-bg:var(--bs-success-text-emphasis);--bs-list-group-active-border-color:var(--bs-success-text-emphasis)}.list-group-item-info{--bs-list-group-color:var(--bs-info-text-emphasis);--bs-list-group-bg:var(--bs-info-bg-subtle);--bs-list-group-border-color:var(--bs-info-border-subtle);--bs-list-group-action-hover-color:var(--bs-emphasis-color);--bs-list-group-action-hover-bg:var(--bs-info-border-subtle);--bs-list-group-action-active-color:var(--bs-emphasis-color);--bs-list-group-action-active-bg:var(--bs-info-border-subtle);--bs-list-group-active-color:var(--bs-info-bg-subtle);--bs-list-group-active-bg:var(--bs-info-text-emphasis);--bs-list-group-active-border-color:var(--bs-info-text-emphasis)}.list-group-item-warning{--bs-list-group-color:var(--bs-warning-text-emphasis);--bs-list-group-bg:var(--bs-warning-bg-subtle);--bs-list-group-border-color:var(--bs-warning-border-subtle);--bs-list-group-action-hover-color:var(--bs-emphasis-color);--bs-list-group-action-hover-bg:var(--bs-warning-border-subtle);--bs-list-group-action-active-color:var(--bs-emphasis-color);--bs-list-group-action-active-bg:var(--bs-warning-border-subtle);--bs-list-group-active-color:var(--bs-warning-bg-subtle);--bs-list-group-active-bg:var(--bs-warning-text-emphasis);--bs-list-group-active-border-color:var(--bs-warning-text-emphasis)}.list-group-item-danger{--bs-list-group-color:var(--bs-danger-text-emphasis);--bs-list-group-bg:var(--bs-danger-bg-subtle);--bs-list-group-border-color:var(--bs-danger-border-subtle);--bs-list-group-action-hover-color:var(--bs-emphasis-color);--bs-list-group-action-hover-bg:var(--bs-danger-border-subtle);--bs-list-group-action-active-color:var(--bs-emphasis-color);--bs-list-group-action-active-bg:var(--bs-danger-border-subtle);--bs-list-group-active-color:var(--bs-danger-bg-subtle);--bs-list-group-active-bg:var(--bs-danger-text-emphasis);--bs-list-group-active-border-color:var(--bs-danger-text-emphasis)}.list-group-item-light{--bs-list-group-color:var(--bs-light-text-emphasis);--bs-list-group-bg:var(--bs-light-bg-subtle);--bs-list-group-border-color:var(--bs-light-border-subtle);--bs-list-group-action-hover-color:var(--bs-emphasis-color);--bs-list-group-action-hover-bg:var(--bs-light-border-subtle);--bs-list-group-action-active-color:var(--bs-emphasis-color);--bs-list-group-action-active-bg:var(--bs-light-border-subtle);--bs-list-group-active-color:var(--bs-light-bg-subtle);--bs-list-group-active-bg:var(--bs-light-text-emphasis);--bs-list-group-active-border-color:var(--bs-light-text-emphasis)}.list-group-item-dark{--bs-list-group-color:var(--bs-dark-text-emphasis);--bs-list-group-bg:var(--bs-dark-bg-subtle);--bs-list-group-border-color:var(--bs-dark-border-subtle);--bs-list-group-action-hover-color:var(--bs-emphasis-color);--bs-list-group-action-hover-bg:var(--bs-dark-border-subtle);--bs-list-group-action-active-color:var(--bs-emphasis-color);--bs-list-group-action-active-bg:var(--bs-dark-border-subtle);--bs-list-group-active-color:var(--bs-dark-bg-subtle);--bs-list-group-active-bg:var(--bs-dark-text-emphasis);--bs-list-group-active-border-color:var(--bs-dark-text-emphasis)}.btn-close{--bs-btn-close-color:#000;--bs-btn-close-bg:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%23000'%3e%3cpath d='M.293.293a1 1 0 0 1 1.414 0L8 6.586 14.293.293a1 1 0 1 1 1.414 1.414L9.414 8l6.293 6.293a1 1 0 0 1-1.414 1.414L8 9.414l-6.293 6.293a1 1 0 0 1-1.414-1.414L6.586 8 .293 1.707a1 1 0 0 1 0-1.414z'/%3e%3c/svg%3e");--bs-btn-close-opacity:0.5;--bs-btn-close-hover-opacity:0.75;--bs-btn-close-focus-shadow:0 0 0 0.25rem rgba(13, 110, 253, 0.25);--bs-btn-close-focus-opacity:1;--bs-btn-close-disabled-opacity:0.25;--bs-btn-close-white-filter:invert(1) grayscale(100%) brightness(200%);box-sizing:content-box;width:1em;height:1em;padding:.25em .25em;color:var(--bs-btn-close-color);background:transparent var(--bs-btn-close-bg) center/1em auto no-repeat;border:0;border-radius:.375rem;opacity:var(--bs-btn-close-opacity)}.btn-close:hover{color:var(--bs-btn-close-color);text-decoration:none;opacity:var(--bs-btn-close-hover-opacity)}.btn-close:focus{outline:0;box-shadow:var(--bs-btn-close-focus-shadow);opacity:var(--bs-btn-close-focus-opacity)}.btn-close.disabled,.btn-close:disabled{pointer-events:none;-webkit-user-select:none;-moz-user-select:none;user-select:none;opacity:var(--bs-btn-close-disabled-opacity)}.btn-close-white{filter:var(--bs-btn-close-white-filter)}[data-bs-theme=dark] .btn-close{filter:var(--bs-btn-close-white-filter)}.toast{--bs-toast-zindex:1090;--bs-toast-padding-x:0.75rem;--bs-toast-padding-y:0.5rem;--bs-toast-spacing:1.5rem;--bs-toast-max-width:350px;--bs-toast-font-size:0.875rem;--bs-toast-color: ;--bs-toast-bg:rgba(var(--bs-body-bg-rgb), 0.85);--bs-toast-border-width:var(--bs-border-width);--bs-toast-border-color:var(--bs-border-color-translucent);--bs-toast-border-radius:var(--bs-border-radius);--bs-toast-box-shadow:var(--bs-box-shadow);--bs-toast-header-color:var(--bs-secondary-color);--bs-toast-header-bg:rgba(var(--bs-body-bg-rgb), 0.85);--bs-toast-header-border-color:var(--bs-border-color-translucent);width:var(--bs-toast-max-width);max-width:100%;font-size:var(--bs-toast-font-size);color:var(--bs-toast-color);pointer-events:auto;background-color:var(--bs-toast-bg);background-clip:padding-box;border:var(--bs-toast-border-width) solid var(--bs-toast-border-color);box-shadow:var(--bs-toast-box-shadow);border-radius:var(--bs-toast-border-radius)}.toast.showing{opacity:0}.toast:not(.show){display:none}.toast-container{--bs-toast-zindex:1090;position:absolute;z-index:var(--bs-toast-zindex);width:-webkit-max-content;width:-moz-max-content;width:max-content;max-width:100%;pointer-events:none}.toast-container>:not(:last-child){margin-bottom:var(--bs-toast-spacing)}.toast-header{display:flex;align-items:center;padding:var(--bs-toast-padding-y) var(--bs-toast-padding-x);color:var(--bs-toast-header-color);background-color:var(--bs-toast-header-bg);background-clip:padding-box;border-bottom:var(--bs-toast-border-width) solid var(--bs-toast-header-border-color);border-top-left-radius:calc(var(--bs-toast-border-radius) - var(--bs-toast-border-width));border-top-right-radius:calc(var(--bs-toast-border-radius) - var(--bs-toast-border-width))}.toast-header .btn-close{margin-right:calc(-.5 * var(--bs-toast-padding-x));margin-left:var(--bs-toast-padding-x)}.toast-body{padding:var(--bs-toast-padding-x);word-wrap:break-word}.modal{--bs-modal-zindex:1055;--bs-modal-width:500px;--bs-modal-padding:1rem;--bs-modal-margin:0.5rem;--bs-modal-color: ;--bs-modal-bg:var(--bs-body-bg);--bs-modal-border-color:var(--bs-border-color-translucent);--bs-modal-border-width:var(--bs-border-width);--bs-modal-border-radius:var(--bs-border-radius-lg);--bs-modal-box-shadow:var(--bs-box-shadow-sm);--bs-modal-inner-border-radius:calc(var(--bs-border-radius-lg) - (var(--bs-border-width)));--bs-modal-header-padding-x:1rem;--bs-modal-header-padding-y:1rem;--bs-modal-header-padding:1rem 1rem;--bs-modal-header-border-color:var(--bs-border-color);--bs-modal-header-border-width:var(--bs-border-width);--bs-modal-title-line-height:1.5;--bs-modal-footer-gap:0.5rem;--bs-modal-footer-bg: ;--bs-modal-footer-border-color:var(--bs-border-color);--bs-modal-footer-border-width:var(--bs-border-width);position:fixed;top:0;left:0;z-index:var(--bs-modal-zindex);display:none;width:100%;height:100%;overflow-x:hidden;overflow-y:auto;outline:0}.modal-dialog{position:relative;width:auto;margin:var(--bs-modal-margin);pointer-events:none}.modal.fade .modal-dialog{transition:transform .3s ease-out;transform:translate(0,-50px)}@media (prefers-reduced-motion:reduce){.modal.fade .modal-dialog{transition:none}}.modal.show .modal-dialog{transform:none}.modal.modal-static .modal-dialog{transform:scale(1.02)}.modal-dialog-scrollable{height:calc(100% - var(--bs-modal-margin) * 2)}.modal-dialog-scrollable .modal-content{max-height:100%;overflow:hidden}.modal-dialog-scrollable .modal-body{overflow-y:auto}.modal-dialog-centered{display:flex;align-items:center;min-height:calc(100% - var(--bs-modal-margin) * 2)}.modal-content{position:relative;display:flex;flex-direction:column;width:100%;color:var(--bs-modal-color);pointer-events:auto;background-color:var(--bs-modal-bg);background-clip:padding-box;border:var(--bs-modal-border-width) solid var(--bs-modal-border-color);border-radius:var(--bs-modal-border-radius);outline:0}.modal-backdrop{--bs-backdrop-zindex:1050;--bs-backdrop-bg:#000;--bs-backdrop-opacity:0.5;position:fixed;top:0;left:0;z-index:var(--bs-backdrop-zindex);width:100vw;height:100vh;background-color:var(--bs-backdrop-bg)}.modal-backdrop.fade{opacity:0}.modal-backdrop.show{opacity:var(--bs-backdrop-opacity)}.modal-header{display:flex;flex-shrink:0;align-items:center;justify-content:space-between;padding:var(--bs-modal-header-padding);border-bottom:var(--bs-modal-header-border-width) solid var(--bs-modal-header-border-color);border-top-left-radius:var(--bs-modal-inner-border-radius);border-top-right-radius:var(--bs-modal-inner-border-radius)}.modal-header .btn-close{padding:calc(var(--bs-modal-header-padding-y) * .5) calc(var(--bs-modal-header-padding-x) * .5);margin:calc(-.5 * var(--bs-modal-header-padding-y)) calc(-.5 * var(--bs-modal-header-padding-x)) calc(-.5 * var(--bs-modal-header-padding-y)) auto}.modal-title{margin-bottom:0;line-height:var(--bs-modal-title-line-height)}.modal-body{position:relative;flex:1 1 auto;padding:var(--bs-modal-padding)}.modal-footer{display:flex;flex-shrink:0;flex-wrap:wrap;align-items:center;justify-content:flex-end;padding:calc(var(--bs-modal-padding) - var(--bs-modal-footer-gap) * .5);background-color:var(--bs-modal-footer-bg);border-top:var(--bs-modal-footer-border-width) solid var(--bs-modal-footer-border-color);border-bottom-right-radius:var(--bs-modal-inner-border-radius);border-bottom-left-radius:var(--bs-modal-inner-border-radius)}.modal-footer>*{margin:calc(var(--bs-modal-footer-gap) * .5)}@media (min-width:576px){.modal{--bs-modal-margin:1.75rem;--bs-modal-box-shadow:var(--bs-box-shadow)}.modal-dialog{max-width:var(--bs-modal-width);margin-right:auto;margin-left:auto}.modal-sm{--bs-modal-width:300px}}@media (min-width:992px){.modal-lg,.modal-xl{--bs-modal-width:800px}}@media (min-width:1200px){.modal-xl{--bs-modal-width:1140px}}.modal-fullscreen{width:100vw;max-width:none;height:100%;margin:0}.modal-fullscreen .modal-content{height:100%;border:0;border-radius:0}.modal-fullscreen .modal-footer,.modal-fullscreen .modal-header{border-radius:0}.modal-fullscreen .modal-body{overflow-y:auto}@media (max-width:575.98px){.modal-fullscreen-sm-down{width:100vw;max-width:none;height:100%;margin:0}.modal-fullscreen-sm-down .modal-content{height:100%;border:0;border-radius:0}.modal-fullscreen-sm-down .modal-footer,.modal-fullscreen-sm-down .modal-header{border-radius:0}.modal-fullscreen-sm-down .modal-body{overflow-y:auto}}@media (max-width:767.98px){.modal-fullscreen-md-down{width:100vw;max-width:none;height:100%;margin:0}.modal-fullscreen-md-down .modal-content{height:100%;border:0;border-radius:0}.modal-fullscreen-md-down .modal-footer,.modal-fullscreen-md-down .modal-header{border-radius:0}.modal-fullscreen-md-down .modal-body{overflow-y:auto}}@media (max-width:991.98px){.modal-fullscreen-lg-down{width:100vw;max-width:none;height:100%;margin:0}.modal-fullscreen-lg-down .modal-content{height:100%;border:0;border-radius:0}.modal-fullscreen-lg-down .modal-footer,.modal-fullscreen-lg-down .modal-header{border-radius:0}.modal-fullscreen-lg-down .modal-body{overflow-y:auto}}@media (max-width:1199.98px){.modal-fullscreen-xl-down{width:100vw;max-width:none;height:100%;margin:0}.modal-fullscreen-xl-down .modal-content{height:100%;border:0;border-radius:0}.modal-fullscreen-xl-down .modal-footer,.modal-fullscreen-xl-down .modal-header{border-radius:0}.modal-fullscreen-xl-down .modal-body{overflow-y:auto}}@media (max-width:1399.98px){.modal-fullscreen-xxl-down{width:100vw;max-width:none;height:100%;margin:0}.modal-fullscreen-xxl-down .modal-content{height:100%;border:0;border-radius:0}.modal-fullscreen-xxl-down .modal-footer,.modal-fullscreen-xxl-down .modal-header{border-radius:0}.modal-fullscreen-xxl-down .modal-body{overflow-y:auto}}.tooltip{--bs-tooltip-zindex:1080;--bs-tooltip-max-width:200px;--bs-tooltip-padding-x:0.5rem;--bs-tooltip-padding-y:0.25rem;--bs-tooltip-margin: ;--bs-tooltip-font-size:0.875rem;--bs-tooltip-color:var(--bs-body-bg);--bs-tooltip-bg:var(--bs-emphasis-color);--bs-tooltip-border-radius:var(--bs-border-radius);--bs-tooltip-opacity:0.9;--bs-tooltip-arrow-width:0.8rem;--bs-tooltip-arrow-height:0.4rem;z-index:var(--bs-tooltip-zindex);display:block;margin:var(--bs-tooltip-margin);font-family:var(--bs-font-sans-serif);font-style:normal;font-weight:400;line-height:1.5;text-align:left;text-align:start;text-decoration:none;text-shadow:none;text-transform:none;letter-spacing:normal;word-break:normal;white-space:normal;word-spacing:normal;line-break:auto;font-size:var(--bs-tooltip-font-size);word-wrap:break-word;opacity:0}.tooltip.show{opacity:var(--bs-tooltip-opacity)}.tooltip .tooltip-arrow{display:block;width:var(--bs-tooltip-arrow-width);height:var(--bs-tooltip-arrow-height)}.tooltip .tooltip-arrow::before{position:absolute;content:"";border-color:transparent;border-style:solid}.bs-tooltip-auto[data-popper-placement^=top] .tooltip-arrow,.bs-tooltip-top .tooltip-arrow{bottom:calc(-1 * var(--bs-tooltip-arrow-height))}.bs-tooltip-auto[data-popper-placement^=top] .tooltip-arrow::before,.bs-tooltip-top .tooltip-arrow::before{top:-1px;border-width:var(--bs-tooltip-arrow-height) calc(var(--bs-tooltip-arrow-width) * .5) 0;border-top-color:var(--bs-tooltip-bg)}.bs-tooltip-auto[data-popper-placement^=right] .tooltip-arrow,.bs-tooltip-end .tooltip-arrow{left:calc(-1 * var(--bs-tooltip-arrow-height));width:var(--bs-tooltip-arrow-height);height:var(--bs-tooltip-arrow-width)}.bs-tooltip-auto[data-popper-placement^=right] .tooltip-arrow::before,.bs-tooltip-end .tooltip-arrow::before{right:-1px;border-width:calc(var(--bs-tooltip-arrow-width) * .5) var(--bs-tooltip-arrow-height) calc(var(--bs-tooltip-arrow-width) * .5) 0;border-right-color:var(--bs-tooltip-bg)}.bs-tooltip-auto[data-popper-placement^=bottom] .tooltip-arrow,.bs-tooltip-bottom .tooltip-arrow{top:calc(-1 * var(--bs-tooltip-arrow-height))}.bs-tooltip-auto[data-popper-placement^=bottom] .tooltip-arrow::before,.bs-tooltip-bottom .tooltip-arrow::before{bottom:-1px;border-width:0 calc(var(--bs-tooltip-arrow-width) * .5) var(--bs-tooltip-arrow-height);border-bottom-color:var(--bs-tooltip-bg)}.bs-tooltip-auto[data-popper-placement^=left] .tooltip-arrow,.bs-tooltip-start .tooltip-arrow{right:calc(-1 * var(--bs-tooltip-arrow-height));width:var(--bs-tooltip-arrow-height);height:var(--bs-tooltip-arrow-width)}.bs-tooltip-auto[data-popper-placement^=left] .tooltip-arrow::before,.bs-tooltip-start .tooltip-arrow::before{left:-1px;border-width:calc(var(--bs-tooltip-arrow-width) * .5) 0 calc(var(--bs-tooltip-arrow-width) * .5) var(--bs-tooltip-arrow-height);border-left-color:var(--bs-tooltip-bg)}.tooltip-inner{max-width:var(--bs-tooltip-max-width);padding:var(--bs-tooltip-padding-y) var(--bs-tooltip-padding-x);color:var(--bs-tooltip-color);text-align:center;background-color:var(--bs-tooltip-bg);border-radius:var(--bs-tooltip-border-radius)}.popover{--bs-popover-zindex:1070;--bs-popover-max-width:276px;--bs-popover-font-size:0.875rem;--bs-popover-bg:var(--bs-body-bg);--bs-popover-border-width:var(--bs-border-width);--bs-popover-border-color:var(--bs-border-color-translucent);--bs-popover-border-radius:var(--bs-border-radius-lg);--bs-popover-inner-border-radius:calc(var(--bs-border-radius-lg) - var(--bs-border-width));--bs-popover-box-shadow:var(--bs-box-shadow);--bs-popover-header-padding-x:1rem;--bs-popover-header-padding-y:0.5rem;--bs-popover-header-font-size:1rem;--bs-popover-header-color:inherit;--bs-popover-header-bg:var(--bs-secondary-bg);--bs-popover-body-padding-x:1rem;--bs-popover-body-padding-y:1rem;--bs-popover-body-color:var(--bs-body-color);--bs-popover-arrow-width:1rem;--bs-popover-arrow-height:0.5rem;--bs-popover-arrow-border:var(--bs-popover-border-color);z-index:var(--bs-popover-zindex);display:block;max-width:var(--bs-popover-max-width);font-family:var(--bs-font-sans-serif);font-style:normal;font-weight:400;line-height:1.5;text-align:left;text-align:start;text-decoration:none;text-shadow:none;text-transform:none;letter-spacing:normal;word-break:normal;white-space:normal;word-spacing:normal;line-break:auto;font-size:var(--bs-popover-font-size);word-wrap:break-word;background-color:var(--bs-popover-bg);background-clip:padding-box;border:var(--bs-popover-border-width) solid var(--bs-popover-border-color);border-radius:var(--bs-popover-border-radius)}.popover .popover-arrow{display:block;width:var(--bs-popover-arrow-width);height:var(--bs-popover-arrow-height)}.popover .popover-arrow::after,.popover .popover-arrow::before{position:absolute;display:block;content:"";border-color:transparent;border-style:solid;border-width:0}.bs-popover-auto[data-popper-placement^=top]>.popover-arrow,.bs-popover-top>.popover-arrow{bottom:calc(-1 * (var(--bs-popover-arrow-height)) - var(--bs-popover-border-width))}.bs-popover-auto[data-popper-placement^=top]>.popover-arrow::after,.bs-popover-auto[data-popper-placement^=top]>.popover-arrow::before,.bs-popover-top>.popover-arrow::after,.bs-popover-top>.popover-arrow::before{border-width:var(--bs-popover-arrow-height) calc(var(--bs-popover-arrow-width) * .5) 0}.bs-popover-auto[data-popper-placement^=top]>.popover-arrow::before,.bs-popover-top>.popover-arrow::before{bottom:0;border-top-color:var(--bs-popover-arrow-border)}.bs-popover-auto[data-popper-placement^=top]>.popover-arrow::after,.bs-popover-top>.popover-arrow::after{bottom:var(--bs-popover-border-width);border-top-color:var(--bs-popover-bg)}.bs-popover-auto[data-popper-placement^=right]>.popover-arrow,.bs-popover-end>.popover-arrow{left:calc(-1 * (var(--bs-popover-arrow-height)) - var(--bs-popover-border-width));width:var(--bs-popover-arrow-height);height:var(--bs-popover-arrow-width)}.bs-popover-auto[data-popper-placement^=right]>.popover-arrow::after,.bs-popover-auto[data-popper-placement^=right]>.popover-arrow::before,.bs-popover-end>.popover-arrow::after,.bs-popover-end>.popover-arrow::before{border-width:calc(var(--bs-popover-arrow-width) * .5) var(--bs-popover-arrow-height) calc(var(--bs-popover-arrow-width) * .5) 0}.bs-popover-auto[data-popper-placement^=right]>.popover-arrow::before,.bs-popover-end>.popover-arrow::before{left:0;border-right-color:var(--bs-popover-arrow-border)}.bs-popover-auto[data-popper-placement^=right]>.popover-arrow::after,.bs-popover-end>.popover-arrow::after{left:var(--bs-popover-border-width);border-right-color:var(--bs-popover-bg)}.bs-popover-auto[data-popper-placement^=bottom]>.popover-arrow,.bs-popover-bottom>.popover-arrow{top:calc(-1 * (var(--bs-popover-arrow-height)) - var(--bs-popover-border-width))}.bs-popover-auto[data-popper-placement^=bottom]>.popover-arrow::after,.bs-popover-auto[data-popper-placement^=bottom]>.popover-arrow::before,.bs-popover-bottom>.popover-arrow::after,.bs-popover-bottom>.popover-arrow::before{border-width:0 calc(var(--bs-popover-arrow-width) * .5) var(--bs-popover-arrow-height)}.bs-popover-auto[data-popper-placement^=bottom]>.popover-arrow::before,.bs-popover-bottom>.popover-arrow::before{top:0;border-bottom-color:var(--bs-popover-arrow-border)}.bs-popover-auto[data-popper-placement^=bottom]>.popover-arrow::after,.bs-popover-bottom>.popover-arrow::after{top:var(--bs-popover-border-width);border-bottom-color:var(--bs-popover-bg)}.bs-popover-auto[data-popper-placement^=bottom] .popover-header::before,.bs-popover-bottom .popover-header::before{position:absolute;top:0;left:50%;display:block;width:var(--bs-popover-arrow-width);margin-left:calc(-.5 * var(--bs-popover-arrow-width));content:"";border-bottom:var(--bs-popover-border-width) solid var(--bs-popover-header-bg)}.bs-popover-auto[data-popper-placement^=left]>.popover-arrow,.bs-popover-start>.popover-arrow{right:calc(-1 * (var(--bs-popover-arrow-height)) - var(--bs-popover-border-width));width:var(--bs-popover-arrow-height);height:var(--bs-popover-arrow-width)}.bs-popover-auto[data-popper-placement^=left]>.popover-arrow::after,.bs-popover-auto[data-popper-placement^=left]>.popover-arrow::before,.bs-popover-start>.popover-arrow::after,.bs-popover-start>.popover-arrow::before{border-width:calc(var(--bs-popover-arrow-width) * .5) 0 calc(var(--bs-popover-arrow-width) * .5) var(--bs-popover-arrow-height)}.bs-popover-auto[data-popper-placement^=left]>.popover-arrow::before,.bs-popover-start>.popover-arrow::before{right:0;border-left-color:var(--bs-popover-arrow-border)}.bs-popover-auto[data-popper-placement^=left]>.popover-arrow::after,.bs-popover-start>.popover-arrow::after{right:var(--bs-popover-border-width);border-left-color:var(--bs-popover-bg)}.popover-header{padding:var(--bs-popover-header-padding-y) var(--bs-popover-header-padding-x);margin-bottom:0;font-size:var(--bs-popover-header-font-size);color:var(--bs-popover-header-color);background-color:var(--bs-popover-header-bg);border-bottom:var(--bs-popover-border-width) solid var(--bs-popover-border-color);border-top-left-radius:var(--bs-popover-inner-border-radius);border-top-right-radius:var(--bs-popover-inner-border-radius)}.popover-header:empty{display:none}.popover-body{padding:var(--bs-popover-body-padding-y) var(--bs-popover-body-padding-x);color:var(--bs-popover-body-color)}.carousel{position:relative}.carousel.pointer-event{touch-action:pan-y}.carousel-inner{position:relative;width:100%;overflow:hidden}.carousel-inner::after{display:block;clear:both;content:""}.carousel-item{position:relative;display:none;float:left;width:100%;margin-right:-100%;-webkit-backface-visibility:hidden;backface-visibility:hidden;transition:transform .6s ease-in-out}@media (prefers-reduced-motion:reduce){.carousel-item{transition:none}}.carousel-item-next,.carousel-item-prev,.carousel-item.active{display:block}.active.carousel-item-end,.carousel-item-next:not(.carousel-item-start){transform:translateX(100%)}.active.carousel-item-start,.carousel-item-prev:not(.carousel-item-end){transform:translateX(-100%)}.carousel-fade .carousel-item{opacity:0;transition-property:opacity;transform:none}.carousel-fade .carousel-item-next.carousel-item-start,.carousel-fade .carousel-item-prev.carousel-item-end,.carousel-fade .carousel-item.active{z-index:1;opacity:1}.carousel-fade .active.carousel-item-end,.carousel-fade .active.carousel-item-start{z-index:0;opacity:0;transition:opacity 0s .6s}@media (prefers-reduced-motion:reduce){.carousel-fade .active.carousel-item-end,.carousel-fade .active.carousel-item-start{transition:none}}.carousel-control-next,.carousel-control-prev{position:absolute;top:0;bottom:0;z-index:1;display:flex;align-items:center;justify-content:center;width:15%;padding:0;color:#fff;text-align:center;background:0 0;border:0;opacity:.5;transition:opacity .15s ease}@media (prefers-reduced-motion:reduce){.carousel-control-next,.carousel-control-prev{transition:none}}.carousel-control-next:focus,.carousel-control-next:hover,.carousel-control-prev:focus,.carousel-control-prev:hover{color:#fff;text-decoration:none;outline:0;opacity:.9}.carousel-control-prev{left:0}.carousel-control-next{right:0}.carousel-control-next-icon,.carousel-control-prev-icon{display:inline-block;width:2rem;height:2rem;background-repeat:no-repeat;background-position:50%;background-size:100% 100%}.carousel-control-prev-icon{background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%23fff'%3e%3cpath d='M11.354 1.646a.5.5 0 0 1 0 .708L5.707 8l5.647 5.646a.5.5 0 0 1-.708.708l-6-6a.5.5 0 0 1 0-.708l6-6a.5.5 0 0 1 .708 0z'/%3e%3c/svg%3e")}.carousel-control-next-icon{background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%23fff'%3e%3cpath d='M4.646 1.646a.5.5 0 0 1 .708 0l6 6a.5.5 0 0 1 0 .708l-6 6a.5.5 0 0 1-.708-.708L10.293 8 4.646 2.354a.5.5 0 0 1 0-.708z'/%3e%3c/svg%3e")}.carousel-indicators{position:absolute;right:0;bottom:0;left:0;z-index:2;display:flex;justify-content:center;padding:0;margin-right:15%;margin-bottom:1rem;margin-left:15%}.carousel-indicators [data-bs-target]{box-sizing:content-box;flex:0 1 auto;width:30px;height:3px;padding:0;margin-right:3px;margin-left:3px;text-indent:-999px;cursor:pointer;background-color:#fff;background-clip:padding-box;border:0;border-top:10px solid transparent;border-bottom:10px solid transparent;opacity:.5;transition:opacity .6s ease}@media (prefers-reduced-motion:reduce){.carousel-indicators [data-bs-target]{transition:none}}.carousel-indicators .active{opacity:1}.carousel-caption{position:absolute;right:15%;bottom:1.25rem;left:15%;padding-top:1.25rem;padding-bottom:1.25rem;color:#fff;text-align:center}.carousel-dark .carousel-control-next-icon,.carousel-dark .carousel-control-prev-icon{filter:invert(1) grayscale(100)}.carousel-dark .carousel-indicators [data-bs-target]{background-color:#000}.carousel-dark .carousel-caption{color:#000}[data-bs-theme=dark] .carousel .carousel-control-next-icon,[data-bs-theme=dark] .carousel .carousel-control-prev-icon,[data-bs-theme=dark].carousel .carousel-control-next-icon,[data-bs-theme=dark].carousel .carousel-control-prev-icon{filter:invert(1) grayscale(100)}[data-bs-theme=dark] .carousel .carousel-indicators [data-bs-target],[data-bs-theme=dark].carousel .carousel-indicators [data-bs-target]{background-color:#000}[data-bs-theme=dark] .carousel .carousel-caption,[data-bs-theme=dark].carousel .carousel-caption{color:#000}.spinner-border,.spinner-grow{display:inline-block;width:var(--bs-spinner-width);height:var(--bs-spinner-height);vertical-align:var(--bs-spinner-vertical-align);border-radius:50%;animation:var(--bs-spinner-animation-speed) linear infinite var(--bs-spinner-animation-name)}@keyframes spinner-border{to{transform:rotate(360deg)}}.spinner-border{--bs-spinner-width:2rem;--bs-spinner-height:2rem;--bs-spinner-vertical-align:-0.125em;--bs-spinner-border-width:0.25em;--bs-spinner-animation-speed:0.75s;--bs-spinner-animation-name:spinner-border;border:var(--bs-spinner-border-width) solid currentcolor;border-right-color:transparent}.spinner-border-sm{--bs-spinner-width:1rem;--bs-spinner-height:1rem;--bs-spinner-border-width:0.2em}@keyframes spinner-grow{0%{transform:scale(0)}50%{opacity:1;transform:none}}.spinner-grow{--bs-spinner-width:2rem;--bs-spinner-height:2rem;--bs-spinner-vertical-align:-0.125em;--bs-spinner-animation-speed:0.75s;--bs-spinner-animation-name:spinner-grow;background-color:currentcolor;opacity:0}.spinner-grow-sm{--bs-spinner-width:1rem;--bs-spinner-height:1rem}@media (prefers-reduced-motion:reduce){.spinner-border,.spinner-grow{--bs-spinner-animation-speed:1.5s}}.offcanvas,.offcanvas-lg,.offcanvas-md,.offcanvas-sm,.offcanvas-xl,.offcanvas-xxl{--bs-offcanvas-zindex:1045;--bs-offcanvas-width:400px;--bs-offcanvas-height:30vh;--bs-offcanvas-padding-x:1rem;--bs-offcanvas-padding-y:1rem;--bs-offcanvas-color:var(--bs-body-color);--bs-offcanvas-bg:var(--bs-body-bg);--bs-offcanvas-border-width:var(--bs-border-width);--bs-offcanvas-border-color:var(--bs-border-color-translucent);--bs-offcanvas-box-shadow:var(--bs-box-shadow-sm);--bs-offcanvas-transition:transform 0.3s ease-in-out;--bs-offcanvas-title-line-height:1.5}@media (max-width:575.98px){.offcanvas-sm{position:fixed;bottom:0;z-index:var(--bs-offcanvas-zindex);display:flex;flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;transition:var(--bs-offcanvas-transition)}}@media (max-width:575.98px) and (prefers-reduced-motion:reduce){.offcanvas-sm{transition:none}}@media (max-width:575.98px){.offcanvas-sm.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}.offcanvas-sm.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}.offcanvas-sm.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}.offcanvas-sm.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}.offcanvas-sm.show:not(.hiding),.offcanvas-sm.showing{transform:none}.offcanvas-sm.hiding,.offcanvas-sm.show,.offcanvas-sm.showing{visibility:visible}}@media (min-width:576px){.offcanvas-sm{--bs-offcanvas-height:auto;--bs-offcanvas-border-width:0;background-color:transparent!important}.offcanvas-sm .offcanvas-header{display:none}.offcanvas-sm .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible;background-color:transparent!important}}@media (max-width:767.98px){.offcanvas-md{position:fixed;bottom:0;z-index:var(--bs-offcanvas-zindex);display:flex;flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;transition:var(--bs-offcanvas-transition)}}@media (max-width:767.98px) and (prefers-reduced-motion:reduce){.offcanvas-md{transition:none}}@media (max-width:767.98px){.offcanvas-md.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}.offcanvas-md.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}.offcanvas-md.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}.offcanvas-md.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}.offcanvas-md.show:not(.hiding),.offcanvas-md.showing{transform:none}.offcanvas-md.hiding,.offcanvas-md.show,.offcanvas-md.showing{visibility:visible}}@media (min-width:768px){.offcanvas-md{--bs-offcanvas-height:auto;--bs-offcanvas-border-width:0;background-color:transparent!important}.offcanvas-md .offcanvas-header{display:none}.offcanvas-md .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible;background-color:transparent!important}}@media (max-width:991.98px){.offcanvas-lg{position:fixed;bottom:0;z-index:var(--bs-offcanvas-zindex);display:flex;flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;transition:var(--bs-offcanvas-transition)}}@media (max-width:991.98px) and (prefers-reduced-motion:reduce){.offcanvas-lg{transition:none}}@media (max-width:991.98px){.offcanvas-lg.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}.offcanvas-lg.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}.offcanvas-lg.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}.offcanvas-lg.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}.offcanvas-lg.show:not(.hiding),.offcanvas-lg.showing{transform:none}.offcanvas-lg.hiding,.offcanvas-lg.show,.offcanvas-lg.showing{visibility:visible}}@media (min-width:992px){.offcanvas-lg{--bs-offcanvas-height:auto;--bs-offcanvas-border-width:0;background-color:transparent!important}.offcanvas-lg .offcanvas-header{display:none}.offcanvas-lg .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible;background-color:transparent!important}}@media (max-width:1199.98px){.offcanvas-xl{position:fixed;bottom:0;z-index:var(--bs-offcanvas-zindex);display:flex;flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;transition:var(--bs-offcanvas-transition)}}@media (max-width:1199.98px) and (prefers-reduced-motion:reduce){.offcanvas-xl{transition:none}}@media (max-width:1199.98px){.offcanvas-xl.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}.offcanvas-xl.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}.offcanvas-xl.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}.offcanvas-xl.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}.offcanvas-xl.show:not(.hiding),.offcanvas-xl.showing{transform:none}.offcanvas-xl.hiding,.offcanvas-xl.show,.offcanvas-xl.showing{visibility:visible}}@media (min-width:1200px){.offcanvas-xl{--bs-offcanvas-height:auto;--bs-offcanvas-border-width:0;background-color:transparent!important}.offcanvas-xl .offcanvas-header{display:none}.offcanvas-xl .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible;background-color:transparent!important}}@media (max-width:1399.98px){.offcanvas-xxl{position:fixed;bottom:0;z-index:var(--bs-offcanvas-zindex);display:flex;flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;transition:var(--bs-offcanvas-transition)}}@media (max-width:1399.98px) and (prefers-reduced-motion:reduce){.offcanvas-xxl{transition:none}}@media (max-width:1399.98px){.offcanvas-xxl.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}.offcanvas-xxl.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}.offcanvas-xxl.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}.offcanvas-xxl.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}.offcanvas-xxl.show:not(.hiding),.offcanvas-xxl.showing{transform:none}.offcanvas-xxl.hiding,.offcanvas-xxl.show,.offcanvas-xxl.showing{visibility:visible}}@media (min-width:1400px){.offcanvas-xxl{--bs-offcanvas-height:auto;--bs-offcanvas-border-width:0;background-color:transparent!important}.offcanvas-xxl .offcanvas-header{display:none}.offcanvas-xxl .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible;background-color:transparent!important}}.offcanvas{position:fixed;bottom:0;z-index:var(--bs-offcanvas-zindex);display:flex;flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;transition:var(--bs-offcanvas-transition)}@media (prefers-reduced-motion:reduce){.offcanvas{transition:none}}.offcanvas.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}.offcanvas.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}.offcanvas.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}.offcanvas.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}.offcanvas.show:not(.hiding),.offcanvas.showing{transform:none}.offcanvas.hiding,.offcanvas.show,.offcanvas.showing{visibility:visible}.offcanvas-backdrop{position:fixed;top:0;left:0;z-index:1040;width:100vw;height:100vh;background-color:#000}.offcanvas-backdrop.fade{opacity:0}.offcanvas-backdrop.show{opacity:.5}.offcanvas-header{display:flex;align-items:center;justify-content:space-between;padding:var(--bs-offcanvas-padding-y) var(--bs-offcanvas-padding-x)}.offcanvas-header .btn-close{padding:calc(var(--bs-offcanvas-padding-y) * .5) calc(var(--bs-offcanvas-padding-x) * .5);margin-top:calc(-.5 * var(--bs-offcanvas-padding-y));margin-right:calc(-.5 * var(--bs-offcanvas-padding-x));margin-bottom:calc(-.5 * var(--bs-offcanvas-padding-y))}.offcanvas-title{margin-bottom:0;line-height:var(--bs-offcanvas-title-line-height)}.offcanvas-body{flex-grow:1;padding:var(--bs-offcanvas-padding-y) var(--bs-offcanvas-padding-x);overflow-y:auto}.placeholder{display:inline-block;min-height:1em;vertical-align:middle;cursor:wait;background-color:currentcolor;opacity:.5}.placeholder.btn::before{display:inline-block;content:""}.placeholder-xs{min-height:.6em}.placeholder-sm{min-height:.8em}.placeholder-lg{min-height:1.2em}.placeholder-glow .placeholder{animation:placeholder-glow 2s ease-in-out infinite}@keyframes placeholder-glow{50%{opacity:.2}}.placeholder-wave{-webkit-mask-image:linear-gradient(130deg,#000 55%,rgba(0,0,0,0.8) 75%,#000 95%);mask-image:linear-gradient(130deg,#000 55%,rgba(0,0,0,0.8) 75%,#000 95%);-webkit-mask-size:200% 100%;mask-size:200% 100%;animation:placeholder-wave 2s linear infinite}@keyframes placeholder-wave{100%{-webkit-mask-position:-200% 0%;mask-position:-200% 0%}}.clearfix::after{display:block;clear:both;content:""}.text-bg-primary{color:#fff!important;background-color:RGBA(var(--bs-primary-rgb),var(--bs-bg-opacity,1))!important}.text-bg-secondary{color:#fff!important;background-color:RGBA(var(--bs-secondary-rgb),var(--bs-bg-opacity,1))!important}.text-bg-success{color:#fff!important;background-color:RGBA(var(--bs-success-rgb),var(--bs-bg-opacity,1))!important}.text-bg-info{color:#000!important;background-color:RGBA(var(--bs-info-rgb),var(--bs-bg-opacity,1))!important}.text-bg-warning{color:#000!important;background-color:RGBA(var(--bs-warning-rgb),var(--bs-bg-opacity,1))!important}.text-bg-danger{color:#fff!important;background-color:RGBA(var(--bs-danger-rgb),var(--bs-bg-opacity,1))!important}.text-bg-light{color:#000!important;background-color:RGBA(var(--bs-light-rgb),var(--bs-bg-opacity,1))!important}.text-bg-dark{color:#fff!important;background-color:RGBA(var(--bs-dark-rgb),var(--bs-bg-opacity,1))!important}.link-primary{color:RGBA(var(--bs-primary-rgb),var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(var(--bs-primary-rgb),var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(var(--bs-primary-rgb),var(--bs-link-underline-opacity,1))!important}.link-primary:focus,.link-primary:hover{color:RGBA(10,88,202,var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(10,88,202,var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(10,88,202,var(--bs-link-underline-opacity,1))!important}.link-secondary{color:RGBA(var(--bs-secondary-rgb),var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(var(--bs-secondary-rgb),var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(var(--bs-secondary-rgb),var(--bs-link-underline-opacity,1))!important}.link-secondary:focus,.link-secondary:hover{color:RGBA(86,94,100,var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(86,94,100,var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(86,94,100,var(--bs-link-underline-opacity,1))!important}.link-success{color:RGBA(var(--bs-success-rgb),var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(var(--bs-success-rgb),var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(var(--bs-success-rgb),var(--bs-link-underline-opacity,1))!important}.link-success:focus,.link-success:hover{color:RGBA(20,108,67,var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(20,108,67,var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(20,108,67,var(--bs-link-underline-opacity,1))!important}.link-info{color:RGBA(var(--bs-info-rgb),var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(var(--bs-info-rgb),var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(var(--bs-info-rgb),var(--bs-link-underline-opacity,1))!important}.link-info:focus,.link-info:hover{color:RGBA(61,213,243,var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(61,213,243,var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(61,213,243,var(--bs-link-underline-opacity,1))!important}.link-warning{color:RGBA(var(--bs-warning-rgb),var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(var(--bs-warning-rgb),var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(var(--bs-warning-rgb),var(--bs-link-underline-opacity,1))!important}.link-warning:focus,.link-warning:hover{color:RGBA(255,205,57,var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(255,205,57,var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(255,205,57,var(--bs-link-underline-opacity,1))!important}.link-danger{color:RGBA(var(--bs-danger-rgb),var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(var(--bs-danger-rgb),var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(var(--bs-danger-rgb),var(--bs-link-underline-opacity,1))!important}.link-danger:focus,.link-danger:hover{color:RGBA(176,42,55,var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(176,42,55,var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(176,42,55,var(--bs-link-underline-opacity,1))!important}.link-light{color:RGBA(var(--bs-light-rgb),var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(var(--bs-light-rgb),var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(var(--bs-light-rgb),var(--bs-link-underline-opacity,1))!important}.link-light:focus,.link-light:hover{color:RGBA(249,250,251,var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(249,250,251,var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(249,250,251,var(--bs-link-underline-opacity,1))!important}.link-dark{color:RGBA(var(--bs-dark-rgb),var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(var(--bs-dark-rgb),var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(var(--bs-dark-rgb),var(--bs-link-underline-opacity,1))!important}.link-dark:focus,.link-dark:hover{color:RGBA(26,30,33,var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(26,30,33,var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(26,30,33,var(--bs-link-underline-opacity,1))!important}.link-body-emphasis{color:RGBA(var(--bs-emphasis-color-rgb),var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(var(--bs-emphasis-color-rgb),var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(var(--bs-emphasis-color-rgb),var(--bs-link-underline-opacity,1))!important}.link-body-emphasis:focus,.link-body-emphasis:hover{color:RGBA(var(--bs-emphasis-color-rgb),var(--bs-link-opacity,.75))!important;-webkit-text-decoration-color:RGBA(var(--bs-emphasis-color-rgb),var(--bs-link-underline-opacity,0.75))!important;text-decoration-color:RGBA(var(--bs-emphasis-color-rgb),var(--bs-link-underline-opacity,0.75))!important}.focus-ring:focus{outline:0;box-shadow:var(--bs-focus-ring-x,0) var(--bs-focus-ring-y,0) var(--bs-focus-ring-blur,0) var(--bs-focus-ring-width) var(--bs-focus-ring-color)}.icon-link{display:inline-flex;gap:.375rem;align-items:center;-webkit-text-decoration-color:rgba(var(--bs-link-color-rgb),var(--bs-link-opacity,0.5));text-decoration-color:rgba(var(--bs-link-color-rgb),var(--bs-link-opacity,0.5));text-underline-offset:0.25em;-webkit-backface-visibility:hidden;backface-visibility:hidden}.icon-link>.bi{flex-shrink:0;width:1em;height:1em;fill:currentcolor;transition:.2s ease-in-out transform}@media (prefers-reduced-motion:reduce){.icon-link>.bi{transition:none}}.icon-link-hover:focus-visible>.bi,.icon-link-hover:hover>.bi{transform:var(--bs-icon-link-transform,translate3d(.25em,0,0))}.ratio{position:relative;width:100%}.ratio::before{display:block;padding-top:var(--bs-aspect-ratio);content:""}.ratio>*{position:absolute;top:0;left:0;width:100%;height:100%}.ratio-1x1{--bs-aspect-ratio:100%}.ratio-4x3{--bs-aspect-ratio:75%}.ratio-16x9{--bs-aspect-ratio:56.25%}.ratio-21x9{--bs-aspect-ratio:42.8571428571%}.fixed-top{position:fixed;top:0;right:0;left:0;z-index:1030}.fixed-bottom{position:fixed;right:0;bottom:0;left:0;z-index:1030}.sticky-top{position:-webkit-sticky;position:sticky;top:0;z-index:1020}.sticky-bottom{position:-webkit-sticky;position:sticky;bottom:0;z-index:1020}@media (min-width:576px){.sticky-sm-top{position:-webkit-sticky;position:sticky;top:0;z-index:1020}.sticky-sm-bottom{position:-webkit-sticky;position:sticky;bottom:0;z-index:1020}}@media (min-width:768px){.sticky-md-top{position:-webkit-sticky;position:sticky;top:0;z-index:1020}.sticky-md-bottom{position:-webkit-sticky;position:sticky;bottom:0;z-index:1020}}@media (min-width:992px){.sticky-lg-top{position:-webkit-sticky;position:sticky;top:0;z-index:1020}.sticky-lg-bottom{position:-webkit-sticky;position:sticky;bottom:0;z-index:1020}}@media (min-width:1200px){.sticky-xl-top{position:-webkit-sticky;position:sticky;top:0;z-index:1020}.sticky-xl-bottom{position:-webkit-sticky;position:sticky;bottom:0;z-index:1020}}@media (min-width:1400px){.sticky-xxl-top{position:-webkit-sticky;position:sticky;top:0;z-index:1020}.sticky-xxl-bottom{position:-webkit-sticky;position:sticky;bottom:0;z-index:1020}}.hstack{display:flex;flex-direction:row;align-items:center;align-self:stretch}.vstack{display:flex;flex:1 1 auto;flex-direction:column;align-self:stretch}.visually-hidden,.visually-hidden-focusable:not(:focus):not(:focus-within){width:1px!important;height:1px!important;padding:0!important;margin:-1px!important;overflow:hidden!important;clip:rect(0,0,0,0)!important;white-space:nowrap!important;border:0!important}.visually-hidden-focusable:not(:focus):not(:focus-within):not(caption),.visually-hidden:not(caption){position:absolute!important}.stretched-link::after{position:absolute;top:0;right:0;bottom:0;left:0;z-index:1;content:""}.text-truncate{overflow:hidden;text-overflow:ellipsis;white-space:nowrap}.vr{display:inline-block;align-self:stretch;width:var(--bs-border-width);min-height:1em;background-color:currentcolor;opacity:.25}.align-baseline{vertical-align:baseline!important}.align-top{vertical-align:top!important}.align-middle{vertical-align:middle!important}.align-bottom{vertical-align:bottom!important}.align-text-bottom{vertical-align:text-bottom!important}.align-text-top{vertical-align:text-top!important}.float-start{float:left!important}.float-end{float:right!important}.float-none{float:none!important}.object-fit-contain{-o-object-fit:contain!important;object-fit:contain!important}.object-fit-cover{-o-object-fit:cover!important;object-fit:cover!important}.object-fit-fill{-o-object-fit:fill!important;object-fit:fill!important}.object-fit-scale{-o-object-fit:scale-down!important;object-fit:scale-down!important}.object-fit-none{-o-object-fit:none!important;object-fit:none!important}.opacity-0{opacity:0!important}.opacity-25{opacity:.25!important}.opacity-50{opacity:.5!important}.opacity-75{opacity:.75!important}.opacity-100{opacity:1!important}.overflow-auto{overflow:auto!important}.overflow-hidden{overflow:hidden!important}.overflow-visible{overflow:visible!important}.overflow-scroll{overflow:scroll!important}.overflow-x-auto{overflow-x:auto!important}.overflow-x-hidden{overflow-x:hidden!important}.overflow-x-visible{overflow-x:visible!important}.overflow-x-scroll{overflow-x:scroll!important}.overflow-y-auto{overflow-y:auto!important}.overflow-y-hidden{overflow-y:hidden!important}.overflow-y-visible{overflow-y:visible!important}.overflow-y-scroll{overflow-y:scroll!important}.d-inline{display:inline!important}.d-inline-block{display:inline-block!important}.d-block{display:block!important}.d-grid{display:grid!important}.d-inline-grid{display:inline-grid!important}.d-table{display:table!important}.d-table-row{display:table-row!important}.d-table-cell{display:table-cell!important}.d-flex{display:flex!important}.d-inline-flex{display:inline-flex!important}.d-none{display:none!important}.shadow{box-shadow:var(--bs-box-shadow)!important}.shadow-sm{box-shadow:var(--bs-box-shadow-sm)!important}.shadow-lg{box-shadow:var(--bs-box-shadow-lg)!important}.shadow-none{box-shadow:none!important}.focus-ring-primary{--bs-focus-ring-color:rgba(var(--bs-primary-rgb), var(--bs-focus-ring-opacity))}.focus-ring-secondary{--bs-focus-ring-color:rgba(var(--bs-secondary-rgb), var(--bs-focus-ring-opacity))}.focus-ring-success{--bs-focus-ring-color:rgba(var(--bs-success-rgb), var(--bs-focus-ring-opacity))}.focus-ring-info{--bs-focus-ring-color:rgba(var(--bs-info-rgb), var(--bs-focus-ring-opacity))}.focus-ring-warning{--bs-focus-ring-color:rgba(var(--bs-warning-rgb), var(--bs-focus-ring-opacity))}.focus-ring-danger{--bs-focus-ring-color:rgba(var(--bs-danger-rgb), var(--bs-focus-ring-opacity))}.focus-ring-light{--bs-focus-ring-color:rgba(var(--bs-light-rgb), var(--bs-focus-ring-opacity))}.focus-ring-dark{--bs-focus-ring-color:rgba(var(--bs-dark-rgb), var(--bs-focus-ring-opacity))}.position-static{position:static!important}.position-relative{position:relative!important}.position-absolute{position:absolute!important}.position-fixed{position:fixed!important}.position-sticky{position:-webkit-sticky!important;position:sticky!important}.top-0{top:0!important}.top-50{top:50%!important}.top-100{top:100%!important}.bottom-0{bottom:0!important}.bottom-50{bottom:50%!important}.bottom-100{bottom:100%!important}.start-0{left:0!important}.start-50{left:50%!important}.start-100{left:100%!important}.end-0{right:0!important}.end-50{right:50%!important}.end-100{right:100%!important}.translate-middle{transform:translate(-50%,-50%)!important}.translate-middle-x{transform:translateX(-50%)!important}.translate-middle-y{transform:translateY(-50%)!important}.border{border:var(--bs-border-width) var(--bs-border-style) var(--bs-border-color)!important}.border-0{border:0!important}.border-top{border-top:var(--bs-border-width) var(--bs-border-style) var(--bs-border-color)!important}.border-top-0{border-top:0!important}.border-end{border-right:var(--bs-border-width) var(--bs-border-style) var(--bs-border-color)!important}.border-end-0{border-right:0!important}.border-bottom{border-bottom:var(--bs-border-width) var(--bs-border-style) var(--bs-border-color)!important}.border-bottom-0{border-bottom:0!important}.border-start{border-left:var(--bs-border-width) var(--bs-border-style) var(--bs-border-color)!important}.border-start-0{border-left:0!important}.border-primary{--bs-border-opacity:1;border-color:rgba(var(--bs-primary-rgb),var(--bs-border-opacity))!important}.border-secondary{--bs-border-opacity:1;border-color:rgba(var(--bs-secondary-rgb),var(--bs-border-opacity))!important}.border-success{--bs-border-opacity:1;border-color:rgba(var(--bs-success-rgb),var(--bs-border-opacity))!important}.border-info{--bs-border-opacity:1;border-color:rgba(var(--bs-info-rgb),var(--bs-border-opacity))!important}.border-warning{--bs-border-opacity:1;border-color:rgba(var(--bs-warning-rgb),var(--bs-border-opacity))!important}.border-danger{--bs-border-opacity:1;border-color:rgba(var(--bs-danger-rgb),var(--bs-border-opacity))!important}.border-light{--bs-border-opacity:1;border-color:rgba(var(--bs-light-rgb),var(--bs-border-opacity))!important}.border-dark{--bs-border-opacity:1;border-color:rgba(var(--bs-dark-rgb),var(--bs-border-opacity))!important}.border-black{--bs-border-opacity:1;border-color:rgba(var(--bs-black-rgb),var(--bs-border-opacity))!important}.border-white{--bs-border-opacity:1;border-color:rgba(var(--bs-white-rgb),var(--bs-border-opacity))!important}.border-primary-subtle{border-color:var(--bs-primary-border-subtle)!important}.border-secondary-subtle{border-color:var(--bs-secondary-border-subtle)!important}.border-success-subtle{border-color:var(--bs-success-border-subtle)!important}.border-info-subtle{border-color:var(--bs-info-border-subtle)!important}.border-warning-subtle{border-color:var(--bs-warning-border-subtle)!important}.border-danger-subtle{border-color:var(--bs-danger-border-subtle)!important}.border-light-subtle{border-color:var(--bs-light-border-subtle)!important}.border-dark-subtle{border-color:var(--bs-dark-border-subtle)!important}.border-1{border-width:1px!important}.border-2{border-width:2px!important}.border-3{border-width:3px!important}.border-4{border-width:4px!important}.border-5{border-width:5px!important}.border-opacity-10{--bs-border-opacity:0.1}.border-opacity-25{--bs-border-opacity:0.25}.border-opacity-50{--bs-border-opacity:0.5}.border-opacity-75{--bs-border-opacity:0.75}.border-opacity-100{--bs-border-opacity:1}.w-25{width:25%!important}.w-50{width:50%!important}.w-75{width:75%!important}.w-100{width:100%!important}.w-auto{width:auto!important}.mw-100{max-width:100%!important}.vw-100{width:100vw!important}.min-vw-100{min-width:100vw!important}.h-25{height:25%!important}.h-50{height:50%!important}.h-75{height:75%!important}.h-100{height:100%!important}.h-auto{height:auto!important}.mh-100{max-height:100%!important}.vh-100{height:100vh!important}.min-vh-100{min-height:100vh!important}.flex-fill{flex:1 1 auto!important}.flex-row{flex-direction:row!important}.flex-column{flex-direction:column!important}.flex-row-reverse{flex-direction:row-reverse!important}.flex-column-reverse{flex-direction:column-reverse!important}.flex-grow-0{flex-grow:0!important}.flex-grow-1{flex-grow:1!important}.flex-shrink-0{flex-shrink:0!important}.flex-shrink-1{flex-shrink:1!important}.flex-wrap{flex-wrap:wrap!important}.flex-nowrap{flex-wrap:nowrap!important}.flex-wrap-reverse{flex-wrap:wrap-reverse!important}.justify-content-start{justify-content:flex-start!important}.justify-content-end{justify-content:flex-end!important}.justify-content-center{justify-content:center!important}.justify-content-between{justify-content:space-between!important}.justify-content-around{justify-content:space-around!important}.justify-content-evenly{justify-content:space-evenly!important}.align-items-start{align-items:flex-start!important}.align-items-end{align-items:flex-end!important}.align-items-center{align-items:center!important}.align-items-baseline{align-items:baseline!important}.align-items-stretch{align-items:stretch!important}.align-content-start{align-content:flex-start!important}.align-content-end{align-content:flex-end!important}.align-content-center{align-content:center!important}.align-content-between{align-content:space-between!important}.align-content-around{align-content:space-around!important}.align-content-stretch{align-content:stretch!important}.align-self-auto{align-self:auto!important}.align-self-start{align-self:flex-start!important}.align-self-end{align-self:flex-end!important}.align-self-center{align-self:center!important}.align-self-baseline{align-self:baseline!important}.align-self-stretch{align-self:stretch!important}.order-first{order:-1!important}.order-0{order:0!important}.order-1{order:1!important}.order-2{order:2!important}.order-3{order:3!important}.order-4{order:4!important}.order-5{order:5!important}.order-last{order:6!important}.m-0{margin:0!important}.m-1{margin:.25rem!important}.m-2{margin:.5rem!important}.m-3{margin:1rem!important}.m-4{margin:1.5rem!important}.m-5{margin:3rem!important}.m-auto{margin:auto!important}.mx-0{margin-right:0!important;margin-left:0!important}.mx-1{margin-right:.25rem!important;margin-left:.25rem!important}.mx-2{margin-right:.5rem!important;margin-left:.5rem!important}.mx-3{margin-right:1rem!important;margin-left:1rem!important}.mx-4{margin-right:1.5rem!important;margin-left:1.5rem!important}.mx-5{margin-right:3rem!important;margin-left:3rem!important}.mx-auto{margin-right:auto!important;margin-left:auto!important}.my-0{margin-top:0!important;margin-bottom:0!important}.my-1{margin-top:.25rem!important;margin-bottom:.25rem!important}.my-2{margin-top:.5rem!important;margin-bottom:.5rem!important}.my-3{margin-top:1rem!important;margin-bottom:1rem!important}.my-4{margin-top:1.5rem!important;margin-bottom:1.5rem!important}.my-5{margin-top:3rem!important;margin-bottom:3rem!important}.my-auto{margin-top:auto!important;margin-bottom:auto!important}.mt-0{margin-top:0!important}.mt-1{margin-top:.25rem!important}.mt-2{margin-top:.5rem!important}.mt-3{margin-top:1rem!important}.mt-4{margin-top:1.5rem!important}.mt-5{margin-top:3rem!important}.mt-auto{margin-top:auto!important}.me-0{margin-right:0!important}.me-1{margin-right:.25rem!important}.me-2{margin-right:.5rem!important}.me-3{margin-right:1rem!important}.me-4{margin-right:1.5rem!important}.me-5{margin-right:3rem!important}.me-auto{margin-right:auto!important}.mb-0{margin-bottom:0!important}.mb-1{margin-bottom:.25rem!important}.mb-2{margin-bottom:.5rem!important}.mb-3{margin-bottom:1rem!important}.mb-4{margin-bottom:1.5rem!important}.mb-5{margin-bottom:3rem!important}.mb-auto{margin-bottom:auto!important}.ms-0{margin-left:0!important}.ms-1{margin-left:.25rem!important}.ms-2{margin-left:.5rem!important}.ms-3{margin-left:1rem!important}.ms-4{margin-left:1.5rem!important}.ms-5{margin-left:3rem!important}.ms-auto{margin-left:auto!important}.p-0{padding:0!important}.p-1{padding:.25rem!important}.p-2{padding:.5rem!important}.p-3{padding:1rem!important}.p-4{padding:1.5rem!important}.p-5{padding:3rem!important}.px-0{padding-right:0!important;padding-left:0!important}.px-1{padding-right:.25rem!important;padding-left:.25rem!important}.px-2{padding-right:.5rem!important;padding-left:.5rem!important}.px-3{padding-right:1rem!important;padding-left:1rem!important}.px-4{padding-right:1.5rem!important;padding-left:1.5rem!important}.px-5{padding-right:3rem!important;padding-left:3rem!important}.py-0{padding-top:0!important;padding-bottom:0!important}.py-1{padding-top:.25rem!important;padding-bottom:.25rem!important}.py-2{padding-top:.5rem!important;padding-bottom:.5rem!important}.py-3{padding-top:1rem!important;padding-bottom:1rem!important}.py-4{padding-top:1.5rem!important;padding-bottom:1.5rem!important}.py-5{padding-top:3rem!important;padding-bottom:3rem!important}.pt-0{padding-top:0!important}.pt-1{padding-top:.25rem!important}.pt-2{padding-top:.5rem!important}.pt-3{padding-top:1rem!important}.pt-4{padding-top:1.5rem!important}.pt-5{padding-top:3rem!important}.pe-0{padding-right:0!important}.pe-1{padding-right:.25rem!important}.pe-2{padding-right:.5rem!important}.pe-3{padding-right:1rem!important}.pe-4{padding-right:1.5rem!important}.pe-5{padding-right:3rem!important}.pb-0{padding-bottom:0!important}.pb-1{padding-bottom:.25rem!important}.pb-2{padding-bottom:.5rem!important}.pb-3{padding-bottom:1rem!important}.pb-4{padding-bottom:1.5rem!important}.pb-5{padding-bottom:3rem!important}.ps-0{padding-left:0!important}.ps-1{padding-left:.25rem!important}.ps-2{padding-left:.5rem!important}.ps-3{padding-left:1rem!important}.ps-4{padding-left:1.5rem!important}.ps-5{padding-left:3rem!important}.gap-0{gap:0!important}.gap-1{gap:.25rem!important}.gap-2{gap:.5rem!important}.gap-3{gap:1rem!important}.gap-4{gap:1.5rem!important}.gap-5{gap:3rem!important}.row-gap-0{row-gap:0!important}.row-gap-1{row-gap:.25rem!important}.row-gap-2{row-gap:.5rem!important}.row-gap-3{row-gap:1rem!important}.row-gap-4{row-gap:1.5rem!important}.row-gap-5{row-gap:3rem!important}.column-gap-0{-moz-column-gap:0!important;column-gap:0!important}.column-gap-1{-moz-column-gap:0.25rem!important;column-gap:.25rem!important}.column-gap-2{-moz-column-gap:0.5rem!important;column-gap:.5rem!important}.column-gap-3{-moz-column-gap:1rem!important;column-gap:1rem!important}.column-gap-4{-moz-column-gap:1.5rem!important;column-gap:1.5rem!important}.column-gap-5{-moz-column-gap:3rem!important;column-gap:3rem!important}.font-monospace{font-family:var(--bs-font-monospace)!important}.fs-1{font-size:calc(1.375rem + 1.5vw)!important}.fs-2{font-size:calc(1.325rem + .9vw)!important}.fs-3{font-size:calc(1.3rem + .6vw)!important}.fs-4{font-size:calc(1.275rem + .3vw)!important}.fs-5{font-size:1.25rem!important}.fs-6{font-size:1rem!important}.fst-italic{font-style:italic!important}.fst-normal{font-style:normal!important}.fw-lighter{font-weight:lighter!important}.fw-light{font-weight:300!important}.fw-normal{font-weight:400!important}.fw-medium{font-weight:500!important}.fw-semibold{font-weight:600!important}.fw-bold{font-weight:700!important}.fw-bolder{font-weight:bolder!important}.lh-1{line-height:1!important}.lh-sm{line-height:1.25!important}.lh-base{line-height:1.5!important}.lh-lg{line-height:2!important}.text-start{text-align:left!important}.text-end{text-align:right!important}.text-center{text-align:center!important}.text-decoration-none{text-decoration:none!important}.text-decoration-underline{text-decoration:underline!important}.text-decoration-line-through{text-decoration:line-through!important}.text-lowercase{text-transform:lowercase!important}.text-uppercase{text-transform:uppercase!important}.text-capitalize{text-transform:capitalize!important}.text-wrap{white-space:normal!important}.text-nowrap{white-space:nowrap!important}.text-break{word-wrap:break-word!important;word-break:break-word!important}.text-primary{--bs-text-opacity:1;color:rgba(var(--bs-primary-rgb),var(--bs-text-opacity))!important}.text-secondary{--bs-text-opacity:1;color:rgba(var(--bs-secondary-rgb),var(--bs-text-opacity))!important}.text-success{--bs-text-opacity:1;color:rgba(var(--bs-success-rgb),var(--bs-text-opacity))!important}.text-info{--bs-text-opacity:1;color:rgba(var(--bs-info-rgb),var(--bs-text-opacity))!important}.text-warning{--bs-text-opacity:1;color:rgba(var(--bs-warning-rgb),var(--bs-text-opacity))!important}.text-danger{--bs-text-opacity:1;color:rgba(var(--bs-danger-rgb),var(--bs-text-opacity))!important}.text-light{--bs-text-opacity:1;color:rgba(var(--bs-light-rgb),var(--bs-text-opacity))!important}.text-dark{--bs-text-opacity:1;color:rgba(var(--bs-dark-rgb),var(--bs-text-opacity))!important}.text-black{--bs-text-opacity:1;color:rgba(var(--bs-black-rgb),var(--bs-text-opacity))!important}.text-white{--bs-text-opacity:1;color:rgba(var(--bs-white-rgb),var(--bs-text-opacity))!important}.text-body{--bs-text-opacity:1;color:rgba(var(--bs-body-color-rgb),var(--bs-text-opacity))!important}.text-muted{--bs-text-opacity:1;color:var(--bs-secondary-color)!important}.text-black-50{--bs-text-opacity:1;color:rgba(0,0,0,.5)!important}.text-white-50{--bs-text-opacity:1;color:rgba(255,255,255,.5)!important}.text-body-secondary{--bs-text-opacity:1;color:var(--bs-secondary-color)!important}.text-body-tertiary{--bs-text-opacity:1;color:var(--bs-tertiary-color)!important}.text-body-emphasis{--bs-text-opacity:1;color:var(--bs-emphasis-color)!important}.text-reset{--bs-text-opacity:1;color:inherit!important}.text-opacity-25{--bs-text-opacity:0.25}.text-opacity-50{--bs-text-opacity:0.5}.text-opacity-75{--bs-text-opacity:0.75}.text-opacity-100{--bs-text-opacity:1}.text-primary-emphasis{color:var(--bs-primary-text-emphasis)!important}.text-secondary-emphasis{color:var(--bs-secondary-text-emphasis)!important}.text-success-emphasis{color:var(--bs-success-text-emphasis)!important}.text-info-emphasis{color:var(--bs-info-text-emphasis)!important}.text-warning-emphasis{color:var(--bs-warning-text-emphasis)!important}.text-danger-emphasis{color:var(--bs-danger-text-emphasis)!important}.text-light-emphasis{color:var(--bs-light-text-emphasis)!important}.text-dark-emphasis{color:var(--bs-dark-text-emphasis)!important}.link-opacity-10{--bs-link-opacity:0.1}.link-opacity-10-hover:hover{--bs-link-opacity:0.1}.link-opacity-25{--bs-link-opacity:0.25}.link-opacity-25-hover:hover{--bs-link-opacity:0.25}.link-opacity-50{--bs-link-opacity:0.5}.link-opacity-50-hover:hover{--bs-link-opacity:0.5}.link-opacity-75{--bs-link-opacity:0.75}.link-opacity-75-hover:hover{--bs-link-opacity:0.75}.link-opacity-100{--bs-link-opacity:1}.link-opacity-100-hover:hover{--bs-link-opacity:1}.link-offset-1{text-underline-offset:0.125em!important}.link-offset-1-hover:hover{text-underline-offset:0.125em!important}.link-offset-2{text-underline-offset:0.25em!important}.link-offset-2-hover:hover{text-underline-offset:0.25em!important}.link-offset-3{text-underline-offset:0.375em!important}.link-offset-3-hover:hover{text-underline-offset:0.375em!important}.link-underline-primary{--bs-link-underline-opacity:1;-webkit-text-decoration-color:rgba(var(--bs-primary-rgb),var(--bs-link-underline-opacity))!important;text-decoration-color:rgba(var(--bs-primary-rgb),var(--bs-link-underline-opacity))!important}.link-underline-secondary{--bs-link-underline-opacity:1;-webkit-text-decoration-color:rgba(var(--bs-secondary-rgb),var(--bs-link-underline-opacity))!important;text-decoration-color:rgba(var(--bs-secondary-rgb),var(--bs-link-underline-opacity))!important}.link-underline-success{--bs-link-underline-opacity:1;-webkit-text-decoration-color:rgba(var(--bs-success-rgb),var(--bs-link-underline-opacity))!important;text-decoration-color:rgba(var(--bs-success-rgb),var(--bs-link-underline-opacity))!important}.link-underline-info{--bs-link-underline-opacity:1;-webkit-text-decoration-color:rgba(var(--bs-info-rgb),var(--bs-link-underline-opacity))!important;text-decoration-color:rgba(var(--bs-info-rgb),var(--bs-link-underline-opacity))!important}.link-underline-warning{--bs-link-underline-opacity:1;-webkit-text-decoration-color:rgba(var(--bs-warning-rgb),var(--bs-link-underline-opacity))!important;text-decoration-color:rgba(var(--bs-warning-rgb),var(--bs-link-underline-opacity))!important}.link-underline-danger{--bs-link-underline-opacity:1;-webkit-text-decoration-color:rgba(var(--bs-danger-rgb),var(--bs-link-underline-opacity))!important;text-decoration-color:rgba(var(--bs-danger-rgb),var(--bs-link-underline-opacity))!important}.link-underline-light{--bs-link-underline-opacity:1;-webkit-text-decoration-color:rgba(var(--bs-light-rgb),var(--bs-link-underline-opacity))!important;text-decoration-color:rgba(var(--bs-light-rgb),var(--bs-link-underline-opacity))!important}.link-underline-dark{--bs-link-underline-opacity:1;-webkit-text-decoration-color:rgba(var(--bs-dark-rgb),var(--bs-link-underline-opacity))!important;text-decoration-color:rgba(var(--bs-dark-rgb),var(--bs-link-underline-opacity))!important}.link-underline{--bs-link-underline-opacity:1;-webkit-text-decoration-color:rgba(var(--bs-link-color-rgb),var(--bs-link-underline-opacity,1))!important;text-decoration-color:rgba(var(--bs-link-color-rgb),var(--bs-link-underline-opacity,1))!important}.link-underline-opacity-0{--bs-link-underline-opacity:0}.link-underline-opacity-0-hover:hover{--bs-link-underline-opacity:0}.link-underline-opacity-10{--bs-link-underline-opacity:0.1}.link-underline-opacity-10-hover:hover{--bs-link-underline-opacity:0.1}.link-underline-opacity-25{--bs-link-underline-opacity:0.25}.link-underline-opacity-25-hover:hover{--bs-link-underline-opacity:0.25}.link-underline-opacity-50{--bs-link-underline-opacity:0.5}.link-underline-opacity-50-hover:hover{--bs-link-underline-opacity:0.5}.link-underline-opacity-75{--bs-link-underline-opacity:0.75}.link-underline-opacity-75-hover:hover{--bs-link-underline-opacity:0.75}.link-underline-opacity-100{--bs-link-underline-opacity:1}.link-underline-opacity-100-hover:hover{--bs-link-underline-opacity:1}.bg-primary{--bs-bg-opacity:1;background-color:rgba(var(--bs-primary-rgb),var(--bs-bg-opacity))!important}.bg-secondary{--bs-bg-opacity:1;background-color:rgba(var(--bs-secondary-rgb),var(--bs-bg-opacity))!important}.bg-success{--bs-bg-opacity:1;background-color:rgba(var(--bs-success-rgb),var(--bs-bg-opacity))!important}.bg-info{--bs-bg-opacity:1;background-color:rgba(var(--bs-info-rgb),var(--bs-bg-opacity))!important}.bg-warning{--bs-bg-opacity:1;background-color:rgba(var(--bs-warning-rgb),var(--bs-bg-opacity))!important}.bg-danger{--bs-bg-opacity:1;background-color:rgba(var(--bs-danger-rgb),var(--bs-bg-opacity))!important}.bg-light{--bs-bg-opacity:1;background-color:rgba(var(--bs-light-rgb),var(--bs-bg-opacity))!important}.bg-dark{--bs-bg-opacity:1;background-color:rgba(var(--bs-dark-rgb),var(--bs-bg-opacity))!important}.bg-black{--bs-bg-opacity:1;background-color:rgba(var(--bs-black-rgb),var(--bs-bg-opacity))!important}.bg-white{--bs-bg-opacity:1;background-color:rgba(var(--bs-white-rgb),var(--bs-bg-opacity))!important}.bg-body{--bs-bg-opacity:1;background-color:rgba(var(--bs-body-bg-rgb),var(--bs-bg-opacity))!important}.bg-transparent{--bs-bg-opacity:1;background-color:transparent!important}.bg-body-secondary{--bs-bg-opacity:1;background-color:rgba(var(--bs-secondary-bg-rgb),var(--bs-bg-opacity))!important}.bg-body-tertiary{--bs-bg-opacity:1;background-color:rgba(var(--bs-tertiary-bg-rgb),var(--bs-bg-opacity))!important}.bg-opacity-10{--bs-bg-opacity:0.1}.bg-opacity-25{--bs-bg-opacity:0.25}.bg-opacity-50{--bs-bg-opacity:0.5}.bg-opacity-75{--bs-bg-opacity:0.75}.bg-opacity-100{--bs-bg-opacity:1}.bg-primary-subtle{background-color:var(--bs-primary-bg-subtle)!important}.bg-secondary-subtle{background-color:var(--bs-secondary-bg-subtle)!important}.bg-success-subtle{background-color:var(--bs-success-bg-subtle)!important}.bg-info-subtle{background-color:var(--bs-info-bg-subtle)!important}.bg-warning-subtle{background-color:var(--bs-warning-bg-subtle)!important}.bg-danger-subtle{background-color:var(--bs-danger-bg-subtle)!important}.bg-light-subtle{background-color:var(--bs-light-bg-subtle)!important}.bg-dark-subtle{background-color:var(--bs-dark-bg-subtle)!important}.bg-gradient{background-image:var(--bs-gradient)!important}.user-select-all{-webkit-user-select:all!important;-moz-user-select:all!important;user-select:all!important}.user-select-auto{-webkit-user-select:auto!important;-moz-user-select:auto!important;user-select:auto!important}.user-select-none{-webkit-user-select:none!important;-moz-user-select:none!important;user-select:none!important}.pe-none{pointer-events:none!important}.pe-auto{pointer-events:auto!important}.rounded{border-radius:var(--bs-border-radius)!important}.rounded-0{border-radius:0!important}.rounded-1{border-radius:var(--bs-border-radius-sm)!important}.rounded-2{border-radius:var(--bs-border-radius)!important}.rounded-3{border-radius:var(--bs-border-radius-lg)!important}.rounded-4{border-radius:var(--bs-border-radius-xl)!important}.rounded-5{border-radius:var(--bs-border-radius-xxl)!important}.rounded-circle{border-radius:50%!important}.rounded-pill{border-radius:var(--bs-border-radius-pill)!important}.rounded-top{border-top-left-radius:var(--bs-border-radius)!important;border-top-right-radius:var(--bs-border-radius)!important}.rounded-top-0{border-top-left-radius:0!important;border-top-right-radius:0!important}.rounded-top-1{border-top-left-radius:var(--bs-border-radius-sm)!important;border-top-right-radius:var(--bs-border-radius-sm)!important}.rounded-top-2{border-top-left-radius:var(--bs-border-radius)!important;border-top-right-radius:var(--bs-border-radius)!important}.rounded-top-3{border-top-left-radius:var(--bs-border-radius-lg)!important;border-top-right-radius:var(--bs-border-radius-lg)!important}.rounded-top-4{border-top-left-radius:var(--bs-border-radius-xl)!important;border-top-right-radius:var(--bs-border-radius-xl)!important}.rounded-top-5{border-top-left-radius:var(--bs-border-radius-xxl)!important;border-top-right-radius:var(--bs-border-radius-xxl)!important}.rounded-top-circle{border-top-left-radius:50%!important;border-top-right-radius:50%!important}.rounded-top-pill{border-top-left-radius:var(--bs-border-radius-pill)!important;border-top-right-radius:var(--bs-border-radius-pill)!important}.rounded-end{border-top-right-radius:var(--bs-border-radius)!important;border-bottom-right-radius:var(--bs-border-radius)!important}.rounded-end-0{border-top-right-radius:0!important;border-bottom-right-radius:0!important}.rounded-end-1{border-top-right-radius:var(--bs-border-radius-sm)!important;border-bottom-right-radius:var(--bs-border-radius-sm)!important}.rounded-end-2{border-top-right-radius:var(--bs-border-radius)!important;border-bottom-right-radius:var(--bs-border-radius)!important}.rounded-end-3{border-top-right-radius:var(--bs-border-radius-lg)!important;border-bottom-right-radius:var(--bs-border-radius-lg)!important}.rounded-end-4{border-top-right-radius:var(--bs-border-radius-xl)!important;border-bottom-right-radius:var(--bs-border-radius-xl)!important}.rounded-end-5{border-top-right-radius:var(--bs-border-radius-xxl)!important;border-bottom-right-radius:var(--bs-border-radius-xxl)!important}.rounded-end-circle{border-top-right-radius:50%!important;border-bottom-right-radius:50%!important}.rounded-end-pill{border-top-right-radius:var(--bs-border-radius-pill)!important;border-bottom-right-radius:var(--bs-border-radius-pill)!important}.rounded-bottom{border-bottom-right-radius:var(--bs-border-radius)!important;border-bottom-left-radius:var(--bs-border-radius)!important}.rounded-bottom-0{border-bottom-right-radius:0!important;border-bottom-left-radius:0!important}.rounded-bottom-1{border-bottom-right-radius:var(--bs-border-radius-sm)!important;border-bottom-left-radius:var(--bs-border-radius-sm)!important}.rounded-bottom-2{border-bottom-right-radius:var(--bs-border-radius)!important;border-bottom-left-radius:var(--bs-border-radius)!important}.rounded-bottom-3{border-bottom-right-radius:var(--bs-border-radius-lg)!important;border-bottom-left-radius:var(--bs-border-radius-lg)!important}.rounded-bottom-4{border-bottom-right-radius:var(--bs-border-radius-xl)!important;border-bottom-left-radius:var(--bs-border-radius-xl)!important}.rounded-bottom-5{border-bottom-right-radius:var(--bs-border-radius-xxl)!important;border-bottom-left-radius:var(--bs-border-radius-xxl)!important}.rounded-bottom-circle{border-bottom-right-radius:50%!important;border-bottom-left-radius:50%!important}.rounded-bottom-pill{border-bottom-right-radius:var(--bs-border-radius-pill)!important;border-bottom-left-radius:var(--bs-border-radius-pill)!important}.rounded-start{border-bottom-left-radius:var(--bs-border-radius)!important;border-top-left-radius:var(--bs-border-radius)!important}.rounded-start-0{border-bottom-left-radius:0!important;border-top-left-radius:0!important}.rounded-start-1{border-bottom-left-radius:var(--bs-border-radius-sm)!important;border-top-left-radius:var(--bs-border-radius-sm)!important}.rounded-start-2{border-bottom-left-radius:var(--bs-border-radius)!important;border-top-left-radius:var(--bs-border-radius)!important}.rounded-start-3{border-bottom-left-radius:var(--bs-border-radius-lg)!important;border-top-left-radius:var(--bs-border-radius-lg)!important}.rounded-start-4{border-bottom-left-radius:var(--bs-border-radius-xl)!important;border-top-left-radius:var(--bs-border-radius-xl)!important}.rounded-start-5{border-bottom-left-radius:var(--bs-border-radius-xxl)!important;border-top-left-radius:var(--bs-border-radius-xxl)!important}.rounded-start-circle{border-bottom-left-radius:50%!important;border-top-left-radius:50%!important}.rounded-start-pill{border-bottom-left-radius:var(--bs-border-radius-pill)!important;border-top-left-radius:var(--bs-border-radius-pill)!important}.visible{visibility:visible!important}.invisible{visibility:hidden!important}.z-n1{z-index:-1!important}.z-0{z-index:0!important}.z-1{z-index:1!important}.z-2{z-index:2!important}.z-3{z-index:3!important}@media (min-width:576px){.float-sm-start{float:left!important}.float-sm-end{float:right!important}.float-sm-none{float:none!important}.object-fit-sm-contain{-o-object-fit:contain!important;object-fit:contain!important}.object-fit-sm-cover{-o-object-fit:cover!important;object-fit:cover!important}.object-fit-sm-fill{-o-object-fit:fill!important;object-fit:fill!important}.object-fit-sm-scale{-o-object-fit:scale-down!important;object-fit:scale-down!important}.object-fit-sm-none{-o-object-fit:none!important;object-fit:none!important}.d-sm-inline{display:inline!important}.d-sm-inline-block{display:inline-block!important}.d-sm-block{display:block!important}.d-sm-grid{display:grid!important}.d-sm-inline-grid{display:inline-grid!important}.d-sm-table{display:table!important}.d-sm-table-row{display:table-row!important}.d-sm-table-cell{display:table-cell!important}.d-sm-flex{display:flex!important}.d-sm-inline-flex{display:inline-flex!important}.d-sm-none{display:none!important}.flex-sm-fill{flex:1 1 auto!important}.flex-sm-row{flex-direction:row!important}.flex-sm-column{flex-direction:column!important}.flex-sm-row-reverse{flex-direction:row-reverse!important}.flex-sm-column-reverse{flex-direction:column-reverse!important}.flex-sm-grow-0{flex-grow:0!important}.flex-sm-grow-1{flex-grow:1!important}.flex-sm-shrink-0{flex-shrink:0!important}.flex-sm-shrink-1{flex-shrink:1!important}.flex-sm-wrap{flex-wrap:wrap!important}.flex-sm-nowrap{flex-wrap:nowrap!important}.flex-sm-wrap-reverse{flex-wrap:wrap-reverse!important}.justify-content-sm-start{justify-content:flex-start!important}.justify-content-sm-end{justify-content:flex-end!important}.justify-content-sm-center{justify-content:center!important}.justify-content-sm-between{justify-content:space-between!important}.justify-content-sm-around{justify-content:space-around!important}.justify-content-sm-evenly{justify-content:space-evenly!important}.align-items-sm-start{align-items:flex-start!important}.align-items-sm-end{align-items:flex-end!important}.align-items-sm-center{align-items:center!important}.align-items-sm-baseline{align-items:baseline!important}.align-items-sm-stretch{align-items:stretch!important}.align-content-sm-start{align-content:flex-start!important}.align-content-sm-end{align-content:flex-end!important}.align-content-sm-center{align-content:center!important}.align-content-sm-between{align-content:space-between!important}.align-content-sm-around{align-content:space-around!important}.align-content-sm-stretch{align-content:stretch!important}.align-self-sm-auto{align-self:auto!important}.align-self-sm-start{align-self:flex-start!important}.align-self-sm-end{align-self:flex-end!important}.align-self-sm-center{align-self:center!important}.align-self-sm-baseline{align-self:baseline!important}.align-self-sm-stretch{align-self:stretch!important}.order-sm-first{order:-1!important}.order-sm-0{order:0!important}.order-sm-1{order:1!important}.order-sm-2{order:2!important}.order-sm-3{order:3!important}.order-sm-4{order:4!important}.order-sm-5{order:5!important}.order-sm-last{order:6!important}.m-sm-0{margin:0!important}.m-sm-1{margin:.25rem!important}.m-sm-2{margin:.5rem!important}.m-sm-3{margin:1rem!important}.m-sm-4{margin:1.5rem!important}.m-sm-5{margin:3rem!important}.m-sm-auto{margin:auto!important}.mx-sm-0{margin-right:0!important;margin-left:0!important}.mx-sm-1{margin-right:.25rem!important;margin-left:.25rem!important}.mx-sm-2{margin-right:.5rem!important;margin-left:.5rem!important}.mx-sm-3{margin-right:1rem!important;margin-left:1rem!important}.mx-sm-4{margin-right:1.5rem!important;margin-left:1.5rem!important}.mx-sm-5{margin-right:3rem!important;margin-left:3rem!important}.mx-sm-auto{margin-right:auto!important;margin-left:auto!important}.my-sm-0{margin-top:0!important;margin-bottom:0!important}.my-sm-1{margin-top:.25rem!important;margin-bottom:.25rem!important}.my-sm-2{margin-top:.5rem!important;margin-bottom:.5rem!important}.my-sm-3{margin-top:1rem!important;margin-bottom:1rem!important}.my-sm-4{margin-top:1.5rem!important;margin-bottom:1.5rem!important}.my-sm-5{margin-top:3rem!important;margin-bottom:3rem!important}.my-sm-auto{margin-top:auto!important;margin-bottom:auto!important}.mt-sm-0{margin-top:0!important}.mt-sm-1{margin-top:.25rem!important}.mt-sm-2{margin-top:.5rem!important}.mt-sm-3{margin-top:1rem!important}.mt-sm-4{margin-top:1.5rem!important}.mt-sm-5{margin-top:3rem!important}.mt-sm-auto{margin-top:auto!important}.me-sm-0{margin-right:0!important}.me-sm-1{margin-right:.25rem!important}.me-sm-2{margin-right:.5rem!important}.me-sm-3{margin-right:1rem!important}.me-sm-4{margin-right:1.5rem!important}.me-sm-5{margin-right:3rem!important}.me-sm-auto{margin-right:auto!important}.mb-sm-0{margin-bottom:0!important}.mb-sm-1{margin-bottom:.25rem!important}.mb-sm-2{margin-bottom:.5rem!important}.mb-sm-3{margin-bottom:1rem!important}.mb-sm-4{margin-bottom:1.5rem!important}.mb-sm-5{margin-bottom:3rem!important}.mb-sm-auto{margin-bottom:auto!important}.ms-sm-0{margin-left:0!important}.ms-sm-1{margin-left:.25rem!important}.ms-sm-2{margin-left:.5rem!important}.ms-sm-3{margin-left:1rem!important}.ms-sm-4{margin-left:1.5rem!important}.ms-sm-5{margin-left:3rem!important}.ms-sm-auto{margin-left:auto!important}.p-sm-0{padding:0!important}.p-sm-1{padding:.25rem!important}.p-sm-2{padding:.5rem!important}.p-sm-3{padding:1rem!important}.p-sm-4{padding:1.5rem!important}.p-sm-5{padding:3rem!important}.px-sm-0{padding-right:0!important;padding-left:0!important}.px-sm-1{padding-right:.25rem!important;padding-left:.25rem!important}.px-sm-2{padding-right:.5rem!important;padding-left:.5rem!important}.px-sm-3{padding-right:1rem!important;padding-left:1rem!important}.px-sm-4{padding-right:1.5rem!important;padding-left:1.5rem!important}.px-sm-5{padding-right:3rem!important;padding-left:3rem!important}.py-sm-0{padding-top:0!important;padding-bottom:0!important}.py-sm-1{padding-top:.25rem!important;padding-bottom:.25rem!important}.py-sm-2{padding-top:.5rem!important;padding-bottom:.5rem!important}.py-sm-3{padding-top:1rem!important;padding-bottom:1rem!important}.py-sm-4{padding-top:1.5rem!important;padding-bottom:1.5rem!important}.py-sm-5{padding-top:3rem!important;padding-bottom:3rem!important}.pt-sm-0{padding-top:0!important}.pt-sm-1{padding-top:.25rem!important}.pt-sm-2{padding-top:.5rem!important}.pt-sm-3{padding-top:1rem!important}.pt-sm-4{padding-top:1.5rem!important}.pt-sm-5{padding-top:3rem!important}.pe-sm-0{padding-right:0!important}.pe-sm-1{padding-right:.25rem!important}.pe-sm-2{padding-right:.5rem!important}.pe-sm-3{padding-right:1rem!important}.pe-sm-4{padding-right:1.5rem!important}.pe-sm-5{padding-right:3rem!important}.pb-sm-0{padding-bottom:0!important}.pb-sm-1{padding-bottom:.25rem!important}.pb-sm-2{padding-bottom:.5rem!important}.pb-sm-3{padding-bottom:1rem!important}.pb-sm-4{padding-bottom:1.5rem!important}.pb-sm-5{padding-bottom:3rem!important}.ps-sm-0{padding-left:0!important}.ps-sm-1{padding-left:.25rem!important}.ps-sm-2{padding-left:.5rem!important}.ps-sm-3{padding-left:1rem!important}.ps-sm-4{padding-left:1.5rem!important}.ps-sm-5{padding-left:3rem!important}.gap-sm-0{gap:0!important}.gap-sm-1{gap:.25rem!important}.gap-sm-2{gap:.5rem!important}.gap-sm-3{gap:1rem!important}.gap-sm-4{gap:1.5rem!important}.gap-sm-5{gap:3rem!important}.row-gap-sm-0{row-gap:0!important}.row-gap-sm-1{row-gap:.25rem!important}.row-gap-sm-2{row-gap:.5rem!important}.row-gap-sm-3{row-gap:1rem!important}.row-gap-sm-4{row-gap:1.5rem!important}.row-gap-sm-5{row-gap:3rem!important}.column-gap-sm-0{-moz-column-gap:0!important;column-gap:0!important}.column-gap-sm-1{-moz-column-gap:0.25rem!important;column-gap:.25rem!important}.column-gap-sm-2{-moz-column-gap:0.5rem!important;column-gap:.5rem!important}.column-gap-sm-3{-moz-column-gap:1rem!important;column-gap:1rem!important}.column-gap-sm-4{-moz-column-gap:1.5rem!important;column-gap:1.5rem!important}.column-gap-sm-5{-moz-column-gap:3rem!important;column-gap:3rem!important}.text-sm-start{text-align:left!important}.text-sm-end{text-align:right!important}.text-sm-center{text-align:center!important}}@media (min-width:768px){.float-md-start{float:left!important}.float-md-end{float:right!important}.float-md-none{float:none!important}.object-fit-md-contain{-o-object-fit:contain!important;object-fit:contain!important}.object-fit-md-cover{-o-object-fit:cover!important;object-fit:cover!important}.object-fit-md-fill{-o-object-fit:fill!important;object-fit:fill!important}.object-fit-md-scale{-o-object-fit:scale-down!important;object-fit:scale-down!important}.object-fit-md-none{-o-object-fit:none!important;object-fit:none!important}.d-md-inline{display:inline!important}.d-md-inline-block{display:inline-block!important}.d-md-block{display:block!important}.d-md-grid{display:grid!important}.d-md-inline-grid{display:inline-grid!important}.d-md-table{display:table!important}.d-md-table-row{display:table-row!important}.d-md-table-cell{display:table-cell!important}.d-md-flex{display:flex!important}.d-md-inline-flex{display:inline-flex!important}.d-md-none{display:none!important}.flex-md-fill{flex:1 1 auto!important}.flex-md-row{flex-direction:row!important}.flex-md-column{flex-direction:column!important}.flex-md-row-reverse{flex-direction:row-reverse!important}.flex-md-column-reverse{flex-direction:column-reverse!important}.flex-md-grow-0{flex-grow:0!important}.flex-md-grow-1{flex-grow:1!important}.flex-md-shrink-0{flex-shrink:0!important}.flex-md-shrink-1{flex-shrink:1!important}.flex-md-wrap{flex-wrap:wrap!important}.flex-md-nowrap{flex-wrap:nowrap!important}.flex-md-wrap-reverse{flex-wrap:wrap-reverse!important}.justify-content-md-start{justify-content:flex-start!important}.justify-content-md-end{justify-content:flex-end!important}.justify-content-md-center{justify-content:center!important}.justify-content-md-between{justify-content:space-between!important}.justify-content-md-around{justify-content:space-around!important}.justify-content-md-evenly{justify-content:space-evenly!important}.align-items-md-start{align-items:flex-start!important}.align-items-md-end{align-items:flex-end!important}.align-items-md-center{align-items:center!important}.align-items-md-baseline{align-items:baseline!important}.align-items-md-stretch{align-items:stretch!important}.align-content-md-start{align-content:flex-start!important}.align-content-md-end{align-content:flex-end!important}.align-content-md-center{align-content:center!important}.align-content-md-between{align-content:space-between!important}.align-content-md-around{align-content:space-around!important}.align-content-md-stretch{align-content:stretch!important}.align-self-md-auto{align-self:auto!important}.align-self-md-start{align-self:flex-start!important}.align-self-md-end{align-self:flex-end!important}.align-self-md-center{align-self:center!important}.align-self-md-baseline{align-self:baseline!important}.align-self-md-stretch{align-self:stretch!important}.order-md-first{order:-1!important}.order-md-0{order:0!important}.order-md-1{order:1!important}.order-md-2{order:2!important}.order-md-3{order:3!important}.order-md-4{order:4!important}.order-md-5{order:5!important}.order-md-last{order:6!important}.m-md-0{margin:0!important}.m-md-1{margin:.25rem!important}.m-md-2{margin:.5rem!important}.m-md-3{margin:1rem!important}.m-md-4{margin:1.5rem!important}.m-md-5{margin:3rem!important}.m-md-auto{margin:auto!important}.mx-md-0{margin-right:0!important;margin-left:0!important}.mx-md-1{margin-right:.25rem!important;margin-left:.25rem!important}.mx-md-2{margin-right:.5rem!important;margin-left:.5rem!important}.mx-md-3{margin-right:1rem!important;margin-left:1rem!important}.mx-md-4{margin-right:1.5rem!important;margin-left:1.5rem!important}.mx-md-5{margin-right:3rem!important;margin-left:3rem!important}.mx-md-auto{margin-right:auto!important;margin-left:auto!important}.my-md-0{margin-top:0!important;margin-bottom:0!important}.my-md-1{margin-top:.25rem!important;margin-bottom:.25rem!important}.my-md-2{margin-top:.5rem!important;margin-bottom:.5rem!important}.my-md-3{margin-top:1rem!important;margin-bottom:1rem!important}.my-md-4{margin-top:1.5rem!important;margin-bottom:1.5rem!important}.my-md-5{margin-top:3rem!important;margin-bottom:3rem!important}.my-md-auto{margin-top:auto!important;margin-bottom:auto!important}.mt-md-0{margin-top:0!important}.mt-md-1{margin-top:.25rem!important}.mt-md-2{margin-top:.5rem!important}.mt-md-3{margin-top:1rem!important}.mt-md-4{margin-top:1.5rem!important}.mt-md-5{margin-top:3rem!important}.mt-md-auto{margin-top:auto!important}.me-md-0{margin-right:0!important}.me-md-1{margin-right:.25rem!important}.me-md-2{margin-right:.5rem!important}.me-md-3{margin-right:1rem!important}.me-md-4{margin-right:1.5rem!important}.me-md-5{margin-right:3rem!important}.me-md-auto{margin-right:auto!important}.mb-md-0{margin-bottom:0!important}.mb-md-1{margin-bottom:.25rem!important}.mb-md-2{margin-bottom:.5rem!important}.mb-md-3{margin-bottom:1rem!important}.mb-md-4{margin-bottom:1.5rem!important}.mb-md-5{margin-bottom:3rem!important}.mb-md-auto{margin-bottom:auto!important}.ms-md-0{margin-left:0!important}.ms-md-1{margin-left:.25rem!important}.ms-md-2{margin-left:.5rem!important}.ms-md-3{margin-left:1rem!important}.ms-md-4{margin-left:1.5rem!important}.ms-md-5{margin-left:3rem!important}.ms-md-auto{margin-left:auto!important}.p-md-0{padding:0!important}.p-md-1{padding:.25rem!important}.p-md-2{padding:.5rem!important}.p-md-3{padding:1rem!important}.p-md-4{padding:1.5rem!important}.p-md-5{padding:3rem!important}.px-md-0{padding-right:0!important;padding-left:0!important}.px-md-1{padding-right:.25rem!important;padding-left:.25rem!important}.px-md-2{padding-right:.5rem!important;padding-left:.5rem!important}.px-md-3{padding-right:1rem!important;padding-left:1rem!important}.px-md-4{padding-right:1.5rem!important;padding-left:1.5rem!important}.px-md-5{padding-right:3rem!important;padding-left:3rem!important}.py-md-0{padding-top:0!important;padding-bottom:0!important}.py-md-1{padding-top:.25rem!important;padding-bottom:.25rem!important}.py-md-2{padding-top:.5rem!important;padding-bottom:.5rem!important}.py-md-3{padding-top:1rem!important;padding-bottom:1rem!important}.py-md-4{padding-top:1.5rem!important;padding-bottom:1.5rem!important}.py-md-5{padding-top:3rem!important;padding-bottom:3rem!important}.pt-md-0{padding-top:0!important}.pt-md-1{padding-top:.25rem!important}.pt-md-2{padding-top:.5rem!important}.pt-md-3{padding-top:1rem!important}.pt-md-4{padding-top:1.5rem!important}.pt-md-5{padding-top:3rem!important}.pe-md-0{padding-right:0!important}.pe-md-1{padding-right:.25rem!important}.pe-md-2{padding-right:.5rem!important}.pe-md-3{padding-right:1rem!important}.pe-md-4{padding-right:1.5rem!important}.pe-md-5{padding-right:3rem!important}.pb-md-0{padding-bottom:0!important}.pb-md-1{padding-bottom:.25rem!important}.pb-md-2{padding-bottom:.5rem!important}.pb-md-3{padding-bottom:1rem!important}.pb-md-4{padding-bottom:1.5rem!important}.pb-md-5{padding-bottom:3rem!important}.ps-md-0{padding-left:0!important}.ps-md-1{padding-left:.25rem!important}.ps-md-2{padding-left:.5rem!important}.ps-md-3{padding-left:1rem!important}.ps-md-4{padding-left:1.5rem!important}.ps-md-5{padding-left:3rem!important}.gap-md-0{gap:0!important}.gap-md-1{gap:.25rem!important}.gap-md-2{gap:.5rem!important}.gap-md-3{gap:1rem!important}.gap-md-4{gap:1.5rem!important}.gap-md-5{gap:3rem!important}.row-gap-md-0{row-gap:0!important}.row-gap-md-1{row-gap:.25rem!important}.row-gap-md-2{row-gap:.5rem!important}.row-gap-md-3{row-gap:1rem!important}.row-gap-md-4{row-gap:1.5rem!important}.row-gap-md-5{row-gap:3rem!important}.column-gap-md-0{-moz-column-gap:0!important;column-gap:0!important}.column-gap-md-1{-moz-column-gap:0.25rem!important;column-gap:.25rem!important}.column-gap-md-2{-moz-column-gap:0.5rem!important;column-gap:.5rem!important}.column-gap-md-3{-moz-column-gap:1rem!important;column-gap:1rem!important}.column-gap-md-4{-moz-column-gap:1.5rem!important;column-gap:1.5rem!important}.column-gap-md-5{-moz-column-gap:3rem!important;column-gap:3rem!important}.text-md-start{text-align:left!important}.text-md-end{text-align:right!important}.text-md-center{text-align:center!important}}@media (min-width:992px){.float-lg-start{float:left!important}.float-lg-end{float:right!important}.float-lg-none{float:none!important}.object-fit-lg-contain{-o-object-fit:contain!important;object-fit:contain!important}.object-fit-lg-cover{-o-object-fit:cover!important;object-fit:cover!important}.object-fit-lg-fill{-o-object-fit:fill!important;object-fit:fill!important}.object-fit-lg-scale{-o-object-fit:scale-down!important;object-fit:scale-down!important}.object-fit-lg-none{-o-object-fit:none!important;object-fit:none!important}.d-lg-inline{display:inline!important}.d-lg-inline-block{display:inline-block!important}.d-lg-block{display:block!important}.d-lg-grid{display:grid!important}.d-lg-inline-grid{display:inline-grid!important}.d-lg-table{display:table!important}.d-lg-table-row{display:table-row!important}.d-lg-table-cell{display:table-cell!important}.d-lg-flex{display:flex!important}.d-lg-inline-flex{display:inline-flex!important}.d-lg-none{display:none!important}.flex-lg-fill{flex:1 1 auto!important}.flex-lg-row{flex-direction:row!important}.flex-lg-column{flex-direction:column!important}.flex-lg-row-reverse{flex-direction:row-reverse!important}.flex-lg-column-reverse{flex-direction:column-reverse!important}.flex-lg-grow-0{flex-grow:0!important}.flex-lg-grow-1{flex-grow:1!important}.flex-lg-shrink-0{flex-shrink:0!important}.flex-lg-shrink-1{flex-shrink:1!important}.flex-lg-wrap{flex-wrap:wrap!important}.flex-lg-nowrap{flex-wrap:nowrap!important}.flex-lg-wrap-reverse{flex-wrap:wrap-reverse!important}.justify-content-lg-start{justify-content:flex-start!important}.justify-content-lg-end{justify-content:flex-end!important}.justify-content-lg-center{justify-content:center!important}.justify-content-lg-between{justify-content:space-between!important}.justify-content-lg-around{justify-content:space-around!important}.justify-content-lg-evenly{justify-content:space-evenly!important}.align-items-lg-start{align-items:flex-start!important}.align-items-lg-end{align-items:flex-end!important}.align-items-lg-center{align-items:center!important}.align-items-lg-baseline{align-items:baseline!important}.align-items-lg-stretch{align-items:stretch!important}.align-content-lg-start{align-content:flex-start!important}.align-content-lg-end{align-content:flex-end!important}.align-content-lg-center{align-content:center!important}.align-content-lg-between{align-content:space-between!important}.align-content-lg-around{align-content:space-around!important}.align-content-lg-stretch{align-content:stretch!important}.align-self-lg-auto{align-self:auto!important}.align-self-lg-start{align-self:flex-start!important}.align-self-lg-end{align-self:flex-end!important}.align-self-lg-center{align-self:center!important}.align-self-lg-baseline{align-self:baseline!important}.align-self-lg-stretch{align-self:stretch!important}.order-lg-first{order:-1!important}.order-lg-0{order:0!important}.order-lg-1{order:1!important}.order-lg-2{order:2!important}.order-lg-3{order:3!important}.order-lg-4{order:4!important}.order-lg-5{order:5!important}.order-lg-last{order:6!important}.m-lg-0{margin:0!important}.m-lg-1{margin:.25rem!important}.m-lg-2{margin:.5rem!important}.m-lg-3{margin:1rem!important}.m-lg-4{margin:1.5rem!important}.m-lg-5{margin:3rem!important}.m-lg-auto{margin:auto!important}.mx-lg-0{margin-right:0!important;margin-left:0!important}.mx-lg-1{margin-right:.25rem!important;margin-left:.25rem!important}.mx-lg-2{margin-right:.5rem!important;margin-left:.5rem!important}.mx-lg-3{margin-right:1rem!important;margin-left:1rem!important}.mx-lg-4{margin-right:1.5rem!important;margin-left:1.5rem!important}.mx-lg-5{margin-right:3rem!important;margin-left:3rem!important}.mx-lg-auto{margin-right:auto!important;margin-left:auto!important}.my-lg-0{margin-top:0!important;margin-bottom:0!important}.my-lg-1{margin-top:.25rem!important;margin-bottom:.25rem!important}.my-lg-2{margin-top:.5rem!important;margin-bottom:.5rem!important}.my-lg-3{margin-top:1rem!important;margin-bottom:1rem!important}.my-lg-4{margin-top:1.5rem!important;margin-bottom:1.5rem!important}.my-lg-5{margin-top:3rem!important;margin-bottom:3rem!important}.my-lg-auto{margin-top:auto!important;margin-bottom:auto!important}.mt-lg-0{margin-top:0!important}.mt-lg-1{margin-top:.25rem!important}.mt-lg-2{margin-top:.5rem!important}.mt-lg-3{margin-top:1rem!important}.mt-lg-4{margin-top:1.5rem!important}.mt-lg-5{margin-top:3rem!important}.mt-lg-auto{margin-top:auto!important}.me-lg-0{margin-right:0!important}.me-lg-1{margin-right:.25rem!important}.me-lg-2{margin-right:.5rem!important}.me-lg-3{margin-right:1rem!important}.me-lg-4{margin-right:1.5rem!important}.me-lg-5{margin-right:3rem!important}.me-lg-auto{margin-right:auto!important}.mb-lg-0{margin-bottom:0!important}.mb-lg-1{margin-bottom:.25rem!important}.mb-lg-2{margin-bottom:.5rem!important}.mb-lg-3{margin-bottom:1rem!important}.mb-lg-4{margin-bottom:1.5rem!important}.mb-lg-5{margin-bottom:3rem!important}.mb-lg-auto{margin-bottom:auto!important}.ms-lg-0{margin-left:0!important}.ms-lg-1{margin-left:.25rem!important}.ms-lg-2{margin-left:.5rem!important}.ms-lg-3{margin-left:1rem!important}.ms-lg-4{margin-left:1.5rem!important}.ms-lg-5{margin-left:3rem!important}.ms-lg-auto{margin-left:auto!important}.p-lg-0{padding:0!important}.p-lg-1{padding:.25rem!important}.p-lg-2{padding:.5rem!important}.p-lg-3{padding:1rem!important}.p-lg-4{padding:1.5rem!important}.p-lg-5{padding:3rem!important}.px-lg-0{padding-right:0!important;padding-left:0!important}.px-lg-1{padding-right:.25rem!important;padding-left:.25rem!important}.px-lg-2{padding-right:.5rem!important;padding-left:.5rem!important}.px-lg-3{padding-right:1rem!important;padding-left:1rem!important}.px-lg-4{padding-right:1.5rem!important;padding-left:1.5rem!important}.px-lg-5{padding-right:3rem!important;padding-left:3rem!important}.py-lg-0{padding-top:0!important;padding-bottom:0!important}.py-lg-1{padding-top:.25rem!important;padding-bottom:.25rem!important}.py-lg-2{padding-top:.5rem!important;padding-bottom:.5rem!important}.py-lg-3{padding-top:1rem!important;padding-bottom:1rem!important}.py-lg-4{padding-top:1.5rem!important;padding-bottom:1.5rem!important}.py-lg-5{padding-top:3rem!important;padding-bottom:3rem!important}.pt-lg-0{padding-top:0!important}.pt-lg-1{padding-top:.25rem!important}.pt-lg-2{padding-top:.5rem!important}.pt-lg-3{padding-top:1rem!important}.pt-lg-4{padding-top:1.5rem!important}.pt-lg-5{padding-top:3rem!important}.pe-lg-0{padding-right:0!important}.pe-lg-1{padding-right:.25rem!important}.pe-lg-2{padding-right:.5rem!important}.pe-lg-3{padding-right:1rem!important}.pe-lg-4{padding-right:1.5rem!important}.pe-lg-5{padding-right:3rem!important}.pb-lg-0{padding-bottom:0!important}.pb-lg-1{padding-bottom:.25rem!important}.pb-lg-2{padding-bottom:.5rem!important}.pb-lg-3{padding-bottom:1rem!important}.pb-lg-4{padding-bottom:1.5rem!important}.pb-lg-5{padding-bottom:3rem!important}.ps-lg-0{padding-left:0!important}.ps-lg-1{padding-left:.25rem!important}.ps-lg-2{padding-left:.5rem!important}.ps-lg-3{padding-left:1rem!important}.ps-lg-4{padding-left:1.5rem!important}.ps-lg-5{padding-left:3rem!important}.gap-lg-0{gap:0!important}.gap-lg-1{gap:.25rem!important}.gap-lg-2{gap:.5rem!important}.gap-lg-3{gap:1rem!important}.gap-lg-4{gap:1.5rem!important}.gap-lg-5{gap:3rem!important}.row-gap-lg-0{row-gap:0!important}.row-gap-lg-1{row-gap:.25rem!important}.row-gap-lg-2{row-gap:.5rem!important}.row-gap-lg-3{row-gap:1rem!important}.row-gap-lg-4{row-gap:1.5rem!important}.row-gap-lg-5{row-gap:3rem!important}.column-gap-lg-0{-moz-column-gap:0!important;column-gap:0!important}.column-gap-lg-1{-moz-column-gap:0.25rem!important;column-gap:.25rem!important}.column-gap-lg-2{-moz-column-gap:0.5rem!important;column-gap:.5rem!important}.column-gap-lg-3{-moz-column-gap:1rem!important;column-gap:1rem!important}.column-gap-lg-4{-moz-column-gap:1.5rem!important;column-gap:1.5rem!important}.column-gap-lg-5{-moz-column-gap:3rem!important;column-gap:3rem!important}.text-lg-start{text-align:left!important}.text-lg-end{text-align:right!important}.text-lg-center{text-align:center!important}}@media (min-width:1200px){.float-xl-start{float:left!important}.float-xl-end{float:right!important}.float-xl-none{float:none!important}.object-fit-xl-contain{-o-object-fit:contain!important;object-fit:contain!important}.object-fit-xl-cover{-o-object-fit:cover!important;object-fit:cover!important}.object-fit-xl-fill{-o-object-fit:fill!important;object-fit:fill!important}.object-fit-xl-scale{-o-object-fit:scale-down!important;object-fit:scale-down!important}.object-fit-xl-none{-o-object-fit:none!important;object-fit:none!important}.d-xl-inline{display:inline!important}.d-xl-inline-block{display:inline-block!important}.d-xl-block{display:block!important}.d-xl-grid{display:grid!important}.d-xl-inline-grid{display:inline-grid!important}.d-xl-table{display:table!important}.d-xl-table-row{display:table-row!important}.d-xl-table-cell{display:table-cell!important}.d-xl-flex{display:flex!important}.d-xl-inline-flex{display:inline-flex!important}.d-xl-none{display:none!important}.flex-xl-fill{flex:1 1 auto!important}.flex-xl-row{flex-direction:row!important}.flex-xl-column{flex-direction:column!important}.flex-xl-row-reverse{flex-direction:row-reverse!important}.flex-xl-column-reverse{flex-direction:column-reverse!important}.flex-xl-grow-0{flex-grow:0!important}.flex-xl-grow-1{flex-grow:1!important}.flex-xl-shrink-0{flex-shrink:0!important}.flex-xl-shrink-1{flex-shrink:1!important}.flex-xl-wrap{flex-wrap:wrap!important}.flex-xl-nowrap{flex-wrap:nowrap!important}.flex-xl-wrap-reverse{flex-wrap:wrap-reverse!important}.justify-content-xl-start{justify-content:flex-start!important}.justify-content-xl-end{justify-content:flex-end!important}.justify-content-xl-center{justify-content:center!important}.justify-content-xl-between{justify-content:space-between!important}.justify-content-xl-around{justify-content:space-around!important}.justify-content-xl-evenly{justify-content:space-evenly!important}.align-items-xl-start{align-items:flex-start!important}.align-items-xl-end{align-items:flex-end!important}.align-items-xl-center{align-items:center!important}.align-items-xl-baseline{align-items:baseline!important}.align-items-xl-stretch{align-items:stretch!important}.align-content-xl-start{align-content:flex-start!important}.align-content-xl-end{align-content:flex-end!important}.align-content-xl-center{align-content:center!important}.align-content-xl-between{align-content:space-between!important}.align-content-xl-around{align-content:space-around!important}.align-content-xl-stretch{align-content:stretch!important}.align-self-xl-auto{align-self:auto!important}.align-self-xl-start{align-self:flex-start!important}.align-self-xl-end{align-self:flex-end!important}.align-self-xl-center{align-self:center!important}.align-self-xl-baseline{align-self:baseline!important}.align-self-xl-stretch{align-self:stretch!important}.order-xl-first{order:-1!important}.order-xl-0{order:0!important}.order-xl-1{order:1!important}.order-xl-2{order:2!important}.order-xl-3{order:3!important}.order-xl-4{order:4!important}.order-xl-5{order:5!important}.order-xl-last{order:6!important}.m-xl-0{margin:0!important}.m-xl-1{margin:.25rem!important}.m-xl-2{margin:.5rem!important}.m-xl-3{margin:1rem!important}.m-xl-4{margin:1.5rem!important}.m-xl-5{margin:3rem!important}.m-xl-auto{margin:auto!important}.mx-xl-0{margin-right:0!important;margin-left:0!important}.mx-xl-1{margin-right:.25rem!important;margin-left:.25rem!important}.mx-xl-2{margin-right:.5rem!important;margin-left:.5rem!important}.mx-xl-3{margin-right:1rem!important;margin-left:1rem!important}.mx-xl-4{margin-right:1.5rem!important;margin-left:1.5rem!important}.mx-xl-5{margin-right:3rem!important;margin-left:3rem!important}.mx-xl-auto{margin-right:auto!important;margin-left:auto!important}.my-xl-0{margin-top:0!important;margin-bottom:0!important}.my-xl-1{margin-top:.25rem!important;margin-bottom:.25rem!important}.my-xl-2{margin-top:.5rem!important;margin-bottom:.5rem!important}.my-xl-3{margin-top:1rem!important;margin-bottom:1rem!important}.my-xl-4{margin-top:1.5rem!important;margin-bottom:1.5rem!important}.my-xl-5{margin-top:3rem!important;margin-bottom:3rem!important}.my-xl-auto{margin-top:auto!important;margin-bottom:auto!important}.mt-xl-0{margin-top:0!important}.mt-xl-1{margin-top:.25rem!important}.mt-xl-2{margin-top:.5rem!important}.mt-xl-3{margin-top:1rem!important}.mt-xl-4{margin-top:1.5rem!important}.mt-xl-5{margin-top:3rem!important}.mt-xl-auto{margin-top:auto!important}.me-xl-0{margin-right:0!important}.me-xl-1{margin-right:.25rem!important}.me-xl-2{margin-right:.5rem!important}.me-xl-3{margin-right:1rem!important}.me-xl-4{margin-right:1.5rem!important}.me-xl-5{margin-right:3rem!important}.me-xl-auto{margin-right:auto!important}.mb-xl-0{margin-bottom:0!important}.mb-xl-1{margin-bottom:.25rem!important}.mb-xl-2{margin-bottom:.5rem!important}.mb-xl-3{margin-bottom:1rem!important}.mb-xl-4{margin-bottom:1.5rem!important}.mb-xl-5{margin-bottom:3rem!important}.mb-xl-auto{margin-bottom:auto!important}.ms-xl-0{margin-left:0!important}.ms-xl-1{margin-left:.25rem!important}.ms-xl-2{margin-left:.5rem!important}.ms-xl-3{margin-left:1rem!important}.ms-xl-4{margin-left:1.5rem!important}.ms-xl-5{margin-left:3rem!important}.ms-xl-auto{margin-left:auto!important}.p-xl-0{padding:0!important}.p-xl-1{padding:.25rem!important}.p-xl-2{padding:.5rem!important}.p-xl-3{padding:1rem!important}.p-xl-4{padding:1.5rem!important}.p-xl-5{padding:3rem!important}.px-xl-0{padding-right:0!important;padding-left:0!important}.px-xl-1{padding-right:.25rem!important;padding-left:.25rem!important}.px-xl-2{padding-right:.5rem!important;padding-left:.5rem!important}.px-xl-3{padding-right:1rem!important;padding-left:1rem!important}.px-xl-4{padding-right:1.5rem!important;padding-left:1.5rem!important}.px-xl-5{padding-right:3rem!important;padding-left:3rem!important}.py-xl-0{padding-top:0!important;padding-bottom:0!important}.py-xl-1{padding-top:.25rem!important;padding-bottom:.25rem!important}.py-xl-2{padding-top:.5rem!important;padding-bottom:.5rem!important}.py-xl-3{padding-top:1rem!important;padding-bottom:1rem!important}.py-xl-4{padding-top:1.5rem!important;padding-bottom:1.5rem!important}.py-xl-5{padding-top:3rem!important;padding-bottom:3rem!important}.pt-xl-0{padding-top:0!important}.pt-xl-1{padding-top:.25rem!important}.pt-xl-2{padding-top:.5rem!important}.pt-xl-3{padding-top:1rem!important}.pt-xl-4{padding-top:1.5rem!important}.pt-xl-5{padding-top:3rem!important}.pe-xl-0{padding-right:0!important}.pe-xl-1{padding-right:.25rem!important}.pe-xl-2{padding-right:.5rem!important}.pe-xl-3{padding-right:1rem!important}.pe-xl-4{padding-right:1.5rem!important}.pe-xl-5{padding-right:3rem!important}.pb-xl-0{padding-bottom:0!important}.pb-xl-1{padding-bottom:.25rem!important}.pb-xl-2{padding-bottom:.5rem!important}.pb-xl-3{padding-bottom:1rem!important}.pb-xl-4{padding-bottom:1.5rem!important}.pb-xl-5{padding-bottom:3rem!important}.ps-xl-0{padding-left:0!important}.ps-xl-1{padding-left:.25rem!important}.ps-xl-2{padding-left:.5rem!important}.ps-xl-3{padding-left:1rem!important}.ps-xl-4{padding-left:1.5rem!important}.ps-xl-5{padding-left:3rem!important}.gap-xl-0{gap:0!important}.gap-xl-1{gap:.25rem!important}.gap-xl-2{gap:.5rem!important}.gap-xl-3{gap:1rem!important}.gap-xl-4{gap:1.5rem!important}.gap-xl-5{gap:3rem!important}.row-gap-xl-0{row-gap:0!important}.row-gap-xl-1{row-gap:.25rem!important}.row-gap-xl-2{row-gap:.5rem!important}.row-gap-xl-3{row-gap:1rem!important}.row-gap-xl-4{row-gap:1.5rem!important}.row-gap-xl-5{row-gap:3rem!important}.column-gap-xl-0{-moz-column-gap:0!important;column-gap:0!important}.column-gap-xl-1{-moz-column-gap:0.25rem!important;column-gap:.25rem!important}.column-gap-xl-2{-moz-column-gap:0.5rem!important;column-gap:.5rem!important}.column-gap-xl-3{-moz-column-gap:1rem!important;column-gap:1rem!important}.column-gap-xl-4{-moz-column-gap:1.5rem!important;column-gap:1.5rem!important}.column-gap-xl-5{-moz-column-gap:3rem!important;column-gap:3rem!important}.text-xl-start{text-align:left!important}.text-xl-end{text-align:right!important}.text-xl-center{text-align:center!important}}@media (min-width:1400px){.float-xxl-start{float:left!important}.float-xxl-end{float:right!important}.float-xxl-none{float:none!important}.object-fit-xxl-contain{-o-object-fit:contain!important;object-fit:contain!important}.object-fit-xxl-cover{-o-object-fit:cover!important;object-fit:cover!important}.object-fit-xxl-fill{-o-object-fit:fill!important;object-fit:fill!important}.object-fit-xxl-scale{-o-object-fit:scale-down!important;object-fit:scale-down!important}.object-fit-xxl-none{-o-object-fit:none!important;object-fit:none!important}.d-xxl-inline{display:inline!important}.d-xxl-inline-block{display:inline-block!important}.d-xxl-block{display:block!important}.d-xxl-grid{display:grid!important}.d-xxl-inline-grid{display:inline-grid!important}.d-xxl-table{display:table!important}.d-xxl-table-row{display:table-row!important}.d-xxl-table-cell{display:table-cell!important}.d-xxl-flex{display:flex!important}.d-xxl-inline-flex{display:inline-flex!important}.d-xxl-none{display:none!important}.flex-xxl-fill{flex:1 1 auto!important}.flex-xxl-row{flex-direction:row!important}.flex-xxl-column{flex-direction:column!important}.flex-xxl-row-reverse{flex-direction:row-reverse!important}.flex-xxl-column-reverse{flex-direction:column-reverse!important}.flex-xxl-grow-0{flex-grow:0!important}.flex-xxl-grow-1{flex-grow:1!important}.flex-xxl-shrink-0{flex-shrink:0!important}.flex-xxl-shrink-1{flex-shrink:1!important}.flex-xxl-wrap{flex-wrap:wrap!important}.flex-xxl-nowrap{flex-wrap:nowrap!important}.flex-xxl-wrap-reverse{flex-wrap:wrap-reverse!important}.justify-content-xxl-start{justify-content:flex-start!important}.justify-content-xxl-end{justify-content:flex-end!important}.justify-content-xxl-center{justify-content:center!important}.justify-content-xxl-between{justify-content:space-between!important}.justify-content-xxl-around{justify-content:space-around!important}.justify-content-xxl-evenly{justify-content:space-evenly!important}.align-items-xxl-start{align-items:flex-start!important}.align-items-xxl-end{align-items:flex-end!important}.align-items-xxl-center{align-items:center!important}.align-items-xxl-baseline{align-items:baseline!important}.align-items-xxl-stretch{align-items:stretch!important}.align-content-xxl-start{align-content:flex-start!important}.align-content-xxl-end{align-content:flex-end!important}.align-content-xxl-center{align-content:center!important}.align-content-xxl-between{align-content:space-between!important}.align-content-xxl-around{align-content:space-around!important}.align-content-xxl-stretch{align-content:stretch!important}.align-self-xxl-auto{align-self:auto!important}.align-self-xxl-start{align-self:flex-start!important}.align-self-xxl-end{align-self:flex-end!important}.align-self-xxl-center{align-self:center!important}.align-self-xxl-baseline{align-self:baseline!important}.align-self-xxl-stretch{align-self:stretch!important}.order-xxl-first{order:-1!important}.order-xxl-0{order:0!important}.order-xxl-1{order:1!important}.order-xxl-2{order:2!important}.order-xxl-3{order:3!important}.order-xxl-4{order:4!important}.order-xxl-5{order:5!important}.order-xxl-last{order:6!important}.m-xxl-0{margin:0!important}.m-xxl-1{margin:.25rem!important}.m-xxl-2{margin:.5rem!important}.m-xxl-3{margin:1rem!important}.m-xxl-4{margin:1.5rem!important}.m-xxl-5{margin:3rem!important}.m-xxl-auto{margin:auto!important}.mx-xxl-0{margin-right:0!important;margin-left:0!important}.mx-xxl-1{margin-right:.25rem!important;margin-left:.25rem!important}.mx-xxl-2{margin-right:.5rem!important;margin-left:.5rem!important}.mx-xxl-3{margin-right:1rem!important;margin-left:1rem!important}.mx-xxl-4{margin-right:1.5rem!important;margin-left:1.5rem!important}.mx-xxl-5{margin-right:3rem!important;margin-left:3rem!important}.mx-xxl-auto{margin-right:auto!important;margin-left:auto!important}.my-xxl-0{margin-top:0!important;margin-bottom:0!important}.my-xxl-1{margin-top:.25rem!important;margin-bottom:.25rem!important}.my-xxl-2{margin-top:.5rem!important;margin-bottom:.5rem!important}.my-xxl-3{margin-top:1rem!important;margin-bottom:1rem!important}.my-xxl-4{margin-top:1.5rem!important;margin-bottom:1.5rem!important}.my-xxl-5{margin-top:3rem!important;margin-bottom:3rem!important}.my-xxl-auto{margin-top:auto!important;margin-bottom:auto!important}.mt-xxl-0{margin-top:0!important}.mt-xxl-1{margin-top:.25rem!important}.mt-xxl-2{margin-top:.5rem!important}.mt-xxl-3{margin-top:1rem!important}.mt-xxl-4{margin-top:1.5rem!important}.mt-xxl-5{margin-top:3rem!important}.mt-xxl-auto{margin-top:auto!important}.me-xxl-0{margin-right:0!important}.me-xxl-1{margin-right:.25rem!important}.me-xxl-2{margin-right:.5rem!important}.me-xxl-3{margin-right:1rem!important}.me-xxl-4{margin-right:1.5rem!important}.me-xxl-5{margin-right:3rem!important}.me-xxl-auto{margin-right:auto!important}.mb-xxl-0{margin-bottom:0!important}.mb-xxl-1{margin-bottom:.25rem!important}.mb-xxl-2{margin-bottom:.5rem!important}.mb-xxl-3{margin-bottom:1rem!important}.mb-xxl-4{margin-bottom:1.5rem!important}.mb-xxl-5{margin-bottom:3rem!important}.mb-xxl-auto{margin-bottom:auto!important}.ms-xxl-0{margin-left:0!important}.ms-xxl-1{margin-left:.25rem!important}.ms-xxl-2{margin-left:.5rem!important}.ms-xxl-3{margin-left:1rem!important}.ms-xxl-4{margin-left:1.5rem!important}.ms-xxl-5{margin-left:3rem!important}.ms-xxl-auto{margin-left:auto!important}.p-xxl-0{padding:0!important}.p-xxl-1{padding:.25rem!important}.p-xxl-2{padding:.5rem!important}.p-xxl-3{padding:1rem!important}.p-xxl-4{padding:1.5rem!important}.p-xxl-5{padding:3rem!important}.px-xxl-0{padding-right:0!important;padding-left:0!important}.px-xxl-1{padding-right:.25rem!important;padding-left:.25rem!important}.px-xxl-2{padding-right:.5rem!important;padding-left:.5rem!important}.px-xxl-3{padding-right:1rem!important;padding-left:1rem!important}.px-xxl-4{padding-right:1.5rem!important;padding-left:1.5rem!important}.px-xxl-5{padding-right:3rem!important;padding-left:3rem!important}.py-xxl-0{padding-top:0!important;padding-bottom:0!important}.py-xxl-1{padding-top:.25rem!important;padding-bottom:.25rem!important}.py-xxl-2{padding-top:.5rem!important;padding-bottom:.5rem!important}.py-xxl-3{padding-top:1rem!important;padding-bottom:1rem!important}.py-xxl-4{padding-top:1.5rem!important;padding-bottom:1.5rem!important}.py-xxl-5{padding-top:3rem!important;padding-bottom:3rem!important}.pt-xxl-0{padding-top:0!important}.pt-xxl-1{padding-top:.25rem!important}.pt-xxl-2{padding-top:.5rem!important}.pt-xxl-3{padding-top:1rem!important}.pt-xxl-4{padding-top:1.5rem!important}.pt-xxl-5{padding-top:3rem!important}.pe-xxl-0{padding-right:0!important}.pe-xxl-1{padding-right:.25rem!important}.pe-xxl-2{padding-right:.5rem!important}.pe-xxl-3{padding-right:1rem!important}.pe-xxl-4{padding-right:1.5rem!important}.pe-xxl-5{padding-right:3rem!important}.pb-xxl-0{padding-bottom:0!important}.pb-xxl-1{padding-bottom:.25rem!important}.pb-xxl-2{padding-bottom:.5rem!important}.pb-xxl-3{padding-bottom:1rem!important}.pb-xxl-4{padding-bottom:1.5rem!important}.pb-xxl-5{padding-bottom:3rem!important}.ps-xxl-0{padding-left:0!important}.ps-xxl-1{padding-left:.25rem!important}.ps-xxl-2{padding-left:.5rem!important}.ps-xxl-3{padding-left:1rem!important}.ps-xxl-4{padding-left:1.5rem!important}.ps-xxl-5{padding-left:3rem!important}.gap-xxl-0{gap:0!important}.gap-xxl-1{gap:.25rem!important}.gap-xxl-2{gap:.5rem!important}.gap-xxl-3{gap:1rem!important}.gap-xxl-4{gap:1.5rem!important}.gap-xxl-5{gap:3rem!important}.row-gap-xxl-0{row-gap:0!important}.row-gap-xxl-1{row-gap:.25rem!important}.row-gap-xxl-2{row-gap:.5rem!important}.row-gap-xxl-3{row-gap:1rem!important}.row-gap-xxl-4{row-gap:1.5rem!important}.row-gap-xxl-5{row-gap:3rem!important}.column-gap-xxl-0{-moz-column-gap:0!important;column-gap:0!important}.column-gap-xxl-1{-moz-column-gap:0.25rem!important;column-gap:.25rem!important}.column-gap-xxl-2{-moz-column-gap:0.5rem!important;column-gap:.5rem!important}.column-gap-xxl-3{-moz-column-gap:1rem!important;column-gap:1rem!important}.column-gap-xxl-4{-moz-column-gap:1.5rem!important;column-gap:1.5rem!important}.column-gap-xxl-5{-moz-column-gap:3rem!important;column-gap:3rem!important}.text-xxl-start{text-align:left!important}.text-xxl-end{text-align:right!important}.text-xxl-center{text-align:center!important}}@media (min-width:1200px){.fs-1{font-size:2.5rem!important}.fs-2{font-size:2rem!important}.fs-3{font-size:1.75rem!important}.fs-4{font-size:1.5rem!important}}@media print{.d-print-inline{display:inline!important}.d-print-inline-block{display:inline-block!important}.d-print-block{display:block!important}.d-print-grid{display:grid!important}.d-print-inline-grid{display:inline-grid!important}.d-print-table{display:table!important}.d-print-table-row{display:table-row!important}.d-print-table-cell{display:table-cell!important}.d-print-flex{display:flex!important}.d-print-inline-flex{display:inline-flex!important}.d-print-none{display:none!important}}
+/*# sourceMappingURL=bootstrap.min.css.map */
\ No newline at end of file
diff --git a/M6/emensa/public/css/style.css b/M6/emensa/public/css/style.css
new file mode 100644
index 0000000..de9cc31
--- /dev/null
+++ b/M6/emensa/public/css/style.css
@@ -0,0 +1,96 @@
+* {
+ font-family: Arial;
+}
+
+.grid {
+ display: grid;
+ grid-template-columns: 200px auto 200px;
+}
+
+img {
+ width: 100%;
+ height: auto;
+}
+
+.speisen {
+ border: solid;
+ border-collapse: collapse;
+}
+
+.speisen td {
+ border: solid;
+ border-collapse: collapse;
+ border-radius: 4px;
+ padding: 5px;
+ width: auto;
+}
+
+.speisen td:not(:first-of-type) {
+ text-align: center;
+}
+
+.speisen img{
+ width: 100px;
+ height: 100px;
+}
+
+
+p {
+ text-align: justify;
+}
+
+.zahlen {
+ list-style-type: none;
+ display: grid;
+ grid-template-columns: auto auto auto;
+ gap: 10px;
+}
+
+.zahlen p {
+ text-align: center;
+ font-weight: bold;
+}
+
+.formular {
+ display: grid;
+ grid-template-columns: auto auto auto;
+ justify-content: start;
+ gap: 10px;
+}
+
+.wichtig {
+ text-align: center;
+}
+
+.wichtigListe {
+ display: inline-block;
+ text-align: left;
+}
+
+.freude {
+ text-align: center;
+}
+
+footer {
+ border-top: 1px solid;
+}
+
+.fusszeile {
+ padding-top: 20px;
+ padding-bottom: 20px;
+ margin-left: auto;
+ margin-right: auto;
+ border: none;
+}
+
+.fusszeile td:first-child {
+ border-left: none;
+ padding-left: 20px;
+ padding-right: 20px;
+}
+
+.fusszeile td {
+ border-left: 3px solid;
+ padding-left: 20px;
+ padding-right: 20px;
+}
diff --git a/M6/emensa/public/favicon.ico b/M6/emensa/public/favicon.ico
new file mode 100644
index 0000000..d062dc0
Binary files /dev/null and b/M6/emensa/public/favicon.ico differ
diff --git a/M6/emensa/public/img/fh-logo.jpg b/M6/emensa/public/img/fh-logo.jpg
new file mode 100644
index 0000000..33cf0b4
Binary files /dev/null and b/M6/emensa/public/img/fh-logo.jpg differ
diff --git a/M6/emensa/public/img/gerichte/00_image_missing.jpg b/M6/emensa/public/img/gerichte/00_image_missing.jpg
new file mode 100644
index 0000000..e0e2d2a
Binary files /dev/null and b/M6/emensa/public/img/gerichte/00_image_missing.jpg differ
diff --git a/M6/emensa/public/img/gerichte/01_bratkartoffel.jpg b/M6/emensa/public/img/gerichte/01_bratkartoffel.jpg
new file mode 100644
index 0000000..802b46d
Binary files /dev/null and b/M6/emensa/public/img/gerichte/01_bratkartoffel.jpg differ
diff --git a/M6/emensa/public/img/gerichte/03_bratkartoffel.jpg b/M6/emensa/public/img/gerichte/03_bratkartoffel.jpg
new file mode 100644
index 0000000..e2d8002
Binary files /dev/null and b/M6/emensa/public/img/gerichte/03_bratkartoffel.jpg differ
diff --git a/M6/emensa/public/img/gerichte/04_tofu.jpg b/M6/emensa/public/img/gerichte/04_tofu.jpg
new file mode 100644
index 0000000..c3f0052
Binary files /dev/null and b/M6/emensa/public/img/gerichte/04_tofu.jpg differ
diff --git a/M6/emensa/public/img/gerichte/06_lasagne.jpg b/M6/emensa/public/img/gerichte/06_lasagne.jpg
new file mode 100644
index 0000000..ea291a9
Binary files /dev/null and b/M6/emensa/public/img/gerichte/06_lasagne.jpg differ
diff --git a/M6/emensa/public/img/gerichte/09_suppe.jpg b/M6/emensa/public/img/gerichte/09_suppe.jpg
new file mode 100644
index 0000000..cdff137
Binary files /dev/null and b/M6/emensa/public/img/gerichte/09_suppe.jpg differ
diff --git a/M6/emensa/public/img/gerichte/10_forelle.jpg b/M6/emensa/public/img/gerichte/10_forelle.jpg
new file mode 100644
index 0000000..4a1c439
Binary files /dev/null and b/M6/emensa/public/img/gerichte/10_forelle.jpg differ
diff --git a/M6/emensa/public/img/gerichte/11_soup.jpg b/M6/emensa/public/img/gerichte/11_soup.jpg
new file mode 100644
index 0000000..f7a416d
Binary files /dev/null and b/M6/emensa/public/img/gerichte/11_soup.jpg differ
diff --git a/M6/emensa/public/img/gerichte/12_kassler.jpg b/M6/emensa/public/img/gerichte/12_kassler.jpg
new file mode 100644
index 0000000..cf0e69a
Binary files /dev/null and b/M6/emensa/public/img/gerichte/12_kassler.jpg differ
diff --git a/M6/emensa/public/img/gerichte/13_reibekuchen.jpg b/M6/emensa/public/img/gerichte/13_reibekuchen.jpg
new file mode 100644
index 0000000..0415c0a
Binary files /dev/null and b/M6/emensa/public/img/gerichte/13_reibekuchen.jpg differ
diff --git a/M6/emensa/public/img/gerichte/15_pilze.jpg b/M6/emensa/public/img/gerichte/15_pilze.jpg
new file mode 100644
index 0000000..849594a
Binary files /dev/null and b/M6/emensa/public/img/gerichte/15_pilze.jpg differ
diff --git a/M6/emensa/public/img/gerichte/17_broetchen.jpg b/M6/emensa/public/img/gerichte/17_broetchen.jpg
new file mode 100644
index 0000000..c0656ac
Binary files /dev/null and b/M6/emensa/public/img/gerichte/17_broetchen.jpg differ
diff --git a/M6/emensa/public/img/gerichte/19_mousse.jpg b/M6/emensa/public/img/gerichte/19_mousse.jpg
new file mode 100644
index 0000000..0045cd1
Binary files /dev/null and b/M6/emensa/public/img/gerichte/19_mousse.jpg differ
diff --git a/M6/emensa/public/img/gerichte/20_suppe.jpg b/M6/emensa/public/img/gerichte/20_suppe.jpg
new file mode 100644
index 0000000..1b075da
Binary files /dev/null and b/M6/emensa/public/img/gerichte/20_suppe.jpg differ
diff --git a/M6/emensa/public/img/gerichte/license.txt b/M6/emensa/public/img/gerichte/license.txt
new file mode 100644
index 0000000..0c6b476
--- /dev/null
+++ b/M6/emensa/public/img/gerichte/license.txt
@@ -0,0 +1,6 @@
+Grafiken von unsplash.com.
+
+Lizenz:
+https://unsplash.com/license
+
+Letzter Zugriff 31.08.2020
\ No newline at end of file
diff --git a/M6/emensa/public/img/mensa21.jpg b/M6/emensa/public/img/mensa21.jpg
new file mode 100644
index 0000000..370d0fc
Binary files /dev/null and b/M6/emensa/public/img/mensa21.jpg differ
diff --git a/M6/emensa/public/img/test.jpg b/M6/emensa/public/img/test.jpg
new file mode 100644
index 0000000..4558cd4
Binary files /dev/null and b/M6/emensa/public/img/test.jpg differ
diff --git a/M6/emensa/public/index.php b/M6/emensa/public/index.php
new file mode 100644
index 0000000..b376d62
--- /dev/null
+++ b/M6/emensa/public/index.php
@@ -0,0 +1,373 @@
+Abhängigkeiten nicht gefunden
"; + } + FrontController::handleRequest("$_SERVER[HTTP_HOST]$_SERVER[REQUEST_URI]", $_SERVER['REQUEST_METHOD'], VERBOSITY); +} + +class RequestData +{ + /** + * @var array Request Querystring, broken down to key-value pairs + */ + public array $query; + /** + * @var array Request arguments from path, after cutting two segments out for controller and action names + */ + public array $args; + /** + * @var string HTTP Verb used + */ + public string $method; + + public function getData() + { + return array_merge($_GET, $_POST); + } + + /** + * @return array + */ + public function getPostData() + { + return $_POST; + } + + /** + * @return array + */ + public function getGetData() + { + return $_GET; + } + + /** + * RequestData is the way the Router will provide information, use it in your Action methods. + * @param $method string Verb used + * @param $args array Arguments + * @param $query array Key-Value Pairs + */ + public function __construct($method, $args, $query) + { + $this->query = $query; + $this->args = $args; + $this->method = $method; + } +} + +class FrontController +{ + + public static function handleRequest($url, $method = 'GET', $verbosity = 0, $configPath = CONFIG_WEBROUTES) + { + assert_blade(); // check if the class is found + + if (!str_contains($url, ':')) $url = $_SERVER['HTTP_HOST'] . ':' . $_SERVER['SERVER_PORT'] . $_SERVER['REQUEST_URI']; + + $scriptPath = dirname(__FILE__, 2) . '/'; + $controllerDirectory = $scriptPath . 'controllers/'; + + // get a router/web-like config array to override filebased convention + $config = FrontController::getConfig($configPath); + + // /Impressum/ --> ImpressumController->index() + $request = parse_url($url); + $ctrlName = $request['path']; + $actionName = 'index'; + $args = array(); + $query = array(); + parse_str($request['query'] ?? "", $query); + + // provide POST data + if ($method != 'GET') + $query = array_merge($query, $_REQUEST); + + + // check, if route has two levels + if (strpos($ctrlName, '/', 1) > 0) { + $path = explode('/', $request['path']); // Werbeseite/Speise/1/mobile?pretty=true&user=marcel + array_shift($path); // skip once + $ctrlName = array_shift($path); // Werbeseite + $actionName = array_shift($path); // Speise + $args = $path; // remainder of path-parts // [1][mobile] + if ($verbosity > 1) { + echo "@
+ if (array_key_exists('/' . $ctrlName . '/' . $actionName, $config)) {
+ $routingConfig = explode('@', $config['/' . $ctrlName . '/' . $actionName]);
+ if ($verbosity > 0) {
+ echo "";
+ }
+ // #ERROR
+ FrontController::showErrorMessage("" .
+ "
Sie betreiben gerade PHP Version " . phpversion()); + exit(1); + } + // version is okay, go on. +} + +/** + * let the script die if the path contains problematic characters. + * @return void + */ +function assert_path(): void +{ + static $chars = array("[", "]", "{", "}"); + $charsfound = 0; + str_ireplace($chars, '', $_SERVER['DOCUMENT_ROOT'], $charsfound); + if ($charsfound > 0) { + FrontController::showErrorMessage("
");
+ exit(1);
+ }
+}
+
+use Monolog\Level;
+use Monolog\Logger;
+use Monolog\Handler\StreamHandler;
+
+function logger($name, $path){
+
+ $fullpath = $path . '\\' . $name . '.txt';
+ $log = new Logger($name);
+ $log->pushHandler(new StreamHandler($fullpath), Level::Warning);
+ return $log;
+}
diff --git a/M6/emensa/public/js/highlight.min.js b/M6/emensa/public/js/highlight.min.js
new file mode 100644
index 0000000..f71c59c
--- /dev/null
+++ b/M6/emensa/public/js/highlight.min.js
@@ -0,0 +1,593 @@
+/*!
+ Highlight.js v11.6.0 (git: bed790f3f3)
+ (c) 2006-2022 undefined and other contributors
+ License: BSD-3-Clause
+ */
+var hljs=function(){"use strict";var e={exports:{}};function t(e){
+return e instanceof Map?e.clear=e.delete=e.set=()=>{
+throw Error("map is read-only")}:e instanceof Set&&(e.add=e.clear=e.delete=()=>{
+throw Error("set is read-only")
+}),Object.freeze(e),Object.getOwnPropertyNames(e).forEach((n=>{var i=e[n]
+;"object"!=typeof i||Object.isFrozen(i)||t(i)})),e}
+e.exports=t,e.exports.default=t;class n{constructor(e){
+void 0===e.data&&(e.data={}),this.data=e.data,this.isMatchIgnored=!1}
+ignoreMatch(){this.isMatchIgnored=!0}}function i(e){
+return e.replace(/&/g,"&").replace(//g,">").replace(/"/g,""").replace(/'/g,"'")
+}function r(e,...t){const n=Object.create(null);for(const t in e)n[t]=e[t]
+;return t.forEach((e=>{for(const t in e)n[t]=e[t]})),n}
+const s=e=>!!e.scope||e.sublanguage&&e.language;class o{constructor(e,t){
+this.buffer="",this.classPrefix=t.classPrefix,e.walk(this)}addText(e){
+this.buffer+=i(e)}openNode(e){if(!s(e))return;let t=""
+;t=e.sublanguage?"language-"+e.language:((e,{prefix:t})=>{if(e.includes(".")){
+const n=e.split(".")
+;return[`${t}${n.shift()}`,...n.map(((e,t)=>`${e}${"_".repeat(t+1)}`))].join(" ")
+}return`${t}${e}`})(e.scope,{prefix:this.classPrefix}),this.span(t)}
+closeNode(e){s(e)&&(this.buffer+="
+
+@endsection
+
+@section("footer")
+
+
+
+
+
+
+ This is a blade view showing phpinfo();
+ + +@php +phpinfo(); +@endphp \ No newline at end of file diff --git a/M6/Dossier/emensa/views/demo/dbdata.blade.php b/M6/Dossier/emensa/views/demo/dbdata.blade.php new file mode 100644 index 0000000..06e0b05 --- /dev/null +++ b/M6/Dossier/emensa/views/demo/dbdata.blade.php @@ -0,0 +1,32 @@ + + + + +Es gab ein Problem mit der Datenbankverbindung
+Fehlermeldung
+ {{$data['beschreibung']}}
+
+@else
+
+
+ Daten aus der Datenbank der Tabelle: Gerichte
+Der Controller inkludiert das benötigte Model (gerichte.php in diesem Fall)
+ und ruft die benötigte Funktion db_gerichte_select_all() zum Laden der Daten auf
-
+ @forelse($data as $a)
+
- {{$a['name']}} + @empty +
- Keine Daten vorhanden. + @endforelse +
+
+@endsection
+
+@section("cssextra")
+
+@endsection
+
+@section("jsextra")
+
+@endsection
\ No newline at end of file
diff --git a/M6/Dossier/emensa/views/demo/requestdata.blade.php b/M6/Dossier/emensa/views/demo/requestdata.blade.php
new file mode 100644
index 0000000..496af1b
--- /dev/null
+++ b/M6/Dossier/emensa/views/demo/requestdata.blade.php
@@ -0,0 +1,24 @@
+Demo für {{ $name }}
+Kurze Übersicht, wie die Arbeit mit dem Router und der Blade View-Engine funktioniert.
+ +Router
+Der Router nimmt den Request entgegen und zerlegt ihn in die einzelnen Teile der URI. Wichtig ist hier vor + allem der Pfad und der Querystring.
+Wenn der Pfad in der Routenkonfiguration (\$config Array aus der Datei
+ routes/web.php) gefunden wird, lädt der Router die angegebene Klasse.
Funktionsweise
+Im vorliegenden Beispiel sehen Sie diese Seite ...
+-
+
- weil der Pfad in der Routenkonfiguration gefunden wurde +
- und dort 'DemoController@howto' hinterlegt ist +
- und im Ordner controllers/ die Datei
DemoController.phpgefunden werden konnte +
+ - und mit ihr ein Objekt des Typs DemoController instanziiert werden konnte +
- und dieses Objekt die Funktion (Action) howto() ausgeführt hat +
Sie sehen: da muss einiges stimmen und vieles davon ist Konvention.
+Querystrings und Pfadsegmente
+Die Actions in den Controller-Klassen sollen per Konvention immer ein RequestData Objekt
+ entgegennehmen. Beispiel: howto(RequestData \$rd)
Dieses RequestData Objekt wird durch den Router befüllt, wenn Daten in der URL extrahiert werden konnten.
+Daten finden sich URLs...
+ +-
+
-
+
+ im Querystring
+
Beispiel: rufen Sie diese mit +{{strtolower(explode('/',$_SERVER["SERVER_PROTOCOL"])[0])}}://{{$_SERVER["HTTP_HOST"]}}/demo?bgcolor=fefbd8&name=Remmy+ auf, werden bgcolor undnamemitsamt Werten als Query Array +$rd->query) übergeben +
+
Probieren Sie es aus ;)
+ @if(count($rd->args)) +Argumente dieses Aufrufs:
+ + @forelse($rd->args as $a) +{{$a}}
+ @empty
+ Keine weiteren Argumente im Request
+ @endforelse + @endif + @if(count($rd->query)) +Daten aus der Query dieses Aufrufs:
+
+ @forelse($rd->query as $k => $v)
+ $rd->query['{{$k}}']={{$v}}
+ @empty
+ Keine Querydaten
+ @endforelse
+ Blade
+Blade muss installiert sein. + Die Installation ist bereits geschehen und die Bibliothek liegt unter /vendor. +
+Daten übergeben und View rendern
+Bei der Verwendung der View-Engine gelten einige Konventionen:
+ Die Dateien müssen <viewname>.blade.php heißen und im Ordner views liegen.
+
Sie können der View dann Daten mitgeben, indem Sie alle Daten in ein Array schreiben und dieses dann + übergeben.
+Beispiel:
+
+ view("viewtest",
+ array(
+ "texts"=>$textArray,
+ "persona"=>$persona,
+ "rd"=>$rd
+ )); // öffnet ../views/viewtest.blade.php
+ RequestData
+ +@if(count($rd->getData())) +combined request data
+
+ {{print_r($rd->getData(),1)}}
+
+@else
+ this request contained zero parameters
+@endif + +@if(count($rd->getGetData())) +GET request data
+ {{print_r($rd->getGetData(),1)}}
+
+@endif
+
+@if(count($rd->getPostData()))
+ POST request data
+ {{print_r($rd->getPostData(),1)}}
+
+@endif
\ No newline at end of file
diff --git a/M6/Dossier/emensa/views/examples/m4_7a_queryparameter.blade.php b/M6/Dossier/emensa/views/examples/m4_7a_queryparameter.blade.php
new file mode 100644
index 0000000..c094999
--- /dev/null
+++ b/M6/Dossier/emensa/views/examples/m4_7a_queryparameter.blade.php
@@ -0,0 +1,13 @@
+
+
+
+
+ Es gab ein Problem mit der Datenbankverbindung
+Fehlermeldung
+ {{$data['beschreibung']}}
+
+@else
+
+
+ Daten aus der Datenbank der Tabelle: Kategorien
+ +-
+ @forelse($data as $a)
+ @if($zweites)
- {{$a['name']}} + @else +
- {{$a['name']}} + @endif + @empty +
- Keine Daten vorhanden. + @endforelse +
Es gab ein Problem mit der Datenbankverbindung
+Fehlermeldung
+ {{$data['beschreibung']}}
+
+@else
+
+ Daten aus der Datenbank der Tabelle: Kategorien
+ +-
+ @forelse($data as $a)
+ @if(!empty($a['name']))
+
- {{$a['name']}} + @endif + + @empty +
- Es sind keine Gerichte vorhanden + @endforelse +
Page 1
+@endsection + +@section("footer") +Footer of Page 1
+@endsection \ No newline at end of file diff --git a/M6/Dossier/emensa/views/examples/pages/m4_7d_page_2.blade.php b/M6/Dossier/emensa/views/examples/pages/m4_7d_page_2.blade.php new file mode 100644 index 0000000..920a59a --- /dev/null +++ b/M6/Dossier/emensa/views/examples/pages/m4_7d_page_2.blade.php @@ -0,0 +1,13 @@ +@extends(".layouts.m4_7d_layout",['title' => "Page 2"]) + +@section("header") + +@endsection + +@section("body") +Page 2
+@endsection + +@section("footer") +Footer of Page 2
+@endsection \ No newline at end of file diff --git a/M6/Dossier/emensa/views/home.blade.php b/M6/Dossier/emensa/views/home.blade.php new file mode 100644 index 0000000..474d713 --- /dev/null +++ b/M6/Dossier/emensa/views/home.blade.php @@ -0,0 +1,34 @@ +@extends("layouts.layout") + +@section("content") +Hauptseite E-Mensa
+
+
+
+
+@yield("jsextra")
+
+
+
diff --git a/M6/Dossier/emensa/views/layouts/m4_7d_layout.blade.php b/M6/Dossier/emensa/views/layouts/m4_7d_layout.blade.php
new file mode 100644
index 0000000..2ae864d
--- /dev/null
+++ b/M6/Dossier/emensa/views/layouts/m4_7d_layout.blade.php
@@ -0,0 +1,21 @@
+
+
+
+
+
+
+ @yield("content")
+
++
+
+
+
+
+
\ No newline at end of file
diff --git a/M6/Dossier/emensa/views/m5_a1/abmeldung.blade.php b/M6/Dossier/emensa/views/m5_a1/abmeldung.blade.php
new file mode 100644
index 0000000..c3044c8
--- /dev/null
+++ b/M6/Dossier/emensa/views/m5_a1/abmeldung.blade.php
@@ -0,0 +1,11 @@
+@extends("m5_a1.layout_anmeldung")
+
+@section("main")
+
+ @if(!isset($_SESSION['name']))
+
+
+
+ @endif
+
+@endsection
\ No newline at end of file
diff --git a/M6/Dossier/emensa/views/m5_a1/anmeldung.blade.php b/M6/Dossier/emensa/views/m5_a1/anmeldung.blade.php
new file mode 100644
index 0000000..4e39a2e
--- /dev/null
+++ b/M6/Dossier/emensa/views/m5_a1/anmeldung.blade.php
@@ -0,0 +1,23 @@
+@extends("m5_a1.layout_anmeldung")
+
+@section("main")
+
+
+
+ @if(!isset($anmeldung)) Bitte anmelden!
+ @elseif ($anmeldung == 1)
+ {{ session_start() }}
+ Anmeldung erlaubt!
+ @else Es ist ein Fehler aufgetretten!
+ @endif
+
+@endsection
\ No newline at end of file
diff --git a/M6/Dossier/emensa/views/m5_a1/anmeldung_nichtkorrekt.blade.php b/M6/Dossier/emensa/views/m5_a1/anmeldung_nichtkorrekt.blade.php
new file mode 100644
index 0000000..4e39a2e
--- /dev/null
+++ b/M6/Dossier/emensa/views/m5_a1/anmeldung_nichtkorrekt.blade.php
@@ -0,0 +1,23 @@
+@extends("m5_a1.layout_anmeldung")
+
+@section("main")
+
+
+
+ @if(!isset($anmeldung)) Bitte anmelden!
+ @elseif ($anmeldung == 1)
+ {{ session_start() }}
+ Anmeldung erlaubt!
+ @else Es ist ein Fehler aufgetretten!
+ @endif
+
+@endsection
\ No newline at end of file
diff --git a/M6/Dossier/emensa/views/m5_a1/anmeldung_verifizieren.blade.php b/M6/Dossier/emensa/views/m5_a1/anmeldung_verifizieren.blade.php
new file mode 100644
index 0000000..bebb978
--- /dev/null
+++ b/M6/Dossier/emensa/views/m5_a1/anmeldung_verifizieren.blade.php
@@ -0,0 +1,50 @@
+@extends("m5_a1.layout_anmeldung")
+
+@section("main")
+
+ @if($anmeldung == 1)
+
+
+
+
+ @else
+
+
+
+
+ @endif
+
+
+@yield("text")
+
+@yield("gerichte")
+
+
+
+ + Bitte warten! + +@endsection \ No newline at end of file diff --git a/M6/Dossier/emensa/views/m5_a1/layout_anmeldung.blade.php b/M6/Dossier/emensa/views/m5_a1/layout_anmeldung.blade.php new file mode 100644 index 0000000..c230204 --- /dev/null +++ b/M6/Dossier/emensa/views/m5_a1/layout_anmeldung.blade.php @@ -0,0 +1,21 @@ + + + + +
+
+
+@endsection
+
+@section("text")
+
+
+
+
+
+
+
+
+ Bald gibt es auch Essen online ;)
+Lorem ipsum dolor sit amet, consetetur sadipscing elitr, sed diam nonumy eirmod tempor invidunt ut labore et + dolore magna aliquyam erat, sed diam voluptua. At vero eos et accusam et justo duo dolores et ea rebum. Stet + clita kasd gubergren, no sea takimata sanctus est Lorem ipsum dolor sit amet. Lorem ipsum dolor sit amet, + consetetur sadipscing elitr, sed diam nonumy eirmod tempor invidunt ut labore et dolore magna aliquyam erat, + sed diam voluptua. At vero eos et accusam et justo duo dolores et ea rebum. Stet clita kasd gubergren, no + sea takimata sanctus est Lorem ipsum dolor sit amet.
+Köstlichkeiten die Sie erwarten
+ +@endsection + +@section("gerichte") + + + @if (isset($data['error'])) +Es gab ein Problem mit der Datenbankverbindung
+Fehlermeldung
+ {{$data['beschreibung']}}
+
+ @else
+ Nicht implementiert
+Sie haben eine Action aufgerufen, die zu dieser View führt.
+Vervollständigen Sie die Action, sodass die Aufgabe erfüllt wird.
+@endsection \ No newline at end of file diff --git a/M6/composer.phar b/M6/composer.phar new file mode 100644 index 0000000..4723b1b Binary files /dev/null and b/M6/composer.phar differ diff --git a/M6/emensa/README.md b/M6/emensa/README.md new file mode 100644 index 0000000..1e7b904 --- /dev/null +++ b/M6/emensa/README.md @@ -0,0 +1,22 @@ +# Routingscript MVC + +little routing script for use in DBWT + +intended to run with only one dependency (bladeone). + +## usage + +* start this script by either executing `start_server.bat` or running `php -S 127.0.0.1:9000 -t public` in a shell from the project´s root directory. + +* [open the website](http://127.0.0.1:9000/) + +## folder overview + +* `bin/` is only necessary if you need to use composer and dont have it installed already +* `config/` holds configuration files +* `controllers/` contains all Controller Classes +* `models/` contains the Model Classes +* `public/` is the web root for your http server and contains the routing script itself, next to resources that will be accessible by http clients (css, js, images, etc.) +* `storage/` is necessary to hold Blade Cache Files +* `views/` holds all View Files + diff --git a/M6/emensa/bin/composer.phar b/M6/emensa/bin/composer.phar new file mode 100644 index 0000000..e766506 Binary files /dev/null and b/M6/emensa/bin/composer.phar differ diff --git a/M6/emensa/composer.json b/M6/emensa/composer.json new file mode 100644 index 0000000..5246984 --- /dev/null +++ b/M6/emensa/composer.json @@ -0,0 +1,10 @@ +{ + "name": "emensa/mvc", + "description": "routing script for module Datenbanken und Webtechnologien MVC", + "license": "proprietary", + "require": { + "eftec/bladeone": "^4.1", + "ext-mysqli": "*", + "monolog/monolog": "^3.5" + } +} diff --git a/M6/emensa/composer.lock b/M6/emensa/composer.lock new file mode 100644 index 0000000..8536679 --- /dev/null +++ b/M6/emensa/composer.lock @@ -0,0 +1,231 @@ +{ + "_readme": [ + "This file locks the dependencies of your project to a known state", + "Read more about it at https://getcomposer.org/doc/01-basic-usage.md#installing-dependencies", + "This file is @generated automatically" + ], + "content-hash": "56e35407c924fe62af5e2eb164530d54", + "packages": [ + { + "name": "eftec/bladeone", + "version": "4.9", + "source": { + "type": "git", + "url": "https://github.com/EFTEC/BladeOne.git", + "reference": "019036c226086fbe7591360d260067c5d82400ca" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/EFTEC/BladeOne/zipball/019036c226086fbe7591360d260067c5d82400ca", + "reference": "019036c226086fbe7591360d260067c5d82400ca", + "shasum": "" + }, + "require": { + "ext-json": "*", + "php": ">=7.2.5" + }, + "require-dev": { + "phpunit/phpunit": "^8.5.23" + }, + "suggest": { + "eftec/bladeonehtml": "Extension to create forms", + "ext-mbstring": "This extension is used if it's active" + }, + "bin": [ + "lib/bladeonecli" + ], + "type": "library", + "autoload": { + "psr-4": { + "eftec\\bladeone\\": "lib/" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Jorge Patricio Castro Castillo", + "email": "jcastro@eftec.cl" + } + ], + "description": "The standalone version Blade Template Engine from Laravel in a single php file", + "homepage": "https://github.com/EFTEC/BladeOne", + "keywords": [ + "blade", + "php", + "template", + "templating", + "view" + ], + "support": { + "issues": "https://github.com/EFTEC/BladeOne/issues", + "source": "https://github.com/EFTEC/BladeOne/tree/4.9" + }, + "time": "2023-05-01T12:48:42+00:00" + }, + { + "name": "monolog/monolog", + "version": "3.5.0", + "source": { + "type": "git", + "url": "https://github.com/Seldaek/monolog.git", + "reference": "c915e2634718dbc8a4a15c61b0e62e7a44e14448" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/Seldaek/monolog/zipball/c915e2634718dbc8a4a15c61b0e62e7a44e14448", + "reference": "c915e2634718dbc8a4a15c61b0e62e7a44e14448", + "shasum": "" + }, + "require": { + "php": ">=8.1", + "psr/log": "^2.0 || ^3.0" + }, + "provide": { + "psr/log-implementation": "3.0.0" + }, + "require-dev": { + "aws/aws-sdk-php": "^3.0", + "doctrine/couchdb": "~1.0@dev", + "elasticsearch/elasticsearch": "^7 || ^8", + "ext-json": "*", + "graylog2/gelf-php": "^1.4.2 || ^2.0", + "guzzlehttp/guzzle": "^7.4.5", + "guzzlehttp/psr7": "^2.2", + "mongodb/mongodb": "^1.8", + "php-amqplib/php-amqplib": "~2.4 || ^3", + "phpstan/phpstan": "^1.9", + "phpstan/phpstan-deprecation-rules": "^1.0", + "phpstan/phpstan-strict-rules": "^1.4", + "phpunit/phpunit": "^10.1", + "predis/predis": "^1.1 || ^2", + "ruflin/elastica": "^7", + "symfony/mailer": "^5.4 || ^6", + "symfony/mime": "^5.4 || ^6" + }, + "suggest": { + "aws/aws-sdk-php": "Allow sending log messages to AWS services like DynamoDB", + "doctrine/couchdb": "Allow sending log messages to a CouchDB server", + "elasticsearch/elasticsearch": "Allow sending log messages to an Elasticsearch server via official client", + "ext-amqp": "Allow sending log messages to an AMQP server (1.0+ required)", + "ext-curl": "Required to send log messages using the IFTTTHandler, the LogglyHandler, the SendGridHandler, the SlackWebhookHandler or the TelegramBotHandler", + "ext-mbstring": "Allow to work properly with unicode symbols", + "ext-mongodb": "Allow sending log messages to a MongoDB server (via driver)", + "ext-openssl": "Required to send log messages using SSL", + "ext-sockets": "Allow sending log messages to a Syslog server (via UDP driver)", + "graylog2/gelf-php": "Allow sending log messages to a GrayLog2 server", + "mongodb/mongodb": "Allow sending log messages to a MongoDB server (via library)", + "php-amqplib/php-amqplib": "Allow sending log messages to an AMQP server using php-amqplib", + "rollbar/rollbar": "Allow sending log messages to Rollbar", + "ruflin/elastica": "Allow sending log messages to an Elastic Search server" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-main": "3.x-dev" + } + }, + "autoload": { + "psr-4": { + "Monolog\\": "src/Monolog" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Jordi Boggiano", + "email": "j.boggiano@seld.be", + "homepage": "https://seld.be" + } + ], + "description": "Sends your logs to files, sockets, inboxes, databases and various web services", + "homepage": "https://github.com/Seldaek/monolog", + "keywords": [ + "log", + "logging", + "psr-3" + ], + "support": { + "issues": "https://github.com/Seldaek/monolog/issues", + "source": "https://github.com/Seldaek/monolog/tree/3.5.0" + }, + "funding": [ + { + "url": "https://github.com/Seldaek", + "type": "github" + }, + { + "url": "https://tidelift.com/funding/github/packagist/monolog/monolog", + "type": "tidelift" + } + ], + "time": "2023-10-27T15:32:31+00:00" + }, + { + "name": "psr/log", + "version": "3.0.0", + "source": { + "type": "git", + "url": "https://github.com/php-fig/log.git", + "reference": "fe5ea303b0887d5caefd3d431c3e61ad47037001" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/php-fig/log/zipball/fe5ea303b0887d5caefd3d431c3e61ad47037001", + "reference": "fe5ea303b0887d5caefd3d431c3e61ad47037001", + "shasum": "" + }, + "require": { + "php": ">=8.0.0" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "3.x-dev" + } + }, + "autoload": { + "psr-4": { + "Psr\\Log\\": "src" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "PHP-FIG", + "homepage": "https://www.php-fig.org/" + } + ], + "description": "Common interface for logging libraries", + "homepage": "https://github.com/php-fig/log", + "keywords": [ + "log", + "psr", + "psr-3" + ], + "support": { + "source": "https://github.com/php-fig/log/tree/3.0.0" + }, + "time": "2021-07-14T16:46:02+00:00" + } + ], + "packages-dev": [], + "aliases": [], + "minimum-stability": "stable", + "stability-flags": [], + "prefer-stable": false, + "prefer-lowest": false, + "platform": { + "ext-mysqli": "*" + }, + "platform-dev": [], + "plugin-api-version": "2.6.0" +} diff --git a/M6/emensa/config/db.php b/M6/emensa/config/db.php new file mode 100644 index 0000000..636415f --- /dev/null +++ b/M6/emensa/config/db.php @@ -0,0 +1,9 @@ + 'localhost', // 'localhost' or '127.0.0.1' + 'user' => 'root', // 'DOCUMENT_ROOT: {$_SERVER['DOCUMENT_ROOT']}Datei nicht gefunden: {$_SERVER['DOCUMENT_ROOT']}/../vendor/autoload.php
"; + echo "Häufigste Ursache
-
+
- Das Verzeichnis
public/ist nicht als Wurzelverzeichnis verwendet worden.
+ - Die Abhängigkeiten wurden nicht mit
composer updateinstalliert.
+
DOCUMENT_ROOT{$_SERVER['DOCUMENT_ROOT']}Error" . $ex->getMessage() . ""; +} + +use eftec\bladeone\BladeOne; + +/* Routing Script for PHP Dev Server */ +$verbosity = VERBOSITY; +if (preg_match('/\.(?:css|js|png|jpg|jpeg|gif)$/', $_SERVER["REQUEST_URI"])) { + return false; +} else { + if ($verbosity > 1) { + echo + "
Verbosity-Level: {$verbosity}" .
+ "" . print_r($_SERVER, 1) . "
"; + } + FrontController::handleRequest("$_SERVER[HTTP_HOST]$_SERVER[REQUEST_URI]", $_SERVER['REQUEST_METHOD'], VERBOSITY); +} + +class RequestData +{ + /** + * @var array Request Querystring, broken down to key-value pairs + */ + public array $query; + /** + * @var array Request arguments from path, after cutting two segments out for controller and action names + */ + public array $args; + /** + * @var string HTTP Verb used + */ + public string $method; + + public function getData() + { + return array_merge($_GET, $_POST); + } + + /** + * @return array + */ + public function getPostData() + { + return $_POST; + } + + /** + * @return array + */ + public function getGetData() + { + return $_GET; + } + + /** + * RequestData is the way the Router will provide information, use it in your Action methods. + * @param $method string Verb used + * @param $args array Arguments + * @param $query array Key-Value Pairs + */ + public function __construct($method, $args, $query) + { + $this->query = $query; + $this->args = $args; + $this->method = $method; + } +} + +class FrontController +{ + + public static function handleRequest($url, $method = 'GET', $verbosity = 0, $configPath = CONFIG_WEBROUTES) + { + assert_blade(); // check if the class is found + + if (!str_contains($url, ':')) $url = $_SERVER['HTTP_HOST'] . ':' . $_SERVER['SERVER_PORT'] . $_SERVER['REQUEST_URI']; + + $scriptPath = dirname(__FILE__, 2) . '/'; + $controllerDirectory = $scriptPath . 'controllers/'; + + // get a router/web-like config array to override filebased convention + $config = FrontController::getConfig($configPath); + + // /Impressum/ --> ImpressumController->index() + $request = parse_url($url); + $ctrlName = $request['path']; + $actionName = 'index'; + $args = array(); + $query = array(); + parse_str($request['query'] ?? "", $query); + + // provide POST data + if ($method != 'GET') + $query = array_merge($query, $_REQUEST); + + + // check, if route has two levels + if (strpos($ctrlName, '/', 1) > 0) { + $path = explode('/', $request['path']); // Werbeseite/Speise/1/mobile?pretty=true&user=marcel + array_shift($path); // skip once + $ctrlName = array_shift($path); // Werbeseite + $actionName = array_shift($path); // Speise + $args = $path; // remainder of path-parts // [1][mobile] + if ($verbosity > 1) { + echo "
Request\n", print_r($request), ""; + echo "
Path\n", print_r($path), ""; + echo "
Query\n", print_r($query), ""; + } + } + + // fix: trim slashes + $ctrlName = trim($ctrlName, '/'); + $actionName = trim($actionName, '/'); + + // $config based renaming of Controller/Action, precedes filebased convention + // $config values must use syntax
Routing Config matched request for /" . $ctrlName . "/" . $actionName . ":
routing config is
" . print_r($routingConfig, 1) . ''; + } + // important: overwriting controller and action name + $ctrlClass = $routingConfig[0]; + $actionName = $routingConfig[1]; + } elseif (array_key_exists($request['path'], $config)) { + // exact match on full path, this also means "/" + $routingConfig = explode('@', $config[$request['path']]); + if ($verbosity > 0) { + echo "
Routing Config matched for full path " . $request['path'] . ":
routing config is
" . print_r($routingConfig, 1) . ''; + } + // important: overwriting controller and action name + $ctrlClass = $routingConfig[0]; + $actionName = $routingConfig[1]; + } else { + if ($verbosity > 0) { + echo "Request $ctrlName/$actionName was not in \$config."; + } + + // fall back to filebased convention: match controller classes in directory + $ctrlClass = ucfirst($ctrlName . 'Controller'); + } + + $ctrlFile = ($ctrlClass . '.php'); + $validControllers = FrontController::getValidControllers($controllerDirectory); + if (!in_array($controllerDirectory . $ctrlFile, $validControllers)) { + if ($verbosity > 0) { + echo "
Controller: $ctrlFile not found in
" . print_r($validControllers, 1) . "
Config Array:
" . print_r($config, 1) . "
Web Software Error
" .
+ "Keine entspreche Zuordnung der Route für {$ctrlName}::{$actionName} gefunden. Tippfehler in der Route?" . + "
Es konnte keine Klasse " . $ctrlFile . " gefunden werden! Request fehlgeschlagen.
" . + " Prüfen Sie die Einträge in der Datei config/web.php und gleichen Sie den getätigten Aufruf damit ab.
Fehler in Controller " . get_class($controller) . "!
Stellen Sie sicher, dass die Action/der Controller existiert.
+Das Routing Config-Array hat " . count($config) . " Einträge.
+Exception text
" . $ex->getMessage() . "
{$text}
");
+ if ($die) exit($severity);
+ }
+
+ public static function getConfig($configPath)
+ {
+ try {
+ // load the $config Array from a file given in $configPath
+ $path_to_config = realpath($_SERVER['DOCUMENT_ROOT'] . DIRECTORY_SEPARATOR . $configPath);
+ // print("Path to config " . $path_to_config);
+ $config = include $path_to_config;
+ } catch (Exception $e) {
+ print_r($e);
+ $config = array('/' => 'HomeController@index');
+ } finally {
+ return $config;
+ }
+ }
+
+ public static function getValidControllers($path = '')
+ {
+ if ($path == '') {
+ $path = getcwd() . DIRECTORY_SEPARATOR . 'controllers' . DIRECTORY_SEPARATOR;
+ }
+ return glob($path . '*Controller.php');
+ }
+}
+
+function connectdb()
+{
+ $path_to_config_db = $_SERVER['DOCUMENT_ROOT'] . DIRECTORY_SEPARATOR . CONFIG_DB;
+ $config = include $path_to_config_db;
+ $link = mysqli_connect( // Daten aus config/db.php
+ $config['host'],
+ $config['user'],
+ $config['password'],
+ $config['database'], // Auswahl der Datenbank
+ $config['port'] ?? 3306);
+ if (!$link) {
+ FrontController::showErrorMessage("Verbindung mit der Datenbank nicht möglich
+Verbindung fehlgeschlagen: " . mysqli_connect_error() . ".
Prüfen Sie
- die Angaben in der Datei
config/db.php: + ( ist Benutzer{$config['user']}an Datenbank{$config['database']}auf Server{$config['host']}korrekt?)
+ - ob Ihre Datenbank unter der oben gezeigten Adresse läuft
Verbindung mit der Datenbank nicht möglich
+Fehlermeldung" . mysqli_connect_error() . "", 2, true); + exit(1); + } + + return $link; +} + +function view($viewname, $viewargs = array()) +{ + $views = dirname(__DIR__) . '/views'; + $cache = dirname(__DIR__) . '/storage/cache'; + $blade = new BladeOne($views, $cache, BladeOne::MODE_DEBUG); + + return $blade->run($viewname, $viewargs); +} + +/** + * let the script die if the php minimum version is not met. + * @param $minversion + * @return void + */ +function assert_php_version($minversion = '8.0.0') +{ + $version_too_low = 0; + $minver = explode('.', $minversion); + $version = explode('.', phpversion()); + + if (intval($minver[0]) > intval($version[0])) { + $version_too_low = 1; + } elseif (intval($minver[1]) > intval($version[1])) { + $version_too_low = 1; + } elseif (intval($minver[2]) > intval($version[2])) { + $version_too_low = 1; + } + + if ($version_too_low) { + FrontController::showErrorMessage("Diese PHP-Version wird nicht unterstützt: Minimum PHP Version " . $minversion . "
Sie betreiben gerade PHP Version " . phpversion()); + exit(1); + } + // version is okay, go on. +} + +/** + * let the script die if the path contains problematic characters. + * @return void + */ +function assert_path(): void +{ + static $chars = array("[", "]", "{", "}"); + $charsfound = 0; + str_ireplace($chars, '', $_SERVER['DOCUMENT_ROOT'], $charsfound); + if ($charsfound > 0) { + FrontController::showErrorMessage("
Bitte verwenden Sie einen anderen Ordner für das Projekt!
+Der Pfad " . $_SERVER['DOCUMENT_ROOT'] . " enthält " . $charsfound . " problematische Zeichen, die die korrekte Ausführung verhindern.
Bekannte problematische Zeichen sind
+ " . implode(" ", $chars) . " ");
+ exit(1);
+ }
+
+}
+
+function assert_blade(): void
+{
+ if (!class_exists('eftec\bladeone\BladeOne')) {
+ // #ERROR
+ FrontController::showErrorMessage("
+ Fehler: Blade wurde nicht gefunden
+Tipps für die Lösung:
+-
+
führen Sie im Terminal folgende Zeilen aus.
+-
+
php bin/composer.phar updateoderphp bin/composer.phar reinstall eftec/bladeone
+ php bin/composer.phar dump-autoload
+
Prüfen Sie im Anschluss: befindet sich in dem Ordner
vendor/eftec/bladeone/lib/die DateiBladeOne.php?
+ Starten Sie dann den Webserver neu.
+ Befragen Sie gerne auch das Forum in Ilias.
+
+
+
+yieldContent("jsextra"); ?>
+
+
+
diff --git a/M6/emensa/storage/cache/.layouts.layout_933596b3f8bdab5243334e13bf36856f2a87605f.bladec b/M6/emensa/storage/cache/.layouts.layout_933596b3f8bdab5243334e13bf36856f2a87605f.bladec
new file mode 100644
index 0000000..3ef70b4
--- /dev/null
+++ b/M6/emensa/storage/cache/.layouts.layout_933596b3f8bdab5243334e13bf36856f2a87605f.bladec
@@ -0,0 +1,23 @@
+
+
+
+
+
+ yieldContent("content"); ?>
+
+
+
+
+yieldContent("jsextra"); ?>
+
+
+
diff --git a/M6/emensa/storage/cache/.layouts.m4_7d_layout_ecc36cbad49aa38782cc08cc5e9ca6c7ae3590d0.bladec b/M6/emensa/storage/cache/.layouts.m4_7d_layout_ecc36cbad49aa38782cc08cc5e9ca6c7ae3590d0.bladec
new file mode 100644
index 0000000..941fc86
--- /dev/null
+++ b/M6/emensa/storage/cache/.layouts.m4_7d_layout_ecc36cbad49aa38782cc08cc5e9ca6c7ae3590d0.bladec
@@ -0,0 +1,21 @@
+
+
+
+
+
+
+ yieldContent("content"); ?>
+
+This is a blade view showing phpinfo();
+ + + \ No newline at end of file diff --git a/M6/emensa/storage/cache/demo.dbdata_371b3aba36aa73bbc6704e7ce839ac185b43f3a9.bladec b/M6/emensa/storage/cache/demo.dbdata_371b3aba36aa73bbc6704e7ce839ac185b43f3a9.bladec new file mode 100644 index 0000000..b866e05 --- /dev/null +++ b/M6/emensa/storage/cache/demo.dbdata_371b3aba36aa73bbc6704e7ce839ac185b43f3a9.bladec @@ -0,0 +1,32 @@ + + + + +Es gab ein Problem mit der Datenbankverbindung
+Fehlermeldung
++ + + + +
Daten aus der Datenbank der Tabelle: Gerichte
+Der Controller inkludiert das benötigte Model (gerichte.php in diesem Fall)
+ und ruft die benötigte Funktion db_gerichte_select_all() zum Laden der Daten auf
-
+
+
+
+
- Keine Daten vorhanden. + +
+
+stopSection(); ?>
+
+startSection("cssextra"); ?>
+
+stopSection(); ?>
+
+startSection("jsextra"); ?>
+
+stopSection(); ?>
+runChild(".layouts.layout"); } ?>
\ No newline at end of file
diff --git a/M6/emensa/storage/cache/demo.demo_fc1036c569380dbc95c820cc4f5096087e39b268.bladec b/M6/emensa/storage/cache/demo.demo_fc1036c569380dbc95c820cc4f5096087e39b268.bladec
new file mode 100644
index 0000000..cc3f065
--- /dev/null
+++ b/M6/emensa/storage/cache/demo.demo_fc1036c569380dbc95c820cc4f5096087e39b268.bladec
@@ -0,0 +1,94 @@
+
+
+startSection("content"); ?>
+ Demo für
+Kurze Übersicht, wie die Arbeit mit dem Router und der Blade View-Engine funktioniert.
+ +Router
+Der Router nimmt den Request entgegen und zerlegt ihn in die einzelnen Teile der URI. Wichtig ist hier vor + allem der Pfad und der Querystring.
+Wenn der Pfad in der Routenkonfiguration (\$config Array aus der Datei
+ routes/web.php) gefunden wird, lädt der Router die angegebene Klasse.
Funktionsweise
+Im vorliegenden Beispiel sehen Sie diese Seite ...
+-
+
- weil der Pfad in der Routenkonfiguration gefunden wurde +
- und dort 'DemoController@howto' hinterlegt ist +
- und im Ordner controllers/ die Datei
DemoController.phpgefunden werden konnte +
+ - und mit ihr ein Objekt des Typs DemoController instanziiert werden konnte +
- und dieses Objekt die Funktion (Action) howto() ausgeführt hat +
Sie sehen: da muss einiges stimmen und vieles davon ist Konvention.
+Querystrings und Pfadsegmente
+Die Actions in den Controller-Klassen sollen per Konvention immer ein RequestData Objekt
+ entgegennehmen. Beispiel: howto(RequestData \$rd)
Dieses RequestData Objekt wird durch den Router befüllt, wenn Daten in der URL extrahiert werden konnten.
+Daten finden sich URLs...
+ +-
+
-
+
+ im Querystring
+
Beispiel: rufen Sie diese mit +:///demo?bgcolor=fefbd8&name=Remmy+ auf, werden bgcolor undnamemitsamt Werten als Query Array +$rd->query) übergeben +
+
Probieren Sie es aus ;)
+ args)): ?> +Argumente dieses Aufrufs:
+ + args as $a): $__empty_1 = false; ?> +
+
+
Keine weiteren Argumente im Request
+ + + query)): ?> +Daten aus der Query dieses Aufrufs:
+
+ query as $k => $v): $__empty_1 = false; ?>
+ $rd->query['']=
+
+
+ Keine Querydaten
+
+ Blade
+Blade muss installiert sein. + Die Installation ist bereits geschehen und die Bibliothek liegt unter /vendor. +
+Daten übergeben und View rendern
+Bei der Verwendung der View-Engine gelten einige Konventionen:
+ Die Dateien müssen <viewname>.blade.php heißen und im Ordner views liegen.
+
Sie können der View dann Daten mitgeben, indem Sie alle Daten in ein Array schreiben und dieses dann + übergeben.
+Beispiel:
+
+ view("viewtest",
+ array(
+ "texts"=>$textArray,
+ "persona"=>$persona,
+ "rd"=>$rd
+ )); // öffnet ../views/viewtest.blade.php
+
+
+stopSection(); ?>
+
+startSection("cssextra"); ?>
+
+stopSection(); ?>
+
+startSection("jsextra"); ?>
+
+stopSection(); ?>
+runChild(".layouts.layout"); } ?>
\ No newline at end of file
diff --git a/M6/emensa/storage/cache/examples.m4_7a_queryparameter_964ef996681a5d33ee4d5aaa7f2b050eecc4776f.bladec b/M6/emensa/storage/cache/examples.m4_7a_queryparameter_964ef996681a5d33ee4d5aaa7f2b050eecc4776f.bladec
new file mode 100644
index 0000000..b580eec
--- /dev/null
+++ b/M6/emensa/storage/cache/examples.m4_7a_queryparameter_964ef996681a5d33ee4d5aaa7f2b050eecc4776f.bladec
@@ -0,0 +1,14 @@
+
+
+
+
+ Demo für
+Kurze Übersicht, wie die Arbeit mit dem Router und der Blade View-Engine funktioniert.
+ +Router
+Der Router nimmt den Request entgegen und zerlegt ihn in die einzelnen Teile der URI. Wichtig ist hier vor + allem der Pfad und der Querystring.
+Wenn der Pfad in der Routenkonfiguration (\$config Array aus der Datei
+ routes/web.php) gefunden wird, lädt der Router die angegebene Klasse.
Funktionsweise
+Im vorliegenden Beispiel sehen Sie diese Seite ...
+-
+
- weil der Pfad in der Routenkonfiguration gefunden wurde +
- und dort 'DemoController@howto' hinterlegt ist +
- und im Ordner controllers/ die Datei
DemoController.phpgefunden werden konnte +
+ - und mit ihr ein Objekt des Typs DemoController instanziiert werden konnte +
- und dieses Objekt die Funktion (Action) howto() ausgeführt hat +
Sie sehen: da muss einiges stimmen und vieles davon ist Konvention.
+Querystrings und Pfadsegmente
+Die Actions in den Controller-Klassen sollen per Konvention immer ein RequestData Objekt
+ entgegennehmen. Beispiel: howto(RequestData \$rd)
Dieses RequestData Objekt wird durch den Router befüllt, wenn Daten in der URL extrahiert werden konnten.
+Daten finden sich URLs...
+ +-
+
-
+
+ im Querystring
+
Beispiel: rufen Sie diese mit +:///demo?bgcolor=fefbd8&name=Remmy+ auf, werden bgcolor undnamemitsamt Werten als Query Array +$rd->query) übergeben +
+
Probieren Sie es aus ;)
+ args)): ?> +Argumente dieses Aufrufs:
+ + args as $a): $__empty_1 = false; ?> +
+
+
Keine weiteren Argumente im Request
+ + + query)): ?> +Daten aus der Query dieses Aufrufs:
+
+ query as $k => $v): $__empty_1 = false; ?>
+ $rd->query['']=
+
+
+ Keine Querydaten
+
+ Blade
+Blade muss installiert sein. + Die Installation ist bereits geschehen und die Bibliothek liegt unter /vendor. +
+Daten übergeben und View rendern
+Bei der Verwendung der View-Engine gelten einige Konventionen:
+ Die Dateien müssen <viewname>.blade.php heißen und im Ordner views liegen.
+
Sie können der View dann Daten mitgeben, indem Sie alle Daten in ein Array schreiben und dieses dann + übergeben.
+Beispiel:
+
+ view("viewtest",
+ array(
+ "texts"=>$textArray,
+ "persona"=>$persona,
+ "rd"=>$rd
+ )); // öffnet ../views/viewtest.blade.php
+ Es gab ein Problem mit der Datenbankverbindung
+Fehlermeldung
++ + + + +
Daten aus der Datenbank der Tabelle: Kategorien
+ +-
+
+
+
+
+
+
+
- Keine Daten vorhanden. + +
Es gab ein Problem mit der Datenbankverbindung
+Fehlermeldung
++ + + +
Daten aus der Datenbank der Tabelle: Kategorien
+ +-
+
+
+
+
+
+
+
- Es sind keine Gerichte vorhanden + +
Es gab ein Problem mit der Datenbankverbindung
+Fehlermeldung
++ + + +
Daten aus der Datenbank der Tabelle: Kategorien
+ +-
+
+
+
+
+
+
+
- Es sind keine Gerichte vorhanden + +
Page 1
+stopSection(); ?> + +startSection("footer"); ?> +Footer of Page 1
+stopSection(); ?> +runChild(".layouts.m4_7d_layout",['title' => "Page 1"]); } ?> \ No newline at end of file diff --git a/M6/emensa/storage/cache/examples.pages.m4_7d_page_2_ed122779e3e904882984750d979c216b1e98ea8d.bladec b/M6/emensa/storage/cache/examples.pages.m4_7d_page_2_ed122779e3e904882984750d979c216b1e98ea8d.bladec new file mode 100644 index 0000000..961375a --- /dev/null +++ b/M6/emensa/storage/cache/examples.pages.m4_7d_page_2_ed122779e3e904882984750d979c216b1e98ea8d.bladec @@ -0,0 +1,14 @@ + + +startSection("header"); ?> + +stopSection(); ?> + +startSection("body"); ?> +Page 2
+stopSection(); ?> + +startSection("footer"); ?> +Footer of Page 2
+stopSection(); ?> +runChild(".layouts.m4_7d_layout",['title' => "Page 2"]); } ?> \ No newline at end of file diff --git a/M6/emensa/storage/cache/home_be3f101c28919ade210629435b0b22d1f6f23f27.bladec b/M6/emensa/storage/cache/home_be3f101c28919ade210629435b0b22d1f6f23f27.bladec new file mode 100644 index 0000000..c54dc25 --- /dev/null +++ b/M6/emensa/storage/cache/home_be3f101c28919ade210629435b0b22d1f6f23f27.bladec @@ -0,0 +1,36 @@ + + +startSection("content"); ?> +Hauptseite E-Mensa
+
+
+
+
+yieldContent("jsextra"); ?>
+
+
+
diff --git a/M6/emensa/storage/cache/layouts.main_layout_3661f571e5a2129da3ca081fa828422117d3b345.bladec b/M6/emensa/storage/cache/layouts.main_layout_3661f571e5a2129da3ca081fa828422117d3b345.bladec
new file mode 100644
index 0000000..aec0cb1
--- /dev/null
+++ b/M6/emensa/storage/cache/layouts.main_layout_3661f571e5a2129da3ca081fa828422117d3b345.bladec
@@ -0,0 +1,30 @@
+
+
+
+
+
+
+ yieldContent("content"); ?>
+
++
+
+
+
+
+
\ No newline at end of file
diff --git a/M6/emensa/storage/cache/layouts.main_layout_54314409e9b1b39431b6e14f05f203008160a8be.bladec b/M6/emensa/storage/cache/layouts.main_layout_54314409e9b1b39431b6e14f05f203008160a8be.bladec
new file mode 100644
index 0000000..aec0cb1
--- /dev/null
+++ b/M6/emensa/storage/cache/layouts.main_layout_54314409e9b1b39431b6e14f05f203008160a8be.bladec
@@ -0,0 +1,30 @@
+
+
+
+
+
+
+yieldContent("text"); ?>
+
+yieldContent("gerichte"); ?>
+
+
++
+
+
+
+
+
\ No newline at end of file
diff --git a/M6/emensa/storage/cache/layouts.main_layout_8077339149503599d9e0031a6524512372b045d7.bladec b/M6/emensa/storage/cache/layouts.main_layout_8077339149503599d9e0031a6524512372b045d7.bladec
new file mode 100644
index 0000000..aec0cb1
--- /dev/null
+++ b/M6/emensa/storage/cache/layouts.main_layout_8077339149503599d9e0031a6524512372b045d7.bladec
@@ -0,0 +1,30 @@
+
+
+
+
+
+
+yieldContent("text"); ?>
+
+yieldContent("gerichte"); ?>
+
+
++
+
+
+
+
+
\ No newline at end of file
diff --git a/M6/emensa/storage/cache/layouts.main_layout_9f099eee303f11c8c3f1b61e05a54e7376df8add.bladec b/M6/emensa/storage/cache/layouts.main_layout_9f099eee303f11c8c3f1b61e05a54e7376df8add.bladec
new file mode 100644
index 0000000..aec0cb1
--- /dev/null
+++ b/M6/emensa/storage/cache/layouts.main_layout_9f099eee303f11c8c3f1b61e05a54e7376df8add.bladec
@@ -0,0 +1,30 @@
+
+
+
+
+
+
+yieldContent("text"); ?>
+
+yieldContent("gerichte"); ?>
+
+
++
+
+
+
+
+
\ No newline at end of file
diff --git a/M6/emensa/storage/cache/layouts.main_layout_ff0dbbbcc8c331f06acac2bd395c317de615c9d1.bladec b/M6/emensa/storage/cache/layouts.main_layout_ff0dbbbcc8c331f06acac2bd395c317de615c9d1.bladec
new file mode 100644
index 0000000..aec0cb1
--- /dev/null
+++ b/M6/emensa/storage/cache/layouts.main_layout_ff0dbbbcc8c331f06acac2bd395c317de615c9d1.bladec
@@ -0,0 +1,30 @@
+
+
+
+
+
+
+yieldContent("text"); ?>
+
+yieldContent("gerichte"); ?>
+
+
++
+
+
+
+
+
\ No newline at end of file
diff --git a/M6/emensa/storage/cache/m5_a1.abmeldung_17f241c320c4a8a9a33bfe29835f14c33bd19626.bladec b/M6/emensa/storage/cache/m5_a1.abmeldung_17f241c320c4a8a9a33bfe29835f14c33bd19626.bladec
new file mode 100644
index 0000000..f59bef6
--- /dev/null
+++ b/M6/emensa/storage/cache/m5_a1.abmeldung_17f241c320c4a8a9a33bfe29835f14c33bd19626.bladec
@@ -0,0 +1,12 @@
+
+
+startSection("main"); ?>
+
+
+
+
+
+
+
+stopSection(); ?>
+runChild("m5_a1.layout_anmeldung"); } ?>
\ No newline at end of file
diff --git a/M6/emensa/storage/cache/m5_a1.anmeldung_01c45fd41d095952aa184fb3fc764d18878732cb.bladec b/M6/emensa/storage/cache/m5_a1.anmeldung_01c45fd41d095952aa184fb3fc764d18878732cb.bladec
new file mode 100644
index 0000000..bac6ca9
--- /dev/null
+++ b/M6/emensa/storage/cache/m5_a1.anmeldung_01c45fd41d095952aa184fb3fc764d18878732cb.bladec
@@ -0,0 +1,25 @@
+
+
+startSection("main"); ?>
+
+
+
+ Bitte anmelden!
+
+
+
+ Anmeldung erlaubt!
+ Es ist ein Fehler aufgetretten!
+
+
+stopSection(); ?>
+runChild("m5_a1.layout_anmeldung"); } ?>
\ No newline at end of file
diff --git a/M6/emensa/storage/cache/m5_a1.anmeldung_4561ed53dca7d646bba9841a2b057ea32d050a0c.bladec b/M6/emensa/storage/cache/m5_a1.anmeldung_4561ed53dca7d646bba9841a2b057ea32d050a0c.bladec
new file mode 100644
index 0000000..bac6ca9
--- /dev/null
+++ b/M6/emensa/storage/cache/m5_a1.anmeldung_4561ed53dca7d646bba9841a2b057ea32d050a0c.bladec
@@ -0,0 +1,25 @@
+
+
+startSection("main"); ?>
+
+
+
+ Bitte anmelden!
+
+
+
+ Anmeldung erlaubt!
+ Es ist ein Fehler aufgetretten!
+
+
+stopSection(); ?>
+runChild("m5_a1.layout_anmeldung"); } ?>
\ No newline at end of file
diff --git a/M6/emensa/storage/cache/m5_a1.anmeldung_c24d33e917eb7ef9d14d646f11f37749504ff5c8.bladec b/M6/emensa/storage/cache/m5_a1.anmeldung_c24d33e917eb7ef9d14d646f11f37749504ff5c8.bladec
new file mode 100644
index 0000000..bac6ca9
--- /dev/null
+++ b/M6/emensa/storage/cache/m5_a1.anmeldung_c24d33e917eb7ef9d14d646f11f37749504ff5c8.bladec
@@ -0,0 +1,25 @@
+
+
+startSection("main"); ?>
+
+
+
+ Bitte anmelden!
+
+
+
+ Anmeldung erlaubt!
+ Es ist ein Fehler aufgetretten!
+
+
+stopSection(); ?>
+runChild("m5_a1.layout_anmeldung"); } ?>
\ No newline at end of file
diff --git a/M6/emensa/storage/cache/m5_a1.anmeldung_verifizieren_06701b6bf7b5936abd21c6cfbe469b752d069cec.bladec b/M6/emensa/storage/cache/m5_a1.anmeldung_verifizieren_06701b6bf7b5936abd21c6cfbe469b752d069cec.bladec
new file mode 100644
index 0000000..3ce0535
--- /dev/null
+++ b/M6/emensa/storage/cache/m5_a1.anmeldung_verifizieren_06701b6bf7b5936abd21c6cfbe469b752d069cec.bladec
@@ -0,0 +1,51 @@
+
+
+startSection("main"); ?>
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+yieldContent("text"); ?>
+
+yieldContent("gerichte"); ?>
+
+
+
+ + Bitte warten! + +stopSection(); ?> +runChild("m5_a1.layout_anmeldung"); } ?> \ No newline at end of file diff --git a/M6/emensa/storage/cache/m5_a1.layout_anmeldung_0bf7f1c53d4cd4970b2790535eaffcc9dddc4266.bladec b/M6/emensa/storage/cache/m5_a1.layout_anmeldung_0bf7f1c53d4cd4970b2790535eaffcc9dddc4266.bladec new file mode 100644 index 0000000..5331778 --- /dev/null +++ b/M6/emensa/storage/cache/m5_a1.layout_anmeldung_0bf7f1c53d4cd4970b2790535eaffcc9dddc4266.bladec @@ -0,0 +1,21 @@ + + + + +
+
+stopSection(); ?>
+
+startSection("text"); ?>
+
+
+
+
+
+
+
+ Bald gibt es auch Essen online ;)
+Lorem ipsum dolor sit amet, consetetur sadipscing elitr, sed diam nonumy eirmod tempor invidunt ut labore et + dolore magna aliquyam erat, sed diam voluptua. At vero eos et accusam et justo duo dolores et ea rebum. Stet + clita kasd gubergren, no sea takimata sanctus est Lorem ipsum dolor sit amet. Lorem ipsum dolor sit amet, + consetetur sadipscing elitr, sed diam nonumy eirmod tempor invidunt ut labore et dolore magna aliquyam erat, + sed diam voluptua. At vero eos et accusam et justo duo dolores et ea rebum. Stet clita kasd gubergren, no + sea takimata sanctus est Lorem ipsum dolor sit amet.
+Köstlichkeiten die Sie erwarten
+ +stopSection(); ?> + +startSection("gerichte"); ?> + + +Es gab ein Problem mit der Datenbankverbindung
+Fehlermeldung
++ + + + + +stopSection(); ?> + +startSection("footer"); ?> + +
+
+
+stopSection(); ?>
+
+startSection("text"); ?>
+
+
+
+
+
+
+
+
+ Bald gibt es auch Essen online ;)
+Lorem ipsum dolor sit amet, consetetur sadipscing elitr, sed diam nonumy eirmod tempor invidunt ut labore et + dolore magna aliquyam erat, sed diam voluptua. At vero eos et accusam et justo duo dolores et ea rebum. Stet + clita kasd gubergren, no sea takimata sanctus est Lorem ipsum dolor sit amet. Lorem ipsum dolor sit amet, + consetetur sadipscing elitr, sed diam nonumy eirmod tempor invidunt ut labore et dolore magna aliquyam erat, + sed diam voluptua. At vero eos et accusam et justo duo dolores et ea rebum. Stet clita kasd gubergren, no + sea takimata sanctus est Lorem ipsum dolor sit amet.
+Köstlichkeiten die Sie erwarten
+ +stopSection(); ?> + +startSection("gerichte"); ?> + + + +Es gab ein Problem mit der Datenbankverbindung
+Fehlermeldung
++ + +
+
+
+stopSection(); ?>
+
+startSection("text"); ?>
+
+
+
+
+
+
+
+
+ Bald gibt es auch Essen online ;)
+Lorem ipsum dolor sit amet, consetetur sadipscing elitr, sed diam nonumy eirmod tempor invidunt ut labore et + dolore magna aliquyam erat, sed diam voluptua. At vero eos et accusam et justo duo dolores et ea rebum. Stet + clita kasd gubergren, no sea takimata sanctus est Lorem ipsum dolor sit amet. Lorem ipsum dolor sit amet, + consetetur sadipscing elitr, sed diam nonumy eirmod tempor invidunt ut labore et dolore magna aliquyam erat, + sed diam voluptua. At vero eos et accusam et justo duo dolores et ea rebum. Stet clita kasd gubergren, no + sea takimata sanctus est Lorem ipsum dolor sit amet.
+Köstlichkeiten die Sie erwarten
+ +stopSection(); ?> + +startSection("gerichte"); ?> + + +Es gab ein Problem mit der Datenbankverbindung
+Fehlermeldung
++ + + + + +stopSection(); ?> + +startSection("footer"); ?> + +
+
+
+stopSection(); ?>
+
+startSection("text"); ?>
+
+
+
+
+
+
+
+
+ Bald gibt es auch Essen online ;)
+Lorem ipsum dolor sit amet, consetetur sadipscing elitr, sed diam nonumy eirmod tempor invidunt ut labore et + dolore magna aliquyam erat, sed diam voluptua. At vero eos et accusam et justo duo dolores et ea rebum. Stet + clita kasd gubergren, no sea takimata sanctus est Lorem ipsum dolor sit amet. Lorem ipsum dolor sit amet, + consetetur sadipscing elitr, sed diam nonumy eirmod tempor invidunt ut labore et dolore magna aliquyam erat, + sed diam voluptua. At vero eos et accusam et justo duo dolores et ea rebum. Stet clita kasd gubergren, no + sea takimata sanctus est Lorem ipsum dolor sit amet.
+Köstlichkeiten die Sie erwarten
+ +stopSection(); ?> + +startSection("gerichte"); ?> + + + +Es gab ein Problem mit der Datenbankverbindung
+Fehlermeldung
++ + +
+
+stopSection(); ?>
+
+startSection("text"); ?>
+
+
+
+
+
+
+
+ Bald gibt es auch Essen online ;)
+Lorem ipsum dolor sit amet, consetetur sadipscing elitr, sed diam nonumy eirmod tempor invidunt ut labore et + dolore magna aliquyam erat, sed diam voluptua. At vero eos et accusam et justo duo dolores et ea rebum. Stet + clita kasd gubergren, no sea takimata sanctus est Lorem ipsum dolor sit amet. Lorem ipsum dolor sit amet, + consetetur sadipscing elitr, sed diam nonumy eirmod tempor invidunt ut labore et dolore magna aliquyam erat, + sed diam voluptua. At vero eos et accusam et justo duo dolores et ea rebum. Stet clita kasd gubergren, no + sea takimata sanctus est Lorem ipsum dolor sit amet.
+Köstlichkeiten die Sie erwarten
+ +stopSection(); ?> + +startSection("gerichte"); ?> + + +Es gab ein Problem mit der Datenbankverbindung
+Fehlermeldung
++ + + + + +stopSection(); ?> + +startSection("footer"); ?> + +
+ * Example: (includeScope=false)
+ *
+ * @include("template",['a1'=>'abc']) // a1 is equals to abc
+ * @include("template",[]) // a1 is equals to abc
+ *
+ * Example: (includeScope=true)+ *
+ * @include("template",['a1'=>'abc']) // a1 is equals to abc
+ * @include("template",[]) // a1 is not defined
+ *
+ */
+ public $includeScope = false;
+ /**
+ * @var callable[] It allows to parse the compiled output using a function.
+ * This function doesn't require to return a value+ * Example: this converts all compiled result in uppercase (note, content is a ref) + *
+ * $this->compileCallbacks[]= static function (&$content, $templatename=null) {
+ * $content=strtoupper($content);
+ * };
+ *
+ */
+ public $compileCallbacks = [];
+ /** @var array All the registered extensions. */
+ protected $extensions = [];
+ /** @var array All the finished, captured sections. */
+ protected $sections = [];
+ /** @var string The template currently being compiled. For example "folder.template" */
+ protected $fileName;
+ protected $currentView;
+ protected $notFoundPath;
+ /** @var string File extension for the template files. */
+ protected $fileExtension = '.blade.php';
+ /** @var array The stack of in-progress sections. */
+ protected $sectionStack = [];
+ /** @var array The stack of in-progress loops. */
+ protected $loopsStack = [];
+ /** @var array Dictionary of variables */
+ protected $variables = [];
+ /** @var array Dictionary of global variables */
+ protected $variablesGlobal = [];
+ /** @var array All the available compiler functions. */
+ protected $compilers = [
+ 'Extensions',
+ 'Statements',
+ 'Comments',
+ 'Echos',
+ ];
+ /** @var string|null it allows to set the stack */
+ protected $viewStack;
+ /** @var array used by $this->composer() */
+ protected $composerStack = [];
+ /** @var array The stack of in-progress push sections. */
+ protected $pushStack = [];
+ /** @var array All the finished, captured push sections. */
+ protected $pushes = [];
+ /** @var int The number of active rendering operations. */
+ protected $renderCount = 0;
+ /** @var string[] Get the template path for the compiled views. */
+ protected $templatePath;
+ /** @var string Get the compiled path for the compiled views. If null then it uses the default path */
+ protected $compiledPath;
+ /** @var string the extension of the compiled file. */
+ protected $compileExtension = '.bladec';
+ /**
+ * @var string=['auto','sha1','md5'][$i] It determines how the compiled filename will be called.+ * auto (default mode) the mode is "sha1"
+ * sha1 the filename is converted into a sha1 hash
+ * md5 the filename is converted into a md5 hash
+ */ + protected $compileTypeFileName='auto'; + + + /** @var array Custom "directive" dictionary. Those directives run at compile time. */ + protected $customDirectives = []; + /** @var bool[] Custom directive dictionary. Those directives run at runtime. */ + protected $customDirectivesRT = []; + /** @var callable Function used for resolving injected classes. */ + protected $injectResolver; + /** @var array Used for conditional if. */ + protected $conditions = []; + /** @var int Unique counter. It's used for extends */ + protected $uidCounter = 0; + /** @var string The main url of the system. Don't use raw $_SERVER values unless the value is sanitized */ + protected $baseUrl = '.'; + /** @var string|null The base domain of the system */ + protected $baseDomain; + /** @var string|null It stores the current canonical url. */ + protected $canonicalUrl; + /** @var string|null It stores the current url including arguments */ + protected $currentUrl; + /** @var string it is a relative path calculated between baseUrl and the current url. Example ../../ */ + protected $relativePath = ''; + /** @var string[] Dictionary of assets */ + protected $assetDict; + /** @var bool if true then it removes tabs and unneeded spaces */ + protected $optimize = true; + /** @var bool if false, then the template is not compiled (but executed on memory). */ + protected $isCompiled = true; + /** @var bool */ + protected $isRunFast = false; // stored for historical purpose. + /** @var array Array of opening and closing tags for raw echos. */ + protected $rawTags = ['{!!', '!!}']; + /** @var array Array of opening and closing tags for regular echos. */ + protected $contentTags = ['{{', '}}']; + /** @var array Array of opening and closing tags for escaped echos. */ + protected $escapedTags = ['{{{', '}}}']; + /** @var string The "regular" / legacy echo string format. */ + protected $echoFormat = '\htmlentities(%s??\'\', ENT_QUOTES, \'UTF-8\', false)'; + /** @var string */ + protected $echoFormatOld = 'static::e(%s)'; + /** @var array Lines that will be added at the footer of the template */ + protected $footer = []; + /** @var string Placeholder to temporary mark the position of verbatim blocks. */ + protected $verbatimPlaceholder = '$__verbatim__$'; + /** @var array Array to temporary store the verbatim blocks found in the template. */ + protected $verbatimBlocks = []; + /** @var int Counter to keep track of nested forelse statements. */ + protected $forelseCounter = 0; + /** @var array The components being rendered. */ + protected $componentStack = []; + /** @var array The original data passed to the component. */ + protected $componentData = []; + /** @var array The slot contents for the component. */ + protected $slots = []; + /** @var array The names of the slots being rendered. */ + protected $slotStack = []; + /** @var string tag unique */ + protected $PARENTKEY = '@parentXYZABC'; + /** + * Indicates the compile mode. + * if the constant BLADEONE_MODE is defined, then it is used instead of this field. + * + * @var int=[BladeOne::MODE_AUTO,BladeOne::MODE_DEBUG,BladeOne::MODE_SLOW,BladeOne::MODE_FAST][$i] + */ + protected $mode; + /** @var int Indicates the number of open switches */ + protected $switchCount = 0; + /** @var bool Indicates if the switch is recently open */ + protected $firstCaseInSwitch = true; + + //
";
+ $msg .= "BladeOne Error [$id]:
"; + $msg .= "$text
\n";
+ echo $msg;
+ if ($critic) {
+ die(1);
+ }
+ return $msg;
+ }
+
+ /**
+ * Escape HTML entities in a string.
+ *
+ * @param int|string|null $value
+ * @return string
+ */
+ public static function e($value): string
+ {
+ // Prevent "Deprecated: htmlentities(): Passing null to parameter #1 ($string) of type string is deprecated" message
+ if (\is_null($value)) {
+ return '';
+ }
+ if (\is_array($value) || \is_object($value)) {
+ return \htmlentities(\print_r($value, true), ENT_QUOTES, 'UTF-8', false);
+ }
+ if (\is_numeric($value)) {
+ $value=(string)$value;
+ }
+ return \htmlentities($value, ENT_QUOTES, 'UTF-8', false);
+ }
+
+ protected static function convertArgCallBack($k, $v): string
+ {
+ return $k . "='$v' ";
+ }
+
+ /**
+ * @param mixed|\DateTime $variable
+ * @param string|null $format
+ * @return string
+ */
+ public function format($variable, $format = null): string
+ {
+ if ($variable instanceof \DateTime) {
+ $format = $format ?? 'Y/m/d';
+ return $variable->format($format);
+ }
+ $format = $format ?? '%s';
+ return sprintf($format, $variable);
+ }
+
+ /**
+ * It converts a text into a php code with echo"; + $msg .= "$text
+ * Example:
+ *
+ * $this->wrapPHP('$hello'); // "< ?php echo $this->e($hello); ? >"
+ * $this->wrapPHP('$hello',''); // < ?php echo $this->e($hello); ? >
+ * $this->wrapPHP('$hello','',false); // < ?php echo $hello; ? >
+ * $this->wrapPHP('"hello"'); // "< ?php echo $this->e("hello"); ? >"
+ * $this->wrapPHP('hello()'); // "< ?php echo $this->e(hello()); ? >"
+ *
+ *
+ * @param ?string $input The input value
+ * @param string $quote The quote used (to quote the result)
+ * @param bool $parse If the result will be parsed or not. If false then it's returned without $this->e
+ * @return string
+ */
+ public function wrapPHP($input, $quote = '"', $parse = true): string
+ {
+ if($input===null) {
+ return 'null';
+ }
+ if (strpos($input, '(') !== false && !$this->isQuoted($input)) {
+ if ($parse) {
+ return $quote . $this->phpTagEcho . '$this->e(' . $input . ');?>' . $quote;
+ }
+
+ return $quote . $this->phpTagEcho . $input . ';?>' . $quote;
+ }
+ if (strpos($input, '$') === false) {
+ if ($parse) {
+ return self::enq($input);
+ }
+
+ return $input;
+ }
+ if ($parse) {
+ return $quote . $this->phpTagEcho . '$this->e(' . $input . ');?>' . $quote;
+ }
+ return $quote . $this->phpTagEcho . $input . ';?>' . $quote;
+ }
+
+ /**
+ * Returns true if the text is surrounded by quotes (double or single quote)
+ *
+ * @param string|null $text
+ * @return bool
+ */
+ public function isQuoted($text): bool
+ {
+ if (!$text || strlen($text) < 2) {
+ return false;
+ }
+ if ($text[0] === '"' && substr($text, -1) === '"') {
+ return true;
+ }
+ return ($text[0] === "'" && substr($text, -1) === "'");
+ }
+
+ /**
+ * Escape HTML entities in a string.
+ *
+ * @param string $value
+ * @return string
+ */
+ public static function enq($value): string
+ {
+ if (\is_array($value) || \is_object($value)) {
+ return \htmlentities(\print_r($value, true), ENT_NOQUOTES, 'UTF-8', false);
+ }
+ return \htmlentities($value??'', ENT_NOQUOTES, 'UTF-8', false);
+ }
+
+ /**
+ * @param string $view example "folder.template"
+ * @param string|null $alias example "mynewop". If null then it uses the name of the template.
+ */
+ public function addInclude($view, $alias = null): void
+ {
+ if (!isset($alias)) {
+ $alias = \explode('.', $view);
+ $alias = \end($alias);
+ }
+ $this->directive($alias, function ($expression) use ($view) {
+ $expression = $this->stripParentheses($expression) ?: '[]';
+ return "$this->phpTag echo \$this->runChild('$view', $expression); ?>";
+ });
+ }
+
+ /**
+ * Register a handler for custom directives.
+ *
+ * @param string $name
+ * @param callable $handler
+ * @return void
+ */
+ public function directive($name, callable $handler): void
+ {
+ $this->customDirectives[$name] = $handler;
+ $this->customDirectivesRT[$name] = false;
+ }
+
+ /**
+ * Strip the parentheses from the given expression.
+ *
+ * @param string|null $expression
+ * @return string
+ */
+ public function stripParentheses($expression): string
+ {
+ if (\is_null($expression)) {
+ return '';
+ }
+
+ if (static::startsWith($expression, '(')) {
+ $expression = \substr($expression, 1, -1);
+ }
+
+ return $expression;
+ }
+
+ /**
+ * Determine if a given string starts with a given substring.
+ *
+ * @param string $haystack
+ * @param string|array $needles
+ * @return bool
+ */
+ public static function startsWith($haystack, $needles): bool
+ {
+ foreach ((array)$needles as $needle) {
+ if ($needle != '') {
+ if (\function_exists('mb_strpos')) {
+ if ($haystack !== null && \mb_strpos($haystack, $needle) === 0) {
+ return true;
+ }
+ } elseif ($haystack !== null && \strpos($haystack, $needle) === 0) {
+ return true;
+ }
+ }
+ }
+
+ return false;
+ }
+
+ /**
+ * If false then the file is not compiled, and it is executed directly from the memory.+ * By default the value is true
+ * It also sets the mode to MODE_SLOW + * + * @param bool $bool + * @return BladeOne + * @see BladeOne::setMode + */ + public function setIsCompiled($bool = false): BladeOne + { + $this->isCompiled = $bool; + if (!$bool) { + $this->setMode(self::MODE_SLOW); + } + return $this; + } + + /** + * It sets the template and compile path (without trailing slash). + *
Example:setPath("somefolder","otherfolder"); + * + * @param null|string|string[] $templatePath If null then it uses the current path /views folder + * @param null|string $compiledPath If null then it uses the current path /views folder + */ + public function setPath($templatePath, $compiledPath): void + { + if ($templatePath === null) { + $templatePath = \getcwd() . '/views'; + } + if ($compiledPath === null) { + $compiledPath = \getcwd() . '/compiles'; + } + $this->templatePath = (is_array($templatePath)) ? $templatePath : [$templatePath]; + $this->compiledPath = $compiledPath; + } + + /** + * @return array + */ + public function getAliasClasses(): array + { + return $this->aliasClasses; + } + + /** + * @param array $aliasClasses + */ + public function setAliasClasses($aliasClasses): void + { + $this->aliasClasses = $aliasClasses; + } + + /** + * @param string $aliasName + * @param string $classWithNS + */ + public function addAliasClasses($aliasName, $classWithNS): void + { + $this->aliasClasses[$aliasName] = $classWithNS; + } + //
+ * This function uses the current url and the baseurl + * + * @param string $relativeWeb . Example img/images.jpg + * @return string Example ../../img/images.jpg + */ + public function relative($relativeWeb): string + { + return $this->assetDict[$relativeWeb] ?? ($this->relativePath . $relativeWeb); + } + + /** + * It adds an alias to the link of the resources.
+ * addAssetDict('name','url/res.jpg')
+ * addAssetDict(['name'=>'url/res.jpg','name2'=>'url/res2.jpg']); + * + * @param string|array $name example 'css/style.css', you could also add an array + * @param string $url example https://www.web.com/style.css' + */ + public function addAssetDict($name, $url = ''): void + { + if (\is_array($name)) { + if ($this->assetDict === null) { + $this->assetDict = $name; + } else { + $this->assetDict = \array_merge($this->assetDict, $name); + } + } else { + $this->assetDict[$name] = $url; + } + } + + /** + * Compile the push statements into valid PHP. + * + * @param string $expression + * @return string + * @see BladeOne::startPush + */ + public function compilePush($expression): string + { + return $this->phpTag . "\$this->startPush$expression; ?>"; + } + + /** + * Compile the push statements into valid PHP. + * + * @param string $expression + * @return string + * @see BladeOne::startPush + */ + public function compilePushOnce($expression): string + { + $key = '$__pushonce__' . \trim(\substr($expression, 2, -2)); + return $this->phpTag . "if(!isset($key)): $key=1; \$this->startPush$expression; ?>"; + } + + /** + * Compile the push statements into valid PHP. + * + * @param string $expression + * @return string + * @see BladeOne::startPush + */ + public function compilePrepend($expression): string + { + return $this->phpTag . "\$this->startPush$expression; ?>"; + } + + /** + * Start injecting content into a push section. + * + * @param string $section + * @param string $content + * @return void + */ + public function startPush($section, $content = ''): void + { + if ($content === '') { + if (\ob_start()) { + $this->pushStack[] = $section; + } + } else { + $this->extendPush($section, $content); + } + } + + /* + * endswitch tag + */ + + /** + * Append content to a given push section. + * + * @param string $section + * @param string $content + * @return void + */ + protected function extendPush($section, $content): void + { + if (!isset($this->pushes[$section])) { + $this->pushes[$section] = []; // start an empty section + } + if (!isset($this->pushes[$section][$this->renderCount])) { + $this->pushes[$section][$this->renderCount] = $content; + } else { + $this->pushes[$section][$this->renderCount] .= $content; + } + } + + /** + * Start injecting content into a push section. + * + * @param string $section + * @param string $content + * @return void + */ + public function startPrepend($section, $content = ''): void + { + if ($content === '') { + if (\ob_start()) { + \array_unshift($this->pushStack[], $section); + } + } else { + $this->extendPush($section, $content); + } + } + + /** + * Stop injecting content into a push section. + * + * @return string + */ + public function stopPush(): string + { + if (empty($this->pushStack)) { + $this->showError('stopPush', 'Cannot end a section without first starting one', true); + } + $last = \array_pop($this->pushStack); + $this->extendPush($last, \ob_get_clean()); + return $last; + } + + /** + * Stop injecting content into a push section. + * + * @return string + */ + public function stopPrepend(): string + { + if (empty($this->pushStack)) { + $this->showError('stopPrepend', 'Cannot end a section without first starting one', true); + } + $last = \array_shift($this->pushStack); + $this->extendStartPush($last, \ob_get_clean()); + return $last; + } + + /** + * Append content to a given push section. + * + * @param string $section + * @param string $content + * @return void + */ + protected function extendStartPush($section, $content): void + { + if (!isset($this->pushes[$section])) { + $this->pushes[$section] = []; // start an empty section + } + if (!isset($this->pushes[$section][$this->renderCount])) { + $this->pushes[$section][$this->renderCount] = $content; + } else { + $this->pushes[$section][$this->renderCount] = $content . $this->pushes[$section][$this->renderCount]; + } + } + + /** + * Get the string contents of a push section. + * + * @param string $section the name of the section + * @param string $default the default name of the section is not found. + * @return string + */ + public function yieldPushContent($section, $default = ''): string + { + if($section===null || $section==='') { + return $default; + } + if($section[-1]==='*') { + $keys=array_keys($this->pushes); + $findme=rtrim($section,'*'); + $result=""; + foreach($keys as $key) { + if(strpos($key,$findme)===0) { + $result.=\implode(\array_reverse($this->pushes[$key])); + } + } + return $result; + } + if (!isset($this->pushes[$section])) { + return $default; + } + return \implode(\array_reverse($this->pushes[$section])); + } + + /** + * Get the string contents of a push section. + * + * @param int|string $each if "int", then it split the foreach every $each numbers.
+ * if "string" or "c3", then it means that it will split in 3 columns
+ * @param string $splitText + * @param string $splitEnd + * @return string + */ + public function splitForeach($each = 1, $splitText = ',', $splitEnd = ''): string + { + $loopStack = static::last($this->loopsStack); // array(7) { ["index"]=> int(0) ["remaining"]=> int(6) ["count"]=> int(5) ["first"]=> bool(true) ["last"]=> bool(false) ["depth"]=> int(1) ["parent"]=> NULL } + if (($loopStack['index']) == $loopStack['count'] - 1) { + return $splitEnd; + } + $eachN = 0; + if (is_numeric($each)) { + $eachN = $each; + } elseif (strlen($each) > 1) { + if ($each[0] === 'c') { + $eachN = $loopStack['count'] / substr($each, 1); + } + } else { + $eachN = PHP_INT_MAX; + } + + if (($loopStack['index'] + 1) % $eachN === 0) { + return $splitText; + } + return ''; + } + + /** + * Return the last element in an array passing a given truth test. + * + * @param array $array + * @param callable|null $callback + * @param mixed $default + * @return mixed + */ + public static function last($array, callable $callback = null, $default = null) + { + if (\is_null($callback)) { + return empty($array) ? static::value($default) : \end($array); + } + return static::first(\array_reverse($array), $callback, $default); + } + + /** + * Return the default value of the given value. + * + * @param mixed $value + * @return mixed + */ + public static function value($value) + { + return $value instanceof Closure ? $value() : $value; + } + + /** + * Return the first element in an array passing a given truth test. + * + * @param array $array + * @param callable|null $callback + * @param mixed $default + * @return mixed + */ + public static function first($array, callable $callback = null, $default = null) + { + if (\is_null($callback)) { + return empty($array) ? static::value($default) : \reset($array); + } + foreach ($array as $key => $value) { + if ($callback($key, $value)) { + return $value; + } + } + return static::value($default); + } + + /** + * @param string $name + * @param $args [] + * @return string + * @throws BadMethodCallException + */ + public function __call($name, $args) + { + if ($name === 'if') { + return $this->registerIfStatement($args[0] ?? null, $args[1] ?? null); + } + $this->showError('call', "function $name is not defined
", true, true); + return ''; + } + + /** + * Register an "if" statement directive. + * + * @param string $name + * @param callable $callback + * @return string + */ + public function registerIfStatement($name, callable $callback): string + { + $this->conditions[$name] = $callback; + + $this->directive($name, function ($expression) use ($name) { + $tmp = $this->stripParentheses($expression); + return $expression !== '' + ? $this->phpTag . " if (\$this->check('$name', $tmp)): ?>" + : $this->phpTag . " if (\$this->check('$name')): ?>"; + }); + + $this->directive('else' . $name, function ($expression) use ($name) { + $tmp = $this->stripParentheses($expression); + return $expression !== '' + ? $this->phpTag . " elseif (\$this->check('$name', $tmp)): ?>" + : $this->phpTag . " elseif (\$this->check('$name')): ?>"; + }); + + $this->directive('end' . $name, function () { + return $this->phpTag . ' endif; ?>'; + }); + return ''; + } + + /** + * Check the result of a condition. + * + * @param string $name + * @param array $parameters + * @return bool + */ + public function check($name, ...$parameters): bool + { + return \call_user_func($this->conditions[$name], ...$parameters); + } + + /** + * @param bool $bool + * @param string $view name of the view + * @param array $value arrays of values + * @return string + * @throws Exception + */ + public function includeWhen($bool = false, $view = '', $value = []): string + { + if ($bool) { + return $this->runChild($view, $value); + } + return ''; + } + + /** + * Macro of function run + * + * @param $view + * @param array $variables + * @return string + * @throws Exception + */ + public function runChild($view, $variables = []): string + { + if (\is_array($variables)) { + if ($this->includeScope) { + $backup = $this->variables; + } else { + $backup = null; + } + $newVariables = \array_merge($this->variables, $variables); + } else { + if ($variables === null) { + $newVariables = $this->variables; + var_dump($newVariables); + die(1); + } + + $this->showError('run/include', "RunChild: Include/run variables should be defined as array ['idx'=>'value']", true); + return ''; + } + $r = $this->runInternal($view, $newVariables, false, $this->isRunFast); + if ($backup !== null) { + $this->variables = $backup; + } + return $r; + } + + /** + * run the blade engine. It returns the result of the code. + * + * @param string $view + * @param array $variables + * @param bool $forced if true then it recompiles no matter if the compiled file exists or not. + * @param bool $runFast if true then the code is not compiled neither checked, and it runs directly the compiled + * version. + * @return string + * @throws Exception + * @noinspection PhpUnusedParameterInspection + */ + protected function runInternal($view, $variables = [], $forced = false, $runFast = false): string + { + $this->currentView = $view; + if (@\count($this->composerStack)) { + $this->evalComposer($view); + } + if (@\count($this->variablesGlobal) > 0) { + $this->variables = \array_merge($variables, $this->variablesGlobal); + //$this->variablesGlobal = []; // used so we delete it. + } else { + $this->variables = $variables; + } + if (!$runFast) { + // a) if the "compile" is forced then we compile the original file, then save the file. + // b) if the "compile" is not forced then we read the datetime of both file, and we compared. + // c) in both cases, if the compiled doesn't exist then we compile. + if ($view) { + $this->fileName = $view; + } + $result = $this->compile($view, $forced); + if (!$this->isCompiled) { + return $this->evaluateText($result, $this->variables); + } + } elseif ($view) { + $this->fileName = $view; + } + $this->isRunFast = $runFast; + return $this->evaluatePath($this->getCompiledFile(), $this->variables); + } + + protected function evalComposer($view): void + { + foreach ($this->composerStack as $viewKey => $fn) { + if ($this->wildCardComparison($view, $viewKey)) { + if (is_callable($fn)) { + $fn($this); + } elseif ($this->methodExistsStatic($fn, 'composer')) { + // if the method exists statically then $fn is the class and 'composer' is the name of the method + $fn::composer($this); + } elseif (is_object($fn) || class_exists($fn)) { + // if $fn is an object, or it is a class and the class exists. + $instance = (is_object($fn)) ? $fn : new $fn(); + if (method_exists($instance, 'composer')) { + // and the method exists inside the instance. + $instance->composer($this); + } else { + if ($this->mode === self::MODE_DEBUG) { + $this->showError('evalComposer', "BladeOne: composer() added an incorrect method [$fn]", true, true); + return; + } + $this->showError('evalComposer', 'BladeOne: composer() added an incorrect method', true, true); + return; + } + } else { + $this->showError('evalComposer', 'BladeOne: composer() added an incorrect method', true, true); + } + } + } + } + + /** + * It compares with wildcards (*) and returns true if both strings are equals
+ * The wildcards only works at the beginning and/or at the end of the string.
+ * Example:
+ *
+ * Text::wildCardComparison('abcdef','abc*'); // true
+ * Text::wildCardComparison('abcdef','*def'); // true
+ * Text::wildCardComparison('abcdef','*abc*'); // true
+ * Text::wildCardComparison('abcdef','*cde*'); // true
+ * Text::wildCardComparison('abcdef','*cde'); // false
+ *
+ *
+ *
+ * @param string $text
+ * @param string|null $textWithWildcard
+ *
+ * @return bool
+ */
+ protected function wildCardComparison($text, $textWithWildcard): bool
+ {
+ if (($textWithWildcard === null || $textWithWildcard === '')
+ || strpos($textWithWildcard, '*') === false
+ ) {
+ // if the text with wildcard is null or empty, or it contains two ** or it contains no * then..
+ return $text == $textWithWildcard;
+ }
+ if ($textWithWildcard === '*' || $textWithWildcard === '**') {
+ return true;
+ }
+ $c0 = $textWithWildcard[0];
+ $c1 = substr($textWithWildcard, -1);
+ $textWithWildcardClean = str_replace('*', '', $textWithWildcard);
+ $p0 = strpos($text, $textWithWildcardClean);
+ if ($p0 === false) {
+ // no matches.
+ return false;
+ }
+ if ($c0 === '*' && $c1 === '*') {
+ // $textWithWildcard='*asasasas*'
+ return true;
+ }
+ if ($c1 === '*') {
+ // $textWithWildcard='asasasas*'
+ return $p0 === 0;
+ }
+ // $textWithWildcard='*asasasas'
+ $len = strlen($textWithWildcardClean);
+ return (substr($text, -$len) === $textWithWildcardClean);
+ }
+
+ protected function methodExistsStatic($class, $method): bool
+ {
+ try {
+ return (new \ReflectionMethod($class, $method))->isStatic();
+ } catch (\ReflectionException $e) {
+ return false;
+ }
+ }
+
+ /**
+ * Compile the view at the given path.
+ *
+ * @param string $templateName The name of the template. Example folder.template
+ * @param bool $forced If the compilation will be forced (always compile) or not.
+ * @return boolean|string True if the operation was correct, or false (if not exception)
+ * if it fails. It returns a string (the content compiled) if isCompiled=false
+ * @throws Exception
+ */
+ public function compile($templateName = null, $forced = false)
+ {
+ $compiled = $this->getCompiledFile($templateName);
+ $template = $this->getTemplateFile($templateName);
+ if (!$this->isCompiled) {
+ $contents = $this->compileString($this->getFile($template));
+ $this->compileCallBacks($contents, $templateName);
+ return $contents;
+ }
+ if ($forced || $this->isExpired($templateName)) {
+ // compile the original file
+ $contents = $this->compileString($this->getFile($template));
+ $this->compileCallBacks($contents, $templateName);
+ if ($this->optimize) {
+ // removes space and tabs and replaces by a single space
+ $contents = \preg_replace('/^ {2,}/m', ' ', $contents);
+ $contents = \preg_replace('/^\t{2,}/m', ' ', $contents);
+ }
+ $ok = @\file_put_contents($compiled, $contents);
+ if ($ok === false) {
+ $this->showError(
+ 'Compiling',
+ "Unable to save the file [$compiled]. Check the compile folder is defined and has the right permission"
+ );
+ return false;
+ }
+ }
+ return true;
+ }
+
+ /**
+ * Get the full path of the compiled file.
+ *
+ * @param string $templateName
+ * @return string
+ */
+ public function getCompiledFile($templateName = ''): string
+ {
+ $templateName = (empty($templateName)) ? $this->fileName : $templateName;
+
+ $fullPath = $this->getTemplateFile($templateName);
+ if($fullPath == '') {
+ throw new \RuntimeException('Template not found: ' . $templateName);
+ }
+
+ $style=$this->compileTypeFileName;
+ if ($style==='auto') {
+ $style='sha1';
+ }
+ $hash = $style === 'md5' ? \md5($fullPath) : \sha1($fullPath);
+ return $this->compiledPath . '/' . basename($templateName) . '_' . $hash . $this->compileExtension;
+ }
+
+
+
+ /**
+ * Get the mode of the engine.See BladeOne::MODE_* constants
+ *
+ * @return int=[self::MODE_AUTO,self::MODE_DEBUG,self::MODE_FAST,self::MODE_SLOW][$i]
+ */
+ public function getMode(): int
+ {
+ if (\defined('BLADEONE_MODE')) {
+ $this->mode = BLADEONE_MODE;
+ }
+ return $this->mode;
+ }
+
+ /**
+ * Set the compile mode+ * + * @param $mode int=[self::MODE_AUTO,self::MODE_DEBUG,self::MODE_FAST,self::MODE_SLOW][$i] + * @return void + */ + public function setMode($mode): void + { + $this->mode = $mode; + } + + /** + * Get the full path of the template file. + *
Example: getTemplateFile('.abc.def')
+ * + * @param string $templateName template name. If not template is set then it uses the base template. + * @return string + */ + public function getTemplateFile($templateName = ''): string + { + $templateName = (empty($templateName)) ? $this->fileName : $templateName; + if (\strpos($templateName, '/') !== false) { + return $this->locateTemplate($templateName); // it's a literal + } + $arr = \explode('.', $templateName); + $c = \count($arr); + if ($c == 1) { + // it's in the root of the template folder. + return $this->locateTemplate($templateName . $this->fileExtension); + } + + $file = $arr[$c - 1]; + \array_splice($arr, $c - 1, $c - 1); // delete the last element + $path = \implode('/', $arr); + return $this->locateTemplate($path . '/' . $file . $this->fileExtension); + } + + /** + * Find template file with the given name in all template paths in the order the paths were written + * + * @param string $name Filename of the template (without path) + * @return string template file + */ + protected function locateTemplate($name): string + { + $this->notFoundPath = ''; + foreach ($this->templatePath as $dir) { + $path = $dir . '/' . $name; + if (\is_file($path)) { + return $path; + } + + $this->notFoundPath .= $path . ","; + } + return ''; + } + + /** + * Get the contents of a file. + * + * @param string $fullFileName It gets the content of a filename or returns ''. + * + * @return string + */ + public function getFile($fullFileName): string + { + if (\is_file($fullFileName)) { + return \file_get_contents($fullFileName); + } + $this->showError('getFile', "File does not exist at paths (separated by comma) [$this->notFoundPath] or permission denied"); + return ''; + } + + protected function compileCallBacks(&$contents, $templateName): void + { + if (!empty($this->compileCallbacks)) { + foreach ($this->compileCallbacks as $callback) { + if (is_callable($callback)) { + $callback($contents, $templateName); + } + } + } + } + + /** + * Determine if the view has expired. + * + * @param string|null $fileName + * @return bool + */ + public function isExpired($fileName): bool + { + $compiled = $this->getCompiledFile($fileName); + $template = $this->getTemplateFile($fileName); + if (!\is_file($template)) { + if ($this->mode == self::MODE_DEBUG) { + $this->showError('Read file', 'Template not found :' . $this->fileName . " on file: $template", true); + } else { + $this->showError('Read file', 'Template not found :' . $this->fileName, true); + } + } + // If the compiled file doesn't exist we will indicate that the view is expired + // so that it can be re-compiled. Else, we will verify the last modification + // of the views is less than the modification times of the compiled views. + if (!$this->compiledPath || !\is_file($compiled)) { + return true; + } + return \filemtime($compiled) < \filemtime($template); + } + + /** + * Evaluates a text (string) using the current variables + * + * @param string $content + * @param array $variables + * @return string + * @throws Exception + */ + protected function evaluateText($content, $variables): string + { + \ob_start(); + \extract($variables); + // We'll evaluate the contents of the view inside a try/catch block, so we can + // flush out any stray output that might get out before an error occurs or + // an exception is thrown. This prevents any partial views from leaking. + try { + eval(' ?>' . $content . $this->phpTag); + } catch (Exception $e) { + $this->handleViewException($e); + } + return \ltrim(\ob_get_clean()); + } + + /** + * Handle a view exception. + * + * @param Exception $e + * @return void + * @throws $e + */ + protected function handleViewException($e): void + { + \ob_get_clean(); + throw $e; + } + + /** + * Evaluates a compiled file using the current variables + * + * @param string $compiledFile full path of the compile file. + * @param array $variables + * @return string + * @throws Exception + */ + protected function evaluatePath($compiledFile, $variables): string + { + \ob_start(); + // note, the variables are extracted locally inside this method, + // they are not global variables :-3 + \extract($variables); + // We'll evaluate the contents of the view inside a try/catch block, so we can + // flush out any stray output that might get out before an error occurs or + // an exception is thrown. This prevents any partial views from leaking. + try { + include $compiledFile; + } catch (Exception $e) { + $this->handleViewException($e); + } + return \ltrim(\ob_get_clean()); + } + + /** + * @param array $views array of views + * @param array $value + * @return string + * @throws Exception + */ + public function includeFirst($views = [], $value = []): string + { + foreach ($views as $view) { + if ($this->templateExist($view)) { + return $this->runChild($view, $value); + } + } + return ''; + } + + /** + * Returns true if the template exists. Otherwise, it returns false + * + * @param $templateName + * @return bool + */ + protected function templateExist($templateName): bool + { + $file = $this->getTemplateFile($templateName); + return \is_file($file); + } + + /** + * Convert an array such as ["class1"=>"myclass","style="mystyle"] to class1='myclass' style='mystyle' string + * + * @param array|string $array array to convert + * @return string + */ + public function convertArg($array): string + { + if (!\is_array($array)) { + return $array; // nothing to convert. + } + return \implode(' ', \array_map('static::convertArgCallBack', \array_keys($array), $array)); + } + + /** + * Returns the current token. if there is not a token then it generates a new one. + * It could require an open session. + * + * @param bool $fullToken It returns a token with the current ip. + * @param string $tokenId [optional] Name of the token. + * + * @return string + */ + public function getCsrfToken($fullToken = false, $tokenId = '_token'): string + { + if ($this->csrf_token == '') { + $this->regenerateToken($tokenId); + } + if ($fullToken) { + return $this->csrf_token . '|' . $this->ipClient(); + } + return $this->csrf_token; + } + + /** + * Regenerates the csrf token and stores in the session. + * It requires an open session. + * + * @param string $tokenId [optional] Name of the token. + */ + public function regenerateToken($tokenId = '_token'): void + { + try { + $this->csrf_token = \bin2hex(\random_bytes(10)); + } catch (Exception $e) { + $this->csrf_token = '123456789012345678901234567890'; // unable to generates a random token. + } + @$_SESSION[$tokenId] = $this->csrf_token . '|' . $this->ipClient(); + } + + public function ipClient() + { + if ( + isset($_SERVER['HTTP_X_FORWARDED_FOR']) + && \preg_match('/^(d{1,3}).(d{1,3}).(d{1,3}).(d{1,3})$/', $_SERVER['HTTP_X_FORWARDED_FOR']) + ) { + return $_SERVER['HTTP_X_FORWARDED_FOR']; + } + return $_SERVER['REMOTE_ADDR'] ?? ''; + } + + /** + * Validates if the csrf token is valid or not.+ * It requires an open session. + * + * @param bool $alwaysRegenerate [optional] Default is false.
+ * If true then it will generate a new token regardless + * of the method.
+ * If false, then it will generate only if the method is POST.
+ * Note: You must not use true if you want to use csrf with AJAX. + * + * @param string $tokenId [optional] Name of the token. + * + * @return bool It returns true if the token is valid, or it is generated. Otherwise, false. + */ + public function csrfIsValid($alwaysRegenerate = false, $tokenId = '_token'): bool + { + if (@$_SERVER['REQUEST_METHOD'] === 'POST' && $alwaysRegenerate === false) { + $this->csrf_token = $_POST[$tokenId] ?? null; // ping pong the token. + return $this->csrf_token . '|' . $this->ipClient() === ($_SESSION[$tokenId] ?? null); + } + + if ($this->csrf_token == '' || $alwaysRegenerate) { + // if not token then we generate a new one + $this->regenerateToken($tokenId); + } + return true; + } + + /** + * Stop injecting content into a section and return its contents. + * + * @return string + */ + public function yieldSection(): ?string + { + $sc = $this->stopSection(); + return $this->sections[$sc] ?? null; + } + + /** + * Stop injecting content into a section. + * + * @param bool $overwrite + * @return string + */ + public function stopSection($overwrite = false): string + { + if (empty($this->sectionStack)) { + $this->showError('stopSection', 'Cannot end a section without first starting one.', true, true); + } + $last = \array_pop($this->sectionStack); + if ($overwrite) { + $this->sections[$last] = \ob_get_clean(); + } else { + $this->extendSection($last, \ob_get_clean()); + } + return $last; + } + + /** + * Append content to a given section. + * + * @param string $section + * @param string $content + * @return void + */ + protected function extendSection($section, $content): void + { + if (isset($this->sections[$section])) { + $content = \str_replace($this->PARENTKEY, $content, $this->sections[$section]); + } + $this->sections[$section] = $content; + } + + public function dump($object, $jsconsole = false): void + { + if (!$jsconsole) { + echo '
'; + \var_dump($object); + echo ''; + } else { + /** @noinspection BadExpressionStatementJS */ + /** @noinspection JSVoidFunctionReturnValueUsed */ + echo ''; + } + } + + /** + * Start injecting content into a section. + * + * @param string $section + * @param string $content + * @return void + */ + public function startSection($section, $content = ''): void + { + if ($content === '') { + \ob_start() && $this->sectionStack[] = $section; + } else { + $this->extendSection($section, $content); + } + } + + /** + * Stop injecting content into a section and append it. + * + * @return string + * @throws InvalidArgumentException + */ + public function appendSection(): string + { + if (empty($this->sectionStack)) { + $this->showError('appendSection', 'Cannot end a section without first starting one.', true, true); + } + $last = \array_pop($this->sectionStack); + if (isset($this->sections[$last])) { + $this->sections[$last] .= \ob_get_clean(); + } else { + $this->sections[$last] = \ob_get_clean(); + } + return $last; + } + + /** + * Adds a global variable. If $varname is an array then it merges all the values. + * Example: + *
+ * $this->share('variable',10.5);
+ * $this->share('variable2','hello');
+ * // or we could add the two variables as:
+ * $this->share(['variable'=>10.5,'variable2'=>'hello']);
+ *
+ *
+ * @param string|array $varname It is the name of the variable or, it is an associative array
+ * @param mixed $value
+ * @return $this
+ * @see BladeOne::share
+ */
+ public function with($varname, $value = null): BladeOne
+ {
+ return $this->share($varname, $value);
+ }
+
+ /**
+ * Adds a global variable. If $varname is an array then it merges all the values.
+ * Example:
+ *
+ * $this->share('variable',10.5);
+ * $this->share('variable2','hello');
+ * // or we could add the two variables as:
+ * $this->share(['variable'=>10.5,'variable2'=>'hello']);
+ *
+ *
+ * @param string|array $varname It is the name of the variable, or it is an associative array
+ * @param mixed $value
+ * @return $this
+ */
+ public function share($varname, $value = null): BladeOne
+ {
+ if (is_array($varname)) {
+ $this->variablesGlobal = \array_merge($this->variablesGlobal, $varname);
+ } else {
+ $this->variablesGlobal[$varname] = $value;
+ }
+ return $this;
+ }
+
+ /**
+ * Get the string contents of a section.
+ *
+ * @param string $section
+ * @param string $default
+ * @return string
+ */
+ public function yieldContent($section, $default = ''): string
+ {
+ if (isset($this->sections[$section])) {
+ return \str_replace($this->PARENTKEY, $default, $this->sections[$section]);
+ }
+
+ return $default;
+ }
+
+ /**
+ * Register a custom Blade compiler.
+ *
+ * @param callable $compiler
+ * @return void
+ */
+ public function extend(callable $compiler): void
+ {
+ $this->extensions[] = $compiler;
+ }
+
+ /**
+ * Register a handler for custom directives for run at runtime
+ *
+ * @param string $name
+ * @param callable $handler
+ * @return void
+ */
+ public function directiveRT($name, callable $handler): void
+ {
+ $this->customDirectives[$name] = $handler;
+ $this->customDirectivesRT[$name] = true;
+ }
+
+ /**
+ * Sets the escaped content tags used for the compiler.
+ *
+ * @param string $openTag
+ * @param string $closeTag
+ * @return void
+ */
+ public function setEscapedContentTags($openTag, $closeTag): void
+ {
+ $this->setContentTags($openTag, $closeTag, true);
+ }
+
+ /**
+ * Gets the content tags used for the compiler.
+ *
+ * @return array
+ */
+ public function getContentTags(): array
+ {
+ return $this->getTags();
+ }
+
+ /**
+ * Sets the content tags used for the compiler.
+ *
+ * @param string $openTag
+ * @param string $closeTag
+ * @param bool $escaped
+ * @return void
+ */
+ public function setContentTags($openTag, $closeTag, $escaped = false): void
+ {
+ $property = ($escaped === true) ? 'escapedTags' : 'contentTags';
+ $this->{$property} = [\preg_quote($openTag), \preg_quote($closeTag)];
+ }
+
+ /**
+ * Gets the tags used for the compiler.
+ *
+ * @param bool $escaped
+ * @return array
+ */
+ protected function getTags($escaped = false): array
+ {
+ $tags = $escaped ? $this->escapedTags : $this->contentTags;
+ return \array_map('stripcslashes', $tags);
+ }
+
+ /**
+ * Gets the escaped content tags used for the compiler.
+ *
+ * @return array
+ */
+ public function getEscapedContentTags(): array
+ {
+ return $this->getTags(true);
+ }
+
+ /**
+ * Sets the function used for resolving classes with inject.
+ *
+ * @param callable $function
+ */
+ public function setInjectResolver(callable $function): void
+ {
+ $this->injectResolver = $function;
+ }
+
+ /**
+ * Get the file extension for template files.
+ *
+ * @return string
+ */
+ public function getFileExtension(): string
+ {
+ return $this->fileExtension;
+ }
+
+ /**
+ * Set the file extension for the template files.
+ * It must include the leading dot e.g. ".blade.php"
+ *
+ * @param string $fileExtension Example: .prefix.ext
+ */
+ public function setFileExtension($fileExtension): void
+ {
+ $this->fileExtension = $fileExtension;
+ }
+
+ /**
+ * Get the file extension for template files.
+ *
+ * @return string
+ */
+ public function getCompiledExtension(): string
+ {
+ return $this->compileExtension;
+ }
+
+ /**
+ * Set the file extension for the compiled files.
+ * Including the leading dot for the extension is required, e.g. ".bladec"
+ *
+ * @param $fileExtension
+ */
+ public function setCompiledExtension($fileExtension): void
+ {
+ $this->compileExtension = $fileExtension;
+ }
+ /**
+ * @return string
+ * @see BladeOne::setCompileTypeFileName
+ */
+ public function getCompileTypeFileName(): string
+ {
+ return $this->compileTypeFileName;
+ }
+
+ /**
+ * It determines how the compiled filename will be called.+ * auto (default mode) the mode is "sha1"
+ * sha1 the filename is converted into a sha1 hash (it's the slow method, but it is safest)
+ * md5 the filename is converted into a md5 hash (it's faster than sha1, and it uses less space)
+ * @param string $compileTypeFileName=['auto','sha1','md5'][$i] + * @return BladeOne + */ + public function setCompileTypeFileName(string $compileTypeFileName): BladeOne + { + $this->compileTypeFileName = $compileTypeFileName; + return $this; + } + /** + * Add new loop to the stack. + * + * @param array|Countable $data + * @return void + */ + public function addLoop($data): void + { + $length = \is_array($data) || $data instanceof Countable ? \count($data) : null; + $parent = static::last($this->loopsStack); + $this->loopsStack[] = [ + 'index' => -1, + 'iteration' => 0, + 'remaining' => isset($length) ? $length + 1 : null, + 'count' => $length, + 'first' => true, + 'even' => true, + 'odd' => false, + 'last' => isset($length) ? $length == 1 : null, + 'depth' => \count($this->loopsStack) + 1, + 'parent' => $parent ? (object)$parent : null, + ]; + } + + /** + * Increment the top loop's indices. + * + * @return object + */ + public function incrementLoopIndices(): object + { + $c = \count($this->loopsStack) - 1; + $loop = &$this->loopsStack[$c]; + + $loop['index']++; + $loop['iteration']++; + $loop['first'] = $loop['index'] == 0; + $loop['even'] = $loop['index'] % 2 == 0; + $loop['odd'] = !$loop['even']; + if (isset($loop['count'])) { + $loop['remaining']--; + $loop['last'] = $loop['index'] == $loop['count'] - 1; + } + return (object)$loop; + } + + /** + * Pop a loop from the top of the loop stack. + * + * @return void + */ + public function popLoop(): void + { + \array_pop($this->loopsStack); + } + + /** + * Get an instance of the first loop in the stack. + * + * @return object|null + */ + public function getFirstLoop(): ?object + { + return ($last = static::last($this->loopsStack)) ? (object)$last : null; + } + + /** + * Get the rendered contents of a partial from a loop. + * + * @param string $view + * @param array $data + * @param string $iterator + * @param string $empty + * @return string + * @throws Exception + */ + public function renderEach($view, $data, $iterator, $empty = 'raw|'): string + { + $result = ''; + + if (\count($data) > 0) { + // If is actually data in the array, we will loop through the data and append + // an instance of the partial view to the final result HTML passing in the + // iterated value of this data array, allowing the views to access them. + foreach ($data as $key => $value) { + $data = ['key' => $key, $iterator => $value]; + $result .= $this->runChild($view, $data); + } + } elseif (static::startsWith($empty, 'raw|')) { + $result = \substr($empty, 4); + } else { + $result = $this->run($empty); + } + return $result; + } + + /** + * Run the blade engine. It returns the result of the code. + * + * @param string|null $view The name of the cache. Ex: "folder.folder.view" ("/folder/folder/view.blade") + * @param array $variables An associative arrays with the values to display. + * @return string + * @throws Exception + */ + public function run($view = null, $variables = []): string + { + $mode = $this->getMode(); + + if ($view === null) { + $view = $this->viewStack; + } + $this->viewStack = null; + if ($view === null) { + $this->showError('run', 'BladeOne: view not set', true); + return ''; + } + + $forced = ($mode & 1)!==0; // mode=1 forced:it recompiles no matter if the compiled file exists or not. + $runFast = ($mode & 2)!==0; // mode=2 runfast: the code is not compiled neither checked, and it runs directly the compiled + $this->sections = []; + if ($mode == 3) { + $this->showError('run', "we can't force and run fast at the same time", true); + } + return $this->runInternal($view, $variables, $forced, $runFast); + } + + /** + * It sets the current view
+ * This value is cleared when it is used (method run).
+ * Example:
+ *
+ * $this->setView('folder.view')->share(['var1'=>20])->run(); // or $this->run('folder.view',['var1'=>20]);
+ *
+ *
+ * @param string $view
+ * @return BladeOne
+ */
+ public function setView($view): BladeOne
+ {
+ $this->viewStack = $view;
+ return $this;
+ }
+
+ /**
+ * It injects a function, an instance, or a method class when a view is called.+ * It could be stacked. If it sets null then it clears all definitions. + * Example:
+ *
+ * $this->composer('folder.view',function($bladeOne) { $bladeOne->share('newvalue','hi there'); });
+ * $this->composer('folder.view','namespace1\namespace2\SomeClass'); // SomeClass must exist, and it must have the
+ * // method 'composer'
+ * $this->composer('folder.*',$instance); // $instance must have the method called 'composer'
+ * $this->composer(); // clear all composer.
+ *
+ *
+ * @param string|array|null $view It could contain wildcards (*). Example: 'aa.bb.cc','*.bb.cc','aa.bb.*','*.bb.*'
+ *
+ * @param callable|string|null $functionOrClass
+ * @return BladeOne
+ */
+ public function composer($view = null, $functionOrClass = null): BladeOne
+ {
+ if ($view === null && $functionOrClass === null) {
+ $this->composerStack = [];
+ return $this;
+ }
+ if (is_array($view)) {
+ foreach ($view as $v) {
+ $this->composerStack[$v] = $functionOrClass;
+ }
+ } else {
+ $this->composerStack[$view] = $functionOrClass;
+ }
+
+ return $this;
+ }
+
+ /**
+ * Start a component rendering process.
+ *
+ * @param string $name
+ * @param array $data
+ * @return void
+ */
+ public function startComponent($name, array $data = []): void
+ {
+ if (\ob_start()) {
+ $this->componentStack[] = $name;
+
+ $this->componentData[$this->currentComponent()] = $data;
+
+ $this->slots[$this->currentComponent()] = [];
+ }
+ }
+
+ /**
+ * Get the index for the current component.
+ *
+ * @return int
+ */
+ protected function currentComponent(): int
+ {
+ return \count($this->componentStack) - 1;
+ }
+
+ /**
+ * Render the current component.
+ *
+ * @return string
+ * @throws Exception
+ */
+ public function renderComponent(): string
+ {
+ //echo "render
"; + $name = \array_pop($this->componentStack); + //return $this->runChild($name, $this->componentData()); + $cd = $this->componentData(); + $clean = array_keys($cd); + $r = $this->runChild($name, $cd); + // we clean variables defined inside the component (so they are garbaged when the component is used) + foreach ($clean as $key) { + unset($this->variables[$key]); + } + return $r; + } + + /** + * Get the data for the given component. + * + * @return array + */ + protected function componentData(): array + { + $cs = count($this->componentStack); + //echo "
"; + //echo "
data:
"; + //var_dump($this->componentData); + //echo "
datac:
"; + //var_dump(count($this->componentStack)); + return array_merge( + $this->componentData[$cs], + ['slot' => trim(ob_get_clean())], + $this->slots[$cs] + ); + } + + /** + * Start the slot rendering process. + * + * @param string $name + * @param string|null $content + * @return void + */ + public function slot($name, $content = null): void + { + if (\count(\func_get_args()) === 2) { + $this->slots[$this->currentComponent()][$name] = $content; + } elseif (\ob_start()) { + $this->slots[$this->currentComponent()][$name] = ''; + + $this->slotStack[$this->currentComponent()][] = $name; + } + } + + /** + * Save the slot content for rendering. + * + * @return void + */ + public function endSlot(): void + { + static::last($this->componentStack); + + $currentSlot = \array_pop( + $this->slotStack[$this->currentComponent()] + ); + + $this->slots[$this->currentComponent()][$currentSlot] = \trim(\ob_get_clean()); + } + + /** + * @return string + */ + public function getPhpTag(): string + { + return $this->phpTag; + } + + /** + * @param string $phpTag + */ + public function setPhpTag($phpTag): void + { + $this->phpTag = $phpTag; + } + + /** + * @return string + */ + public function getCurrentUser(): string + { + return $this->currentUser; + } + + /** + * @param string $currentUser + */ + public function setCurrentUser($currentUser): void + { + $this->currentUser = $currentUser; + } + + /** + * @return string + */ + public function getCurrentRole(): string + { + return $this->currentRole; + } + + /** + * @param string $currentRole + */ + public function setCurrentRole($currentRole): void + { + $this->currentRole = $currentRole; + } + + /** + * @return string[] + */ + public function getCurrentPermission(): array + { + return $this->currentPermission; + } + + /** + * @param string[] $currentPermission + */ + public function setCurrentPermission($currentPermission): void + { + $this->currentPermission = $currentPermission; + } + + /** + * Returns the current base url without trailing slash. + * + * @return string + */ + public function getBaseUrl(): string + { + return $this->baseUrl; + } + + /** + * It sets the base url and, it also calculates the relative path.
+ * The base url defines the "root" of the project, not always the level of the domain, but it could be + * any folder.
+ * This value is used to calculate the relativity of the resources, but it is also used to set the domain.
+ * Note: The trailing slash is removed automatically if it's present.
+ * Note: We should not use arguments or name of the script.
+ * Examples:
+ *
+ * $this->setBaseUrl('http://domain.dom/myblog');
+ * $this->setBaseUrl('http://domain.dom/corporate/erp');
+ * $this->setBaseUrl('http://domain.dom/blog.php?args=20'); // avoid this one.
+ * $this->setBaseUrl('http://another.dom');
+ *
+ *
+ * @param string $baseUrl Example http://www.web.com/folder https://www.web.com/folder/anotherfolder
+ * @return BladeOne
+ */
+ public function setBaseUrl($baseUrl): BladeOne
+ {
+ $this->baseUrl = \rtrim($baseUrl, '/'); // base with the url trimmed
+ $this->baseDomain = @parse_url($this->baseUrl)['host'];
+ $currentUrl = $this->getCurrentUrlCalculated();
+ if ($currentUrl === '') {
+ $this->relativePath = '';
+ return $this;
+ }
+ if (\strpos($currentUrl, $this->baseUrl) === 0) {
+ $part = \str_replace($this->baseUrl, '', $currentUrl);
+ $numf = \substr_count($part, '/') - 1;
+ $numf = ($numf > 10) ? 10 : $numf; // avoid overflow
+ $this->relativePath = ($numf < 0) ? '' : \str_repeat('../', $numf);
+ } else {
+ $this->relativePath = '';
+ }
+ return $this;
+ }
+
+ /**
+ * It gets the full current url calculated with the information sends by the user.+ * Note: If we set baseurl, then it always uses the baseurl as domain (it's safe).
+ * Note: This information could be forged/faked by the end-user.
+ * Note: It returns empty '' if it is called in a command line interface / non-web.
+ * Note: It doesn't return the user and password.
+ * @param bool $noArgs if true then it excludes the arguments. + * @return string + */ + public function getCurrentUrlCalculated($noArgs = false): string + { + if (!isset($_SERVER['HTTP_HOST'], $_SERVER['REQUEST_URI'])) { + return ''; + } + $host = $this->baseDomain ?? $_SERVER['HTTP_HOST']; // <-- it could be forged! + $link = (isset($_SERVER['HTTPS']) && $_SERVER['HTTPS'] === 'on' ? 'https' : 'http'); + $port = $_SERVER['SERVER_PORT']; + $port2 = (($link === 'http' && $port === '80') || ($link === 'https' && $port === '443')) ? '' : ':' . $port; + $link .= "://$host$port2$_SERVER[REQUEST_URI]"; + if ($noArgs) { + $link = @explode('?', $link)[0]; + } + return $link; + } + + /** + * It returns the relative path to the base url or empty if not set
+ * Example:
+ *
+ * // current url='http://domain.dom/page/subpage/web.php?aaa=2
+ * $this->setBaseUrl('http://domain.dom/');
+ * $this->getRelativePath(); // '../../'
+ * $this->setBaseUrl('http://domain.dom/');
+ * $this->getRelativePath(); // '../../'
+ *
+ * Note:The relative path is calculated when we set the base url.
+ *
+ * @return string
+ * @see BladeOne::setBaseUrl
+ */
+ public function getRelativePath(): string
+ {
+ return $this->relativePath;
+ }
+
+ /**
+ * It gets the full current canonical url.+ * Example: https://www.mysite.com/aaa/bb/php.php?aa=bb + *
-
+ *
- It returns the $this->canonicalUrl value if is not null + *
- Otherwise, it returns the $this->currentUrl if not null + *
- Otherwise, the url is calculated with the information sends by the user + *
+ * Example: https://www.mysite.com/aaa/bb/php.php?aa=bb + * + * @param string|null $canonUrl + * @return BladeOne + */ + public function setCanonicalUrl($canonUrl = null): BladeOne + { + $this->canonicalUrl = $canonUrl; + return $this; + } + + /** + * It gets the full current url
+ * Example: https://www.mysite.com/aaa/bb/php.php?aa=bb + *
-
+ *
- It returns the $this->currentUrl if not null + *
- Otherwise, the url is calculated with the information sends by the user + *
+ * Example: https://www.mysite.com/aaa/bb/php.php?aa=bb + * Note: If the current url is not set, then the system could calculate the current url. + * + * @param string|null $currentUrl + * @return BladeOne + */ + public function setCurrentUrl($currentUrl = null): BladeOne + { + $this->currentUrl = $currentUrl; + return $this; + } + + /** + * If true then it optimizes the result (it removes tab and extra spaces). + * + * @param bool $bool + * @return BladeOne + */ + public function setOptimize($bool = false): BladeOne + { + $this->optimize = $bool; + return $this; + } + + /** + * It sets the callback function for authentication. It is used by @can and @cannot + * + * @param callable $fn + */ + public function setCanFunction(callable $fn): void + { + $this->authCallBack = $fn; + } + + /** + * It sets the callback function for authentication. It is used by @canany + * + * @param callable $fn + */ + public function setAnyFunction(callable $fn): void + { + $this->authAnyCallBack = $fn; + } + + /** + * It sets the callback function for errors. It is used by @error + * + * @param callable $fn + */ + public function setErrorFunction(callable $fn): void + { + $this->errorCallBack = $fn; + } + + //
+ * example:
+ *
+ * $this->addInsideQuote("'hello'"," world"); // 'hello world'
+ * $this->addInsideQuote("hello"," world"); // hello world
+ *
+ *
+ * @param $quoted
+ * @param $newFragment
+ * @return string
+ */
+ public function addInsideQuote($quoted, $newFragment): string
+ {
+ if ($this->isQuoted($quoted)) {
+ return substr($quoted, 0, -1) . $newFragment . substr($quoted, -1);
+ }
+ return $quoted . $newFragment;
+ }
+
+ /**
+ * Return true if the string is a php variable (it starts with $)
+ *
+ * @param string|null $text
+ * @return bool
+ */
+ public function isVariablePHP($text): bool
+ {
+ if (!$text || strlen($text) < 2) {
+ return false;
+ }
+ return $text[0] === '$';
+ }
+
+ /**
+ * It's the same as "@_e", however it parses the text (using sprintf).
+ * If the operation fails then, it returns the original expression without translation.
+ *
+ * @param $phrase
+ *
+ * @return string
+ */
+ public function _ef($phrase): string
+ {
+ $argv = \func_get_args();
+ $r = $this->_e($phrase);
+ $argv[0] = $r; // replace the first argument with the translation.
+ $result = @sprintf(...$argv);
+ return !$result ? $r : $result;
+ }
+
+ /**
+ * Tries to translate the word if it's in the array defined by BladeOneLang::$dictionary
+ * If the operation fails then, it returns the original expression without translation.
+ *
+ * @param $phrase
+ *
+ * @return string
+ */
+ public function _e($phrase): string
+ {
+ if ((!\array_key_exists($phrase, static::$dictionary))) {
+ $this->missingTranslation($phrase);
+ return $phrase;
+ }
+
+ return static::$dictionary[$phrase];
+ }
+
+ /**
+ * Log a missing translation into the file $this->missingLog.+ * If the file is not defined, then it doesn't write the log. + * + * @param string $txt Message to write on. + */ + protected function missingTranslation($txt): void + { + if (!$this->missingLog) { + return; // if there is not a file assigned then it skips saving. + } + $fz = @\filesize($this->missingLog); + if (\is_object($txt) || \is_array($txt)) { + $txt = \print_r($txt, true); + } + // Rewrite file if more than 100000 bytes + $mode = ($fz > 100000) ? 'w' : 'a'; + $fp = \fopen($this->missingLog, $mode); + \fwrite($fp, $txt . "\n"); + \fclose($fp); + } + + /** + * if num is more than one then it returns the phrase in plural, otherwise the phrase in singular. + * Note: the translation should be as follows: $msg['Person']='Person' $msg=['Person']['p']='People' + * + * @param string $phrase + * @param string $phrases + * @param int $num + * + * @return string + */ + public function _n($phrase, $phrases, $num = 0): string + { + if ((!\array_key_exists($phrase, static::$dictionary))) { + $this->missingTranslation($phrase); + return ($num <= 1) ? $phrase : $phrases; + } + + return ($num <= 1) ? $this->_e($phrase) : $this->_e($phrases); + } + + /** + * @param $expression + * @return string + * @see BladeOne::getCanonicalUrl + */ + public function compileCanonical($expression = null): string + { + return ''; + } + + /** + * @param $expression + * @return string + * @see BladeOne::getBaseUrl + */ + public function compileBase($expression = null): string + { + return '
'; var_dump$expression; echo '';?>"; + } + + /** + * Execute the case tag. + * + * @param $expression + * @return string + */ + protected function compileCase($expression): string + { + if ($this->firstCaseInSwitch) { + $this->firstCaseInSwitch = false; + return 'case ' . $expression . ': ?>'; + } + return $this->phpTag . "case $expression: ?>"; + } + + /** + * Compile the while statements into valid PHP. + * + * @param string $expression + * @return string + */ + protected function compileWhile($expression): string + { + return $this->phpTag . "while$expression: ?>"; + } + + /** + * default tag used for switch/case + * + * @return string + */ + protected function compileDefault(): string + { + if ($this->firstCaseInSwitch) { + return $this->showError('@default', '@switch without any @case', true); + } + return $this->phpTag . 'default: ?>'; + } + + protected function compileEndSwitch(): string + { + --$this->switchCount; + if ($this->switchCount < 0) { + return $this->showError('@endswitch', 'Missing @switch', true); + } + return $this->phpTag . '} // end switch ?>'; + } + + /** + * Compile while statements into valid PHP. + * + * @param string $expression + * @return string + */ + protected function compileInject($expression): string + { + $ex = $this->stripParentheses($expression); + $p0 = \strpos($ex, ','); + if (!$p0) { + $var = $this->stripQuotes($ex); + $namespace = ''; + } else { + $var = $this->stripQuotes(\substr($ex, 0, $p0)); + $namespace = $this->stripQuotes(\substr($ex, $p0 + 1)); + } + return $this->phpTag . "\$$var = \$this->injectClass('$namespace', '$var'); ?>"; + } + + /** + * Remove first and end quote from a quoted string of text + * + * @param mixed $text + * @return null|string|string[] + */ + public function stripQuotes($text) + { + if (!$text || strlen($text) < 2) { + return $text; + } + $text = trim($text); + $p0 = $text[0]; + $p1 = \substr($text, -1); + if ($p0 === $p1 && ($p0 === '"' || $p0 === "'")) { + return \substr($text, 1, -1); + } + return $text; + } + + /** + * Execute the user defined extensions. + * + * @param string $value + * @return string + */ + protected function compileExtensions($value): string + { + foreach ($this->extensions as $compiler) { + $value = $compiler($value, $this); + } + return $value; + } + + /** + * Compile Blade comments into valid PHP. + * + * @param string $value + * @return string + */ + protected function compileComments($value): string + { + $pattern = \sprintf('/%s--(.*?)--%s/s', $this->contentTags[0], $this->contentTags[1]); + return \preg_replace($pattern, $this->phpTag . '/*$1*/ ?>', $value); + } + + /** + * Compile Blade echos into valid PHP. + * + * @param string $value + * @return string + * @throws Exception + */ + protected function compileEchos($value): string + { + foreach ($this->getEchoMethods() as $method => $length) { + $value = $this->$method($value); + } + return $value; + } + + /** + * Get the echo methods in the proper order for compilation. + * + * @return array + */ + protected function getEchoMethods(): array + { + $methods = [ + 'compileRawEchos' => \strlen(\stripcslashes($this->rawTags[0])), + 'compileEscapedEchos' => \strlen(\stripcslashes($this->escapedTags[0])), + 'compileRegularEchos' => \strlen(\stripcslashes($this->contentTags[0])), + ]; + \uksort($methods, static function ($method1, $method2) use ($methods) { + // Ensure the longest tags are processed first + if ($methods[$method1] > $methods[$method2]) { + return -1; + } + if ($methods[$method1] < $methods[$method2]) { + return 1; + } + // Otherwise, give preference to raw tags (assuming they've overridden) + if ($method1 === 'compileRawEchos') { + return -1; + } + if ($method2 === 'compileRawEchos') { + return 1; + } + if ($method1 === 'compileEscapedEchos') { + return -1; + } + if ($method2 === 'compileEscapedEchos') { + return 1; + } + throw new BadMethodCallException("Method [$method1] not defined"); + }); + return $methods; + } + + /** + * Compile Blade statements that start with "@". + * + * @param string $value + * + * @return array|string|string[]|null + */ + protected function compileStatements($value) + { + /** + * @param array $match + * [0]=full expression with @ and parenthesis + * [1]=expression without @ and argument + * [2]=???? + * [3]=argument with parenthesis and without the first @ + * [4]=argument without parenthesis. + * + * @return mixed|string + */ + $callback = function ($match) { + if (static::contains($match[1], '@')) { + // @@escaped tag + $match[0] = isset($match[3]) ? $match[1] . $match[3] : $match[1]; + } else { + if (strpos($match[1], '::') !== false) { + // Someclass::method + return $this->compileStatementClass($match); + } + if (isset($this->customDirectivesRT[$match[1]])) { + if ($this->customDirectivesRT[$match[1]]) { + $match[0] = $this->compileStatementCustom($match); + } else { + $match[0] = \call_user_func( + $this->customDirectives[$match[1]], + $this->stripParentheses(static::get($match, 3)) + ); + } + } elseif (\method_exists($this, $method = 'compile' . \ucfirst($match[1]))) { + // it calls the function compile
+ * Example: "SomeClass::method()" -> "\namespace\SomeClass::method()"
+ * + * @param string $text + * + * @return string + * @see BladeOne + */ + protected function fixNamespaceClass($text): string + { + if (strpos($text, '::') === false) { + return $text; + } + $classPart = explode('::', $text, 2); + if (isset($this->aliasClasses[$classPart[0]])) { + $classPart[0] = $this->aliasClasses[$classPart[0]]; + } + return $classPart[0] . '::' . $classPart[1]; + } + + /** + * For compile custom directive at runtime. + * + * @param $match + * @return string + */ + protected function compileStatementCustom($match): string + { + $v = $this->stripParentheses(static::get($match, 3)); + $v = ($v == '') ? '' : ',' . $v; + return $this->phpTag . 'call_user_func($this->customDirectives[\'' . $match[1] . '\']' . $v . '); ?>'; + } + + /** + * Get an item from an array using "dot" notation. + * + * @param ArrayAccess|array $array + * @param string $key + * @param mixed $default + * @return mixed + */ + public static function get($array, $key, $default = null) + { + $accesible = \is_array($array) || $array instanceof ArrayAccess; + if (!$accesible) { + return static::value($default); + } + if (\is_null($key)) { + return $array; + } + if (static::exists($array, $key)) { + return $array[$key]; + } + foreach (\explode('.', $key) as $segment) { + if (static::exists($array, $segment)) { + $array = $array[$segment]; + } else { + return static::value($default); + } + } + return $array; + } + + /** + * Determine if the given key exists in the provided array. + * + * @param ArrayAccess|array $array + * @param string|int $key + * @return bool + */ + public static function exists($array, $key): bool + { + if ($array instanceof ArrayAccess) { + return $array->offsetExists($key); + } + return \array_key_exists($key, $array); + } + + /** + * This method removes the parenthesis of the expression and parse the arguments. + * @param string $expression + * @return array + */ + protected function getArgs($expression): array + { + return $this->parseArgs($this->stripParentheses($expression), ' '); + } + + /** + * It separates a string using a separator and an identifier
+ * It excludes quotes,double quotes and the "¬" symbol.
+ * Example
+ *
+ * $this->parseArgs('a=2,b='a,b,c',d'); // ['a'=>'2','b'=>'a,b,c','d'=>null]
+ * $this->parseArgs('a=2,b=c,d'); // ['a'=>'2','b'=>'c','d'=>null]
+ * $this->parseArgs('a=2 b=c',' '); // ['a'=>'2','b'=>'c']
+ * $this->parseArgs('a:2 b:c',' ',':'); // ['a'=>'2','b'=>'c']
+ *
+ * Note: parseArgs('a = 2 b = c',' '); with return 4 values instead of 2.
+ *
+ * @param string $text the text to separate
+ * @param string $separator the separator of arguments
+ * @param string $assigment the character used to assign a new value
+ * @param bool $emptyKey if the argument is without value, we return it as key (true) or value (false) ?
+ * @return array
+ */
+ public function parseArgs($text, $separator = ',', $assigment = '=', $emptyKey = true): array
+ {
+ if ($text === null || $text === '') {
+ return []; //nothing to convert.
+ }
+ $chars = $text; // str_split($text);
+ $parts = [];
+ $nextpart = '';
+ $strL = strlen($chars);
+ $stringArr = '"\'¬';
+ $parenthesis = '([{';
+ $parenthesisClose = ')]}';
+ $insidePar = false;
+ for ($i = 0; $i < $strL; $i++) {
+ $char = $chars[$i];
+ // we check if the character is a parenthesis.
+ $pp = strpos($parenthesis, $char);
+ if ($pp !== false) {
+ // is a parenthesis, so we mark as inside a parenthesis.
+ $insidePar = $parenthesisClose[$pp];
+ }
+ if ($char === $insidePar) {
+ // we close the parenthesis.
+ $insidePar = false;
+ }
+ if (strpos($stringArr, $char) !== false) { // if ($char === '"' || $char === "'" || $char === "¬") {
+ // we found a string initializer
+ $inext = strpos($text, $char, $i + 1);
+ $inext = $inext === false ? $strL : $inext;
+ $nextpart .= substr($text, $i, $inext - $i + 1);
+ $i = $inext;
+ } else {
+ $nextpart .= $char;
+ }
+ if ($char === $separator && !$insidePar) {
+ $parts[] = substr($nextpart, 0, -1);
+ $nextpart = '';
+ }
+ }
+ if ($nextpart !== '') {
+ $parts[] = $nextpart;
+ }
+ $result = [];
+ // duct taping for key= argument (it has a space). however, it doesn't work with key =argument
+ /*
+ foreach ($parts as $k=>$part) {
+ if(substr($part,-1)===$assigment && isset($parts[$k+1])) {
+ var_dump('ok');
+ $parts[$k].=$parts[$k+1];
+ unset($parts[$k+1]);
+ }
+ }
+ */
+ foreach ($parts as $part) {
+ $part = trim($part);
+ if ($part) {
+ $char = $part[0];
+ if (strpos($stringArr, $char) !== false) { // if ($char === '"' || $char === "'" || $char === "¬") {
+ if ($emptyKey) {
+ $result[$part] = null;
+ } else {
+ $result[] = $part;
+ }
+ } else {
+ $r = explode($assigment, $part, 2);
+ if (count($r) === 2) {
+ // key=value.
+ $result[trim($r[0])] = trim($r[1]);
+ } elseif ($emptyKey) {
+ $result[trim($r[0])] = null;
+ } else {
+ $result[] = trim($r[0]);
+ }
+ }
+ }
+ }
+ return $result;
+ }
+
+ public function parseArgsOld($text, $separator = ','): array
+ {
+ if ($text === null || $text === '') {
+ return []; //nothing to convert.
+ }
+ $chars = str_split($text);
+ $parts = [];
+ $nextpart = '';
+ $strL = count($chars);
+ /** @noinspection ForeachInvariantsInspection */
+ for ($i = 0; $i < $strL; $i++) {
+ $char = $chars[$i];
+ if ($char === '"' || $char === "'") {
+ $inext = strpos($text, $char, $i + 1);
+ $inext = $inext === false ? $strL : $inext;
+ $nextpart .= substr($text, $i, $inext - $i + 1);
+ $i = $inext;
+ } else {
+ $nextpart .= $char;
+ }
+ if ($char === $separator) {
+ $parts[] = substr($nextpart, 0, -1);
+ $nextpart = '';
+ }
+ }
+ if ($nextpart !== '') {
+ $parts[] = $nextpart;
+ }
+ $result = [];
+ foreach ($parts as $part) {
+ $r = explode('=', $part, 2);
+ $result[trim($r[0])] = count($r) === 2 ? trim($r[1]) : null;
+ }
+ return $result;
+ }
+
+ /**
+ * Compile the "raw" echo statements.
+ *
+ * @param string $value
+ * @return string
+ */
+ protected function compileRawEchos($value): string
+ {
+ $pattern = \sprintf('/(@)?%s\s*(.+?)\s*%s(\r?\n)?/s', $this->rawTags[0], $this->rawTags[1]);
+ $callback = function ($matches) {
+ $whitespace = empty($matches[3]) ? '' : $matches[3] . $matches[3];
+ return $matches[1] ? \substr(
+ $matches[0],
+ 1
+ ) : $this->phpTagEcho . $this->compileEchoDefaults($matches[2]) . '; ?>' . $whitespace;
+ };
+ return \preg_replace_callback($pattern, $callback, $value);
+ }
+
+ /**
+ * Compile the default values for the echo statement.
+ * Example:
+ * {{ $test or 'test2' }} compiles to {{ isset($test) ? $test : 'test2' }}
+ *
+ * @param string $value
+ * @return string
+ */
+ protected function compileEchoDefaults($value): string
+ {
+ // Source: https://www.php.net/manual/en/language.variables.basics.php
+ $patternPHPVariableName = '\$[a-zA-Z_\x80-\xff][a-zA-Z0-9_\x80-\xff]*';
+
+ $result = \preg_replace('/^(' . $patternPHPVariableName . ')\s+or\s+(.+?)$/s', 'isset($1) ? $1 : $2', $value);
+ if (!$this->pipeEnable) {
+ return $this->fixNamespaceClass($result);
+ }
+ return $this->pipeDream($this->fixNamespaceClass($result));
+ }
+
+ /**
+ * It converts a string separated by pipes | into a filtered expression.+ * If the method exists (as directive), then it is used
+ * If the method exists (in this class) then it is used
+ * Otherwise, it uses a global function.
+ * If you want to escape the "|", then you could use "/|"
+ * Note: It only works if $this->pipeEnable=true and by default it is false
+ * Example:
+ *
+ * $this->pipeDream('$name | strtolower | substr:0,4'); // strtolower(substr($name ,0,4)
+ * $this->pipeDream('$name| getMode') // $this->getMode($name)
+ *
+ *
+ * @param string $result
+ * @return string
+ * @\eftec\bladeone\BladeOne::$pipeEnable
+ */
+ protected function pipeDream($result): string
+ {
+ $array = preg_split('~\\\\.(*SKIP)(*FAIL)|\|~s', $result);
+ $c = count($array) - 1; // base zero.
+ if ($c === 0) {
+ return $result;
+ }
+ $prev = '';
+ for ($i = 1; $i <=$c; $i++) {
+ $r = @explode(':', $array[$i], 2);
+ $fnName = trim($r[0]);
+ $fnNameF = $fnName[0]; // first character
+ if ($fnNameF === '"' || $fnNameF === '\'' || $fnNameF === '$' || is_numeric($fnNameF)) {
+ $fnName = '!isset(' . $array[0] . ') ? ' . $fnName . ' : ';
+ } elseif (isset($this->customDirectives[$fnName])) {
+ $fnName = '$this->customDirectives[\'' . $fnName . '\']';
+ } elseif (method_exists($this, $fnName)) {
+ $fnName = '$this->' . $fnName;
+ }
+ $hasArgument=count($r) === 2;
+ if ($i === 1) {
+ $prev = $fnName . '(' . $array[0];
+ if ($hasArgument) {
+ $prev .= ',' . $r[1];
+ }
+ $prev .= ')';
+ } else {
+ $prev = $fnName . '(' . $prev;
+ if ($hasArgument) {
+ $prev .=','. $r[1] . ')';
+ } else {
+ $prev.=')';
+ }
+ }
+ }
+
+ return $prev;
+ }
+
+ /**
+ * Compile the "regular" echo statements. {{ }}
+ *
+ * @param string $value
+ * @return string
+ */
+ protected function compileRegularEchos($value): string
+ {
+ $pattern = \sprintf('/(@)?%s\s*(.+?)\s*%s(\r?\n)?/s', $this->contentTags[0], $this->contentTags[1]);
+ $callback = function ($matches) {
+ $whitespace = empty($matches[3]) ? '' : $matches[3] . $matches[3];
+ $wrapped = \sprintf($this->echoFormat, $this->compileEchoDefaults($matches[2]));
+ return $matches[1] ? \substr($matches[0], 1) : $this->phpTagEcho . $wrapped . '; ?>' . $whitespace;
+ };
+ return \preg_replace_callback($pattern, $callback, $value);
+ }
+
+ /**
+ * Compile the escaped echo statements. {!! !!}
+ *
+ * @param string $value
+ * @return string
+ */
+ protected function compileEscapedEchos($value): string
+ {
+ $pattern = \sprintf('/(@)?%s\s*(.+?)\s*%s(\r?\n)?/s', $this->escapedTags[0], $this->escapedTags[1]);
+ $callback = function ($matches) {
+ $whitespace = empty($matches[3]) ? '' : $matches[3] . $matches[3];
+
+ return $matches[1] ? $matches[0] : $this->phpTag
+ . \sprintf($this->echoFormat, $this->compileEchoDefaults($matches[2])) . '; ?>'
+ . $whitespace;
+ //return $matches[1] ? $matches[0] : $this->phpTag
+ // . 'echo static::e(' . $this->compileEchoDefaults($matches[2]) . '); ? >' . $whitespace;
+ };
+ return \preg_replace_callback($pattern, $callback, $value);
+ }
+
+ /**
+ * Compile the "@each" tag into valid PHP.
+ *
+ * @param string $expression
+ * @return string
+ */
+ protected function compileEach($expression): string
+ {
+ return $this->phpTagEcho . "\$this->renderEach$expression; ?>";
+ }
+
+ protected function compileSet($expression): string
+ {
+ //$segments = \explode('=', \preg_replace("/[()\\\']/", '', $expression));
+ $segments = \explode('=', $this->stripParentheses($expression));
+ $value = (\count($segments) >= 2) ? '=@' . implode('=', array_slice($segments, 1)) : '++';
+ return $this->phpTag . \trim($segments[0]) . $value . ';?>';
+ }
+
+ /**
+ * Compile the yield statements into valid PHP.
+ *
+ * @param string $expression
+ * @return string
+ */
+ protected function compileYield($expression): string
+ {
+ return $this->phpTagEcho . "\$this->yieldContent$expression; ?>";
+ }
+
+ /**
+ * Compile the show statements into valid PHP.
+ *
+ * @return string
+ */
+ protected function compileShow(): string
+ {
+ return $this->phpTagEcho . '$this->yieldSection(); ?>';
+ }
+
+ /**
+ * Compile the section statements into valid PHP.
+ *
+ * @param string $expression
+ * @return string
+ */
+ protected function compileSection($expression): string
+ {
+ return $this->phpTag . "\$this->startSection$expression; ?>";
+ }
+
+ /**
+ * Compile the append statements into valid PHP.
+ *
+ * @return string
+ */
+ protected function compileAppend(): string
+ {
+ return $this->phpTag . '$this->appendSection(); ?>';
+ }
+
+ /**
+ * Compile the auth statements into valid PHP.
+ *
+ * @param string $expression
+ * @return string
+ */
+ protected function compileAuth($expression = ''): string
+ {
+ $role = $this->stripParentheses($expression);
+ if ($role == '') {
+ return $this->phpTag . 'if(isset($this->currentUser)): ?>';
+ }
+
+ return $this->phpTag . "if(isset(\$this->currentUser) && \$this->currentRole==$role): ?>";
+ }
+
+ /**
+ * Compile the elseauth statements into valid PHP.
+ *
+ * @param string $expression
+ * @return string
+ */
+ protected function compileElseAuth($expression = ''): string
+ {
+ $role = $this->stripParentheses($expression);
+ if ($role == '') {
+ return $this->phpTag . 'else: ?>';
+ }
+
+ return $this->phpTag . "elseif(isset(\$this->currentUser) && \$this->currentRole==$role): ?>";
+ }
+
+ /**
+ * Compile the end-auth statements into valid PHP.
+ *
+ * @return string
+ */
+ protected function compileEndAuth(): string
+ {
+ return $this->phpTag . 'endif; ?>';
+ }
+
+ protected function compileCan($expression): string
+ {
+ $v = $this->stripParentheses($expression);
+ return $this->phpTag . 'if (call_user_func($this->authCallBack,' . $v . ')): ?>';
+ }
+
+ /**
+ * Compile the else statements into valid PHP.
+ *
+ * @param string $expression
+ * @return string
+ */
+ protected function compileElseCan($expression = ''): string
+ {
+ $v = $this->stripParentheses($expression);
+ if ($v) {
+ return $this->phpTag . 'elseif (call_user_func($this->authCallBack,' . $v . ')): ?>';
+ }
+
+ return $this->phpTag . 'else: ?>';
+ }
+ //+ * It uses more disk space, but it decreases the number of includes
+ * + * @param $expression + * @return string + * @throws Exception + */ + protected function compileIncludeFast($expression): string + { + $expression = $this->stripParentheses($expression); + $ex = $this->stripParentheses($expression); + $exp = \explode(',', $ex); + $file = $this->stripQuotes($exp[0] ?? null); + $fileC = $this->getCompiledFile($file); + if (!@\is_file($fileC)) { + // if the file doesn't exist then it's created + $this->compile($file, true); + } + return $this->getFile($fileC); + } + + /** + * Compile the include statements into valid PHP. + * + * @param string $expression + * @return string + */ + protected function compileIncludeIf($expression): string + { + return $this->phpTag . 'if ($this->templateExist' . $expression . ') echo $this->runChild' . $expression . '; ?>'; + } + + /** + * Compile the include statements into valid PHP. + * + * @param string $expression + * @return string + */ + protected function compileIncludeWhen($expression): string + { + $expression = $this->stripParentheses($expression); + return $this->phpTagEcho . '$this->includeWhen(' . $expression . '); ?>'; + } + + /** + * Compile the includefirst statement + * + * @param string $expression + * @return string + */ + protected function compileIncludeFirst($expression): string + { + $expression = $this->stripParentheses($expression); + return $this->phpTagEcho . '$this->includeFirst(' . $expression . '); ?>'; + } + + /** + * Compile the {@}compilestamp statement. + * + * @param string $expression + * + * @return false|string + */ + protected function compileCompileStamp($expression) + { + $expression = $this->stripQuotes($this->stripParentheses($expression)); + $expression = ($expression === '') ? 'Y-m-d H:i:s' : $expression; + return date($expression); + } + + /** + * compile the {@}viewname statement
+ * {@}viewname('compiled') returns the full compiled path + * {@}viewname('template') returns the full template path + * {@}viewname('') returns the view name. + * + * @param mixed $expression + * + * @return string + */ + protected function compileViewName($expression): string + { + $expression = $this->stripQuotes($this->stripParentheses($expression)); + switch ($expression) { + case 'compiled': + return $this->getCompiledFile($this->fileName); + case 'template': + return $this->getTemplateFile($this->fileName); + default: + return $this->fileName; + } + } + + /** + * Compile the stack statements into the content. + * + * @param string $expression + * @return string + * @see BladeOne::yieldPushContent + */ + protected function compileStack($expression): string + { + return $this->phpTagEcho . "\$this->yieldPushContent$expression; ?>"; + } + + /** + * Compile the endpush statements into valid PHP. + * + * @return string + */ + protected function compileEndpush(): string + { + return $this->phpTag . '$this->stopPush(); ?>'; + } + + /** + * Compile the endpushonce statements into valid PHP. + * + * @return string + */ + protected function compileEndpushOnce(): string + { + return $this->phpTag . '$this->stopPush(); endif; ?>'; + } + + /** + * Compile the endpush statements into valid PHP. + * + * @return string + */ + protected function compileEndPrepend(): string + { + return $this->phpTag . '$this->stopPrepend(); ?>'; + } + + /** + * Compile the component statements into valid PHP. + * + * @param string $expression + * @return string + */ + protected function compileComponent($expression): string + { + return $this->phpTag . " \$this->startComponent$expression; ?>"; + } + + /** + * Compile the end-component statements into valid PHP. + * + * @return string + */ + protected function compileEndComponent(): string + { + return $this->phpTagEcho . '$this->renderComponent(); ?>'; + } + + /** + * Compile the slot statements into valid PHP. + * + * @param string $expression + * @return string + */ + protected function compileSlot($expression): string + { + return $this->phpTag . " \$this->slot$expression; ?>"; + } + + /** + * Compile the end-slot statements into valid PHP. + * + * @return string + */ + protected function compileEndSlot(): string + { + return $this->phpTag . ' $this->endSlot(); ?>'; + } + + protected function compileAsset($expression): string + { + return $this->phpTagEcho . "(isset(\$this->assetDict[$expression]))?\$this->assetDict[$expression]:\$this->baseUrl.'/'.$expression; ?>"; + } + + protected function compileJSon($expression): string + { + $parts = \explode(',', $this->stripParentheses($expression)); + $options = isset($parts[1]) ? \trim($parts[1]) : JSON_HEX_TAG | JSON_HEX_APOS | JSON_HEX_AMP | JSON_HEX_QUOT; + $depth = isset($parts[2]) ? \trim($parts[2]) : 512; + return $this->phpTagEcho . "json_encode($parts[0], $options, $depth); ?>"; + } + //
+ * if ($blade->cacheExpired('hellocache',1,5)) { //'helloonecache' =template, =1 id cache, 5=duration (seconds)
+ * // cache expired, so we should do some stuff (such as read from the database)
+ * }
+ *
+ *
+ * @package BladeOneCache
+ * @version 3.42 2020-04-25
+ * @link https://github.com/EFTEC/BladeOne
+ * @author Jorge Patricio Castro Castillo + * The cache log stores each time a template is creates or expired.
+ * + * @param string $file + */ + public function setCacheLog($file): void + { + $this->cacheLog=$file; + } + + public function writeCacheLog($txt, $nivel): void + { + if (!$this->cacheLog) { + return; // if there is not a file assigned then it skips saving. + } + $fz = @filesize($this->cacheLog); + if (is_object($txt) || is_array($txt)) { + $txt = print_r($txt, true); + } + // Rewrite file if more than 100000 bytes + $mode=($fz > 100000) ? 'w':'a'; + $fp = fopen($this->cacheLog, $mode); + if ($fp === false) { + return; + } + switch ($nivel) { + case 1: + $txtNivel='expired'; + break; + case 2: + $txtNivel='new'; + break; + default: + $txtNivel='other'; + } + $txtarg=json_encode($this->cacheUniqueGUID(false)); + fwrite($fp, date('c') . "\t$txt\t$txtNivel\t$txtarg\n"); + fclose($fp); + } + + /** + * It sets the strategy of the cache page. + * + * @param null|string $cacheStrategy =['get','post','getpost','request',null][$i] + * @param array|null $index if null then it reads all indexes. If not, it reads an indexes. + */ + public function setCacheStrategy($cacheStrategy, $index = null): void + { + $this->cacheStrategy = $cacheStrategy; + $this->cacheStrategyIndex = $index; + } + + /** + * It obtains a unique GUID based in:
+ * get= parameters from the url
+ * post= parameters sends via post
+ * getpost = a mix between get and post
+ * request = get, post and cookies (including sessions)
+ * MD5 could generate colisions (2^64 = 18,446,744,073,709,551,616) but the end hash is the sum of the hash of + * the page + this GUID. + * + * @param bool $serialize if true then it serializes using md5 + * @return string|null + */ + private function cacheUniqueGUID($serialize = true): ?string + { + switch ($this->cacheStrategy) { + case 'get': + $r = $_GET; + break; + case 'post': + $r = $_POST; + break; + case 'getpost': + $arr = array_merge($_GET, $_POST); + $r = $arr; + break; + case 'request': + $r = $_REQUEST; + break; + default: + $r = null; + } + if ($this->cacheStrategyIndex === null || !is_array($r)) { + $r= serialize($r); + } else { + $copy=[]; + foreach ($r as $key => $item) { + if (in_array($key, $this->cacheStrategyIndex, true)) { + $copy[$key]=$item; + } + } + $r=serialize($copy); + } + return $serialize===true ? md5($r): $r; + } + + public function compileCache($expression): string + { + // get id of template + // if the file exists then + // compare date. + // if the date is too old then re-save. + // else + // save for the first time. + + return $this->phpTag . "echo \$this->cacheStart$expression; if(!\$this->cacheRunning) { ?>"; + } + + public function compileEndCache($expression): string + { + return $this->phpTag . "} // if cacheRunning\necho \$this->cacheEnd$expression; ?>"; + } + + /** + * It gets the filename of the compiled file (cached). If cache is not enabled, then it + * returns the regular file. + * + * @param string $view + * @return string The full filename + */ + private function getCompiledFileCache($view): string + { + $id = $this->cacheUniqueGUID(); + if ($id !== null) { + return str_replace($this->compileExtension, '_cache' . $id + . $this->compileExtension, $this->getCompiledFile($view)); + } + return $this->getCompiledFile($view); + } + + /** + * run the blade engine. It returns the result of the code. + * + * @param string $view The name of the cache. Ex: "folder.folder.view" ("/folder/folder/view.blade") + * @param array $variables An associative arrays with the values to display. + * @param int $ttl time to live (in second). + * @return string + * @throws Exception + */ + public function runCache($view, $variables = [], $ttl = 86400): string + { + $this->cachePageRunning = true; + $cacheStatus=$this->cachePageExpired($view, $ttl); + if ($cacheStatus!==0) { + $this->writeCacheLog($view, $cacheStatus); + $this->cacheStart('_page_', $ttl); + $content = $this->run($view, $variables); // if no cache, then it runs normally. + $this->fileName = $view; // sometimes the filename is replaced (@include), so we restore it + $this->cacheEnd($content); // and it stores as a cache paged. + } else { + $content = $this->getFile($this->getCompiledFileCache($view)); + } + $this->cachePageRunning = false; + return $content; + } + + /** + * Returns true if the block cache expired (or doesn't exist), otherwise false. + * + * @param string $templateName name of the template to use (such hello for template hello.blade.php) + * @param string $id (id of cache, optional, if not id then it adds automatically a number) + * @param int $cacheDuration (duration of the cache in seconds) + * @return int 0=cache exists, 1= cache expired, 2=not exists, string= the cache file (if any) + */ + public function cacheExpired($templateName, $id, $cacheDuration): int + { + if ($this->getMode() & 1) { + return 2; // forced mode, hence it always expires. (fast mode is ignored). + } + $compiledFile = $this->getCompiledFile($templateName) . '_cache' . $id; + return $this->cacheExpiredInt($compiledFile, $cacheDuration); + } + + /** + * It returns true if the whole page expired. + * + * @param string $templateName + * @param int $cacheDuration is seconds. + * @return int 0=cache exists, 1= cache expired, 2=not exists, string= the cache content (if any) + */ + public function cachePageExpired($templateName, $cacheDuration): int + { + if ($this->getMode() & 1) { + return 2; // forced mode, hence it always expires. (fast mode is ignored). + } + $compiledFile = $this->getCompiledFileCache($templateName); + return $this->CacheExpiredInt($compiledFile, $cacheDuration); + } + + /** + * This method is used by cacheExpired() and cachePageExpired() + * + * @param string $compiledFile + * @param int $cacheDuration is seconds. + * @return int|mixed 0=cache exists, 1= cache expired, 2=not exists, string= the cache content (if any) + */ + private function cacheExpiredInt($compiledFile, $cacheDuration) + { + if (isset($this->cacheExpired[$compiledFile])) { + // if the information is already in the array then returns it. + return $this->cacheExpired[$compiledFile]; + } + $date = @filemtime($compiledFile); + if ($date) { + if ($date + $cacheDuration < time()) { + $this->cacheExpired[$compiledFile] = 1; + return 2; // time-out. + } + } else { + $this->cacheExpired[$compiledFile] = 2; + return 1; // no file + } + $this->cacheExpired[$compiledFile] = 0; + return 0; // cache active. + } + + public function cacheStart($id = '', $cacheDuration = 86400): void + { + $this->curCacheId = ($id == '') ? ($this->curCacheId + 1) : $id; + $this->curCacheDuration = $cacheDuration; + $this->curCachePosition = strlen(ob_get_contents()); + if ($this->cachePageRunning) { + $compiledFile = $this->getCompiledFileCache($this->fileName); + } else { + $compiledFile = $this->getCompiledFile() . '_cache' . $this->curCacheId; + } + + if ($this->cacheExpired('', $id, $cacheDuration) !==0) { + $this->cacheRunning = false; + } else { + $this->cacheRunning = true; + $content = $this->getFile($compiledFile); + echo $content; + } + } + + public function cacheEnd($txt = null): void + { + if (!$this->cacheRunning) { + $txt = $txt ?? substr(ob_get_contents(), $this->curCachePosition); + if ($this->cachePageRunning) { + $compiledFile = $this->getCompiledFileCache($this->fileName); + } else { + $compiledFile = $this->getCompiledFile() . '_cache' . $this->curCacheId; + } + file_put_contents($compiledFile, $txt); + } + $this->cacheRunning = false; + } +} diff --git a/M6/emensa/vendor/eftec/bladeone/lib/BladeOneCacheRedis.php b/M6/emensa/vendor/eftec/bladeone/lib/BladeOneCacheRedis.php new file mode 100644 index 0000000..42fe6db --- /dev/null +++ b/M6/emensa/vendor/eftec/bladeone/lib/BladeOneCacheRedis.php @@ -0,0 +1,160 @@ + + * @ cache([cacheid],[duration=86400]). The id is optional. The duration of the cache is in seconds + * // content here + * @ endcache() + * + * It also adds a new function (optional) to the business or logic layer + *
+ * if ($blade->cacheExpired('hellocache',1,5)) { //'helloonecache' =template, =1 id cache, 5=duration (seconds)
+ * // cache expired, so we should do some stuff (such as read from the database)
+ * }
+ *
+ *
+ * @package BladeOneCacheRedis
+ * @version 0.1 2017-12-15 NOT YET IMPLEMENTED, ITS A WIP!!!!!!!!
+ * @link https://github.com/EFTEC/BladeOne
+ * @author Jorge Patricio Castro Castillo $title
+";
+ }
+ //
+}
diff --git a/M6/emensa/vendor/eftec/bladeone/lib/bladeonecli b/M6/emensa/vendor/eftec/bladeone/lib/bladeonecli
new file mode 100644
index 0000000..bb45532
--- /dev/null
+++ b/M6/emensa/vendor/eftec/bladeone/lib/bladeonecli
@@ -0,0 +1,29 @@
+cliEngine();
+} else {
+ @http_response_code(404);
+}
+
diff --git a/M6/emensa/views/anmeldung/anmeldung.blade.php b/M6/emensa/views/anmeldung/anmeldung.blade.php
new file mode 100644
index 0000000..761eca9
--- /dev/null
+++ b/M6/emensa/views/anmeldung/anmeldung.blade.php
@@ -0,0 +1,31 @@
+@extends("layouts.main_layout", ['title' => "E-Mensa"])
+
+@section("header")
+
+@endsection
+
+@section("nav")
+
+ (c) E-Mensa GmbH
+ Şafak Hazinedar & Robert Joel
+ Impressum
+
+
+@endsection
\ No newline at end of file
diff --git a/M6/emensa/views/debug.blade.php b/M6/emensa/views/debug.blade.php
new file mode 100644
index 0000000..b6eab46
--- /dev/null
+++ b/M6/emensa/views/debug.blade.php
@@ -0,0 +1,6 @@
+Beispiel: Daten aus der Datenbank
+
+
+
+
+@if (isset($data['error']))
+
+
+@endif
+
+
\ No newline at end of file
diff --git a/M6/emensa/views/demo/demo.blade.php b/M6/emensa/views/demo/demo.blade.php
new file mode 100644
index 0000000..cb2c5fd
--- /dev/null
+++ b/M6/emensa/views/demo/demo.blade.php
@@ -0,0 +1,92 @@
+@extends(".layouts.layout")
+
+@section("content")
+ 7a
+
+
+
+Der Wert von name lautet: {{$request}}
+
+
+
+
\ No newline at end of file
diff --git a/M6/emensa/views/examples/m4_7b_kategorie.blade.php b/M6/emensa/views/examples/m4_7b_kategorie.blade.php
new file mode 100644
index 0000000..1d4946d
--- /dev/null
+++ b/M6/emensa/views/examples/m4_7b_kategorie.blade.php
@@ -0,0 +1,41 @@
+
+
+
+
+ Beispiel: Daten aus der Datenbank
+
+
+
+
+
+@if (isset($data['error']))
+
+
+@endif
+
+
+
\ No newline at end of file
diff --git a/M6/emensa/views/examples/m4_7c_gerichte.blade.php b/M6/emensa/views/examples/m4_7c_gerichte.blade.php
new file mode 100644
index 0000000..2f9c073
--- /dev/null
+++ b/M6/emensa/views/examples/m4_7c_gerichte.blade.php
@@ -0,0 +1,34 @@
+
+
+
+
+ Beispiel: Daten aus der Datenbank
+
+
+
+
+@if (isset($data['error']))
+
+
+@endif
+
+
+
\ No newline at end of file
diff --git a/M6/emensa/views/examples/pages/m4_7d_page_1.blade.php b/M6/emensa/views/examples/pages/m4_7d_page_1.blade.php
new file mode 100644
index 0000000..75af2b7
--- /dev/null
+++ b/M6/emensa/views/examples/pages/m4_7d_page_1.blade.php
@@ -0,0 +1,13 @@
+@extends(".layouts.m4_7d_layout",['title' => "Page 1"])
+
+@section("header")
+
+@endsection
+
+@section("body")
+
+
+
+
+
+@endsection
+
+@section("cssextra")
+
+@endsection
+
+@section("jsextra")
+
+@endsection
\ No newline at end of file
diff --git a/M6/emensa/views/layouts/layout.blade.php b/M6/emensa/views/layouts/layout.blade.php
new file mode 100644
index 0000000..fa03e70
--- /dev/null
+++ b/M6/emensa/views/layouts/layout.blade.php
@@ -0,0 +1,23 @@
+
+
+
+
+ E-Mensa Routing Script
+
+
+
+ @yield("cssextra")
+
+
+
+
+{{ $title }}
+
+ @yield("header")
+
+
+
+
+ @yield("body")
+
+
+
+
\ No newline at end of file
diff --git a/M6/emensa/views/layouts/main_layout.blade.php b/M6/emensa/views/layouts/main_layout.blade.php
new file mode 100644
index 0000000..aba28e5
--- /dev/null
+++ b/M6/emensa/views/layouts/main_layout.blade.php
@@ -0,0 +1,30 @@
+
+
+
+
+
+ {{ $title }}
+
+ @yield("header")
+
+
+
+
+@yield("nav")
+
+
+
+ Bitte warten! + +@endsection \ No newline at end of file diff --git a/M6/emensa/views/m5_a1/layout_anmeldung.blade.php b/M6/emensa/views/m5_a1/layout_anmeldung.blade.php new file mode 100644 index 0000000..c230204 --- /dev/null +++ b/M6/emensa/views/m5_a1/layout_anmeldung.blade.php @@ -0,0 +1,21 @@ + + + + +Layout-m5-a1
+
+
+
+ @yield("header")
+
+
+
+ @yield("main")
+
+
+
+
+
+
\ No newline at end of file
diff --git a/M6/emensa/views/main/index.blade.php b/M6/emensa/views/main/index.blade.php
new file mode 100644
index 0000000..60c90b2
--- /dev/null
+++ b/M6/emensa/views/main/index.blade.php
@@ -0,0 +1,111 @@
+@extends("layouts.main_layout", ['title' => "E-Mensa"])
+
+@section("header")
+
+@endsection
+
+@section("nav")
+
+ Gerichte Preis intern Preis extern Bild ";
+
+
+
+ while ($row_gerichte = mysqli_fetch_assoc($result_sql_gerichte)) {
+
+ $preisintern = number_format($row_gerichte['preisintern'], 2, ',', '.');
+ $preisextern = number_format($row_gerichte['preisextern'], 2, ',', '.');
+
+ $bildname = $row_gerichte['bildname'];
+
+ if ($bildname == Null) {
+ $bildname = "00_image_missing.jpg";
+ }
+
+ $bildname = "/img/gerichte/" . $bildname;
+
+ $tabelle .= "" . htmlspecialchars($row_gerichte['name']) . " " . htmlspecialchars($allergene) . " " . htmlspecialchars($preisintern) . "€ " . htmlspecialchars($preisextern) . "€
+ (c) E-Mensa GmbH
+ Şafak Hazinedar & Robert Joel
+ Impressum
+
+
+@endsection
\ No newline at end of file
diff --git a/M6/emensa/views/notimplemented.blade.php b/M6/emensa/views/notimplemented.blade.php
new file mode 100644
index 0000000..0834730
--- /dev/null
+++ b/M6/emensa/views/notimplemented.blade.php
@@ -0,0 +1,7 @@
+@extends("layouts.layout")
+
+@section("content")
+>
+ */
+ protected $middlewareGroups = [
+ 'web' => [
+ \App\Http\Middleware\EncryptCookies::class,
+ \Illuminate\Cookie\Middleware\AddQueuedCookiesToResponse::class,
+ \Illuminate\Session\Middleware\StartSession::class,
+ \Illuminate\View\Middleware\ShareErrorsFromSession::class,
+ \App\Http\Middleware\VerifyCsrfToken::class,
+ \Illuminate\Routing\Middleware\SubstituteBindings::class,
+ ],
+
+ 'api' => [
+ // \Laravel\Sanctum\Http\Middleware\EnsureFrontendRequestsAreStateful::class,
+ \Illuminate\Routing\Middleware\ThrottleRequests::class.':api',
+ \Illuminate\Routing\Middleware\SubstituteBindings::class,
+ ],
+ ];
+
+ /**
+ * The application's middleware aliases.
+ *
+ * Aliases may be used instead of class names to conveniently assign middleware to routes and groups.
+ *
+ * @var array
+ */
+ protected $middlewareAliases = [
+ 'auth' => \App\Http\Middleware\Authenticate::class,
+ 'auth.basic' => \Illuminate\Auth\Middleware\AuthenticateWithBasicAuth::class,
+ 'auth.session' => \Illuminate\Session\Middleware\AuthenticateSession::class,
+ 'cache.headers' => \Illuminate\Http\Middleware\SetCacheHeaders::class,
+ 'can' => \Illuminate\Auth\Middleware\Authorize::class,
+ 'guest' => \App\Http\Middleware\RedirectIfAuthenticated::class,
+ 'password.confirm' => \Illuminate\Auth\Middleware\RequirePassword::class,
+ 'precognitive' => \Illuminate\Foundation\Http\Middleware\HandlePrecognitiveRequests::class,
+ 'signed' => \App\Http\Middleware\ValidateSignature::class,
+ 'throttle' => \Illuminate\Routing\Middleware\ThrottleRequests::class,
+ 'verified' => \Illuminate\Auth\Middleware\EnsureEmailIsVerified::class,
+ ];
+}
diff --git a/M6/emensamobile/app/Http/Middleware/Authenticate.php b/M6/emensamobile/app/Http/Middleware/Authenticate.php
new file mode 100644
index 0000000..d4ef644
--- /dev/null
+++ b/M6/emensamobile/app/Http/Middleware/Authenticate.php
@@ -0,0 +1,17 @@
+expectsJson() ? null : route('login');
+ }
+}
diff --git a/M6/emensamobile/app/Http/Middleware/EncryptCookies.php b/M6/emensamobile/app/Http/Middleware/EncryptCookies.php
new file mode 100644
index 0000000..867695b
--- /dev/null
+++ b/M6/emensamobile/app/Http/Middleware/EncryptCookies.php
@@ -0,0 +1,17 @@
+
+ */
+ protected $except = [
+ //
+ ];
+}
diff --git a/M6/emensamobile/app/Http/Middleware/PreventRequestsDuringMaintenance.php b/M6/emensamobile/app/Http/Middleware/PreventRequestsDuringMaintenance.php
new file mode 100644
index 0000000..74cbd9a
--- /dev/null
+++ b/M6/emensamobile/app/Http/Middleware/PreventRequestsDuringMaintenance.php
@@ -0,0 +1,17 @@
+
+ */
+ protected $except = [
+ //
+ ];
+}
diff --git a/M6/emensamobile/app/Http/Middleware/RedirectIfAuthenticated.php b/M6/emensamobile/app/Http/Middleware/RedirectIfAuthenticated.php
new file mode 100644
index 0000000..afc78c4
--- /dev/null
+++ b/M6/emensamobile/app/Http/Middleware/RedirectIfAuthenticated.php
@@ -0,0 +1,30 @@
+check()) {
+ return redirect(RouteServiceProvider::HOME);
+ }
+ }
+
+ return $next($request);
+ }
+}
diff --git a/M6/emensamobile/app/Http/Middleware/TrimStrings.php b/M6/emensamobile/app/Http/Middleware/TrimStrings.php
new file mode 100644
index 0000000..88cadca
--- /dev/null
+++ b/M6/emensamobile/app/Http/Middleware/TrimStrings.php
@@ -0,0 +1,19 @@
+
+ */
+ protected $except = [
+ 'current_password',
+ 'password',
+ 'password_confirmation',
+ ];
+}
diff --git a/M6/emensamobile/app/Http/Middleware/TrustHosts.php b/M6/emensamobile/app/Http/Middleware/TrustHosts.php
new file mode 100644
index 0000000..c9c58bd
--- /dev/null
+++ b/M6/emensamobile/app/Http/Middleware/TrustHosts.php
@@ -0,0 +1,20 @@
+
+ */
+ public function hosts(): array
+ {
+ return [
+ $this->allSubdomainsOfApplicationUrl(),
+ ];
+ }
+}
diff --git a/M6/emensamobile/app/Http/Middleware/TrustProxies.php b/M6/emensamobile/app/Http/Middleware/TrustProxies.php
new file mode 100644
index 0000000..3391630
--- /dev/null
+++ b/M6/emensamobile/app/Http/Middleware/TrustProxies.php
@@ -0,0 +1,28 @@
+|string|null
+ */
+ protected $proxies;
+
+ /**
+ * The headers that should be used to detect proxies.
+ *
+ * @var int
+ */
+ protected $headers =
+ Request::HEADER_X_FORWARDED_FOR |
+ Request::HEADER_X_FORWARDED_HOST |
+ Request::HEADER_X_FORWARDED_PORT |
+ Request::HEADER_X_FORWARDED_PROTO |
+ Request::HEADER_X_FORWARDED_AWS_ELB;
+}
diff --git a/M6/emensamobile/app/Http/Middleware/ValidateSignature.php b/M6/emensamobile/app/Http/Middleware/ValidateSignature.php
new file mode 100644
index 0000000..093bf64
--- /dev/null
+++ b/M6/emensamobile/app/Http/Middleware/ValidateSignature.php
@@ -0,0 +1,22 @@
+
+ */
+ protected $except = [
+ // 'fbclid',
+ // 'utm_campaign',
+ // 'utm_content',
+ // 'utm_medium',
+ // 'utm_source',
+ // 'utm_term',
+ ];
+}
diff --git a/M6/emensamobile/app/Http/Middleware/VerifyCsrfToken.php b/M6/emensamobile/app/Http/Middleware/VerifyCsrfToken.php
new file mode 100644
index 0000000..9e86521
--- /dev/null
+++ b/M6/emensamobile/app/Http/Middleware/VerifyCsrfToken.php
@@ -0,0 +1,17 @@
+
+ */
+ protected $except = [
+ //
+ ];
+}
diff --git a/M6/emensamobile/app/Models/Gerichte.php b/M6/emensamobile/app/Models/Gerichte.php
new file mode 100644
index 0000000..7b95572
--- /dev/null
+++ b/M6/emensamobile/app/Models/Gerichte.php
@@ -0,0 +1,83 @@
+id;
+ $result_sql_gericht_hat_allergene = DB::select($sql_gericht_hat_allergene);
+ $allergene = "";
+ foreach ($result_sql_gericht_hat_allergene as $row_allergene) {
+ $allergene .= $row_allergene->code . ", ";
+
+ $drin = 0;
+ foreach ($verwendete_allergene_code as $verwendet){
+ if ($verwendet == $row_allergene->code){
+ $drin =1;
+ }
+ }
+
+ if ($drin == 0) {
+ $verwendete_allergene_code[] = $row_allergene->code;
+ }
+ }
+
+ }
+
+
+ $sql_allergen = "SELECT code, name FROM allergen";
+ $result_sql_allergen = DB::select($sql_allergen);
+
+
+
+ $data = [
+ "allergene" => $verwendete_allergene_string,
+ "result_sql_allergen" => $result_sql_allergen,
+ "verwendete_allergene_code" => $verwendete_allergene_code,
+ "result_sql_gerichte" => $result_sql_gerichte1,
+ "allergene1" => $allergene
+ ];
+
+
+ return $data;
+ } catch (Exception $ex) {
+ $data = array(
+ 'id' => '-1',
+ 'error' => true,
+ 'name' => 'Datenbankfehler ' . $ex->getCode(),
+ 'beschreibung' => $ex->getMessage());
+ return $data;
+ }
+
+ }
+
+}
diff --git a/M6/emensamobile/app/Models/User.php b/M6/emensamobile/app/Models/User.php
new file mode 100644
index 0000000..4d7f70f
--- /dev/null
+++ b/M6/emensamobile/app/Models/User.php
@@ -0,0 +1,45 @@
+
+ */
+ protected $fillable = [
+ 'name',
+ 'email',
+ 'password',
+ ];
+
+ /**
+ * The attributes that should be hidden for serialization.
+ *
+ * @var array
+ */
+ protected $hidden = [
+ 'password',
+ 'remember_token',
+ ];
+
+ /**
+ * The attributes that should be cast.
+ *
+ * @var array
+ */
+ protected $casts = [
+ 'email_verified_at' => 'datetime',
+ 'password' => 'hashed',
+ ];
+}
diff --git a/M6/emensamobile/app/Models/benutzer.php b/M6/emensamobile/app/Models/benutzer.php
new file mode 100644
index 0000000..c6ec062
--- /dev/null
+++ b/M6/emensamobile/app/Models/benutzer.php
@@ -0,0 +1,65 @@
+query($sql);
+ $row = $result->fetch_assoc();
+
+ if ($row['passwort'] == NULL) {
+ $row = 0;
+ } elseif ($row['passwort'] == $passwort) {
+ session_start();
+
+ mysqli_begin_transaction($link);
+ $sql = "UPDATE benutzer
+ SET letzteanmeldung = current_time, anzahlfehler = 0
+ WHERE email = '$email'";
+ $link->query($sql);
+
+
+ // $sql = "UPDATE benutzer SET anzahlanmeldungen = anzahlanmeldungen + 1 WHERE id = " . $row['id'];
+ $sql = "CALL incrementAnzahlAnmeldungen(" . ($row['id']) . ")";
+ $link->query($sql);
+
+ mysqli_commit($link);
+
+ $_SESSION['uid'] = session_id();
+ $_SESSION['login'] = 1;
+ $_SESSION['name'] = $row['name'];
+ $_SESSION['email'] = $row['email'];
+ return 1;
+ } else {
+
+ mysqli_begin_transaction($link);
+
+ $sql = "UPDATE benutzer
+ SET anzahlfehler = anzahlfehler+1, letzterfehler = current_time
+ WHERE email = '$email'";
+ $link->query($sql);
+
+ mysqli_commit($link);
+
+ }
+ return 0;
+ }
+}
diff --git a/M6/emensamobile/app/Providers/AppServiceProvider.php b/M6/emensamobile/app/Providers/AppServiceProvider.php
new file mode 100644
index 0000000..452e6b6
--- /dev/null
+++ b/M6/emensamobile/app/Providers/AppServiceProvider.php
@@ -0,0 +1,24 @@
+
+ */
+ protected $policies = [
+ //
+ ];
+
+ /**
+ * Register any authentication / authorization services.
+ */
+ public function boot(): void
+ {
+ //
+ }
+}
diff --git a/M6/emensamobile/app/Providers/BroadcastServiceProvider.php b/M6/emensamobile/app/Providers/BroadcastServiceProvider.php
new file mode 100644
index 0000000..2be04f5
--- /dev/null
+++ b/M6/emensamobile/app/Providers/BroadcastServiceProvider.php
@@ -0,0 +1,19 @@
+>
+ */
+ protected $listen = [
+ Registered::class => [
+ SendEmailVerificationNotification::class,
+ ],
+ ];
+
+ /**
+ * Register any events for your application.
+ */
+ public function boot(): void
+ {
+ //
+ }
+
+ /**
+ * Determine if events and listeners should be automatically discovered.
+ */
+ public function shouldDiscoverEvents(): bool
+ {
+ return false;
+ }
+}
diff --git a/M6/emensamobile/app/Providers/RouteServiceProvider.php b/M6/emensamobile/app/Providers/RouteServiceProvider.php
new file mode 100644
index 0000000..1cf5f15
--- /dev/null
+++ b/M6/emensamobile/app/Providers/RouteServiceProvider.php
@@ -0,0 +1,40 @@
+by($request->user()?->id ?: $request->ip());
+ });
+
+ $this->routes(function () {
+ Route::middleware('api')
+ ->prefix('api')
+ ->group(base_path('routes/api.php'));
+
+ Route::middleware('web')
+ ->group(base_path('routes/web.php'));
+ });
+ }
+}
diff --git a/M6/emensamobile/artisan b/M6/emensamobile/artisan
new file mode 100644
index 0000000..67a3329
--- /dev/null
+++ b/M6/emensamobile/artisan
@@ -0,0 +1,53 @@
+#!/usr/bin/env php
+make(Illuminate\Contracts\Console\Kernel::class);
+
+$status = $kernel->handle(
+ $input = new Symfony\Component\Console\Input\ArgvInput,
+ new Symfony\Component\Console\Output\ConsoleOutput
+);
+
+/*
+|--------------------------------------------------------------------------
+| Shutdown The Application
+|--------------------------------------------------------------------------
+|
+| Once Artisan has finished running, we will fire off the shutdown events
+| so that any final work may be done by the application before we shut
+| down the process. This is the last thing to happen to the request.
+|
+*/
+
+$kernel->terminate($input, $status);
+
+exit($status);
diff --git a/M6/emensamobile/bootstrap/app.php b/M6/emensamobile/bootstrap/app.php
new file mode 100644
index 0000000..037e17d
--- /dev/null
+++ b/M6/emensamobile/bootstrap/app.php
@@ -0,0 +1,55 @@
+singleton(
+ Illuminate\Contracts\Http\Kernel::class,
+ App\Http\Kernel::class
+);
+
+$app->singleton(
+ Illuminate\Contracts\Console\Kernel::class,
+ App\Console\Kernel::class
+);
+
+$app->singleton(
+ Illuminate\Contracts\Debug\ExceptionHandler::class,
+ App\Exceptions\Handler::class
+);
+
+/*
+|--------------------------------------------------------------------------
+| Return The Application
+|--------------------------------------------------------------------------
+|
+| This script returns the application instance. The instance is given to
+| the calling script so we can separate the building of the instances
+| from the actual running of the application and sending responses.
+|
+*/
+
+return $app;
diff --git a/M6/emensamobile/bootstrap/cache/.gitignore b/M6/emensamobile/bootstrap/cache/.gitignore
new file mode 100644
index 0000000..d6b7ef3
--- /dev/null
+++ b/M6/emensamobile/bootstrap/cache/.gitignore
@@ -0,0 +1,2 @@
+*
+!.gitignore
diff --git a/M6/emensamobile/composer.json b/M6/emensamobile/composer.json
new file mode 100644
index 0000000..3f91c54
--- /dev/null
+++ b/M6/emensamobile/composer.json
@@ -0,0 +1,69 @@
+{
+ "name": "laravel/laravel",
+ "type": "project",
+ "description": "The skeleton application for the Laravel framework.",
+ "keywords": ["laravel", "framework"],
+ "license": "MIT",
+ "require": {
+ "php": "^8.1",
+ "guzzlehttp/guzzle": "^7.2",
+ "laravel/framework": "^10.10",
+ "laravel/sanctum": "^3.3",
+ "laravel/tinker": "^2.8",
+ "ext-mysqli": "*",
+ "ext-pdo": "*"
+ },
+ "require-dev": {
+ "fakerphp/faker": "^1.9.1",
+ "laravel/pint": "^1.0",
+ "laravel/sail": "^1.18",
+ "mockery/mockery": "^1.4.4",
+ "nunomaduro/collision": "^7.0",
+ "phpunit/phpunit": "^10.1",
+ "spatie/laravel-ignition": "^2.0"
+
+ },
+ "autoload": {
+ "psr-4": {
+ "App\\": "app/",
+ "Database\\Factories\\": "database/factories/",
+ "Database\\Seeders\\": "database/seeders/"
+ }
+ },
+ "autoload-dev": {
+ "psr-4": {
+ "Tests\\": "tests/"
+ }
+ },
+ "scripts": {
+ "post-autoload-dump": [
+ "Illuminate\\Foundation\\ComposerScripts::postAutoloadDump",
+ "@php artisan package:discover --ansi"
+ ],
+ "post-update-cmd": [
+ "@php artisan vendor:publish --tag=laravel-assets --ansi --force"
+ ],
+ "post-root-package-install": [
+ "@php -r \"file_exists('.env') || copy('.env.example', '.env');\""
+ ],
+ "post-create-project-cmd": [
+ "@php artisan key:generate --ansi"
+ ]
+ },
+ "extra": {
+ "laravel": {
+ "dont-discover": []
+ }
+ },
+ "config": {
+ "optimize-autoloader": true,
+ "preferred-install": "dist",
+ "sort-packages": true,
+ "allow-plugins": {
+ "pestphp/pest-plugin": true,
+ "php-http/discovery": true
+ }
+ },
+ "minimum-stability": "stable",
+ "prefer-stable": true
+}
diff --git a/M6/emensamobile/composer.lock b/M6/emensamobile/composer.lock
new file mode 100644
index 0000000..356a703
--- /dev/null
+++ b/M6/emensamobile/composer.lock
@@ -0,0 +1,8156 @@
+{
+ "_readme": [
+ "This file locks the dependencies of your project to a known state",
+ "Read more about it at https://getcomposer.org/doc/01-basic-usage.md#installing-dependencies",
+ "This file is @generated automatically"
+ ],
+ "content-hash": "9c491b8531eec05ba41a11d9276a5749",
+ "packages": [
+ {
+ "name": "brick/math",
+ "version": "0.11.0",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/brick/math.git",
+ "reference": "0ad82ce168c82ba30d1c01ec86116ab52f589478"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/brick/math/zipball/0ad82ce168c82ba30d1c01ec86116ab52f589478",
+ "reference": "0ad82ce168c82ba30d1c01ec86116ab52f589478",
+ "shasum": ""
+ },
+ "require": {
+ "php": "^8.0"
+ },
+ "require-dev": {
+ "php-coveralls/php-coveralls": "^2.2",
+ "phpunit/phpunit": "^9.0",
+ "vimeo/psalm": "5.0.0"
+ },
+ "type": "library",
+ "autoload": {
+ "psr-4": {
+ "Brick\\Math\\": "src/"
+ }
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "description": "Arbitrary-precision arithmetic library",
+ "keywords": [
+ "Arbitrary-precision",
+ "BigInteger",
+ "BigRational",
+ "arithmetic",
+ "bigdecimal",
+ "bignum",
+ "brick",
+ "math"
+ ],
+ "support": {
+ "issues": "https://github.com/brick/math/issues",
+ "source": "https://github.com/brick/math/tree/0.11.0"
+ },
+ "funding": [
+ {
+ "url": "https://github.com/BenMorel",
+ "type": "github"
+ }
+ ],
+ "time": "2023-01-15T23:15:59+00:00"
+ },
+ {
+ "name": "carbonphp/carbon-doctrine-types",
+ "version": "2.1.0",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/CarbonPHP/carbon-doctrine-types.git",
+ "reference": "99f76ffa36cce3b70a4a6abce41dba15ca2e84cb"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/CarbonPHP/carbon-doctrine-types/zipball/99f76ffa36cce3b70a4a6abce41dba15ca2e84cb",
+ "reference": "99f76ffa36cce3b70a4a6abce41dba15ca2e84cb",
+ "shasum": ""
+ },
+ "require": {
+ "php": "^7.4 || ^8.0"
+ },
+ "conflict": {
+ "doctrine/dbal": "<3.7.0 || >=4.0.0"
+ },
+ "require-dev": {
+ "doctrine/dbal": "^3.7.0",
+ "nesbot/carbon": "^2.71.0 || ^3.0.0",
+ "phpunit/phpunit": "^10.3"
+ },
+ "type": "library",
+ "autoload": {
+ "psr-4": {
+ "Carbon\\Doctrine\\": "src/Carbon/Doctrine/"
+ }
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "authors": [
+ {
+ "name": "KyleKatarn",
+ "email": "kylekatarnls@gmail.com"
+ }
+ ],
+ "description": "Types to use Carbon in Doctrine",
+ "keywords": [
+ "carbon",
+ "date",
+ "datetime",
+ "doctrine",
+ "time"
+ ],
+ "support": {
+ "issues": "https://github.com/CarbonPHP/carbon-doctrine-types/issues",
+ "source": "https://github.com/CarbonPHP/carbon-doctrine-types/tree/2.1.0"
+ },
+ "funding": [
+ {
+ "url": "https://github.com/kylekatarnls",
+ "type": "github"
+ },
+ {
+ "url": "https://opencollective.com/Carbon",
+ "type": "open_collective"
+ },
+ {
+ "url": "https://tidelift.com/funding/github/packagist/nesbot/carbon",
+ "type": "tidelift"
+ }
+ ],
+ "time": "2023-12-11T17:09:12+00:00"
+ },
+ {
+ "name": "dflydev/dot-access-data",
+ "version": "v3.0.2",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/dflydev/dflydev-dot-access-data.git",
+ "reference": "f41715465d65213d644d3141a6a93081be5d3549"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/dflydev/dflydev-dot-access-data/zipball/f41715465d65213d644d3141a6a93081be5d3549",
+ "reference": "f41715465d65213d644d3141a6a93081be5d3549",
+ "shasum": ""
+ },
+ "require": {
+ "php": "^7.1 || ^8.0"
+ },
+ "require-dev": {
+ "phpstan/phpstan": "^0.12.42",
+ "phpunit/phpunit": "^7.5 || ^8.5 || ^9.3",
+ "scrutinizer/ocular": "1.6.0",
+ "squizlabs/php_codesniffer": "^3.5",
+ "vimeo/psalm": "^4.0.0"
+ },
+ "type": "library",
+ "extra": {
+ "branch-alias": {
+ "dev-main": "3.x-dev"
+ }
+ },
+ "autoload": {
+ "psr-4": {
+ "Dflydev\\DotAccessData\\": "src/"
+ }
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "authors": [
+ {
+ "name": "Dragonfly Development Inc.",
+ "email": "info@dflydev.com",
+ "homepage": "http://dflydev.com"
+ },
+ {
+ "name": "Beau Simensen",
+ "email": "beau@dflydev.com",
+ "homepage": "http://beausimensen.com"
+ },
+ {
+ "name": "Carlos Frutos",
+ "email": "carlos@kiwing.it",
+ "homepage": "https://github.com/cfrutos"
+ },
+ {
+ "name": "Colin O'Dell",
+ "email": "colinodell@gmail.com",
+ "homepage": "https://www.colinodell.com"
+ }
+ ],
+ "description": "Given a deep data structure, access data by dot notation.",
+ "homepage": "https://github.com/dflydev/dflydev-dot-access-data",
+ "keywords": [
+ "access",
+ "data",
+ "dot",
+ "notation"
+ ],
+ "support": {
+ "issues": "https://github.com/dflydev/dflydev-dot-access-data/issues",
+ "source": "https://github.com/dflydev/dflydev-dot-access-data/tree/v3.0.2"
+ },
+ "time": "2022-10-27T11:44:00+00:00"
+ },
+ {
+ "name": "doctrine/inflector",
+ "version": "2.0.8",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/doctrine/inflector.git",
+ "reference": "f9301a5b2fb1216b2b08f02ba04dc45423db6bff"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/doctrine/inflector/zipball/f9301a5b2fb1216b2b08f02ba04dc45423db6bff",
+ "reference": "f9301a5b2fb1216b2b08f02ba04dc45423db6bff",
+ "shasum": ""
+ },
+ "require": {
+ "php": "^7.2 || ^8.0"
+ },
+ "require-dev": {
+ "doctrine/coding-standard": "^11.0",
+ "phpstan/phpstan": "^1.8",
+ "phpstan/phpstan-phpunit": "^1.1",
+ "phpstan/phpstan-strict-rules": "^1.3",
+ "phpunit/phpunit": "^8.5 || ^9.5",
+ "vimeo/psalm": "^4.25 || ^5.4"
+ },
+ "type": "library",
+ "autoload": {
+ "psr-4": {
+ "Doctrine\\Inflector\\": "lib/Doctrine/Inflector"
+ }
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "authors": [
+ {
+ "name": "Guilherme Blanco",
+ "email": "guilhermeblanco@gmail.com"
+ },
+ {
+ "name": "Roman Borschel",
+ "email": "roman@code-factory.org"
+ },
+ {
+ "name": "Benjamin Eberlei",
+ "email": "kontakt@beberlei.de"
+ },
+ {
+ "name": "Jonathan Wage",
+ "email": "jonwage@gmail.com"
+ },
+ {
+ "name": "Johannes Schmitt",
+ "email": "schmittjoh@gmail.com"
+ }
+ ],
+ "description": "PHP Doctrine Inflector is a small library that can perform string manipulations with regard to upper/lowercase and singular/plural forms of words.",
+ "homepage": "https://www.doctrine-project.org/projects/inflector.html",
+ "keywords": [
+ "inflection",
+ "inflector",
+ "lowercase",
+ "manipulation",
+ "php",
+ "plural",
+ "singular",
+ "strings",
+ "uppercase",
+ "words"
+ ],
+ "support": {
+ "issues": "https://github.com/doctrine/inflector/issues",
+ "source": "https://github.com/doctrine/inflector/tree/2.0.8"
+ },
+ "funding": [
+ {
+ "url": "https://www.doctrine-project.org/sponsorship.html",
+ "type": "custom"
+ },
+ {
+ "url": "https://www.patreon.com/phpdoctrine",
+ "type": "patreon"
+ },
+ {
+ "url": "https://tidelift.com/funding/github/packagist/doctrine%2Finflector",
+ "type": "tidelift"
+ }
+ ],
+ "time": "2023-06-16T13:40:37+00:00"
+ },
+ {
+ "name": "doctrine/lexer",
+ "version": "3.0.0",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/doctrine/lexer.git",
+ "reference": "84a527db05647743d50373e0ec53a152f2cde568"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/doctrine/lexer/zipball/84a527db05647743d50373e0ec53a152f2cde568",
+ "reference": "84a527db05647743d50373e0ec53a152f2cde568",
+ "shasum": ""
+ },
+ "require": {
+ "php": "^8.1"
+ },
+ "require-dev": {
+ "doctrine/coding-standard": "^10",
+ "phpstan/phpstan": "^1.9",
+ "phpunit/phpunit": "^9.5",
+ "psalm/plugin-phpunit": "^0.18.3",
+ "vimeo/psalm": "^5.0"
+ },
+ "type": "library",
+ "autoload": {
+ "psr-4": {
+ "Doctrine\\Common\\Lexer\\": "src"
+ }
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "authors": [
+ {
+ "name": "Guilherme Blanco",
+ "email": "guilhermeblanco@gmail.com"
+ },
+ {
+ "name": "Roman Borschel",
+ "email": "roman@code-factory.org"
+ },
+ {
+ "name": "Johannes Schmitt",
+ "email": "schmittjoh@gmail.com"
+ }
+ ],
+ "description": "PHP Doctrine Lexer parser library that can be used in Top-Down, Recursive Descent Parsers.",
+ "homepage": "https://www.doctrine-project.org/projects/lexer.html",
+ "keywords": [
+ "annotations",
+ "docblock",
+ "lexer",
+ "parser",
+ "php"
+ ],
+ "support": {
+ "issues": "https://github.com/doctrine/lexer/issues",
+ "source": "https://github.com/doctrine/lexer/tree/3.0.0"
+ },
+ "funding": [
+ {
+ "url": "https://www.doctrine-project.org/sponsorship.html",
+ "type": "custom"
+ },
+ {
+ "url": "https://www.patreon.com/phpdoctrine",
+ "type": "patreon"
+ },
+ {
+ "url": "https://tidelift.com/funding/github/packagist/doctrine%2Flexer",
+ "type": "tidelift"
+ }
+ ],
+ "time": "2022-12-15T16:57:16+00:00"
+ },
+ {
+ "name": "dragonmantank/cron-expression",
+ "version": "v3.3.3",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/dragonmantank/cron-expression.git",
+ "reference": "adfb1f505deb6384dc8b39804c5065dd3c8c8c0a"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/dragonmantank/cron-expression/zipball/adfb1f505deb6384dc8b39804c5065dd3c8c8c0a",
+ "reference": "adfb1f505deb6384dc8b39804c5065dd3c8c8c0a",
+ "shasum": ""
+ },
+ "require": {
+ "php": "^7.2|^8.0",
+ "webmozart/assert": "^1.0"
+ },
+ "replace": {
+ "mtdowling/cron-expression": "^1.0"
+ },
+ "require-dev": {
+ "phpstan/extension-installer": "^1.0",
+ "phpstan/phpstan": "^1.0",
+ "phpstan/phpstan-webmozart-assert": "^1.0",
+ "phpunit/phpunit": "^7.0|^8.0|^9.0"
+ },
+ "type": "library",
+ "autoload": {
+ "psr-4": {
+ "Cron\\": "src/Cron/"
+ }
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "authors": [
+ {
+ "name": "Chris Tankersley",
+ "email": "chris@ctankersley.com",
+ "homepage": "https://github.com/dragonmantank"
+ }
+ ],
+ "description": "CRON for PHP: Calculate the next or previous run date and determine if a CRON expression is due",
+ "keywords": [
+ "cron",
+ "schedule"
+ ],
+ "support": {
+ "issues": "https://github.com/dragonmantank/cron-expression/issues",
+ "source": "https://github.com/dragonmantank/cron-expression/tree/v3.3.3"
+ },
+ "funding": [
+ {
+ "url": "https://github.com/dragonmantank",
+ "type": "github"
+ }
+ ],
+ "time": "2023-08-10T19:36:49+00:00"
+ },
+ {
+ "name": "egulias/email-validator",
+ "version": "4.0.2",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/egulias/EmailValidator.git",
+ "reference": "ebaaf5be6c0286928352e054f2d5125608e5405e"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/egulias/EmailValidator/zipball/ebaaf5be6c0286928352e054f2d5125608e5405e",
+ "reference": "ebaaf5be6c0286928352e054f2d5125608e5405e",
+ "shasum": ""
+ },
+ "require": {
+ "doctrine/lexer": "^2.0 || ^3.0",
+ "php": ">=8.1",
+ "symfony/polyfill-intl-idn": "^1.26"
+ },
+ "require-dev": {
+ "phpunit/phpunit": "^10.2",
+ "vimeo/psalm": "^5.12"
+ },
+ "suggest": {
+ "ext-intl": "PHP Internationalization Libraries are required to use the SpoofChecking validation"
+ },
+ "type": "library",
+ "extra": {
+ "branch-alias": {
+ "dev-master": "4.0.x-dev"
+ }
+ },
+ "autoload": {
+ "psr-4": {
+ "Egulias\\EmailValidator\\": "src"
+ }
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "authors": [
+ {
+ "name": "Eduardo Gulias Davis"
+ }
+ ],
+ "description": "A library for validating emails against several RFCs",
+ "homepage": "https://github.com/egulias/EmailValidator",
+ "keywords": [
+ "email",
+ "emailvalidation",
+ "emailvalidator",
+ "validation",
+ "validator"
+ ],
+ "support": {
+ "issues": "https://github.com/egulias/EmailValidator/issues",
+ "source": "https://github.com/egulias/EmailValidator/tree/4.0.2"
+ },
+ "funding": [
+ {
+ "url": "https://github.com/egulias",
+ "type": "github"
+ }
+ ],
+ "time": "2023-10-06T06:47:41+00:00"
+ },
+ {
+ "name": "fruitcake/php-cors",
+ "version": "v1.3.0",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/fruitcake/php-cors.git",
+ "reference": "3d158f36e7875e2f040f37bc0573956240a5a38b"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/fruitcake/php-cors/zipball/3d158f36e7875e2f040f37bc0573956240a5a38b",
+ "reference": "3d158f36e7875e2f040f37bc0573956240a5a38b",
+ "shasum": ""
+ },
+ "require": {
+ "php": "^7.4|^8.0",
+ "symfony/http-foundation": "^4.4|^5.4|^6|^7"
+ },
+ "require-dev": {
+ "phpstan/phpstan": "^1.4",
+ "phpunit/phpunit": "^9",
+ "squizlabs/php_codesniffer": "^3.5"
+ },
+ "type": "library",
+ "extra": {
+ "branch-alias": {
+ "dev-master": "1.2-dev"
+ }
+ },
+ "autoload": {
+ "psr-4": {
+ "Fruitcake\\Cors\\": "src/"
+ }
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "authors": [
+ {
+ "name": "Fruitcake",
+ "homepage": "https://fruitcake.nl"
+ },
+ {
+ "name": "Barryvdh",
+ "email": "barryvdh@gmail.com"
+ }
+ ],
+ "description": "Cross-origin resource sharing library for the Symfony HttpFoundation",
+ "homepage": "https://github.com/fruitcake/php-cors",
+ "keywords": [
+ "cors",
+ "laravel",
+ "symfony"
+ ],
+ "support": {
+ "issues": "https://github.com/fruitcake/php-cors/issues",
+ "source": "https://github.com/fruitcake/php-cors/tree/v1.3.0"
+ },
+ "funding": [
+ {
+ "url": "https://fruitcake.nl",
+ "type": "custom"
+ },
+ {
+ "url": "https://github.com/barryvdh",
+ "type": "github"
+ }
+ ],
+ "time": "2023-10-12T05:21:21+00:00"
+ },
+ {
+ "name": "graham-campbell/result-type",
+ "version": "v1.1.2",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/GrahamCampbell/Result-Type.git",
+ "reference": "fbd48bce38f73f8a4ec8583362e732e4095e5862"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/GrahamCampbell/Result-Type/zipball/fbd48bce38f73f8a4ec8583362e732e4095e5862",
+ "reference": "fbd48bce38f73f8a4ec8583362e732e4095e5862",
+ "shasum": ""
+ },
+ "require": {
+ "php": "^7.2.5 || ^8.0",
+ "phpoption/phpoption": "^1.9.2"
+ },
+ "require-dev": {
+ "phpunit/phpunit": "^8.5.34 || ^9.6.13 || ^10.4.2"
+ },
+ "type": "library",
+ "autoload": {
+ "psr-4": {
+ "GrahamCampbell\\ResultType\\": "src/"
+ }
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "authors": [
+ {
+ "name": "Graham Campbell",
+ "email": "hello@gjcampbell.co.uk",
+ "homepage": "https://github.com/GrahamCampbell"
+ }
+ ],
+ "description": "An Implementation Of The Result Type",
+ "keywords": [
+ "Graham Campbell",
+ "GrahamCampbell",
+ "Result Type",
+ "Result-Type",
+ "result"
+ ],
+ "support": {
+ "issues": "https://github.com/GrahamCampbell/Result-Type/issues",
+ "source": "https://github.com/GrahamCampbell/Result-Type/tree/v1.1.2"
+ },
+ "funding": [
+ {
+ "url": "https://github.com/GrahamCampbell",
+ "type": "github"
+ },
+ {
+ "url": "https://tidelift.com/funding/github/packagist/graham-campbell/result-type",
+ "type": "tidelift"
+ }
+ ],
+ "time": "2023-11-12T22:16:48+00:00"
+ },
+ {
+ "name": "guzzlehttp/guzzle",
+ "version": "7.8.1",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/guzzle/guzzle.git",
+ "reference": "41042bc7ab002487b876a0683fc8dce04ddce104"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/guzzle/guzzle/zipball/41042bc7ab002487b876a0683fc8dce04ddce104",
+ "reference": "41042bc7ab002487b876a0683fc8dce04ddce104",
+ "shasum": ""
+ },
+ "require": {
+ "ext-json": "*",
+ "guzzlehttp/promises": "^1.5.3 || ^2.0.1",
+ "guzzlehttp/psr7": "^1.9.1 || ^2.5.1",
+ "php": "^7.2.5 || ^8.0",
+ "psr/http-client": "^1.0",
+ "symfony/deprecation-contracts": "^2.2 || ^3.0"
+ },
+ "provide": {
+ "psr/http-client-implementation": "1.0"
+ },
+ "require-dev": {
+ "bamarni/composer-bin-plugin": "^1.8.2",
+ "ext-curl": "*",
+ "php-http/client-integration-tests": "dev-master#2c025848417c1135031fdf9c728ee53d0a7ceaee as 3.0.999",
+ "php-http/message-factory": "^1.1",
+ "phpunit/phpunit": "^8.5.36 || ^9.6.15",
+ "psr/log": "^1.1 || ^2.0 || ^3.0"
+ },
+ "suggest": {
+ "ext-curl": "Required for CURL handler support",
+ "ext-intl": "Required for Internationalized Domain Name (IDN) support",
+ "psr/log": "Required for using the Log middleware"
+ },
+ "type": "library",
+ "extra": {
+ "bamarni-bin": {
+ "bin-links": true,
+ "forward-command": false
+ }
+ },
+ "autoload": {
+ "files": [
+ "src/functions_include.php"
+ ],
+ "psr-4": {
+ "GuzzleHttp\\": "src/"
+ }
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "authors": [
+ {
+ "name": "Graham Campbell",
+ "email": "hello@gjcampbell.co.uk",
+ "homepage": "https://github.com/GrahamCampbell"
+ },
+ {
+ "name": "Michael Dowling",
+ "email": "mtdowling@gmail.com",
+ "homepage": "https://github.com/mtdowling"
+ },
+ {
+ "name": "Jeremy Lindblom",
+ "email": "jeremeamia@gmail.com",
+ "homepage": "https://github.com/jeremeamia"
+ },
+ {
+ "name": "George Mponos",
+ "email": "gmponos@gmail.com",
+ "homepage": "https://github.com/gmponos"
+ },
+ {
+ "name": "Tobias Nyholm",
+ "email": "tobias.nyholm@gmail.com",
+ "homepage": "https://github.com/Nyholm"
+ },
+ {
+ "name": "Márk Sági-Kazár",
+ "email": "mark.sagikazar@gmail.com",
+ "homepage": "https://github.com/sagikazarmark"
+ },
+ {
+ "name": "Tobias Schultze",
+ "email": "webmaster@tubo-world.de",
+ "homepage": "https://github.com/Tobion"
+ }
+ ],
+ "description": "Guzzle is a PHP HTTP client library",
+ "keywords": [
+ "client",
+ "curl",
+ "framework",
+ "http",
+ "http client",
+ "psr-18",
+ "psr-7",
+ "rest",
+ "web service"
+ ],
+ "support": {
+ "issues": "https://github.com/guzzle/guzzle/issues",
+ "source": "https://github.com/guzzle/guzzle/tree/7.8.1"
+ },
+ "funding": [
+ {
+ "url": "https://github.com/GrahamCampbell",
+ "type": "github"
+ },
+ {
+ "url": "https://github.com/Nyholm",
+ "type": "github"
+ },
+ {
+ "url": "https://tidelift.com/funding/github/packagist/guzzlehttp/guzzle",
+ "type": "tidelift"
+ }
+ ],
+ "time": "2023-12-03T20:35:24+00:00"
+ },
+ {
+ "name": "guzzlehttp/promises",
+ "version": "2.0.2",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/guzzle/promises.git",
+ "reference": "bbff78d96034045e58e13dedd6ad91b5d1253223"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/guzzle/promises/zipball/bbff78d96034045e58e13dedd6ad91b5d1253223",
+ "reference": "bbff78d96034045e58e13dedd6ad91b5d1253223",
+ "shasum": ""
+ },
+ "require": {
+ "php": "^7.2.5 || ^8.0"
+ },
+ "require-dev": {
+ "bamarni/composer-bin-plugin": "^1.8.2",
+ "phpunit/phpunit": "^8.5.36 || ^9.6.15"
+ },
+ "type": "library",
+ "extra": {
+ "bamarni-bin": {
+ "bin-links": true,
+ "forward-command": false
+ }
+ },
+ "autoload": {
+ "psr-4": {
+ "GuzzleHttp\\Promise\\": "src/"
+ }
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "authors": [
+ {
+ "name": "Graham Campbell",
+ "email": "hello@gjcampbell.co.uk",
+ "homepage": "https://github.com/GrahamCampbell"
+ },
+ {
+ "name": "Michael Dowling",
+ "email": "mtdowling@gmail.com",
+ "homepage": "https://github.com/mtdowling"
+ },
+ {
+ "name": "Tobias Nyholm",
+ "email": "tobias.nyholm@gmail.com",
+ "homepage": "https://github.com/Nyholm"
+ },
+ {
+ "name": "Tobias Schultze",
+ "email": "webmaster@tubo-world.de",
+ "homepage": "https://github.com/Tobion"
+ }
+ ],
+ "description": "Guzzle promises library",
+ "keywords": [
+ "promise"
+ ],
+ "support": {
+ "issues": "https://github.com/guzzle/promises/issues",
+ "source": "https://github.com/guzzle/promises/tree/2.0.2"
+ },
+ "funding": [
+ {
+ "url": "https://github.com/GrahamCampbell",
+ "type": "github"
+ },
+ {
+ "url": "https://github.com/Nyholm",
+ "type": "github"
+ },
+ {
+ "url": "https://tidelift.com/funding/github/packagist/guzzlehttp/promises",
+ "type": "tidelift"
+ }
+ ],
+ "time": "2023-12-03T20:19:20+00:00"
+ },
+ {
+ "name": "guzzlehttp/psr7",
+ "version": "2.6.2",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/guzzle/psr7.git",
+ "reference": "45b30f99ac27b5ca93cb4831afe16285f57b8221"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/guzzle/psr7/zipball/45b30f99ac27b5ca93cb4831afe16285f57b8221",
+ "reference": "45b30f99ac27b5ca93cb4831afe16285f57b8221",
+ "shasum": ""
+ },
+ "require": {
+ "php": "^7.2.5 || ^8.0",
+ "psr/http-factory": "^1.0",
+ "psr/http-message": "^1.1 || ^2.0",
+ "ralouphie/getallheaders": "^3.0"
+ },
+ "provide": {
+ "psr/http-factory-implementation": "1.0",
+ "psr/http-message-implementation": "1.0"
+ },
+ "require-dev": {
+ "bamarni/composer-bin-plugin": "^1.8.2",
+ "http-interop/http-factory-tests": "^0.9",
+ "phpunit/phpunit": "^8.5.36 || ^9.6.15"
+ },
+ "suggest": {
+ "laminas/laminas-httphandlerrunner": "Emit PSR-7 responses"
+ },
+ "type": "library",
+ "extra": {
+ "bamarni-bin": {
+ "bin-links": true,
+ "forward-command": false
+ }
+ },
+ "autoload": {
+ "psr-4": {
+ "GuzzleHttp\\Psr7\\": "src/"
+ }
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "authors": [
+ {
+ "name": "Graham Campbell",
+ "email": "hello@gjcampbell.co.uk",
+ "homepage": "https://github.com/GrahamCampbell"
+ },
+ {
+ "name": "Michael Dowling",
+ "email": "mtdowling@gmail.com",
+ "homepage": "https://github.com/mtdowling"
+ },
+ {
+ "name": "George Mponos",
+ "email": "gmponos@gmail.com",
+ "homepage": "https://github.com/gmponos"
+ },
+ {
+ "name": "Tobias Nyholm",
+ "email": "tobias.nyholm@gmail.com",
+ "homepage": "https://github.com/Nyholm"
+ },
+ {
+ "name": "Márk Sági-Kazár",
+ "email": "mark.sagikazar@gmail.com",
+ "homepage": "https://github.com/sagikazarmark"
+ },
+ {
+ "name": "Tobias Schultze",
+ "email": "webmaster@tubo-world.de",
+ "homepage": "https://github.com/Tobion"
+ },
+ {
+ "name": "Márk Sági-Kazár",
+ "email": "mark.sagikazar@gmail.com",
+ "homepage": "https://sagikazarmark.hu"
+ }
+ ],
+ "description": "PSR-7 message implementation that also provides common utility methods",
+ "keywords": [
+ "http",
+ "message",
+ "psr-7",
+ "request",
+ "response",
+ "stream",
+ "uri",
+ "url"
+ ],
+ "support": {
+ "issues": "https://github.com/guzzle/psr7/issues",
+ "source": "https://github.com/guzzle/psr7/tree/2.6.2"
+ },
+ "funding": [
+ {
+ "url": "https://github.com/GrahamCampbell",
+ "type": "github"
+ },
+ {
+ "url": "https://github.com/Nyholm",
+ "type": "github"
+ },
+ {
+ "url": "https://tidelift.com/funding/github/packagist/guzzlehttp/psr7",
+ "type": "tidelift"
+ }
+ ],
+ "time": "2023-12-03T20:05:35+00:00"
+ },
+ {
+ "name": "guzzlehttp/uri-template",
+ "version": "v1.0.3",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/guzzle/uri-template.git",
+ "reference": "ecea8feef63bd4fef1f037ecb288386999ecc11c"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/guzzle/uri-template/zipball/ecea8feef63bd4fef1f037ecb288386999ecc11c",
+ "reference": "ecea8feef63bd4fef1f037ecb288386999ecc11c",
+ "shasum": ""
+ },
+ "require": {
+ "php": "^7.2.5 || ^8.0",
+ "symfony/polyfill-php80": "^1.24"
+ },
+ "require-dev": {
+ "bamarni/composer-bin-plugin": "^1.8.2",
+ "phpunit/phpunit": "^8.5.36 || ^9.6.15",
+ "uri-template/tests": "1.0.0"
+ },
+ "type": "library",
+ "extra": {
+ "bamarni-bin": {
+ "bin-links": true,
+ "forward-command": false
+ }
+ },
+ "autoload": {
+ "psr-4": {
+ "GuzzleHttp\\UriTemplate\\": "src"
+ }
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "authors": [
+ {
+ "name": "Graham Campbell",
+ "email": "hello@gjcampbell.co.uk",
+ "homepage": "https://github.com/GrahamCampbell"
+ },
+ {
+ "name": "Michael Dowling",
+ "email": "mtdowling@gmail.com",
+ "homepage": "https://github.com/mtdowling"
+ },
+ {
+ "name": "George Mponos",
+ "email": "gmponos@gmail.com",
+ "homepage": "https://github.com/gmponos"
+ },
+ {
+ "name": "Tobias Nyholm",
+ "email": "tobias.nyholm@gmail.com",
+ "homepage": "https://github.com/Nyholm"
+ }
+ ],
+ "description": "A polyfill class for uri_template of PHP",
+ "keywords": [
+ "guzzlehttp",
+ "uri-template"
+ ],
+ "support": {
+ "issues": "https://github.com/guzzle/uri-template/issues",
+ "source": "https://github.com/guzzle/uri-template/tree/v1.0.3"
+ },
+ "funding": [
+ {
+ "url": "https://github.com/GrahamCampbell",
+ "type": "github"
+ },
+ {
+ "url": "https://github.com/Nyholm",
+ "type": "github"
+ },
+ {
+ "url": "https://tidelift.com/funding/github/packagist/guzzlehttp/uri-template",
+ "type": "tidelift"
+ }
+ ],
+ "time": "2023-12-03T19:50:20+00:00"
+ },
+ {
+ "name": "laravel/framework",
+ "version": "v10.40.0",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/laravel/framework.git",
+ "reference": "7a9470071dac9579ebf29ad1b9d73e4b8eb586fc"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/laravel/framework/zipball/7a9470071dac9579ebf29ad1b9d73e4b8eb586fc",
+ "reference": "7a9470071dac9579ebf29ad1b9d73e4b8eb586fc",
+ "shasum": ""
+ },
+ "require": {
+ "brick/math": "^0.9.3|^0.10.2|^0.11",
+ "composer-runtime-api": "^2.2",
+ "doctrine/inflector": "^2.0.5",
+ "dragonmantank/cron-expression": "^3.3.2",
+ "egulias/email-validator": "^3.2.1|^4.0",
+ "ext-ctype": "*",
+ "ext-filter": "*",
+ "ext-hash": "*",
+ "ext-mbstring": "*",
+ "ext-openssl": "*",
+ "ext-session": "*",
+ "ext-tokenizer": "*",
+ "fruitcake/php-cors": "^1.2",
+ "guzzlehttp/uri-template": "^1.0",
+ "laravel/prompts": "^0.1.9",
+ "laravel/serializable-closure": "^1.3",
+ "league/commonmark": "^2.2.1",
+ "league/flysystem": "^3.8.0",
+ "monolog/monolog": "^3.0",
+ "nesbot/carbon": "^2.67",
+ "nunomaduro/termwind": "^1.13",
+ "php": "^8.1",
+ "psr/container": "^1.1.1|^2.0.1",
+ "psr/log": "^1.0|^2.0|^3.0",
+ "psr/simple-cache": "^1.0|^2.0|^3.0",
+ "ramsey/uuid": "^4.7",
+ "symfony/console": "^6.2",
+ "symfony/error-handler": "^6.2",
+ "symfony/finder": "^6.2",
+ "symfony/http-foundation": "^6.4",
+ "symfony/http-kernel": "^6.2",
+ "symfony/mailer": "^6.2",
+ "symfony/mime": "^6.2",
+ "symfony/process": "^6.2",
+ "symfony/routing": "^6.2",
+ "symfony/uid": "^6.2",
+ "symfony/var-dumper": "^6.2",
+ "tijsverkoyen/css-to-inline-styles": "^2.2.5",
+ "vlucas/phpdotenv": "^5.4.1",
+ "voku/portable-ascii": "^2.0"
+ },
+ "conflict": {
+ "carbonphp/carbon-doctrine-types": ">=3.0",
+ "doctrine/dbal": ">=4.0",
+ "tightenco/collect": "<5.5.33"
+ },
+ "provide": {
+ "psr/container-implementation": "1.1|2.0",
+ "psr/simple-cache-implementation": "1.0|2.0|3.0"
+ },
+ "replace": {
+ "illuminate/auth": "self.version",
+ "illuminate/broadcasting": "self.version",
+ "illuminate/bus": "self.version",
+ "illuminate/cache": "self.version",
+ "illuminate/collections": "self.version",
+ "illuminate/conditionable": "self.version",
+ "illuminate/config": "self.version",
+ "illuminate/console": "self.version",
+ "illuminate/container": "self.version",
+ "illuminate/contracts": "self.version",
+ "illuminate/cookie": "self.version",
+ "illuminate/database": "self.version",
+ "illuminate/encryption": "self.version",
+ "illuminate/events": "self.version",
+ "illuminate/filesystem": "self.version",
+ "illuminate/hashing": "self.version",
+ "illuminate/http": "self.version",
+ "illuminate/log": "self.version",
+ "illuminate/macroable": "self.version",
+ "illuminate/mail": "self.version",
+ "illuminate/notifications": "self.version",
+ "illuminate/pagination": "self.version",
+ "illuminate/pipeline": "self.version",
+ "illuminate/process": "self.version",
+ "illuminate/queue": "self.version",
+ "illuminate/redis": "self.version",
+ "illuminate/routing": "self.version",
+ "illuminate/session": "self.version",
+ "illuminate/support": "self.version",
+ "illuminate/testing": "self.version",
+ "illuminate/translation": "self.version",
+ "illuminate/validation": "self.version",
+ "illuminate/view": "self.version"
+ },
+ "require-dev": {
+ "ably/ably-php": "^1.0",
+ "aws/aws-sdk-php": "^3.235.5",
+ "doctrine/dbal": "^3.5.1",
+ "ext-gmp": "*",
+ "fakerphp/faker": "^1.21",
+ "guzzlehttp/guzzle": "^7.5",
+ "league/flysystem-aws-s3-v3": "^3.0",
+ "league/flysystem-ftp": "^3.0",
+ "league/flysystem-path-prefixing": "^3.3",
+ "league/flysystem-read-only": "^3.3",
+ "league/flysystem-sftp-v3": "^3.0",
+ "mockery/mockery": "^1.5.1",
+ "nyholm/psr7": "^1.2",
+ "orchestra/testbench-core": "^8.18",
+ "pda/pheanstalk": "^4.0",
+ "phpstan/phpstan": "^1.4.7",
+ "phpunit/phpunit": "^10.0.7",
+ "predis/predis": "^2.0.2",
+ "symfony/cache": "^6.2",
+ "symfony/http-client": "^6.2.4",
+ "symfony/psr-http-message-bridge": "^2.0"
+ },
+ "suggest": {
+ "ably/ably-php": "Required to use the Ably broadcast driver (^1.0).",
+ "aws/aws-sdk-php": "Required to use the SQS queue driver, DynamoDb failed job storage, and SES mail driver (^3.235.5).",
+ "brianium/paratest": "Required to run tests in parallel (^6.0).",
+ "doctrine/dbal": "Required to rename columns and drop SQLite columns (^3.5.1).",
+ "ext-apcu": "Required to use the APC cache driver.",
+ "ext-fileinfo": "Required to use the Filesystem class.",
+ "ext-ftp": "Required to use the Flysystem FTP driver.",
+ "ext-gd": "Required to use Illuminate\\Http\\Testing\\FileFactory::image().",
+ "ext-memcached": "Required to use the memcache cache driver.",
+ "ext-pcntl": "Required to use all features of the queue worker and console signal trapping.",
+ "ext-pdo": "Required to use all database features.",
+ "ext-posix": "Required to use all features of the queue worker.",
+ "ext-redis": "Required to use the Redis cache and queue drivers (^4.0|^5.0).",
+ "fakerphp/faker": "Required to use the eloquent factory builder (^1.9.1).",
+ "filp/whoops": "Required for friendly error pages in development (^2.14.3).",
+ "guzzlehttp/guzzle": "Required to use the HTTP Client and the ping methods on schedules (^7.5).",
+ "laravel/tinker": "Required to use the tinker console command (^2.0).",
+ "league/flysystem-aws-s3-v3": "Required to use the Flysystem S3 driver (^3.0).",
+ "league/flysystem-ftp": "Required to use the Flysystem FTP driver (^3.0).",
+ "league/flysystem-path-prefixing": "Required to use the scoped driver (^3.3).",
+ "league/flysystem-read-only": "Required to use read-only disks (^3.3)",
+ "league/flysystem-sftp-v3": "Required to use the Flysystem SFTP driver (^3.0).",
+ "mockery/mockery": "Required to use mocking (^1.5.1).",
+ "nyholm/psr7": "Required to use PSR-7 bridging features (^1.2).",
+ "pda/pheanstalk": "Required to use the beanstalk queue driver (^4.0).",
+ "phpunit/phpunit": "Required to use assertions and run tests (^9.5.8|^10.0.7).",
+ "predis/predis": "Required to use the predis connector (^2.0.2).",
+ "psr/http-message": "Required to allow Storage::put to accept a StreamInterface (^1.0).",
+ "pusher/pusher-php-server": "Required to use the Pusher broadcast driver (^6.0|^7.0).",
+ "symfony/cache": "Required to PSR-6 cache bridge (^6.2).",
+ "symfony/filesystem": "Required to enable support for relative symbolic links (^6.2).",
+ "symfony/http-client": "Required to enable support for the Symfony API mail transports (^6.2).",
+ "symfony/mailgun-mailer": "Required to enable support for the Mailgun mail transport (^6.2).",
+ "symfony/postmark-mailer": "Required to enable support for the Postmark mail transport (^6.2).",
+ "symfony/psr-http-message-bridge": "Required to use PSR-7 bridging features (^2.0)."
+ },
+ "type": "library",
+ "extra": {
+ "branch-alias": {
+ "dev-master": "10.x-dev"
+ }
+ },
+ "autoload": {
+ "files": [
+ "src/Illuminate/Collections/helpers.php",
+ "src/Illuminate/Events/functions.php",
+ "src/Illuminate/Filesystem/functions.php",
+ "src/Illuminate/Foundation/helpers.php",
+ "src/Illuminate/Support/helpers.php"
+ ],
+ "psr-4": {
+ "Illuminate\\": "src/Illuminate/",
+ "Illuminate\\Support\\": [
+ "src/Illuminate/Macroable/",
+ "src/Illuminate/Collections/",
+ "src/Illuminate/Conditionable/"
+ ]
+ }
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "authors": [
+ {
+ "name": "Taylor Otwell",
+ "email": "taylor@laravel.com"
+ }
+ ],
+ "description": "The Laravel Framework.",
+ "homepage": "https://laravel.com",
+ "keywords": [
+ "framework",
+ "laravel"
+ ],
+ "support": {
+ "issues": "https://github.com/laravel/framework/issues",
+ "source": "https://github.com/laravel/framework"
+ },
+ "time": "2024-01-09T11:46:47+00:00"
+ },
+ {
+ "name": "laravel/prompts",
+ "version": "v0.1.15",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/laravel/prompts.git",
+ "reference": "d814a27514d99b03c85aa42b22cfd946568636c1"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/laravel/prompts/zipball/d814a27514d99b03c85aa42b22cfd946568636c1",
+ "reference": "d814a27514d99b03c85aa42b22cfd946568636c1",
+ "shasum": ""
+ },
+ "require": {
+ "ext-mbstring": "*",
+ "illuminate/collections": "^10.0|^11.0",
+ "php": "^8.1",
+ "symfony/console": "^6.2|^7.0"
+ },
+ "conflict": {
+ "illuminate/console": ">=10.17.0 <10.25.0",
+ "laravel/framework": ">=10.17.0 <10.25.0"
+ },
+ "require-dev": {
+ "mockery/mockery": "^1.5",
+ "pestphp/pest": "^2.3",
+ "phpstan/phpstan": "^1.11",
+ "phpstan/phpstan-mockery": "^1.1"
+ },
+ "suggest": {
+ "ext-pcntl": "Required for the spinner to be animated."
+ },
+ "type": "library",
+ "extra": {
+ "branch-alias": {
+ "dev-main": "0.1.x-dev"
+ }
+ },
+ "autoload": {
+ "files": [
+ "src/helpers.php"
+ ],
+ "psr-4": {
+ "Laravel\\Prompts\\": "src/"
+ }
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "support": {
+ "issues": "https://github.com/laravel/prompts/issues",
+ "source": "https://github.com/laravel/prompts/tree/v0.1.15"
+ },
+ "time": "2023-12-29T22:37:42+00:00"
+ },
+ {
+ "name": "laravel/sanctum",
+ "version": "v3.3.3",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/laravel/sanctum.git",
+ "reference": "8c104366459739f3ada0e994bcd3e6fd681ce3d5"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/laravel/sanctum/zipball/8c104366459739f3ada0e994bcd3e6fd681ce3d5",
+ "reference": "8c104366459739f3ada0e994bcd3e6fd681ce3d5",
+ "shasum": ""
+ },
+ "require": {
+ "ext-json": "*",
+ "illuminate/console": "^9.21|^10.0",
+ "illuminate/contracts": "^9.21|^10.0",
+ "illuminate/database": "^9.21|^10.0",
+ "illuminate/support": "^9.21|^10.0",
+ "php": "^8.0.2"
+ },
+ "require-dev": {
+ "mockery/mockery": "^1.0",
+ "orchestra/testbench": "^7.28.2|^8.8.3",
+ "phpstan/phpstan": "^1.10",
+ "phpunit/phpunit": "^9.6"
+ },
+ "type": "library",
+ "extra": {
+ "branch-alias": {
+ "dev-master": "3.x-dev"
+ },
+ "laravel": {
+ "providers": [
+ "Laravel\\Sanctum\\SanctumServiceProvider"
+ ]
+ }
+ },
+ "autoload": {
+ "psr-4": {
+ "Laravel\\Sanctum\\": "src/"
+ }
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "authors": [
+ {
+ "name": "Taylor Otwell",
+ "email": "taylor@laravel.com"
+ }
+ ],
+ "description": "Laravel Sanctum provides a featherweight authentication system for SPAs and simple APIs.",
+ "keywords": [
+ "auth",
+ "laravel",
+ "sanctum"
+ ],
+ "support": {
+ "issues": "https://github.com/laravel/sanctum/issues",
+ "source": "https://github.com/laravel/sanctum"
+ },
+ "time": "2023-12-19T18:44:48+00:00"
+ },
+ {
+ "name": "laravel/serializable-closure",
+ "version": "v1.3.3",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/laravel/serializable-closure.git",
+ "reference": "3dbf8a8e914634c48d389c1234552666b3d43754"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/laravel/serializable-closure/zipball/3dbf8a8e914634c48d389c1234552666b3d43754",
+ "reference": "3dbf8a8e914634c48d389c1234552666b3d43754",
+ "shasum": ""
+ },
+ "require": {
+ "php": "^7.3|^8.0"
+ },
+ "require-dev": {
+ "nesbot/carbon": "^2.61",
+ "pestphp/pest": "^1.21.3",
+ "phpstan/phpstan": "^1.8.2",
+ "symfony/var-dumper": "^5.4.11"
+ },
+ "type": "library",
+ "extra": {
+ "branch-alias": {
+ "dev-master": "1.x-dev"
+ }
+ },
+ "autoload": {
+ "psr-4": {
+ "Laravel\\SerializableClosure\\": "src/"
+ }
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "authors": [
+ {
+ "name": "Taylor Otwell",
+ "email": "taylor@laravel.com"
+ },
+ {
+ "name": "Nuno Maduro",
+ "email": "nuno@laravel.com"
+ }
+ ],
+ "description": "Laravel Serializable Closure provides an easy and secure way to serialize closures in PHP.",
+ "keywords": [
+ "closure",
+ "laravel",
+ "serializable"
+ ],
+ "support": {
+ "issues": "https://github.com/laravel/serializable-closure/issues",
+ "source": "https://github.com/laravel/serializable-closure"
+ },
+ "time": "2023-11-08T14:08:06+00:00"
+ },
+ {
+ "name": "laravel/tinker",
+ "version": "v2.9.0",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/laravel/tinker.git",
+ "reference": "502e0fe3f0415d06d5db1f83a472f0f3b754bafe"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/laravel/tinker/zipball/502e0fe3f0415d06d5db1f83a472f0f3b754bafe",
+ "reference": "502e0fe3f0415d06d5db1f83a472f0f3b754bafe",
+ "shasum": ""
+ },
+ "require": {
+ "illuminate/console": "^6.0|^7.0|^8.0|^9.0|^10.0|^11.0",
+ "illuminate/contracts": "^6.0|^7.0|^8.0|^9.0|^10.0|^11.0",
+ "illuminate/support": "^6.0|^7.0|^8.0|^9.0|^10.0|^11.0",
+ "php": "^7.2.5|^8.0",
+ "psy/psysh": "^0.11.1|^0.12.0",
+ "symfony/var-dumper": "^4.3.4|^5.0|^6.0|^7.0"
+ },
+ "require-dev": {
+ "mockery/mockery": "~1.3.3|^1.4.2",
+ "phpstan/phpstan": "^1.10",
+ "phpunit/phpunit": "^8.5.8|^9.3.3"
+ },
+ "suggest": {
+ "illuminate/database": "The Illuminate Database package (^6.0|^7.0|^8.0|^9.0|^10.0|^11.0)."
+ },
+ "type": "library",
+ "extra": {
+ "laravel": {
+ "providers": [
+ "Laravel\\Tinker\\TinkerServiceProvider"
+ ]
+ }
+ },
+ "autoload": {
+ "psr-4": {
+ "Laravel\\Tinker\\": "src/"
+ }
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "authors": [
+ {
+ "name": "Taylor Otwell",
+ "email": "taylor@laravel.com"
+ }
+ ],
+ "description": "Powerful REPL for the Laravel framework.",
+ "keywords": [
+ "REPL",
+ "Tinker",
+ "laravel",
+ "psysh"
+ ],
+ "support": {
+ "issues": "https://github.com/laravel/tinker/issues",
+ "source": "https://github.com/laravel/tinker/tree/v2.9.0"
+ },
+ "time": "2024-01-04T16:10:04+00:00"
+ },
+ {
+ "name": "league/commonmark",
+ "version": "2.4.1",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/thephpleague/commonmark.git",
+ "reference": "3669d6d5f7a47a93c08ddff335e6d945481a1dd5"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/thephpleague/commonmark/zipball/3669d6d5f7a47a93c08ddff335e6d945481a1dd5",
+ "reference": "3669d6d5f7a47a93c08ddff335e6d945481a1dd5",
+ "shasum": ""
+ },
+ "require": {
+ "ext-mbstring": "*",
+ "league/config": "^1.1.1",
+ "php": "^7.4 || ^8.0",
+ "psr/event-dispatcher": "^1.0",
+ "symfony/deprecation-contracts": "^2.1 || ^3.0",
+ "symfony/polyfill-php80": "^1.16"
+ },
+ "require-dev": {
+ "cebe/markdown": "^1.0",
+ "commonmark/cmark": "0.30.0",
+ "commonmark/commonmark.js": "0.30.0",
+ "composer/package-versions-deprecated": "^1.8",
+ "embed/embed": "^4.4",
+ "erusev/parsedown": "^1.0",
+ "ext-json": "*",
+ "github/gfm": "0.29.0",
+ "michelf/php-markdown": "^1.4 || ^2.0",
+ "nyholm/psr7": "^1.5",
+ "phpstan/phpstan": "^1.8.2",
+ "phpunit/phpunit": "^9.5.21",
+ "scrutinizer/ocular": "^1.8.1",
+ "symfony/finder": "^5.3 | ^6.0",
+ "symfony/yaml": "^2.3 | ^3.0 | ^4.0 | ^5.0 | ^6.0",
+ "unleashedtech/php-coding-standard": "^3.1.1",
+ "vimeo/psalm": "^4.24.0 || ^5.0.0"
+ },
+ "suggest": {
+ "symfony/yaml": "v2.3+ required if using the Front Matter extension"
+ },
+ "type": "library",
+ "extra": {
+ "branch-alias": {
+ "dev-main": "2.5-dev"
+ }
+ },
+ "autoload": {
+ "psr-4": {
+ "League\\CommonMark\\": "src"
+ }
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "BSD-3-Clause"
+ ],
+ "authors": [
+ {
+ "name": "Colin O'Dell",
+ "email": "colinodell@gmail.com",
+ "homepage": "https://www.colinodell.com",
+ "role": "Lead Developer"
+ }
+ ],
+ "description": "Highly-extensible PHP Markdown parser which fully supports the CommonMark spec and GitHub-Flavored Markdown (GFM)",
+ "homepage": "https://commonmark.thephpleague.com",
+ "keywords": [
+ "commonmark",
+ "flavored",
+ "gfm",
+ "github",
+ "github-flavored",
+ "markdown",
+ "md",
+ "parser"
+ ],
+ "support": {
+ "docs": "https://commonmark.thephpleague.com/",
+ "forum": "https://github.com/thephpleague/commonmark/discussions",
+ "issues": "https://github.com/thephpleague/commonmark/issues",
+ "rss": "https://github.com/thephpleague/commonmark/releases.atom",
+ "source": "https://github.com/thephpleague/commonmark"
+ },
+ "funding": [
+ {
+ "url": "https://www.colinodell.com/sponsor",
+ "type": "custom"
+ },
+ {
+ "url": "https://www.paypal.me/colinpodell/10.00",
+ "type": "custom"
+ },
+ {
+ "url": "https://github.com/colinodell",
+ "type": "github"
+ },
+ {
+ "url": "https://tidelift.com/funding/github/packagist/league/commonmark",
+ "type": "tidelift"
+ }
+ ],
+ "time": "2023-08-30T16:55:00+00:00"
+ },
+ {
+ "name": "league/config",
+ "version": "v1.2.0",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/thephpleague/config.git",
+ "reference": "754b3604fb2984c71f4af4a9cbe7b57f346ec1f3"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/thephpleague/config/zipball/754b3604fb2984c71f4af4a9cbe7b57f346ec1f3",
+ "reference": "754b3604fb2984c71f4af4a9cbe7b57f346ec1f3",
+ "shasum": ""
+ },
+ "require": {
+ "dflydev/dot-access-data": "^3.0.1",
+ "nette/schema": "^1.2",
+ "php": "^7.4 || ^8.0"
+ },
+ "require-dev": {
+ "phpstan/phpstan": "^1.8.2",
+ "phpunit/phpunit": "^9.5.5",
+ "scrutinizer/ocular": "^1.8.1",
+ "unleashedtech/php-coding-standard": "^3.1",
+ "vimeo/psalm": "^4.7.3"
+ },
+ "type": "library",
+ "extra": {
+ "branch-alias": {
+ "dev-main": "1.2-dev"
+ }
+ },
+ "autoload": {
+ "psr-4": {
+ "League\\Config\\": "src"
+ }
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "BSD-3-Clause"
+ ],
+ "authors": [
+ {
+ "name": "Colin O'Dell",
+ "email": "colinodell@gmail.com",
+ "homepage": "https://www.colinodell.com",
+ "role": "Lead Developer"
+ }
+ ],
+ "description": "Define configuration arrays with strict schemas and access values with dot notation",
+ "homepage": "https://config.thephpleague.com",
+ "keywords": [
+ "array",
+ "config",
+ "configuration",
+ "dot",
+ "dot-access",
+ "nested",
+ "schema"
+ ],
+ "support": {
+ "docs": "https://config.thephpleague.com/",
+ "issues": "https://github.com/thephpleague/config/issues",
+ "rss": "https://github.com/thephpleague/config/releases.atom",
+ "source": "https://github.com/thephpleague/config"
+ },
+ "funding": [
+ {
+ "url": "https://www.colinodell.com/sponsor",
+ "type": "custom"
+ },
+ {
+ "url": "https://www.paypal.me/colinpodell/10.00",
+ "type": "custom"
+ },
+ {
+ "url": "https://github.com/colinodell",
+ "type": "github"
+ }
+ ],
+ "time": "2022-12-11T20:36:23+00:00"
+ },
+ {
+ "name": "league/flysystem",
+ "version": "3.23.0",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/thephpleague/flysystem.git",
+ "reference": "d4ad81e2b67396e33dc9d7e54ec74ccf73151dcc"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/thephpleague/flysystem/zipball/d4ad81e2b67396e33dc9d7e54ec74ccf73151dcc",
+ "reference": "d4ad81e2b67396e33dc9d7e54ec74ccf73151dcc",
+ "shasum": ""
+ },
+ "require": {
+ "league/flysystem-local": "^3.0.0",
+ "league/mime-type-detection": "^1.0.0",
+ "php": "^8.0.2"
+ },
+ "conflict": {
+ "async-aws/core": "<1.19.0",
+ "async-aws/s3": "<1.14.0",
+ "aws/aws-sdk-php": "3.209.31 || 3.210.0",
+ "guzzlehttp/guzzle": "<7.0",
+ "guzzlehttp/ringphp": "<1.1.1",
+ "phpseclib/phpseclib": "3.0.15",
+ "symfony/http-client": "<5.2"
+ },
+ "require-dev": {
+ "async-aws/s3": "^1.5 || ^2.0",
+ "async-aws/simple-s3": "^1.1 || ^2.0",
+ "aws/aws-sdk-php": "^3.220.0",
+ "composer/semver": "^3.0",
+ "ext-fileinfo": "*",
+ "ext-ftp": "*",
+ "ext-zip": "*",
+ "friendsofphp/php-cs-fixer": "^3.5",
+ "google/cloud-storage": "^1.23",
+ "microsoft/azure-storage-blob": "^1.1",
+ "phpseclib/phpseclib": "^3.0.34",
+ "phpstan/phpstan": "^1.10",
+ "phpunit/phpunit": "^9.5.11|^10.0",
+ "sabre/dav": "^4.3.1"
+ },
+ "type": "library",
+ "autoload": {
+ "psr-4": {
+ "League\\Flysystem\\": "src"
+ }
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "authors": [
+ {
+ "name": "Frank de Jonge",
+ "email": "info@frankdejonge.nl"
+ }
+ ],
+ "description": "File storage abstraction for PHP",
+ "keywords": [
+ "WebDAV",
+ "aws",
+ "cloud",
+ "file",
+ "files",
+ "filesystem",
+ "filesystems",
+ "ftp",
+ "s3",
+ "sftp",
+ "storage"
+ ],
+ "support": {
+ "issues": "https://github.com/thephpleague/flysystem/issues",
+ "source": "https://github.com/thephpleague/flysystem/tree/3.23.0"
+ },
+ "funding": [
+ {
+ "url": "https://ecologi.com/frankdejonge",
+ "type": "custom"
+ },
+ {
+ "url": "https://github.com/frankdejonge",
+ "type": "github"
+ }
+ ],
+ "time": "2023-12-04T10:16:17+00:00"
+ },
+ {
+ "name": "league/flysystem-local",
+ "version": "3.23.0",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/thephpleague/flysystem-local.git",
+ "reference": "5cf046ba5f059460e86a997c504dd781a39a109b"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/thephpleague/flysystem-local/zipball/5cf046ba5f059460e86a997c504dd781a39a109b",
+ "reference": "5cf046ba5f059460e86a997c504dd781a39a109b",
+ "shasum": ""
+ },
+ "require": {
+ "ext-fileinfo": "*",
+ "league/flysystem": "^3.0.0",
+ "league/mime-type-detection": "^1.0.0",
+ "php": "^8.0.2"
+ },
+ "type": "library",
+ "autoload": {
+ "psr-4": {
+ "League\\Flysystem\\Local\\": ""
+ }
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "authors": [
+ {
+ "name": "Frank de Jonge",
+ "email": "info@frankdejonge.nl"
+ }
+ ],
+ "description": "Local filesystem adapter for Flysystem.",
+ "keywords": [
+ "Flysystem",
+ "file",
+ "files",
+ "filesystem",
+ "local"
+ ],
+ "support": {
+ "issues": "https://github.com/thephpleague/flysystem-local/issues",
+ "source": "https://github.com/thephpleague/flysystem-local/tree/3.23.0"
+ },
+ "funding": [
+ {
+ "url": "https://ecologi.com/frankdejonge",
+ "type": "custom"
+ },
+ {
+ "url": "https://github.com/frankdejonge",
+ "type": "github"
+ }
+ ],
+ "time": "2023-12-04T10:14:46+00:00"
+ },
+ {
+ "name": "league/mime-type-detection",
+ "version": "1.14.0",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/thephpleague/mime-type-detection.git",
+ "reference": "b6a5854368533df0295c5761a0253656a2e52d9e"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/thephpleague/mime-type-detection/zipball/b6a5854368533df0295c5761a0253656a2e52d9e",
+ "reference": "b6a5854368533df0295c5761a0253656a2e52d9e",
+ "shasum": ""
+ },
+ "require": {
+ "ext-fileinfo": "*",
+ "php": "^7.4 || ^8.0"
+ },
+ "require-dev": {
+ "friendsofphp/php-cs-fixer": "^3.2",
+ "phpstan/phpstan": "^0.12.68",
+ "phpunit/phpunit": "^8.5.8 || ^9.3 || ^10.0"
+ },
+ "type": "library",
+ "autoload": {
+ "psr-4": {
+ "League\\MimeTypeDetection\\": "src"
+ }
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "authors": [
+ {
+ "name": "Frank de Jonge",
+ "email": "info@frankdejonge.nl"
+ }
+ ],
+ "description": "Mime-type detection for Flysystem",
+ "support": {
+ "issues": "https://github.com/thephpleague/mime-type-detection/issues",
+ "source": "https://github.com/thephpleague/mime-type-detection/tree/1.14.0"
+ },
+ "funding": [
+ {
+ "url": "https://github.com/frankdejonge",
+ "type": "github"
+ },
+ {
+ "url": "https://tidelift.com/funding/github/packagist/league/flysystem",
+ "type": "tidelift"
+ }
+ ],
+ "time": "2023-10-17T14:13:20+00:00"
+ },
+ {
+ "name": "monolog/monolog",
+ "version": "3.5.0",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/Seldaek/monolog.git",
+ "reference": "c915e2634718dbc8a4a15c61b0e62e7a44e14448"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/Seldaek/monolog/zipball/c915e2634718dbc8a4a15c61b0e62e7a44e14448",
+ "reference": "c915e2634718dbc8a4a15c61b0e62e7a44e14448",
+ "shasum": ""
+ },
+ "require": {
+ "php": ">=8.1",
+ "psr/log": "^2.0 || ^3.0"
+ },
+ "provide": {
+ "psr/log-implementation": "3.0.0"
+ },
+ "require-dev": {
+ "aws/aws-sdk-php": "^3.0",
+ "doctrine/couchdb": "~1.0@dev",
+ "elasticsearch/elasticsearch": "^7 || ^8",
+ "ext-json": "*",
+ "graylog2/gelf-php": "^1.4.2 || ^2.0",
+ "guzzlehttp/guzzle": "^7.4.5",
+ "guzzlehttp/psr7": "^2.2",
+ "mongodb/mongodb": "^1.8",
+ "php-amqplib/php-amqplib": "~2.4 || ^3",
+ "phpstan/phpstan": "^1.9",
+ "phpstan/phpstan-deprecation-rules": "^1.0",
+ "phpstan/phpstan-strict-rules": "^1.4",
+ "phpunit/phpunit": "^10.1",
+ "predis/predis": "^1.1 || ^2",
+ "ruflin/elastica": "^7",
+ "symfony/mailer": "^5.4 || ^6",
+ "symfony/mime": "^5.4 || ^6"
+ },
+ "suggest": {
+ "aws/aws-sdk-php": "Allow sending log messages to AWS services like DynamoDB",
+ "doctrine/couchdb": "Allow sending log messages to a CouchDB server",
+ "elasticsearch/elasticsearch": "Allow sending log messages to an Elasticsearch server via official client",
+ "ext-amqp": "Allow sending log messages to an AMQP server (1.0+ required)",
+ "ext-curl": "Required to send log messages using the IFTTTHandler, the LogglyHandler, the SendGridHandler, the SlackWebhookHandler or the TelegramBotHandler",
+ "ext-mbstring": "Allow to work properly with unicode symbols",
+ "ext-mongodb": "Allow sending log messages to a MongoDB server (via driver)",
+ "ext-openssl": "Required to send log messages using SSL",
+ "ext-sockets": "Allow sending log messages to a Syslog server (via UDP driver)",
+ "graylog2/gelf-php": "Allow sending log messages to a GrayLog2 server",
+ "mongodb/mongodb": "Allow sending log messages to a MongoDB server (via library)",
+ "php-amqplib/php-amqplib": "Allow sending log messages to an AMQP server using php-amqplib",
+ "rollbar/rollbar": "Allow sending log messages to Rollbar",
+ "ruflin/elastica": "Allow sending log messages to an Elastic Search server"
+ },
+ "type": "library",
+ "extra": {
+ "branch-alias": {
+ "dev-main": "3.x-dev"
+ }
+ },
+ "autoload": {
+ "psr-4": {
+ "Monolog\\": "src/Monolog"
+ }
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "authors": [
+ {
+ "name": "Jordi Boggiano",
+ "email": "j.boggiano@seld.be",
+ "homepage": "https://seld.be"
+ }
+ ],
+ "description": "Sends your logs to files, sockets, inboxes, databases and various web services",
+ "homepage": "https://github.com/Seldaek/monolog",
+ "keywords": [
+ "log",
+ "logging",
+ "psr-3"
+ ],
+ "support": {
+ "issues": "https://github.com/Seldaek/monolog/issues",
+ "source": "https://github.com/Seldaek/monolog/tree/3.5.0"
+ },
+ "funding": [
+ {
+ "url": "https://github.com/Seldaek",
+ "type": "github"
+ },
+ {
+ "url": "https://tidelift.com/funding/github/packagist/monolog/monolog",
+ "type": "tidelift"
+ }
+ ],
+ "time": "2023-10-27T15:32:31+00:00"
+ },
+ {
+ "name": "nesbot/carbon",
+ "version": "2.72.1",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/briannesbitt/Carbon.git",
+ "reference": "2b3b3db0a2d0556a177392ff1a3bf5608fa09f78"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/briannesbitt/Carbon/zipball/2b3b3db0a2d0556a177392ff1a3bf5608fa09f78",
+ "reference": "2b3b3db0a2d0556a177392ff1a3bf5608fa09f78",
+ "shasum": ""
+ },
+ "require": {
+ "carbonphp/carbon-doctrine-types": "*",
+ "ext-json": "*",
+ "php": "^7.1.8 || ^8.0",
+ "psr/clock": "^1.0",
+ "symfony/polyfill-mbstring": "^1.0",
+ "symfony/polyfill-php80": "^1.16",
+ "symfony/translation": "^3.4 || ^4.0 || ^5.0 || ^6.0"
+ },
+ "provide": {
+ "psr/clock-implementation": "1.0"
+ },
+ "require-dev": {
+ "doctrine/dbal": "^2.0 || ^3.1.4 || ^4.0",
+ "doctrine/orm": "^2.7 || ^3.0",
+ "friendsofphp/php-cs-fixer": "^3.0",
+ "kylekatarnls/multi-tester": "^2.0",
+ "ondrejmirtes/better-reflection": "*",
+ "phpmd/phpmd": "^2.9",
+ "phpstan/extension-installer": "^1.0",
+ "phpstan/phpstan": "^0.12.99 || ^1.7.14",
+ "phpunit/php-file-iterator": "^2.0.5 || ^3.0.6",
+ "phpunit/phpunit": "^7.5.20 || ^8.5.26 || ^9.5.20",
+ "squizlabs/php_codesniffer": "^3.4"
+ },
+ "bin": [
+ "bin/carbon"
+ ],
+ "type": "library",
+ "extra": {
+ "branch-alias": {
+ "dev-3.x": "3.x-dev",
+ "dev-master": "2.x-dev"
+ },
+ "laravel": {
+ "providers": [
+ "Carbon\\Laravel\\ServiceProvider"
+ ]
+ },
+ "phpstan": {
+ "includes": [
+ "extension.neon"
+ ]
+ }
+ },
+ "autoload": {
+ "psr-4": {
+ "Carbon\\": "src/Carbon/"
+ }
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "authors": [
+ {
+ "name": "Brian Nesbitt",
+ "email": "brian@nesbot.com",
+ "homepage": "https://markido.com"
+ },
+ {
+ "name": "kylekatarnls",
+ "homepage": "https://github.com/kylekatarnls"
+ }
+ ],
+ "description": "An API extension for DateTime that supports 281 different languages.",
+ "homepage": "https://carbon.nesbot.com",
+ "keywords": [
+ "date",
+ "datetime",
+ "time"
+ ],
+ "support": {
+ "docs": "https://carbon.nesbot.com/docs",
+ "issues": "https://github.com/briannesbitt/Carbon/issues",
+ "source": "https://github.com/briannesbitt/Carbon"
+ },
+ "funding": [
+ {
+ "url": "https://github.com/sponsors/kylekatarnls",
+ "type": "github"
+ },
+ {
+ "url": "https://opencollective.com/Carbon#sponsor",
+ "type": "opencollective"
+ },
+ {
+ "url": "https://tidelift.com/subscription/pkg/packagist-nesbot-carbon?utm_source=packagist-nesbot-carbon&utm_medium=referral&utm_campaign=readme",
+ "type": "tidelift"
+ }
+ ],
+ "time": "2023-12-08T23:47:49+00:00"
+ },
+ {
+ "name": "nette/schema",
+ "version": "v1.2.5",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/nette/schema.git",
+ "reference": "0462f0166e823aad657c9224d0f849ecac1ba10a"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/nette/schema/zipball/0462f0166e823aad657c9224d0f849ecac1ba10a",
+ "reference": "0462f0166e823aad657c9224d0f849ecac1ba10a",
+ "shasum": ""
+ },
+ "require": {
+ "nette/utils": "^2.5.7 || ^3.1.5 || ^4.0",
+ "php": "7.1 - 8.3"
+ },
+ "require-dev": {
+ "nette/tester": "^2.3 || ^2.4",
+ "phpstan/phpstan-nette": "^1.0",
+ "tracy/tracy": "^2.7"
+ },
+ "type": "library",
+ "extra": {
+ "branch-alias": {
+ "dev-master": "1.2-dev"
+ }
+ },
+ "autoload": {
+ "classmap": [
+ "src/"
+ ]
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "BSD-3-Clause",
+ "GPL-2.0-only",
+ "GPL-3.0-only"
+ ],
+ "authors": [
+ {
+ "name": "David Grudl",
+ "homepage": "https://davidgrudl.com"
+ },
+ {
+ "name": "Nette Community",
+ "homepage": "https://nette.org/contributors"
+ }
+ ],
+ "description": "📐 Nette Schema: validating data structures against a given Schema.",
+ "homepage": "https://nette.org",
+ "keywords": [
+ "config",
+ "nette"
+ ],
+ "support": {
+ "issues": "https://github.com/nette/schema/issues",
+ "source": "https://github.com/nette/schema/tree/v1.2.5"
+ },
+ "time": "2023-10-05T20:37:59+00:00"
+ },
+ {
+ "name": "nette/utils",
+ "version": "v4.0.3",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/nette/utils.git",
+ "reference": "a9d127dd6a203ce6d255b2e2db49759f7506e015"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/nette/utils/zipball/a9d127dd6a203ce6d255b2e2db49759f7506e015",
+ "reference": "a9d127dd6a203ce6d255b2e2db49759f7506e015",
+ "shasum": ""
+ },
+ "require": {
+ "php": ">=8.0 <8.4"
+ },
+ "conflict": {
+ "nette/finder": "<3",
+ "nette/schema": "<1.2.2"
+ },
+ "require-dev": {
+ "jetbrains/phpstorm-attributes": "dev-master",
+ "nette/tester": "^2.5",
+ "phpstan/phpstan": "^1.0",
+ "tracy/tracy": "^2.9"
+ },
+ "suggest": {
+ "ext-gd": "to use Image",
+ "ext-iconv": "to use Strings::webalize(), toAscii(), chr() and reverse()",
+ "ext-intl": "to use Strings::webalize(), toAscii(), normalize() and compare()",
+ "ext-json": "to use Nette\\Utils\\Json",
+ "ext-mbstring": "to use Strings::lower() etc...",
+ "ext-tokenizer": "to use Nette\\Utils\\Reflection::getUseStatements()"
+ },
+ "type": "library",
+ "extra": {
+ "branch-alias": {
+ "dev-master": "4.0-dev"
+ }
+ },
+ "autoload": {
+ "classmap": [
+ "src/"
+ ]
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "BSD-3-Clause",
+ "GPL-2.0-only",
+ "GPL-3.0-only"
+ ],
+ "authors": [
+ {
+ "name": "David Grudl",
+ "homepage": "https://davidgrudl.com"
+ },
+ {
+ "name": "Nette Community",
+ "homepage": "https://nette.org/contributors"
+ }
+ ],
+ "description": "🛠 Nette Utils: lightweight utilities for string & array manipulation, image handling, safe JSON encoding/decoding, validation, slug or strong password generating etc.",
+ "homepage": "https://nette.org",
+ "keywords": [
+ "array",
+ "core",
+ "datetime",
+ "images",
+ "json",
+ "nette",
+ "paginator",
+ "password",
+ "slugify",
+ "string",
+ "unicode",
+ "utf-8",
+ "utility",
+ "validation"
+ ],
+ "support": {
+ "issues": "https://github.com/nette/utils/issues",
+ "source": "https://github.com/nette/utils/tree/v4.0.3"
+ },
+ "time": "2023-10-29T21:02:13+00:00"
+ },
+ {
+ "name": "nikic/php-parser",
+ "version": "v5.0.0",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/nikic/PHP-Parser.git",
+ "reference": "4a21235f7e56e713259a6f76bf4b5ea08502b9dc"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/nikic/PHP-Parser/zipball/4a21235f7e56e713259a6f76bf4b5ea08502b9dc",
+ "reference": "4a21235f7e56e713259a6f76bf4b5ea08502b9dc",
+ "shasum": ""
+ },
+ "require": {
+ "ext-ctype": "*",
+ "ext-json": "*",
+ "ext-tokenizer": "*",
+ "php": ">=7.4"
+ },
+ "require-dev": {
+ "ircmaxell/php-yacc": "^0.0.7",
+ "phpunit/phpunit": "^7.0 || ^8.0 || ^9.0"
+ },
+ "bin": [
+ "bin/php-parse"
+ ],
+ "type": "library",
+ "extra": {
+ "branch-alias": {
+ "dev-master": "5.0-dev"
+ }
+ },
+ "autoload": {
+ "psr-4": {
+ "PhpParser\\": "lib/PhpParser"
+ }
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "BSD-3-Clause"
+ ],
+ "authors": [
+ {
+ "name": "Nikita Popov"
+ }
+ ],
+ "description": "A PHP parser written in PHP",
+ "keywords": [
+ "parser",
+ "php"
+ ],
+ "support": {
+ "issues": "https://github.com/nikic/PHP-Parser/issues",
+ "source": "https://github.com/nikic/PHP-Parser/tree/v5.0.0"
+ },
+ "time": "2024-01-07T17:17:35+00:00"
+ },
+ {
+ "name": "nunomaduro/termwind",
+ "version": "v1.15.1",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/nunomaduro/termwind.git",
+ "reference": "8ab0b32c8caa4a2e09700ea32925441385e4a5dc"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/nunomaduro/termwind/zipball/8ab0b32c8caa4a2e09700ea32925441385e4a5dc",
+ "reference": "8ab0b32c8caa4a2e09700ea32925441385e4a5dc",
+ "shasum": ""
+ },
+ "require": {
+ "ext-mbstring": "*",
+ "php": "^8.0",
+ "symfony/console": "^5.3.0|^6.0.0"
+ },
+ "require-dev": {
+ "ergebnis/phpstan-rules": "^1.0.",
+ "illuminate/console": "^8.0|^9.0",
+ "illuminate/support": "^8.0|^9.0",
+ "laravel/pint": "^1.0.0",
+ "pestphp/pest": "^1.21.0",
+ "pestphp/pest-plugin-mock": "^1.0",
+ "phpstan/phpstan": "^1.4.6",
+ "phpstan/phpstan-strict-rules": "^1.1.0",
+ "symfony/var-dumper": "^5.2.7|^6.0.0",
+ "thecodingmachine/phpstan-strict-rules": "^1.0.0"
+ },
+ "type": "library",
+ "extra": {
+ "laravel": {
+ "providers": [
+ "Termwind\\Laravel\\TermwindServiceProvider"
+ ]
+ }
+ },
+ "autoload": {
+ "files": [
+ "src/Functions.php"
+ ],
+ "psr-4": {
+ "Termwind\\": "src/"
+ }
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "authors": [
+ {
+ "name": "Nuno Maduro",
+ "email": "enunomaduro@gmail.com"
+ }
+ ],
+ "description": "Its like Tailwind CSS, but for the console.",
+ "keywords": [
+ "cli",
+ "console",
+ "css",
+ "package",
+ "php",
+ "style"
+ ],
+ "support": {
+ "issues": "https://github.com/nunomaduro/termwind/issues",
+ "source": "https://github.com/nunomaduro/termwind/tree/v1.15.1"
+ },
+ "funding": [
+ {
+ "url": "https://www.paypal.com/paypalme/enunomaduro",
+ "type": "custom"
+ },
+ {
+ "url": "https://github.com/nunomaduro",
+ "type": "github"
+ },
+ {
+ "url": "https://github.com/xiCO2k",
+ "type": "github"
+ }
+ ],
+ "time": "2023-02-08T01:06:31+00:00"
+ },
+ {
+ "name": "phpoption/phpoption",
+ "version": "1.9.2",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/schmittjoh/php-option.git",
+ "reference": "80735db690fe4fc5c76dfa7f9b770634285fa820"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/schmittjoh/php-option/zipball/80735db690fe4fc5c76dfa7f9b770634285fa820",
+ "reference": "80735db690fe4fc5c76dfa7f9b770634285fa820",
+ "shasum": ""
+ },
+ "require": {
+ "php": "^7.2.5 || ^8.0"
+ },
+ "require-dev": {
+ "bamarni/composer-bin-plugin": "^1.8.2",
+ "phpunit/phpunit": "^8.5.34 || ^9.6.13 || ^10.4.2"
+ },
+ "type": "library",
+ "extra": {
+ "bamarni-bin": {
+ "bin-links": true,
+ "forward-command": true
+ },
+ "branch-alias": {
+ "dev-master": "1.9-dev"
+ }
+ },
+ "autoload": {
+ "psr-4": {
+ "PhpOption\\": "src/PhpOption/"
+ }
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "Apache-2.0"
+ ],
+ "authors": [
+ {
+ "name": "Johannes M. Schmitt",
+ "email": "schmittjoh@gmail.com",
+ "homepage": "https://github.com/schmittjoh"
+ },
+ {
+ "name": "Graham Campbell",
+ "email": "hello@gjcampbell.co.uk",
+ "homepage": "https://github.com/GrahamCampbell"
+ }
+ ],
+ "description": "Option Type for PHP",
+ "keywords": [
+ "language",
+ "option",
+ "php",
+ "type"
+ ],
+ "support": {
+ "issues": "https://github.com/schmittjoh/php-option/issues",
+ "source": "https://github.com/schmittjoh/php-option/tree/1.9.2"
+ },
+ "funding": [
+ {
+ "url": "https://github.com/GrahamCampbell",
+ "type": "github"
+ },
+ {
+ "url": "https://tidelift.com/funding/github/packagist/phpoption/phpoption",
+ "type": "tidelift"
+ }
+ ],
+ "time": "2023-11-12T21:59:55+00:00"
+ },
+ {
+ "name": "psr/clock",
+ "version": "1.0.0",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/php-fig/clock.git",
+ "reference": "e41a24703d4560fd0acb709162f73b8adfc3aa0d"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/php-fig/clock/zipball/e41a24703d4560fd0acb709162f73b8adfc3aa0d",
+ "reference": "e41a24703d4560fd0acb709162f73b8adfc3aa0d",
+ "shasum": ""
+ },
+ "require": {
+ "php": "^7.0 || ^8.0"
+ },
+ "type": "library",
+ "autoload": {
+ "psr-4": {
+ "Psr\\Clock\\": "src/"
+ }
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "authors": [
+ {
+ "name": "PHP-FIG",
+ "homepage": "https://www.php-fig.org/"
+ }
+ ],
+ "description": "Common interface for reading the clock.",
+ "homepage": "https://github.com/php-fig/clock",
+ "keywords": [
+ "clock",
+ "now",
+ "psr",
+ "psr-20",
+ "time"
+ ],
+ "support": {
+ "issues": "https://github.com/php-fig/clock/issues",
+ "source": "https://github.com/php-fig/clock/tree/1.0.0"
+ },
+ "time": "2022-11-25T14:36:26+00:00"
+ },
+ {
+ "name": "psr/container",
+ "version": "2.0.2",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/php-fig/container.git",
+ "reference": "c71ecc56dfe541dbd90c5360474fbc405f8d5963"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/php-fig/container/zipball/c71ecc56dfe541dbd90c5360474fbc405f8d5963",
+ "reference": "c71ecc56dfe541dbd90c5360474fbc405f8d5963",
+ "shasum": ""
+ },
+ "require": {
+ "php": ">=7.4.0"
+ },
+ "type": "library",
+ "extra": {
+ "branch-alias": {
+ "dev-master": "2.0.x-dev"
+ }
+ },
+ "autoload": {
+ "psr-4": {
+ "Psr\\Container\\": "src/"
+ }
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "authors": [
+ {
+ "name": "PHP-FIG",
+ "homepage": "https://www.php-fig.org/"
+ }
+ ],
+ "description": "Common Container Interface (PHP FIG PSR-11)",
+ "homepage": "https://github.com/php-fig/container",
+ "keywords": [
+ "PSR-11",
+ "container",
+ "container-interface",
+ "container-interop",
+ "psr"
+ ],
+ "support": {
+ "issues": "https://github.com/php-fig/container/issues",
+ "source": "https://github.com/php-fig/container/tree/2.0.2"
+ },
+ "time": "2021-11-05T16:47:00+00:00"
+ },
+ {
+ "name": "psr/event-dispatcher",
+ "version": "1.0.0",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/php-fig/event-dispatcher.git",
+ "reference": "dbefd12671e8a14ec7f180cab83036ed26714bb0"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/php-fig/event-dispatcher/zipball/dbefd12671e8a14ec7f180cab83036ed26714bb0",
+ "reference": "dbefd12671e8a14ec7f180cab83036ed26714bb0",
+ "shasum": ""
+ },
+ "require": {
+ "php": ">=7.2.0"
+ },
+ "type": "library",
+ "extra": {
+ "branch-alias": {
+ "dev-master": "1.0.x-dev"
+ }
+ },
+ "autoload": {
+ "psr-4": {
+ "Psr\\EventDispatcher\\": "src/"
+ }
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "authors": [
+ {
+ "name": "PHP-FIG",
+ "homepage": "http://www.php-fig.org/"
+ }
+ ],
+ "description": "Standard interfaces for event handling.",
+ "keywords": [
+ "events",
+ "psr",
+ "psr-14"
+ ],
+ "support": {
+ "issues": "https://github.com/php-fig/event-dispatcher/issues",
+ "source": "https://github.com/php-fig/event-dispatcher/tree/1.0.0"
+ },
+ "time": "2019-01-08T18:20:26+00:00"
+ },
+ {
+ "name": "psr/http-client",
+ "version": "1.0.3",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/php-fig/http-client.git",
+ "reference": "bb5906edc1c324c9a05aa0873d40117941e5fa90"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/php-fig/http-client/zipball/bb5906edc1c324c9a05aa0873d40117941e5fa90",
+ "reference": "bb5906edc1c324c9a05aa0873d40117941e5fa90",
+ "shasum": ""
+ },
+ "require": {
+ "php": "^7.0 || ^8.0",
+ "psr/http-message": "^1.0 || ^2.0"
+ },
+ "type": "library",
+ "extra": {
+ "branch-alias": {
+ "dev-master": "1.0.x-dev"
+ }
+ },
+ "autoload": {
+ "psr-4": {
+ "Psr\\Http\\Client\\": "src/"
+ }
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "authors": [
+ {
+ "name": "PHP-FIG",
+ "homepage": "https://www.php-fig.org/"
+ }
+ ],
+ "description": "Common interface for HTTP clients",
+ "homepage": "https://github.com/php-fig/http-client",
+ "keywords": [
+ "http",
+ "http-client",
+ "psr",
+ "psr-18"
+ ],
+ "support": {
+ "source": "https://github.com/php-fig/http-client"
+ },
+ "time": "2023-09-23T14:17:50+00:00"
+ },
+ {
+ "name": "psr/http-factory",
+ "version": "1.0.2",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/php-fig/http-factory.git",
+ "reference": "e616d01114759c4c489f93b099585439f795fe35"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/php-fig/http-factory/zipball/e616d01114759c4c489f93b099585439f795fe35",
+ "reference": "e616d01114759c4c489f93b099585439f795fe35",
+ "shasum": ""
+ },
+ "require": {
+ "php": ">=7.0.0",
+ "psr/http-message": "^1.0 || ^2.0"
+ },
+ "type": "library",
+ "extra": {
+ "branch-alias": {
+ "dev-master": "1.0.x-dev"
+ }
+ },
+ "autoload": {
+ "psr-4": {
+ "Psr\\Http\\Message\\": "src/"
+ }
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "authors": [
+ {
+ "name": "PHP-FIG",
+ "homepage": "https://www.php-fig.org/"
+ }
+ ],
+ "description": "Common interfaces for PSR-7 HTTP message factories",
+ "keywords": [
+ "factory",
+ "http",
+ "message",
+ "psr",
+ "psr-17",
+ "psr-7",
+ "request",
+ "response"
+ ],
+ "support": {
+ "source": "https://github.com/php-fig/http-factory/tree/1.0.2"
+ },
+ "time": "2023-04-10T20:10:41+00:00"
+ },
+ {
+ "name": "psr/http-message",
+ "version": "2.0",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/php-fig/http-message.git",
+ "reference": "402d35bcb92c70c026d1a6a9883f06b2ead23d71"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/php-fig/http-message/zipball/402d35bcb92c70c026d1a6a9883f06b2ead23d71",
+ "reference": "402d35bcb92c70c026d1a6a9883f06b2ead23d71",
+ "shasum": ""
+ },
+ "require": {
+ "php": "^7.2 || ^8.0"
+ },
+ "type": "library",
+ "extra": {
+ "branch-alias": {
+ "dev-master": "2.0.x-dev"
+ }
+ },
+ "autoload": {
+ "psr-4": {
+ "Psr\\Http\\Message\\": "src/"
+ }
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "authors": [
+ {
+ "name": "PHP-FIG",
+ "homepage": "https://www.php-fig.org/"
+ }
+ ],
+ "description": "Common interface for HTTP messages",
+ "homepage": "https://github.com/php-fig/http-message",
+ "keywords": [
+ "http",
+ "http-message",
+ "psr",
+ "psr-7",
+ "request",
+ "response"
+ ],
+ "support": {
+ "source": "https://github.com/php-fig/http-message/tree/2.0"
+ },
+ "time": "2023-04-04T09:54:51+00:00"
+ },
+ {
+ "name": "psr/log",
+ "version": "3.0.0",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/php-fig/log.git",
+ "reference": "fe5ea303b0887d5caefd3d431c3e61ad47037001"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/php-fig/log/zipball/fe5ea303b0887d5caefd3d431c3e61ad47037001",
+ "reference": "fe5ea303b0887d5caefd3d431c3e61ad47037001",
+ "shasum": ""
+ },
+ "require": {
+ "php": ">=8.0.0"
+ },
+ "type": "library",
+ "extra": {
+ "branch-alias": {
+ "dev-master": "3.x-dev"
+ }
+ },
+ "autoload": {
+ "psr-4": {
+ "Psr\\Log\\": "src"
+ }
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "authors": [
+ {
+ "name": "PHP-FIG",
+ "homepage": "https://www.php-fig.org/"
+ }
+ ],
+ "description": "Common interface for logging libraries",
+ "homepage": "https://github.com/php-fig/log",
+ "keywords": [
+ "log",
+ "psr",
+ "psr-3"
+ ],
+ "support": {
+ "source": "https://github.com/php-fig/log/tree/3.0.0"
+ },
+ "time": "2021-07-14T16:46:02+00:00"
+ },
+ {
+ "name": "psr/simple-cache",
+ "version": "3.0.0",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/php-fig/simple-cache.git",
+ "reference": "764e0b3939f5ca87cb904f570ef9be2d78a07865"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/php-fig/simple-cache/zipball/764e0b3939f5ca87cb904f570ef9be2d78a07865",
+ "reference": "764e0b3939f5ca87cb904f570ef9be2d78a07865",
+ "shasum": ""
+ },
+ "require": {
+ "php": ">=8.0.0"
+ },
+ "type": "library",
+ "extra": {
+ "branch-alias": {
+ "dev-master": "3.0.x-dev"
+ }
+ },
+ "autoload": {
+ "psr-4": {
+ "Psr\\SimpleCache\\": "src/"
+ }
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "authors": [
+ {
+ "name": "PHP-FIG",
+ "homepage": "https://www.php-fig.org/"
+ }
+ ],
+ "description": "Common interfaces for simple caching",
+ "keywords": [
+ "cache",
+ "caching",
+ "psr",
+ "psr-16",
+ "simple-cache"
+ ],
+ "support": {
+ "source": "https://github.com/php-fig/simple-cache/tree/3.0.0"
+ },
+ "time": "2021-10-29T13:26:27+00:00"
+ },
+ {
+ "name": "psy/psysh",
+ "version": "v0.12.0",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/bobthecow/psysh.git",
+ "reference": "750bf031a48fd07c673dbe3f11f72362ea306d0d"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/bobthecow/psysh/zipball/750bf031a48fd07c673dbe3f11f72362ea306d0d",
+ "reference": "750bf031a48fd07c673dbe3f11f72362ea306d0d",
+ "shasum": ""
+ },
+ "require": {
+ "ext-json": "*",
+ "ext-tokenizer": "*",
+ "nikic/php-parser": "^5.0 || ^4.0",
+ "php": "^8.0 || ^7.4",
+ "symfony/console": "^7.0 || ^6.0 || ^5.0 || ^4.0 || ^3.4",
+ "symfony/var-dumper": "^7.0 || ^6.0 || ^5.0 || ^4.0 || ^3.4"
+ },
+ "conflict": {
+ "symfony/console": "4.4.37 || 5.3.14 || 5.3.15 || 5.4.3 || 5.4.4 || 6.0.3 || 6.0.4"
+ },
+ "require-dev": {
+ "bamarni/composer-bin-plugin": "^1.2"
+ },
+ "suggest": {
+ "ext-pcntl": "Enabling the PCNTL extension makes PsySH a lot happier :)",
+ "ext-pdo-sqlite": "The doc command requires SQLite to work.",
+ "ext-posix": "If you have PCNTL, you'll want the POSIX extension as well."
+ },
+ "bin": [
+ "bin/psysh"
+ ],
+ "type": "library",
+ "extra": {
+ "branch-alias": {
+ "dev-main": "0.12.x-dev"
+ },
+ "bamarni-bin": {
+ "bin-links": false,
+ "forward-command": false
+ }
+ },
+ "autoload": {
+ "files": [
+ "src/functions.php"
+ ],
+ "psr-4": {
+ "Psy\\": "src/"
+ }
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "authors": [
+ {
+ "name": "Justin Hileman",
+ "email": "justin@justinhileman.info",
+ "homepage": "http://justinhileman.com"
+ }
+ ],
+ "description": "An interactive shell for modern PHP.",
+ "homepage": "http://psysh.org",
+ "keywords": [
+ "REPL",
+ "console",
+ "interactive",
+ "shell"
+ ],
+ "support": {
+ "issues": "https://github.com/bobthecow/psysh/issues",
+ "source": "https://github.com/bobthecow/psysh/tree/v0.12.0"
+ },
+ "time": "2023-12-20T15:28:09+00:00"
+ },
+ {
+ "name": "ralouphie/getallheaders",
+ "version": "3.0.3",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/ralouphie/getallheaders.git",
+ "reference": "120b605dfeb996808c31b6477290a714d356e822"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/ralouphie/getallheaders/zipball/120b605dfeb996808c31b6477290a714d356e822",
+ "reference": "120b605dfeb996808c31b6477290a714d356e822",
+ "shasum": ""
+ },
+ "require": {
+ "php": ">=5.6"
+ },
+ "require-dev": {
+ "php-coveralls/php-coveralls": "^2.1",
+ "phpunit/phpunit": "^5 || ^6.5"
+ },
+ "type": "library",
+ "autoload": {
+ "files": [
+ "src/getallheaders.php"
+ ]
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "authors": [
+ {
+ "name": "Ralph Khattar",
+ "email": "ralph.khattar@gmail.com"
+ }
+ ],
+ "description": "A polyfill for getallheaders.",
+ "support": {
+ "issues": "https://github.com/ralouphie/getallheaders/issues",
+ "source": "https://github.com/ralouphie/getallheaders/tree/develop"
+ },
+ "time": "2019-03-08T08:55:37+00:00"
+ },
+ {
+ "name": "ramsey/collection",
+ "version": "2.0.0",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/ramsey/collection.git",
+ "reference": "a4b48764bfbb8f3a6a4d1aeb1a35bb5e9ecac4a5"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/ramsey/collection/zipball/a4b48764bfbb8f3a6a4d1aeb1a35bb5e9ecac4a5",
+ "reference": "a4b48764bfbb8f3a6a4d1aeb1a35bb5e9ecac4a5",
+ "shasum": ""
+ },
+ "require": {
+ "php": "^8.1"
+ },
+ "require-dev": {
+ "captainhook/plugin-composer": "^5.3",
+ "ergebnis/composer-normalize": "^2.28.3",
+ "fakerphp/faker": "^1.21",
+ "hamcrest/hamcrest-php": "^2.0",
+ "jangregor/phpstan-prophecy": "^1.0",
+ "mockery/mockery": "^1.5",
+ "php-parallel-lint/php-console-highlighter": "^1.0",
+ "php-parallel-lint/php-parallel-lint": "^1.3",
+ "phpcsstandards/phpcsutils": "^1.0.0-rc1",
+ "phpspec/prophecy-phpunit": "^2.0",
+ "phpstan/extension-installer": "^1.2",
+ "phpstan/phpstan": "^1.9",
+ "phpstan/phpstan-mockery": "^1.1",
+ "phpstan/phpstan-phpunit": "^1.3",
+ "phpunit/phpunit": "^9.5",
+ "psalm/plugin-mockery": "^1.1",
+ "psalm/plugin-phpunit": "^0.18.4",
+ "ramsey/coding-standard": "^2.0.3",
+ "ramsey/conventional-commits": "^1.3",
+ "vimeo/psalm": "^5.4"
+ },
+ "type": "library",
+ "extra": {
+ "captainhook": {
+ "force-install": true
+ },
+ "ramsey/conventional-commits": {
+ "configFile": "conventional-commits.json"
+ }
+ },
+ "autoload": {
+ "psr-4": {
+ "Ramsey\\Collection\\": "src/"
+ }
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "authors": [
+ {
+ "name": "Ben Ramsey",
+ "email": "ben@benramsey.com",
+ "homepage": "https://benramsey.com"
+ }
+ ],
+ "description": "A PHP library for representing and manipulating collections.",
+ "keywords": [
+ "array",
+ "collection",
+ "hash",
+ "map",
+ "queue",
+ "set"
+ ],
+ "support": {
+ "issues": "https://github.com/ramsey/collection/issues",
+ "source": "https://github.com/ramsey/collection/tree/2.0.0"
+ },
+ "funding": [
+ {
+ "url": "https://github.com/ramsey",
+ "type": "github"
+ },
+ {
+ "url": "https://tidelift.com/funding/github/packagist/ramsey/collection",
+ "type": "tidelift"
+ }
+ ],
+ "time": "2022-12-31T21:50:55+00:00"
+ },
+ {
+ "name": "ramsey/uuid",
+ "version": "4.7.5",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/ramsey/uuid.git",
+ "reference": "5f0df49ae5ad6efb7afa69e6bfab4e5b1e080d8e"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/ramsey/uuid/zipball/5f0df49ae5ad6efb7afa69e6bfab4e5b1e080d8e",
+ "reference": "5f0df49ae5ad6efb7afa69e6bfab4e5b1e080d8e",
+ "shasum": ""
+ },
+ "require": {
+ "brick/math": "^0.8.8 || ^0.9 || ^0.10 || ^0.11",
+ "ext-json": "*",
+ "php": "^8.0",
+ "ramsey/collection": "^1.2 || ^2.0"
+ },
+ "replace": {
+ "rhumsaa/uuid": "self.version"
+ },
+ "require-dev": {
+ "captainhook/captainhook": "^5.10",
+ "captainhook/plugin-composer": "^5.3",
+ "dealerdirect/phpcodesniffer-composer-installer": "^0.7.0",
+ "doctrine/annotations": "^1.8",
+ "ergebnis/composer-normalize": "^2.15",
+ "mockery/mockery": "^1.3",
+ "paragonie/random-lib": "^2",
+ "php-mock/php-mock": "^2.2",
+ "php-mock/php-mock-mockery": "^1.3",
+ "php-parallel-lint/php-parallel-lint": "^1.1",
+ "phpbench/phpbench": "^1.0",
+ "phpstan/extension-installer": "^1.1",
+ "phpstan/phpstan": "^1.8",
+ "phpstan/phpstan-mockery": "^1.1",
+ "phpstan/phpstan-phpunit": "^1.1",
+ "phpunit/phpunit": "^8.5 || ^9",
+ "ramsey/composer-repl": "^1.4",
+ "slevomat/coding-standard": "^8.4",
+ "squizlabs/php_codesniffer": "^3.5",
+ "vimeo/psalm": "^4.9"
+ },
+ "suggest": {
+ "ext-bcmath": "Enables faster math with arbitrary-precision integers using BCMath.",
+ "ext-gmp": "Enables faster math with arbitrary-precision integers using GMP.",
+ "ext-uuid": "Enables the use of PeclUuidTimeGenerator and PeclUuidRandomGenerator.",
+ "paragonie/random-lib": "Provides RandomLib for use with the RandomLibAdapter",
+ "ramsey/uuid-doctrine": "Allows the use of Ramsey\\Uuid\\Uuid as Doctrine field type."
+ },
+ "type": "library",
+ "extra": {
+ "captainhook": {
+ "force-install": true
+ }
+ },
+ "autoload": {
+ "files": [
+ "src/functions.php"
+ ],
+ "psr-4": {
+ "Ramsey\\Uuid\\": "src/"
+ }
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "description": "A PHP library for generating and working with universally unique identifiers (UUIDs).",
+ "keywords": [
+ "guid",
+ "identifier",
+ "uuid"
+ ],
+ "support": {
+ "issues": "https://github.com/ramsey/uuid/issues",
+ "source": "https://github.com/ramsey/uuid/tree/4.7.5"
+ },
+ "funding": [
+ {
+ "url": "https://github.com/ramsey",
+ "type": "github"
+ },
+ {
+ "url": "https://tidelift.com/funding/github/packagist/ramsey/uuid",
+ "type": "tidelift"
+ }
+ ],
+ "time": "2023-11-08T05:53:05+00:00"
+ },
+ {
+ "name": "symfony/console",
+ "version": "v6.4.2",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/symfony/console.git",
+ "reference": "0254811a143e6bc6c8deea08b589a7e68a37f625"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/symfony/console/zipball/0254811a143e6bc6c8deea08b589a7e68a37f625",
+ "reference": "0254811a143e6bc6c8deea08b589a7e68a37f625",
+ "shasum": ""
+ },
+ "require": {
+ "php": ">=8.1",
+ "symfony/deprecation-contracts": "^2.5|^3",
+ "symfony/polyfill-mbstring": "~1.0",
+ "symfony/service-contracts": "^2.5|^3",
+ "symfony/string": "^5.4|^6.0|^7.0"
+ },
+ "conflict": {
+ "symfony/dependency-injection": "<5.4",
+ "symfony/dotenv": "<5.4",
+ "symfony/event-dispatcher": "<5.4",
+ "symfony/lock": "<5.4",
+ "symfony/process": "<5.4"
+ },
+ "provide": {
+ "psr/log-implementation": "1.0|2.0|3.0"
+ },
+ "require-dev": {
+ "psr/log": "^1|^2|^3",
+ "symfony/config": "^5.4|^6.0|^7.0",
+ "symfony/dependency-injection": "^5.4|^6.0|^7.0",
+ "symfony/event-dispatcher": "^5.4|^6.0|^7.0",
+ "symfony/http-foundation": "^6.4|^7.0",
+ "symfony/http-kernel": "^6.4|^7.0",
+ "symfony/lock": "^5.4|^6.0|^7.0",
+ "symfony/messenger": "^5.4|^6.0|^7.0",
+ "symfony/process": "^5.4|^6.0|^7.0",
+ "symfony/stopwatch": "^5.4|^6.0|^7.0",
+ "symfony/var-dumper": "^5.4|^6.0|^7.0"
+ },
+ "type": "library",
+ "autoload": {
+ "psr-4": {
+ "Symfony\\Component\\Console\\": ""
+ },
+ "exclude-from-classmap": [
+ "/Tests/"
+ ]
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "authors": [
+ {
+ "name": "Fabien Potencier",
+ "email": "fabien@symfony.com"
+ },
+ {
+ "name": "Symfony Community",
+ "homepage": "https://symfony.com/contributors"
+ }
+ ],
+ "description": "Eases the creation of beautiful and testable command line interfaces",
+ "homepage": "https://symfony.com",
+ "keywords": [
+ "cli",
+ "command-line",
+ "console",
+ "terminal"
+ ],
+ "support": {
+ "source": "https://github.com/symfony/console/tree/v6.4.2"
+ },
+ "funding": [
+ {
+ "url": "https://symfony.com/sponsor",
+ "type": "custom"
+ },
+ {
+ "url": "https://github.com/fabpot",
+ "type": "github"
+ },
+ {
+ "url": "https://tidelift.com/funding/github/packagist/symfony/symfony",
+ "type": "tidelift"
+ }
+ ],
+ "time": "2023-12-10T16:15:48+00:00"
+ },
+ {
+ "name": "symfony/css-selector",
+ "version": "v7.0.0",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/symfony/css-selector.git",
+ "reference": "bb51d46e53ef8d50d523f0c5faedba056a27943e"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/symfony/css-selector/zipball/bb51d46e53ef8d50d523f0c5faedba056a27943e",
+ "reference": "bb51d46e53ef8d50d523f0c5faedba056a27943e",
+ "shasum": ""
+ },
+ "require": {
+ "php": ">=8.2"
+ },
+ "type": "library",
+ "autoload": {
+ "psr-4": {
+ "Symfony\\Component\\CssSelector\\": ""
+ },
+ "exclude-from-classmap": [
+ "/Tests/"
+ ]
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "authors": [
+ {
+ "name": "Fabien Potencier",
+ "email": "fabien@symfony.com"
+ },
+ {
+ "name": "Jean-François Simon",
+ "email": "jeanfrancois.simon@sensiolabs.com"
+ },
+ {
+ "name": "Symfony Community",
+ "homepage": "https://symfony.com/contributors"
+ }
+ ],
+ "description": "Converts CSS selectors to XPath expressions",
+ "homepage": "https://symfony.com",
+ "support": {
+ "source": "https://github.com/symfony/css-selector/tree/v7.0.0"
+ },
+ "funding": [
+ {
+ "url": "https://symfony.com/sponsor",
+ "type": "custom"
+ },
+ {
+ "url": "https://github.com/fabpot",
+ "type": "github"
+ },
+ {
+ "url": "https://tidelift.com/funding/github/packagist/symfony/symfony",
+ "type": "tidelift"
+ }
+ ],
+ "time": "2023-10-31T17:59:56+00:00"
+ },
+ {
+ "name": "symfony/deprecation-contracts",
+ "version": "v3.4.0",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/symfony/deprecation-contracts.git",
+ "reference": "7c3aff79d10325257a001fcf92d991f24fc967cf"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/symfony/deprecation-contracts/zipball/7c3aff79d10325257a001fcf92d991f24fc967cf",
+ "reference": "7c3aff79d10325257a001fcf92d991f24fc967cf",
+ "shasum": ""
+ },
+ "require": {
+ "php": ">=8.1"
+ },
+ "type": "library",
+ "extra": {
+ "branch-alias": {
+ "dev-main": "3.4-dev"
+ },
+ "thanks": {
+ "name": "symfony/contracts",
+ "url": "https://github.com/symfony/contracts"
+ }
+ },
+ "autoload": {
+ "files": [
+ "function.php"
+ ]
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "authors": [
+ {
+ "name": "Nicolas Grekas",
+ "email": "p@tchwork.com"
+ },
+ {
+ "name": "Symfony Community",
+ "homepage": "https://symfony.com/contributors"
+ }
+ ],
+ "description": "A generic function and convention to trigger deprecation notices",
+ "homepage": "https://symfony.com",
+ "support": {
+ "source": "https://github.com/symfony/deprecation-contracts/tree/v3.4.0"
+ },
+ "funding": [
+ {
+ "url": "https://symfony.com/sponsor",
+ "type": "custom"
+ },
+ {
+ "url": "https://github.com/fabpot",
+ "type": "github"
+ },
+ {
+ "url": "https://tidelift.com/funding/github/packagist/symfony/symfony",
+ "type": "tidelift"
+ }
+ ],
+ "time": "2023-05-23T14:45:45+00:00"
+ },
+ {
+ "name": "symfony/error-handler",
+ "version": "v6.4.0",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/symfony/error-handler.git",
+ "reference": "c873490a1c97b3a0a4838afc36ff36c112d02788"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/symfony/error-handler/zipball/c873490a1c97b3a0a4838afc36ff36c112d02788",
+ "reference": "c873490a1c97b3a0a4838afc36ff36c112d02788",
+ "shasum": ""
+ },
+ "require": {
+ "php": ">=8.1",
+ "psr/log": "^1|^2|^3",
+ "symfony/var-dumper": "^5.4|^6.0|^7.0"
+ },
+ "conflict": {
+ "symfony/deprecation-contracts": "<2.5",
+ "symfony/http-kernel": "<6.4"
+ },
+ "require-dev": {
+ "symfony/deprecation-contracts": "^2.5|^3",
+ "symfony/http-kernel": "^6.4|^7.0",
+ "symfony/serializer": "^5.4|^6.0|^7.0"
+ },
+ "bin": [
+ "Resources/bin/patch-type-declarations"
+ ],
+ "type": "library",
+ "autoload": {
+ "psr-4": {
+ "Symfony\\Component\\ErrorHandler\\": ""
+ },
+ "exclude-from-classmap": [
+ "/Tests/"
+ ]
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "authors": [
+ {
+ "name": "Fabien Potencier",
+ "email": "fabien@symfony.com"
+ },
+ {
+ "name": "Symfony Community",
+ "homepage": "https://symfony.com/contributors"
+ }
+ ],
+ "description": "Provides tools to manage errors and ease debugging PHP code",
+ "homepage": "https://symfony.com",
+ "support": {
+ "source": "https://github.com/symfony/error-handler/tree/v6.4.0"
+ },
+ "funding": [
+ {
+ "url": "https://symfony.com/sponsor",
+ "type": "custom"
+ },
+ {
+ "url": "https://github.com/fabpot",
+ "type": "github"
+ },
+ {
+ "url": "https://tidelift.com/funding/github/packagist/symfony/symfony",
+ "type": "tidelift"
+ }
+ ],
+ "time": "2023-10-18T09:43:34+00:00"
+ },
+ {
+ "name": "symfony/event-dispatcher",
+ "version": "v7.0.2",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/symfony/event-dispatcher.git",
+ "reference": "098b62ae81fdd6cbf941f355059f617db28f4f9a"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/symfony/event-dispatcher/zipball/098b62ae81fdd6cbf941f355059f617db28f4f9a",
+ "reference": "098b62ae81fdd6cbf941f355059f617db28f4f9a",
+ "shasum": ""
+ },
+ "require": {
+ "php": ">=8.2",
+ "symfony/event-dispatcher-contracts": "^2.5|^3"
+ },
+ "conflict": {
+ "symfony/dependency-injection": "<6.4",
+ "symfony/service-contracts": "<2.5"
+ },
+ "provide": {
+ "psr/event-dispatcher-implementation": "1.0",
+ "symfony/event-dispatcher-implementation": "2.0|3.0"
+ },
+ "require-dev": {
+ "psr/log": "^1|^2|^3",
+ "symfony/config": "^6.4|^7.0",
+ "symfony/dependency-injection": "^6.4|^7.0",
+ "symfony/error-handler": "^6.4|^7.0",
+ "symfony/expression-language": "^6.4|^7.0",
+ "symfony/http-foundation": "^6.4|^7.0",
+ "symfony/service-contracts": "^2.5|^3",
+ "symfony/stopwatch": "^6.4|^7.0"
+ },
+ "type": "library",
+ "autoload": {
+ "psr-4": {
+ "Symfony\\Component\\EventDispatcher\\": ""
+ },
+ "exclude-from-classmap": [
+ "/Tests/"
+ ]
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "authors": [
+ {
+ "name": "Fabien Potencier",
+ "email": "fabien@symfony.com"
+ },
+ {
+ "name": "Symfony Community",
+ "homepage": "https://symfony.com/contributors"
+ }
+ ],
+ "description": "Provides tools that allow your application components to communicate with each other by dispatching events and listening to them",
+ "homepage": "https://symfony.com",
+ "support": {
+ "source": "https://github.com/symfony/event-dispatcher/tree/v7.0.2"
+ },
+ "funding": [
+ {
+ "url": "https://symfony.com/sponsor",
+ "type": "custom"
+ },
+ {
+ "url": "https://github.com/fabpot",
+ "type": "github"
+ },
+ {
+ "url": "https://tidelift.com/funding/github/packagist/symfony/symfony",
+ "type": "tidelift"
+ }
+ ],
+ "time": "2023-12-27T22:24:19+00:00"
+ },
+ {
+ "name": "symfony/event-dispatcher-contracts",
+ "version": "v3.4.0",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/symfony/event-dispatcher-contracts.git",
+ "reference": "a76aed96a42d2b521153fb382d418e30d18b59df"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/symfony/event-dispatcher-contracts/zipball/a76aed96a42d2b521153fb382d418e30d18b59df",
+ "reference": "a76aed96a42d2b521153fb382d418e30d18b59df",
+ "shasum": ""
+ },
+ "require": {
+ "php": ">=8.1",
+ "psr/event-dispatcher": "^1"
+ },
+ "type": "library",
+ "extra": {
+ "branch-alias": {
+ "dev-main": "3.4-dev"
+ },
+ "thanks": {
+ "name": "symfony/contracts",
+ "url": "https://github.com/symfony/contracts"
+ }
+ },
+ "autoload": {
+ "psr-4": {
+ "Symfony\\Contracts\\EventDispatcher\\": ""
+ }
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "authors": [
+ {
+ "name": "Nicolas Grekas",
+ "email": "p@tchwork.com"
+ },
+ {
+ "name": "Symfony Community",
+ "homepage": "https://symfony.com/contributors"
+ }
+ ],
+ "description": "Generic abstractions related to dispatching event",
+ "homepage": "https://symfony.com",
+ "keywords": [
+ "abstractions",
+ "contracts",
+ "decoupling",
+ "interfaces",
+ "interoperability",
+ "standards"
+ ],
+ "support": {
+ "source": "https://github.com/symfony/event-dispatcher-contracts/tree/v3.4.0"
+ },
+ "funding": [
+ {
+ "url": "https://symfony.com/sponsor",
+ "type": "custom"
+ },
+ {
+ "url": "https://github.com/fabpot",
+ "type": "github"
+ },
+ {
+ "url": "https://tidelift.com/funding/github/packagist/symfony/symfony",
+ "type": "tidelift"
+ }
+ ],
+ "time": "2023-05-23T14:45:45+00:00"
+ },
+ {
+ "name": "symfony/finder",
+ "version": "v6.4.0",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/symfony/finder.git",
+ "reference": "11d736e97f116ac375a81f96e662911a34cd50ce"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/symfony/finder/zipball/11d736e97f116ac375a81f96e662911a34cd50ce",
+ "reference": "11d736e97f116ac375a81f96e662911a34cd50ce",
+ "shasum": ""
+ },
+ "require": {
+ "php": ">=8.1"
+ },
+ "require-dev": {
+ "symfony/filesystem": "^6.0|^7.0"
+ },
+ "type": "library",
+ "autoload": {
+ "psr-4": {
+ "Symfony\\Component\\Finder\\": ""
+ },
+ "exclude-from-classmap": [
+ "/Tests/"
+ ]
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "authors": [
+ {
+ "name": "Fabien Potencier",
+ "email": "fabien@symfony.com"
+ },
+ {
+ "name": "Symfony Community",
+ "homepage": "https://symfony.com/contributors"
+ }
+ ],
+ "description": "Finds files and directories via an intuitive fluent interface",
+ "homepage": "https://symfony.com",
+ "support": {
+ "source": "https://github.com/symfony/finder/tree/v6.4.0"
+ },
+ "funding": [
+ {
+ "url": "https://symfony.com/sponsor",
+ "type": "custom"
+ },
+ {
+ "url": "https://github.com/fabpot",
+ "type": "github"
+ },
+ {
+ "url": "https://tidelift.com/funding/github/packagist/symfony/symfony",
+ "type": "tidelift"
+ }
+ ],
+ "time": "2023-10-31T17:30:12+00:00"
+ },
+ {
+ "name": "symfony/http-foundation",
+ "version": "v6.4.2",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/symfony/http-foundation.git",
+ "reference": "172d807f9ef3fc3fbed8377cc57c20d389269271"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/symfony/http-foundation/zipball/172d807f9ef3fc3fbed8377cc57c20d389269271",
+ "reference": "172d807f9ef3fc3fbed8377cc57c20d389269271",
+ "shasum": ""
+ },
+ "require": {
+ "php": ">=8.1",
+ "symfony/deprecation-contracts": "^2.5|^3",
+ "symfony/polyfill-mbstring": "~1.1",
+ "symfony/polyfill-php83": "^1.27"
+ },
+ "conflict": {
+ "symfony/cache": "<6.3"
+ },
+ "require-dev": {
+ "doctrine/dbal": "^2.13.1|^3|^4",
+ "predis/predis": "^1.1|^2.0",
+ "symfony/cache": "^6.3|^7.0",
+ "symfony/dependency-injection": "^5.4|^6.0|^7.0",
+ "symfony/expression-language": "^5.4|^6.0|^7.0",
+ "symfony/http-kernel": "^5.4.12|^6.0.12|^6.1.4|^7.0",
+ "symfony/mime": "^5.4|^6.0|^7.0",
+ "symfony/rate-limiter": "^5.4|^6.0|^7.0"
+ },
+ "type": "library",
+ "autoload": {
+ "psr-4": {
+ "Symfony\\Component\\HttpFoundation\\": ""
+ },
+ "exclude-from-classmap": [
+ "/Tests/"
+ ]
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "authors": [
+ {
+ "name": "Fabien Potencier",
+ "email": "fabien@symfony.com"
+ },
+ {
+ "name": "Symfony Community",
+ "homepage": "https://symfony.com/contributors"
+ }
+ ],
+ "description": "Defines an object-oriented layer for the HTTP specification",
+ "homepage": "https://symfony.com",
+ "support": {
+ "source": "https://github.com/symfony/http-foundation/tree/v6.4.2"
+ },
+ "funding": [
+ {
+ "url": "https://symfony.com/sponsor",
+ "type": "custom"
+ },
+ {
+ "url": "https://github.com/fabpot",
+ "type": "github"
+ },
+ {
+ "url": "https://tidelift.com/funding/github/packagist/symfony/symfony",
+ "type": "tidelift"
+ }
+ ],
+ "time": "2023-12-27T22:16:42+00:00"
+ },
+ {
+ "name": "symfony/http-kernel",
+ "version": "v6.4.2",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/symfony/http-kernel.git",
+ "reference": "13e8387320b5942d0dc408440c888e2d526efef4"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/symfony/http-kernel/zipball/13e8387320b5942d0dc408440c888e2d526efef4",
+ "reference": "13e8387320b5942d0dc408440c888e2d526efef4",
+ "shasum": ""
+ },
+ "require": {
+ "php": ">=8.1",
+ "psr/log": "^1|^2|^3",
+ "symfony/deprecation-contracts": "^2.5|^3",
+ "symfony/error-handler": "^6.4|^7.0",
+ "symfony/event-dispatcher": "^5.4|^6.0|^7.0",
+ "symfony/http-foundation": "^6.4|^7.0",
+ "symfony/polyfill-ctype": "^1.8"
+ },
+ "conflict": {
+ "symfony/browser-kit": "<5.4",
+ "symfony/cache": "<5.4",
+ "symfony/config": "<6.1",
+ "symfony/console": "<5.4",
+ "symfony/dependency-injection": "<6.4",
+ "symfony/doctrine-bridge": "<5.4",
+ "symfony/form": "<5.4",
+ "symfony/http-client": "<5.4",
+ "symfony/http-client-contracts": "<2.5",
+ "symfony/mailer": "<5.4",
+ "symfony/messenger": "<5.4",
+ "symfony/translation": "<5.4",
+ "symfony/translation-contracts": "<2.5",
+ "symfony/twig-bridge": "<5.4",
+ "symfony/validator": "<6.4",
+ "symfony/var-dumper": "<6.3",
+ "twig/twig": "<2.13"
+ },
+ "provide": {
+ "psr/log-implementation": "1.0|2.0|3.0"
+ },
+ "require-dev": {
+ "psr/cache": "^1.0|^2.0|^3.0",
+ "symfony/browser-kit": "^5.4|^6.0|^7.0",
+ "symfony/clock": "^6.2|^7.0",
+ "symfony/config": "^6.1|^7.0",
+ "symfony/console": "^5.4|^6.0|^7.0",
+ "symfony/css-selector": "^5.4|^6.0|^7.0",
+ "symfony/dependency-injection": "^6.4|^7.0",
+ "symfony/dom-crawler": "^5.4|^6.0|^7.0",
+ "symfony/expression-language": "^5.4|^6.0|^7.0",
+ "symfony/finder": "^5.4|^6.0|^7.0",
+ "symfony/http-client-contracts": "^2.5|^3",
+ "symfony/process": "^5.4|^6.0|^7.0",
+ "symfony/property-access": "^5.4.5|^6.0.5|^7.0",
+ "symfony/routing": "^5.4|^6.0|^7.0",
+ "symfony/serializer": "^6.3|^7.0",
+ "symfony/stopwatch": "^5.4|^6.0|^7.0",
+ "symfony/translation": "^5.4|^6.0|^7.0",
+ "symfony/translation-contracts": "^2.5|^3",
+ "symfony/uid": "^5.4|^6.0|^7.0",
+ "symfony/validator": "^6.4|^7.0",
+ "symfony/var-exporter": "^6.2|^7.0",
+ "twig/twig": "^2.13|^3.0.4"
+ },
+ "type": "library",
+ "autoload": {
+ "psr-4": {
+ "Symfony\\Component\\HttpKernel\\": ""
+ },
+ "exclude-from-classmap": [
+ "/Tests/"
+ ]
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "authors": [
+ {
+ "name": "Fabien Potencier",
+ "email": "fabien@symfony.com"
+ },
+ {
+ "name": "Symfony Community",
+ "homepage": "https://symfony.com/contributors"
+ }
+ ],
+ "description": "Provides a structured process for converting a Request into a Response",
+ "homepage": "https://symfony.com",
+ "support": {
+ "source": "https://github.com/symfony/http-kernel/tree/v6.4.2"
+ },
+ "funding": [
+ {
+ "url": "https://symfony.com/sponsor",
+ "type": "custom"
+ },
+ {
+ "url": "https://github.com/fabpot",
+ "type": "github"
+ },
+ {
+ "url": "https://tidelift.com/funding/github/packagist/symfony/symfony",
+ "type": "tidelift"
+ }
+ ],
+ "time": "2023-12-30T15:31:44+00:00"
+ },
+ {
+ "name": "symfony/mailer",
+ "version": "v6.4.2",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/symfony/mailer.git",
+ "reference": "6da89e5c9202f129717a770a03183fb140720168"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/symfony/mailer/zipball/6da89e5c9202f129717a770a03183fb140720168",
+ "reference": "6da89e5c9202f129717a770a03183fb140720168",
+ "shasum": ""
+ },
+ "require": {
+ "egulias/email-validator": "^2.1.10|^3|^4",
+ "php": ">=8.1",
+ "psr/event-dispatcher": "^1",
+ "psr/log": "^1|^2|^3",
+ "symfony/event-dispatcher": "^5.4|^6.0|^7.0",
+ "symfony/mime": "^6.2|^7.0",
+ "symfony/service-contracts": "^2.5|^3"
+ },
+ "conflict": {
+ "symfony/http-client-contracts": "<2.5",
+ "symfony/http-kernel": "<5.4",
+ "symfony/messenger": "<6.2",
+ "symfony/mime": "<6.2",
+ "symfony/twig-bridge": "<6.2.1"
+ },
+ "require-dev": {
+ "symfony/console": "^5.4|^6.0|^7.0",
+ "symfony/http-client": "^5.4|^6.0|^7.0",
+ "symfony/messenger": "^6.2|^7.0",
+ "symfony/twig-bridge": "^6.2|^7.0"
+ },
+ "type": "library",
+ "autoload": {
+ "psr-4": {
+ "Symfony\\Component\\Mailer\\": ""
+ },
+ "exclude-from-classmap": [
+ "/Tests/"
+ ]
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "authors": [
+ {
+ "name": "Fabien Potencier",
+ "email": "fabien@symfony.com"
+ },
+ {
+ "name": "Symfony Community",
+ "homepage": "https://symfony.com/contributors"
+ }
+ ],
+ "description": "Helps sending emails",
+ "homepage": "https://symfony.com",
+ "support": {
+ "source": "https://github.com/symfony/mailer/tree/v6.4.2"
+ },
+ "funding": [
+ {
+ "url": "https://symfony.com/sponsor",
+ "type": "custom"
+ },
+ {
+ "url": "https://github.com/fabpot",
+ "type": "github"
+ },
+ {
+ "url": "https://tidelift.com/funding/github/packagist/symfony/symfony",
+ "type": "tidelift"
+ }
+ ],
+ "time": "2023-12-19T09:12:31+00:00"
+ },
+ {
+ "name": "symfony/mime",
+ "version": "v6.4.0",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/symfony/mime.git",
+ "reference": "ca4f58b2ef4baa8f6cecbeca2573f88cd577d205"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/symfony/mime/zipball/ca4f58b2ef4baa8f6cecbeca2573f88cd577d205",
+ "reference": "ca4f58b2ef4baa8f6cecbeca2573f88cd577d205",
+ "shasum": ""
+ },
+ "require": {
+ "php": ">=8.1",
+ "symfony/deprecation-contracts": "^2.5|^3",
+ "symfony/polyfill-intl-idn": "^1.10",
+ "symfony/polyfill-mbstring": "^1.0"
+ },
+ "conflict": {
+ "egulias/email-validator": "~3.0.0",
+ "phpdocumentor/reflection-docblock": "<3.2.2",
+ "phpdocumentor/type-resolver": "<1.4.0",
+ "symfony/mailer": "<5.4",
+ "symfony/serializer": "<6.3.2"
+ },
+ "require-dev": {
+ "egulias/email-validator": "^2.1.10|^3.1|^4",
+ "league/html-to-markdown": "^5.0",
+ "phpdocumentor/reflection-docblock": "^3.0|^4.0|^5.0",
+ "symfony/dependency-injection": "^5.4|^6.0|^7.0",
+ "symfony/property-access": "^5.4|^6.0|^7.0",
+ "symfony/property-info": "^5.4|^6.0|^7.0",
+ "symfony/serializer": "^6.3.2|^7.0"
+ },
+ "type": "library",
+ "autoload": {
+ "psr-4": {
+ "Symfony\\Component\\Mime\\": ""
+ },
+ "exclude-from-classmap": [
+ "/Tests/"
+ ]
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "authors": [
+ {
+ "name": "Fabien Potencier",
+ "email": "fabien@symfony.com"
+ },
+ {
+ "name": "Symfony Community",
+ "homepage": "https://symfony.com/contributors"
+ }
+ ],
+ "description": "Allows manipulating MIME messages",
+ "homepage": "https://symfony.com",
+ "keywords": [
+ "mime",
+ "mime-type"
+ ],
+ "support": {
+ "source": "https://github.com/symfony/mime/tree/v6.4.0"
+ },
+ "funding": [
+ {
+ "url": "https://symfony.com/sponsor",
+ "type": "custom"
+ },
+ {
+ "url": "https://github.com/fabpot",
+ "type": "github"
+ },
+ {
+ "url": "https://tidelift.com/funding/github/packagist/symfony/symfony",
+ "type": "tidelift"
+ }
+ ],
+ "time": "2023-10-17T11:49:05+00:00"
+ },
+ {
+ "name": "symfony/polyfill-ctype",
+ "version": "v1.28.0",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/symfony/polyfill-ctype.git",
+ "reference": "ea208ce43cbb04af6867b4fdddb1bdbf84cc28cb"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/symfony/polyfill-ctype/zipball/ea208ce43cbb04af6867b4fdddb1bdbf84cc28cb",
+ "reference": "ea208ce43cbb04af6867b4fdddb1bdbf84cc28cb",
+ "shasum": ""
+ },
+ "require": {
+ "php": ">=7.1"
+ },
+ "provide": {
+ "ext-ctype": "*"
+ },
+ "suggest": {
+ "ext-ctype": "For best performance"
+ },
+ "type": "library",
+ "extra": {
+ "branch-alias": {
+ "dev-main": "1.28-dev"
+ },
+ "thanks": {
+ "name": "symfony/polyfill",
+ "url": "https://github.com/symfony/polyfill"
+ }
+ },
+ "autoload": {
+ "files": [
+ "bootstrap.php"
+ ],
+ "psr-4": {
+ "Symfony\\Polyfill\\Ctype\\": ""
+ }
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "authors": [
+ {
+ "name": "Gert de Pagter",
+ "email": "BackEndTea@gmail.com"
+ },
+ {
+ "name": "Symfony Community",
+ "homepage": "https://symfony.com/contributors"
+ }
+ ],
+ "description": "Symfony polyfill for ctype functions",
+ "homepage": "https://symfony.com",
+ "keywords": [
+ "compatibility",
+ "ctype",
+ "polyfill",
+ "portable"
+ ],
+ "support": {
+ "source": "https://github.com/symfony/polyfill-ctype/tree/v1.28.0"
+ },
+ "funding": [
+ {
+ "url": "https://symfony.com/sponsor",
+ "type": "custom"
+ },
+ {
+ "url": "https://github.com/fabpot",
+ "type": "github"
+ },
+ {
+ "url": "https://tidelift.com/funding/github/packagist/symfony/symfony",
+ "type": "tidelift"
+ }
+ ],
+ "time": "2023-01-26T09:26:14+00:00"
+ },
+ {
+ "name": "symfony/polyfill-intl-grapheme",
+ "version": "v1.28.0",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/symfony/polyfill-intl-grapheme.git",
+ "reference": "875e90aeea2777b6f135677f618529449334a612"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/symfony/polyfill-intl-grapheme/zipball/875e90aeea2777b6f135677f618529449334a612",
+ "reference": "875e90aeea2777b6f135677f618529449334a612",
+ "shasum": ""
+ },
+ "require": {
+ "php": ">=7.1"
+ },
+ "suggest": {
+ "ext-intl": "For best performance"
+ },
+ "type": "library",
+ "extra": {
+ "branch-alias": {
+ "dev-main": "1.28-dev"
+ },
+ "thanks": {
+ "name": "symfony/polyfill",
+ "url": "https://github.com/symfony/polyfill"
+ }
+ },
+ "autoload": {
+ "files": [
+ "bootstrap.php"
+ ],
+ "psr-4": {
+ "Symfony\\Polyfill\\Intl\\Grapheme\\": ""
+ }
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "authors": [
+ {
+ "name": "Nicolas Grekas",
+ "email": "p@tchwork.com"
+ },
+ {
+ "name": "Symfony Community",
+ "homepage": "https://symfony.com/contributors"
+ }
+ ],
+ "description": "Symfony polyfill for intl's grapheme_* functions",
+ "homepage": "https://symfony.com",
+ "keywords": [
+ "compatibility",
+ "grapheme",
+ "intl",
+ "polyfill",
+ "portable",
+ "shim"
+ ],
+ "support": {
+ "source": "https://github.com/symfony/polyfill-intl-grapheme/tree/v1.28.0"
+ },
+ "funding": [
+ {
+ "url": "https://symfony.com/sponsor",
+ "type": "custom"
+ },
+ {
+ "url": "https://github.com/fabpot",
+ "type": "github"
+ },
+ {
+ "url": "https://tidelift.com/funding/github/packagist/symfony/symfony",
+ "type": "tidelift"
+ }
+ ],
+ "time": "2023-01-26T09:26:14+00:00"
+ },
+ {
+ "name": "symfony/polyfill-intl-idn",
+ "version": "v1.28.0",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/symfony/polyfill-intl-idn.git",
+ "reference": "ecaafce9f77234a6a449d29e49267ba10499116d"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/symfony/polyfill-intl-idn/zipball/ecaafce9f77234a6a449d29e49267ba10499116d",
+ "reference": "ecaafce9f77234a6a449d29e49267ba10499116d",
+ "shasum": ""
+ },
+ "require": {
+ "php": ">=7.1",
+ "symfony/polyfill-intl-normalizer": "^1.10",
+ "symfony/polyfill-php72": "^1.10"
+ },
+ "suggest": {
+ "ext-intl": "For best performance"
+ },
+ "type": "library",
+ "extra": {
+ "branch-alias": {
+ "dev-main": "1.28-dev"
+ },
+ "thanks": {
+ "name": "symfony/polyfill",
+ "url": "https://github.com/symfony/polyfill"
+ }
+ },
+ "autoload": {
+ "files": [
+ "bootstrap.php"
+ ],
+ "psr-4": {
+ "Symfony\\Polyfill\\Intl\\Idn\\": ""
+ }
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "authors": [
+ {
+ "name": "Laurent Bassin",
+ "email": "laurent@bassin.info"
+ },
+ {
+ "name": "Trevor Rowbotham",
+ "email": "trevor.rowbotham@pm.me"
+ },
+ {
+ "name": "Symfony Community",
+ "homepage": "https://symfony.com/contributors"
+ }
+ ],
+ "description": "Symfony polyfill for intl's idn_to_ascii and idn_to_utf8 functions",
+ "homepage": "https://symfony.com",
+ "keywords": [
+ "compatibility",
+ "idn",
+ "intl",
+ "polyfill",
+ "portable",
+ "shim"
+ ],
+ "support": {
+ "source": "https://github.com/symfony/polyfill-intl-idn/tree/v1.28.0"
+ },
+ "funding": [
+ {
+ "url": "https://symfony.com/sponsor",
+ "type": "custom"
+ },
+ {
+ "url": "https://github.com/fabpot",
+ "type": "github"
+ },
+ {
+ "url": "https://tidelift.com/funding/github/packagist/symfony/symfony",
+ "type": "tidelift"
+ }
+ ],
+ "time": "2023-01-26T09:30:37+00:00"
+ },
+ {
+ "name": "symfony/polyfill-intl-normalizer",
+ "version": "v1.28.0",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/symfony/polyfill-intl-normalizer.git",
+ "reference": "8c4ad05dd0120b6a53c1ca374dca2ad0a1c4ed92"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/symfony/polyfill-intl-normalizer/zipball/8c4ad05dd0120b6a53c1ca374dca2ad0a1c4ed92",
+ "reference": "8c4ad05dd0120b6a53c1ca374dca2ad0a1c4ed92",
+ "shasum": ""
+ },
+ "require": {
+ "php": ">=7.1"
+ },
+ "suggest": {
+ "ext-intl": "For best performance"
+ },
+ "type": "library",
+ "extra": {
+ "branch-alias": {
+ "dev-main": "1.28-dev"
+ },
+ "thanks": {
+ "name": "symfony/polyfill",
+ "url": "https://github.com/symfony/polyfill"
+ }
+ },
+ "autoload": {
+ "files": [
+ "bootstrap.php"
+ ],
+ "psr-4": {
+ "Symfony\\Polyfill\\Intl\\Normalizer\\": ""
+ },
+ "classmap": [
+ "Resources/stubs"
+ ]
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "authors": [
+ {
+ "name": "Nicolas Grekas",
+ "email": "p@tchwork.com"
+ },
+ {
+ "name": "Symfony Community",
+ "homepage": "https://symfony.com/contributors"
+ }
+ ],
+ "description": "Symfony polyfill for intl's Normalizer class and related functions",
+ "homepage": "https://symfony.com",
+ "keywords": [
+ "compatibility",
+ "intl",
+ "normalizer",
+ "polyfill",
+ "portable",
+ "shim"
+ ],
+ "support": {
+ "source": "https://github.com/symfony/polyfill-intl-normalizer/tree/v1.28.0"
+ },
+ "funding": [
+ {
+ "url": "https://symfony.com/sponsor",
+ "type": "custom"
+ },
+ {
+ "url": "https://github.com/fabpot",
+ "type": "github"
+ },
+ {
+ "url": "https://tidelift.com/funding/github/packagist/symfony/symfony",
+ "type": "tidelift"
+ }
+ ],
+ "time": "2023-01-26T09:26:14+00:00"
+ },
+ {
+ "name": "symfony/polyfill-mbstring",
+ "version": "v1.28.0",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/symfony/polyfill-mbstring.git",
+ "reference": "42292d99c55abe617799667f454222c54c60e229"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/symfony/polyfill-mbstring/zipball/42292d99c55abe617799667f454222c54c60e229",
+ "reference": "42292d99c55abe617799667f454222c54c60e229",
+ "shasum": ""
+ },
+ "require": {
+ "php": ">=7.1"
+ },
+ "provide": {
+ "ext-mbstring": "*"
+ },
+ "suggest": {
+ "ext-mbstring": "For best performance"
+ },
+ "type": "library",
+ "extra": {
+ "branch-alias": {
+ "dev-main": "1.28-dev"
+ },
+ "thanks": {
+ "name": "symfony/polyfill",
+ "url": "https://github.com/symfony/polyfill"
+ }
+ },
+ "autoload": {
+ "files": [
+ "bootstrap.php"
+ ],
+ "psr-4": {
+ "Symfony\\Polyfill\\Mbstring\\": ""
+ }
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "authors": [
+ {
+ "name": "Nicolas Grekas",
+ "email": "p@tchwork.com"
+ },
+ {
+ "name": "Symfony Community",
+ "homepage": "https://symfony.com/contributors"
+ }
+ ],
+ "description": "Symfony polyfill for the Mbstring extension",
+ "homepage": "https://symfony.com",
+ "keywords": [
+ "compatibility",
+ "mbstring",
+ "polyfill",
+ "portable",
+ "shim"
+ ],
+ "support": {
+ "source": "https://github.com/symfony/polyfill-mbstring/tree/v1.28.0"
+ },
+ "funding": [
+ {
+ "url": "https://symfony.com/sponsor",
+ "type": "custom"
+ },
+ {
+ "url": "https://github.com/fabpot",
+ "type": "github"
+ },
+ {
+ "url": "https://tidelift.com/funding/github/packagist/symfony/symfony",
+ "type": "tidelift"
+ }
+ ],
+ "time": "2023-07-28T09:04:16+00:00"
+ },
+ {
+ "name": "symfony/polyfill-php72",
+ "version": "v1.28.0",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/symfony/polyfill-php72.git",
+ "reference": "70f4aebd92afca2f865444d30a4d2151c13c3179"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/symfony/polyfill-php72/zipball/70f4aebd92afca2f865444d30a4d2151c13c3179",
+ "reference": "70f4aebd92afca2f865444d30a4d2151c13c3179",
+ "shasum": ""
+ },
+ "require": {
+ "php": ">=7.1"
+ },
+ "type": "library",
+ "extra": {
+ "branch-alias": {
+ "dev-main": "1.28-dev"
+ },
+ "thanks": {
+ "name": "symfony/polyfill",
+ "url": "https://github.com/symfony/polyfill"
+ }
+ },
+ "autoload": {
+ "files": [
+ "bootstrap.php"
+ ],
+ "psr-4": {
+ "Symfony\\Polyfill\\Php72\\": ""
+ }
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "authors": [
+ {
+ "name": "Nicolas Grekas",
+ "email": "p@tchwork.com"
+ },
+ {
+ "name": "Symfony Community",
+ "homepage": "https://symfony.com/contributors"
+ }
+ ],
+ "description": "Symfony polyfill backporting some PHP 7.2+ features to lower PHP versions",
+ "homepage": "https://symfony.com",
+ "keywords": [
+ "compatibility",
+ "polyfill",
+ "portable",
+ "shim"
+ ],
+ "support": {
+ "source": "https://github.com/symfony/polyfill-php72/tree/v1.28.0"
+ },
+ "funding": [
+ {
+ "url": "https://symfony.com/sponsor",
+ "type": "custom"
+ },
+ {
+ "url": "https://github.com/fabpot",
+ "type": "github"
+ },
+ {
+ "url": "https://tidelift.com/funding/github/packagist/symfony/symfony",
+ "type": "tidelift"
+ }
+ ],
+ "time": "2023-01-26T09:26:14+00:00"
+ },
+ {
+ "name": "symfony/polyfill-php80",
+ "version": "v1.28.0",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/symfony/polyfill-php80.git",
+ "reference": "6caa57379c4aec19c0a12a38b59b26487dcfe4b5"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/symfony/polyfill-php80/zipball/6caa57379c4aec19c0a12a38b59b26487dcfe4b5",
+ "reference": "6caa57379c4aec19c0a12a38b59b26487dcfe4b5",
+ "shasum": ""
+ },
+ "require": {
+ "php": ">=7.1"
+ },
+ "type": "library",
+ "extra": {
+ "branch-alias": {
+ "dev-main": "1.28-dev"
+ },
+ "thanks": {
+ "name": "symfony/polyfill",
+ "url": "https://github.com/symfony/polyfill"
+ }
+ },
+ "autoload": {
+ "files": [
+ "bootstrap.php"
+ ],
+ "psr-4": {
+ "Symfony\\Polyfill\\Php80\\": ""
+ },
+ "classmap": [
+ "Resources/stubs"
+ ]
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "authors": [
+ {
+ "name": "Ion Bazan",
+ "email": "ion.bazan@gmail.com"
+ },
+ {
+ "name": "Nicolas Grekas",
+ "email": "p@tchwork.com"
+ },
+ {
+ "name": "Symfony Community",
+ "homepage": "https://symfony.com/contributors"
+ }
+ ],
+ "description": "Symfony polyfill backporting some PHP 8.0+ features to lower PHP versions",
+ "homepage": "https://symfony.com",
+ "keywords": [
+ "compatibility",
+ "polyfill",
+ "portable",
+ "shim"
+ ],
+ "support": {
+ "source": "https://github.com/symfony/polyfill-php80/tree/v1.28.0"
+ },
+ "funding": [
+ {
+ "url": "https://symfony.com/sponsor",
+ "type": "custom"
+ },
+ {
+ "url": "https://github.com/fabpot",
+ "type": "github"
+ },
+ {
+ "url": "https://tidelift.com/funding/github/packagist/symfony/symfony",
+ "type": "tidelift"
+ }
+ ],
+ "time": "2023-01-26T09:26:14+00:00"
+ },
+ {
+ "name": "symfony/polyfill-php83",
+ "version": "v1.28.0",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/symfony/polyfill-php83.git",
+ "reference": "b0f46ebbeeeda3e9d2faebdfbf4b4eae9b59fa11"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/symfony/polyfill-php83/zipball/b0f46ebbeeeda3e9d2faebdfbf4b4eae9b59fa11",
+ "reference": "b0f46ebbeeeda3e9d2faebdfbf4b4eae9b59fa11",
+ "shasum": ""
+ },
+ "require": {
+ "php": ">=7.1",
+ "symfony/polyfill-php80": "^1.14"
+ },
+ "type": "library",
+ "extra": {
+ "branch-alias": {
+ "dev-main": "1.28-dev"
+ },
+ "thanks": {
+ "name": "symfony/polyfill",
+ "url": "https://github.com/symfony/polyfill"
+ }
+ },
+ "autoload": {
+ "files": [
+ "bootstrap.php"
+ ],
+ "psr-4": {
+ "Symfony\\Polyfill\\Php83\\": ""
+ },
+ "classmap": [
+ "Resources/stubs"
+ ]
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "authors": [
+ {
+ "name": "Nicolas Grekas",
+ "email": "p@tchwork.com"
+ },
+ {
+ "name": "Symfony Community",
+ "homepage": "https://symfony.com/contributors"
+ }
+ ],
+ "description": "Symfony polyfill backporting some PHP 8.3+ features to lower PHP versions",
+ "homepage": "https://symfony.com",
+ "keywords": [
+ "compatibility",
+ "polyfill",
+ "portable",
+ "shim"
+ ],
+ "support": {
+ "source": "https://github.com/symfony/polyfill-php83/tree/v1.28.0"
+ },
+ "funding": [
+ {
+ "url": "https://symfony.com/sponsor",
+ "type": "custom"
+ },
+ {
+ "url": "https://github.com/fabpot",
+ "type": "github"
+ },
+ {
+ "url": "https://tidelift.com/funding/github/packagist/symfony/symfony",
+ "type": "tidelift"
+ }
+ ],
+ "time": "2023-08-16T06:22:46+00:00"
+ },
+ {
+ "name": "symfony/polyfill-uuid",
+ "version": "v1.28.0",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/symfony/polyfill-uuid.git",
+ "reference": "9c44518a5aff8da565c8a55dbe85d2769e6f630e"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/symfony/polyfill-uuid/zipball/9c44518a5aff8da565c8a55dbe85d2769e6f630e",
+ "reference": "9c44518a5aff8da565c8a55dbe85d2769e6f630e",
+ "shasum": ""
+ },
+ "require": {
+ "php": ">=7.1"
+ },
+ "provide": {
+ "ext-uuid": "*"
+ },
+ "suggest": {
+ "ext-uuid": "For best performance"
+ },
+ "type": "library",
+ "extra": {
+ "branch-alias": {
+ "dev-main": "1.28-dev"
+ },
+ "thanks": {
+ "name": "symfony/polyfill",
+ "url": "https://github.com/symfony/polyfill"
+ }
+ },
+ "autoload": {
+ "files": [
+ "bootstrap.php"
+ ],
+ "psr-4": {
+ "Symfony\\Polyfill\\Uuid\\": ""
+ }
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "authors": [
+ {
+ "name": "Grégoire Pineau",
+ "email": "lyrixx@lyrixx.info"
+ },
+ {
+ "name": "Symfony Community",
+ "homepage": "https://symfony.com/contributors"
+ }
+ ],
+ "description": "Symfony polyfill for uuid functions",
+ "homepage": "https://symfony.com",
+ "keywords": [
+ "compatibility",
+ "polyfill",
+ "portable",
+ "uuid"
+ ],
+ "support": {
+ "source": "https://github.com/symfony/polyfill-uuid/tree/v1.28.0"
+ },
+ "funding": [
+ {
+ "url": "https://symfony.com/sponsor",
+ "type": "custom"
+ },
+ {
+ "url": "https://github.com/fabpot",
+ "type": "github"
+ },
+ {
+ "url": "https://tidelift.com/funding/github/packagist/symfony/symfony",
+ "type": "tidelift"
+ }
+ ],
+ "time": "2023-01-26T09:26:14+00:00"
+ },
+ {
+ "name": "symfony/process",
+ "version": "v6.4.2",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/symfony/process.git",
+ "reference": "c4b1ef0bc80533d87a2e969806172f1c2a980241"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/symfony/process/zipball/c4b1ef0bc80533d87a2e969806172f1c2a980241",
+ "reference": "c4b1ef0bc80533d87a2e969806172f1c2a980241",
+ "shasum": ""
+ },
+ "require": {
+ "php": ">=8.1"
+ },
+ "type": "library",
+ "autoload": {
+ "psr-4": {
+ "Symfony\\Component\\Process\\": ""
+ },
+ "exclude-from-classmap": [
+ "/Tests/"
+ ]
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "authors": [
+ {
+ "name": "Fabien Potencier",
+ "email": "fabien@symfony.com"
+ },
+ {
+ "name": "Symfony Community",
+ "homepage": "https://symfony.com/contributors"
+ }
+ ],
+ "description": "Executes commands in sub-processes",
+ "homepage": "https://symfony.com",
+ "support": {
+ "source": "https://github.com/symfony/process/tree/v6.4.2"
+ },
+ "funding": [
+ {
+ "url": "https://symfony.com/sponsor",
+ "type": "custom"
+ },
+ {
+ "url": "https://github.com/fabpot",
+ "type": "github"
+ },
+ {
+ "url": "https://tidelift.com/funding/github/packagist/symfony/symfony",
+ "type": "tidelift"
+ }
+ ],
+ "time": "2023-12-22T16:42:54+00:00"
+ },
+ {
+ "name": "symfony/routing",
+ "version": "v6.4.2",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/symfony/routing.git",
+ "reference": "98eab13a07fddc85766f1756129c69f207ffbc21"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/symfony/routing/zipball/98eab13a07fddc85766f1756129c69f207ffbc21",
+ "reference": "98eab13a07fddc85766f1756129c69f207ffbc21",
+ "shasum": ""
+ },
+ "require": {
+ "php": ">=8.1",
+ "symfony/deprecation-contracts": "^2.5|^3"
+ },
+ "conflict": {
+ "doctrine/annotations": "<1.12",
+ "symfony/config": "<6.2",
+ "symfony/dependency-injection": "<5.4",
+ "symfony/yaml": "<5.4"
+ },
+ "require-dev": {
+ "doctrine/annotations": "^1.12|^2",
+ "psr/log": "^1|^2|^3",
+ "symfony/config": "^6.2|^7.0",
+ "symfony/dependency-injection": "^5.4|^6.0|^7.0",
+ "symfony/expression-language": "^5.4|^6.0|^7.0",
+ "symfony/http-foundation": "^5.4|^6.0|^7.0",
+ "symfony/yaml": "^5.4|^6.0|^7.0"
+ },
+ "type": "library",
+ "autoload": {
+ "psr-4": {
+ "Symfony\\Component\\Routing\\": ""
+ },
+ "exclude-from-classmap": [
+ "/Tests/"
+ ]
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "authors": [
+ {
+ "name": "Fabien Potencier",
+ "email": "fabien@symfony.com"
+ },
+ {
+ "name": "Symfony Community",
+ "homepage": "https://symfony.com/contributors"
+ }
+ ],
+ "description": "Maps an HTTP request to a set of configuration variables",
+ "homepage": "https://symfony.com",
+ "keywords": [
+ "router",
+ "routing",
+ "uri",
+ "url"
+ ],
+ "support": {
+ "source": "https://github.com/symfony/routing/tree/v6.4.2"
+ },
+ "funding": [
+ {
+ "url": "https://symfony.com/sponsor",
+ "type": "custom"
+ },
+ {
+ "url": "https://github.com/fabpot",
+ "type": "github"
+ },
+ {
+ "url": "https://tidelift.com/funding/github/packagist/symfony/symfony",
+ "type": "tidelift"
+ }
+ ],
+ "time": "2023-12-29T15:34:34+00:00"
+ },
+ {
+ "name": "symfony/service-contracts",
+ "version": "v3.4.1",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/symfony/service-contracts.git",
+ "reference": "fe07cbc8d837f60caf7018068e350cc5163681a0"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/symfony/service-contracts/zipball/fe07cbc8d837f60caf7018068e350cc5163681a0",
+ "reference": "fe07cbc8d837f60caf7018068e350cc5163681a0",
+ "shasum": ""
+ },
+ "require": {
+ "php": ">=8.1",
+ "psr/container": "^1.1|^2.0"
+ },
+ "conflict": {
+ "ext-psr": "<1.1|>=2"
+ },
+ "type": "library",
+ "extra": {
+ "branch-alias": {
+ "dev-main": "3.4-dev"
+ },
+ "thanks": {
+ "name": "symfony/contracts",
+ "url": "https://github.com/symfony/contracts"
+ }
+ },
+ "autoload": {
+ "psr-4": {
+ "Symfony\\Contracts\\Service\\": ""
+ },
+ "exclude-from-classmap": [
+ "/Test/"
+ ]
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "authors": [
+ {
+ "name": "Nicolas Grekas",
+ "email": "p@tchwork.com"
+ },
+ {
+ "name": "Symfony Community",
+ "homepage": "https://symfony.com/contributors"
+ }
+ ],
+ "description": "Generic abstractions related to writing services",
+ "homepage": "https://symfony.com",
+ "keywords": [
+ "abstractions",
+ "contracts",
+ "decoupling",
+ "interfaces",
+ "interoperability",
+ "standards"
+ ],
+ "support": {
+ "source": "https://github.com/symfony/service-contracts/tree/v3.4.1"
+ },
+ "funding": [
+ {
+ "url": "https://symfony.com/sponsor",
+ "type": "custom"
+ },
+ {
+ "url": "https://github.com/fabpot",
+ "type": "github"
+ },
+ {
+ "url": "https://tidelift.com/funding/github/packagist/symfony/symfony",
+ "type": "tidelift"
+ }
+ ],
+ "time": "2023-12-26T14:02:43+00:00"
+ },
+ {
+ "name": "symfony/string",
+ "version": "v7.0.2",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/symfony/string.git",
+ "reference": "cc78f14f91f5e53b42044d0620961c48028ff9f5"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/symfony/string/zipball/cc78f14f91f5e53b42044d0620961c48028ff9f5",
+ "reference": "cc78f14f91f5e53b42044d0620961c48028ff9f5",
+ "shasum": ""
+ },
+ "require": {
+ "php": ">=8.2",
+ "symfony/polyfill-ctype": "~1.8",
+ "symfony/polyfill-intl-grapheme": "~1.0",
+ "symfony/polyfill-intl-normalizer": "~1.0",
+ "symfony/polyfill-mbstring": "~1.0"
+ },
+ "conflict": {
+ "symfony/translation-contracts": "<2.5"
+ },
+ "require-dev": {
+ "symfony/error-handler": "^6.4|^7.0",
+ "symfony/http-client": "^6.4|^7.0",
+ "symfony/intl": "^6.4|^7.0",
+ "symfony/translation-contracts": "^2.5|^3.0",
+ "symfony/var-exporter": "^6.4|^7.0"
+ },
+ "type": "library",
+ "autoload": {
+ "files": [
+ "Resources/functions.php"
+ ],
+ "psr-4": {
+ "Symfony\\Component\\String\\": ""
+ },
+ "exclude-from-classmap": [
+ "/Tests/"
+ ]
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "authors": [
+ {
+ "name": "Nicolas Grekas",
+ "email": "p@tchwork.com"
+ },
+ {
+ "name": "Symfony Community",
+ "homepage": "https://symfony.com/contributors"
+ }
+ ],
+ "description": "Provides an object-oriented API to strings and deals with bytes, UTF-8 code points and grapheme clusters in a unified way",
+ "homepage": "https://symfony.com",
+ "keywords": [
+ "grapheme",
+ "i18n",
+ "string",
+ "unicode",
+ "utf-8",
+ "utf8"
+ ],
+ "support": {
+ "source": "https://github.com/symfony/string/tree/v7.0.2"
+ },
+ "funding": [
+ {
+ "url": "https://symfony.com/sponsor",
+ "type": "custom"
+ },
+ {
+ "url": "https://github.com/fabpot",
+ "type": "github"
+ },
+ {
+ "url": "https://tidelift.com/funding/github/packagist/symfony/symfony",
+ "type": "tidelift"
+ }
+ ],
+ "time": "2023-12-10T16:54:46+00:00"
+ },
+ {
+ "name": "symfony/translation",
+ "version": "v6.4.2",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/symfony/translation.git",
+ "reference": "a2ab2ec1a462e53016de8e8d5e8912bfd62ea681"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/symfony/translation/zipball/a2ab2ec1a462e53016de8e8d5e8912bfd62ea681",
+ "reference": "a2ab2ec1a462e53016de8e8d5e8912bfd62ea681",
+ "shasum": ""
+ },
+ "require": {
+ "php": ">=8.1",
+ "symfony/deprecation-contracts": "^2.5|^3",
+ "symfony/polyfill-mbstring": "~1.0",
+ "symfony/translation-contracts": "^2.5|^3.0"
+ },
+ "conflict": {
+ "symfony/config": "<5.4",
+ "symfony/console": "<5.4",
+ "symfony/dependency-injection": "<5.4",
+ "symfony/http-client-contracts": "<2.5",
+ "symfony/http-kernel": "<5.4",
+ "symfony/service-contracts": "<2.5",
+ "symfony/twig-bundle": "<5.4",
+ "symfony/yaml": "<5.4"
+ },
+ "provide": {
+ "symfony/translation-implementation": "2.3|3.0"
+ },
+ "require-dev": {
+ "nikic/php-parser": "^4.13",
+ "psr/log": "^1|^2|^3",
+ "symfony/config": "^5.4|^6.0|^7.0",
+ "symfony/console": "^5.4|^6.0|^7.0",
+ "symfony/dependency-injection": "^5.4|^6.0|^7.0",
+ "symfony/finder": "^5.4|^6.0|^7.0",
+ "symfony/http-client-contracts": "^2.5|^3.0",
+ "symfony/http-kernel": "^5.4|^6.0|^7.0",
+ "symfony/intl": "^5.4|^6.0|^7.0",
+ "symfony/polyfill-intl-icu": "^1.21",
+ "symfony/routing": "^5.4|^6.0|^7.0",
+ "symfony/service-contracts": "^2.5|^3",
+ "symfony/yaml": "^5.4|^6.0|^7.0"
+ },
+ "type": "library",
+ "autoload": {
+ "files": [
+ "Resources/functions.php"
+ ],
+ "psr-4": {
+ "Symfony\\Component\\Translation\\": ""
+ },
+ "exclude-from-classmap": [
+ "/Tests/"
+ ]
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "authors": [
+ {
+ "name": "Fabien Potencier",
+ "email": "fabien@symfony.com"
+ },
+ {
+ "name": "Symfony Community",
+ "homepage": "https://symfony.com/contributors"
+ }
+ ],
+ "description": "Provides tools to internationalize your application",
+ "homepage": "https://symfony.com",
+ "support": {
+ "source": "https://github.com/symfony/translation/tree/v6.4.2"
+ },
+ "funding": [
+ {
+ "url": "https://symfony.com/sponsor",
+ "type": "custom"
+ },
+ {
+ "url": "https://github.com/fabpot",
+ "type": "github"
+ },
+ {
+ "url": "https://tidelift.com/funding/github/packagist/symfony/symfony",
+ "type": "tidelift"
+ }
+ ],
+ "time": "2023-12-18T09:25:29+00:00"
+ },
+ {
+ "name": "symfony/translation-contracts",
+ "version": "v3.4.1",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/symfony/translation-contracts.git",
+ "reference": "06450585bf65e978026bda220cdebca3f867fde7"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/symfony/translation-contracts/zipball/06450585bf65e978026bda220cdebca3f867fde7",
+ "reference": "06450585bf65e978026bda220cdebca3f867fde7",
+ "shasum": ""
+ },
+ "require": {
+ "php": ">=8.1"
+ },
+ "type": "library",
+ "extra": {
+ "branch-alias": {
+ "dev-main": "3.4-dev"
+ },
+ "thanks": {
+ "name": "symfony/contracts",
+ "url": "https://github.com/symfony/contracts"
+ }
+ },
+ "autoload": {
+ "psr-4": {
+ "Symfony\\Contracts\\Translation\\": ""
+ },
+ "exclude-from-classmap": [
+ "/Test/"
+ ]
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "authors": [
+ {
+ "name": "Nicolas Grekas",
+ "email": "p@tchwork.com"
+ },
+ {
+ "name": "Symfony Community",
+ "homepage": "https://symfony.com/contributors"
+ }
+ ],
+ "description": "Generic abstractions related to translation",
+ "homepage": "https://symfony.com",
+ "keywords": [
+ "abstractions",
+ "contracts",
+ "decoupling",
+ "interfaces",
+ "interoperability",
+ "standards"
+ ],
+ "support": {
+ "source": "https://github.com/symfony/translation-contracts/tree/v3.4.1"
+ },
+ "funding": [
+ {
+ "url": "https://symfony.com/sponsor",
+ "type": "custom"
+ },
+ {
+ "url": "https://github.com/fabpot",
+ "type": "github"
+ },
+ {
+ "url": "https://tidelift.com/funding/github/packagist/symfony/symfony",
+ "type": "tidelift"
+ }
+ ],
+ "time": "2023-12-26T14:02:43+00:00"
+ },
+ {
+ "name": "symfony/uid",
+ "version": "v6.4.0",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/symfony/uid.git",
+ "reference": "8092dd1b1a41372110d06374f99ee62f7f0b9a92"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/symfony/uid/zipball/8092dd1b1a41372110d06374f99ee62f7f0b9a92",
+ "reference": "8092dd1b1a41372110d06374f99ee62f7f0b9a92",
+ "shasum": ""
+ },
+ "require": {
+ "php": ">=8.1",
+ "symfony/polyfill-uuid": "^1.15"
+ },
+ "require-dev": {
+ "symfony/console": "^5.4|^6.0|^7.0"
+ },
+ "type": "library",
+ "autoload": {
+ "psr-4": {
+ "Symfony\\Component\\Uid\\": ""
+ },
+ "exclude-from-classmap": [
+ "/Tests/"
+ ]
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "authors": [
+ {
+ "name": "Grégoire Pineau",
+ "email": "lyrixx@lyrixx.info"
+ },
+ {
+ "name": "Nicolas Grekas",
+ "email": "p@tchwork.com"
+ },
+ {
+ "name": "Symfony Community",
+ "homepage": "https://symfony.com/contributors"
+ }
+ ],
+ "description": "Provides an object-oriented API to generate and represent UIDs",
+ "homepage": "https://symfony.com",
+ "keywords": [
+ "UID",
+ "ulid",
+ "uuid"
+ ],
+ "support": {
+ "source": "https://github.com/symfony/uid/tree/v6.4.0"
+ },
+ "funding": [
+ {
+ "url": "https://symfony.com/sponsor",
+ "type": "custom"
+ },
+ {
+ "url": "https://github.com/fabpot",
+ "type": "github"
+ },
+ {
+ "url": "https://tidelift.com/funding/github/packagist/symfony/symfony",
+ "type": "tidelift"
+ }
+ ],
+ "time": "2023-10-31T08:18:17+00:00"
+ },
+ {
+ "name": "symfony/var-dumper",
+ "version": "v6.4.2",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/symfony/var-dumper.git",
+ "reference": "68d6573ec98715ddcae5a0a85bee3c1c27a4c33f"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/symfony/var-dumper/zipball/68d6573ec98715ddcae5a0a85bee3c1c27a4c33f",
+ "reference": "68d6573ec98715ddcae5a0a85bee3c1c27a4c33f",
+ "shasum": ""
+ },
+ "require": {
+ "php": ">=8.1",
+ "symfony/deprecation-contracts": "^2.5|^3",
+ "symfony/polyfill-mbstring": "~1.0"
+ },
+ "conflict": {
+ "symfony/console": "<5.4"
+ },
+ "require-dev": {
+ "ext-iconv": "*",
+ "symfony/console": "^5.4|^6.0|^7.0",
+ "symfony/error-handler": "^6.3|^7.0",
+ "symfony/http-kernel": "^5.4|^6.0|^7.0",
+ "symfony/process": "^5.4|^6.0|^7.0",
+ "symfony/uid": "^5.4|^6.0|^7.0",
+ "twig/twig": "^2.13|^3.0.4"
+ },
+ "bin": [
+ "Resources/bin/var-dump-server"
+ ],
+ "type": "library",
+ "autoload": {
+ "files": [
+ "Resources/functions/dump.php"
+ ],
+ "psr-4": {
+ "Symfony\\Component\\VarDumper\\": ""
+ },
+ "exclude-from-classmap": [
+ "/Tests/"
+ ]
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "authors": [
+ {
+ "name": "Nicolas Grekas",
+ "email": "p@tchwork.com"
+ },
+ {
+ "name": "Symfony Community",
+ "homepage": "https://symfony.com/contributors"
+ }
+ ],
+ "description": "Provides mechanisms for walking through any arbitrary PHP variable",
+ "homepage": "https://symfony.com",
+ "keywords": [
+ "debug",
+ "dump"
+ ],
+ "support": {
+ "source": "https://github.com/symfony/var-dumper/tree/v6.4.2"
+ },
+ "funding": [
+ {
+ "url": "https://symfony.com/sponsor",
+ "type": "custom"
+ },
+ {
+ "url": "https://github.com/fabpot",
+ "type": "github"
+ },
+ {
+ "url": "https://tidelift.com/funding/github/packagist/symfony/symfony",
+ "type": "tidelift"
+ }
+ ],
+ "time": "2023-12-28T19:16:56+00:00"
+ },
+ {
+ "name": "tijsverkoyen/css-to-inline-styles",
+ "version": "v2.2.7",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/tijsverkoyen/CssToInlineStyles.git",
+ "reference": "83ee6f38df0a63106a9e4536e3060458b74ccedb"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/tijsverkoyen/CssToInlineStyles/zipball/83ee6f38df0a63106a9e4536e3060458b74ccedb",
+ "reference": "83ee6f38df0a63106a9e4536e3060458b74ccedb",
+ "shasum": ""
+ },
+ "require": {
+ "ext-dom": "*",
+ "ext-libxml": "*",
+ "php": "^5.5 || ^7.0 || ^8.0",
+ "symfony/css-selector": "^2.7 || ^3.0 || ^4.0 || ^5.0 || ^6.0 || ^7.0"
+ },
+ "require-dev": {
+ "phpunit/phpunit": "^4.8.35 || ^5.7 || ^6.0 || ^7.5 || ^8.5.21 || ^9.5.10"
+ },
+ "type": "library",
+ "extra": {
+ "branch-alias": {
+ "dev-master": "2.2.x-dev"
+ }
+ },
+ "autoload": {
+ "psr-4": {
+ "TijsVerkoyen\\CssToInlineStyles\\": "src"
+ }
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "BSD-3-Clause"
+ ],
+ "authors": [
+ {
+ "name": "Tijs Verkoyen",
+ "email": "css_to_inline_styles@verkoyen.eu",
+ "role": "Developer"
+ }
+ ],
+ "description": "CssToInlineStyles is a class that enables you to convert HTML-pages/files into HTML-pages/files with inline styles. This is very useful when you're sending emails.",
+ "homepage": "https://github.com/tijsverkoyen/CssToInlineStyles",
+ "support": {
+ "issues": "https://github.com/tijsverkoyen/CssToInlineStyles/issues",
+ "source": "https://github.com/tijsverkoyen/CssToInlineStyles/tree/v2.2.7"
+ },
+ "time": "2023-12-08T13:03:43+00:00"
+ },
+ {
+ "name": "vlucas/phpdotenv",
+ "version": "v5.6.0",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/vlucas/phpdotenv.git",
+ "reference": "2cf9fb6054c2bb1d59d1f3817706ecdb9d2934c4"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/vlucas/phpdotenv/zipball/2cf9fb6054c2bb1d59d1f3817706ecdb9d2934c4",
+ "reference": "2cf9fb6054c2bb1d59d1f3817706ecdb9d2934c4",
+ "shasum": ""
+ },
+ "require": {
+ "ext-pcre": "*",
+ "graham-campbell/result-type": "^1.1.2",
+ "php": "^7.2.5 || ^8.0",
+ "phpoption/phpoption": "^1.9.2",
+ "symfony/polyfill-ctype": "^1.24",
+ "symfony/polyfill-mbstring": "^1.24",
+ "symfony/polyfill-php80": "^1.24"
+ },
+ "require-dev": {
+ "bamarni/composer-bin-plugin": "^1.8.2",
+ "ext-filter": "*",
+ "phpunit/phpunit": "^8.5.34 || ^9.6.13 || ^10.4.2"
+ },
+ "suggest": {
+ "ext-filter": "Required to use the boolean validator."
+ },
+ "type": "library",
+ "extra": {
+ "bamarni-bin": {
+ "bin-links": true,
+ "forward-command": true
+ },
+ "branch-alias": {
+ "dev-master": "5.6-dev"
+ }
+ },
+ "autoload": {
+ "psr-4": {
+ "Dotenv\\": "src/"
+ }
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "BSD-3-Clause"
+ ],
+ "authors": [
+ {
+ "name": "Graham Campbell",
+ "email": "hello@gjcampbell.co.uk",
+ "homepage": "https://github.com/GrahamCampbell"
+ },
+ {
+ "name": "Vance Lucas",
+ "email": "vance@vancelucas.com",
+ "homepage": "https://github.com/vlucas"
+ }
+ ],
+ "description": "Loads environment variables from `.env` to `getenv()`, `$_ENV` and `$_SERVER` automagically.",
+ "keywords": [
+ "dotenv",
+ "env",
+ "environment"
+ ],
+ "support": {
+ "issues": "https://github.com/vlucas/phpdotenv/issues",
+ "source": "https://github.com/vlucas/phpdotenv/tree/v5.6.0"
+ },
+ "funding": [
+ {
+ "url": "https://github.com/GrahamCampbell",
+ "type": "github"
+ },
+ {
+ "url": "https://tidelift.com/funding/github/packagist/vlucas/phpdotenv",
+ "type": "tidelift"
+ }
+ ],
+ "time": "2023-11-12T22:43:29+00:00"
+ },
+ {
+ "name": "voku/portable-ascii",
+ "version": "2.0.1",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/voku/portable-ascii.git",
+ "reference": "b56450eed252f6801410d810c8e1727224ae0743"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/voku/portable-ascii/zipball/b56450eed252f6801410d810c8e1727224ae0743",
+ "reference": "b56450eed252f6801410d810c8e1727224ae0743",
+ "shasum": ""
+ },
+ "require": {
+ "php": ">=7.0.0"
+ },
+ "require-dev": {
+ "phpunit/phpunit": "~6.0 || ~7.0 || ~9.0"
+ },
+ "suggest": {
+ "ext-intl": "Use Intl for transliterator_transliterate() support"
+ },
+ "type": "library",
+ "autoload": {
+ "psr-4": {
+ "voku\\": "src/voku/"
+ }
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "authors": [
+ {
+ "name": "Lars Moelleken",
+ "homepage": "http://www.moelleken.org/"
+ }
+ ],
+ "description": "Portable ASCII library - performance optimized (ascii) string functions for php.",
+ "homepage": "https://github.com/voku/portable-ascii",
+ "keywords": [
+ "ascii",
+ "clean",
+ "php"
+ ],
+ "support": {
+ "issues": "https://github.com/voku/portable-ascii/issues",
+ "source": "https://github.com/voku/portable-ascii/tree/2.0.1"
+ },
+ "funding": [
+ {
+ "url": "https://www.paypal.me/moelleken",
+ "type": "custom"
+ },
+ {
+ "url": "https://github.com/voku",
+ "type": "github"
+ },
+ {
+ "url": "https://opencollective.com/portable-ascii",
+ "type": "open_collective"
+ },
+ {
+ "url": "https://www.patreon.com/voku",
+ "type": "patreon"
+ },
+ {
+ "url": "https://tidelift.com/funding/github/packagist/voku/portable-ascii",
+ "type": "tidelift"
+ }
+ ],
+ "time": "2022-03-08T17:03:00+00:00"
+ },
+ {
+ "name": "webmozart/assert",
+ "version": "1.11.0",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/webmozarts/assert.git",
+ "reference": "11cb2199493b2f8a3b53e7f19068fc6aac760991"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/webmozarts/assert/zipball/11cb2199493b2f8a3b53e7f19068fc6aac760991",
+ "reference": "11cb2199493b2f8a3b53e7f19068fc6aac760991",
+ "shasum": ""
+ },
+ "require": {
+ "ext-ctype": "*",
+ "php": "^7.2 || ^8.0"
+ },
+ "conflict": {
+ "phpstan/phpstan": "<0.12.20",
+ "vimeo/psalm": "<4.6.1 || 4.6.2"
+ },
+ "require-dev": {
+ "phpunit/phpunit": "^8.5.13"
+ },
+ "type": "library",
+ "extra": {
+ "branch-alias": {
+ "dev-master": "1.10-dev"
+ }
+ },
+ "autoload": {
+ "psr-4": {
+ "Webmozart\\Assert\\": "src/"
+ }
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "authors": [
+ {
+ "name": "Bernhard Schussek",
+ "email": "bschussek@gmail.com"
+ }
+ ],
+ "description": "Assertions to validate method input/output with nice error messages.",
+ "keywords": [
+ "assert",
+ "check",
+ "validate"
+ ],
+ "support": {
+ "issues": "https://github.com/webmozarts/assert/issues",
+ "source": "https://github.com/webmozarts/assert/tree/1.11.0"
+ },
+ "time": "2022-06-03T18:03:27+00:00"
+ }
+ ],
+ "packages-dev": [
+ {
+ "name": "fakerphp/faker",
+ "version": "v1.23.1",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/FakerPHP/Faker.git",
+ "reference": "bfb4fe148adbf78eff521199619b93a52ae3554b"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/FakerPHP/Faker/zipball/bfb4fe148adbf78eff521199619b93a52ae3554b",
+ "reference": "bfb4fe148adbf78eff521199619b93a52ae3554b",
+ "shasum": ""
+ },
+ "require": {
+ "php": "^7.4 || ^8.0",
+ "psr/container": "^1.0 || ^2.0",
+ "symfony/deprecation-contracts": "^2.2 || ^3.0"
+ },
+ "conflict": {
+ "fzaninotto/faker": "*"
+ },
+ "require-dev": {
+ "bamarni/composer-bin-plugin": "^1.4.1",
+ "doctrine/persistence": "^1.3 || ^2.0",
+ "ext-intl": "*",
+ "phpunit/phpunit": "^9.5.26",
+ "symfony/phpunit-bridge": "^5.4.16"
+ },
+ "suggest": {
+ "doctrine/orm": "Required to use Faker\\ORM\\Doctrine",
+ "ext-curl": "Required by Faker\\Provider\\Image to download images.",
+ "ext-dom": "Required by Faker\\Provider\\HtmlLorem for generating random HTML.",
+ "ext-iconv": "Required by Faker\\Provider\\ru_RU\\Text::realText() for generating real Russian text.",
+ "ext-mbstring": "Required for multibyte Unicode string functionality."
+ },
+ "type": "library",
+ "autoload": {
+ "psr-4": {
+ "Faker\\": "src/Faker/"
+ }
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "authors": [
+ {
+ "name": "François Zaninotto"
+ }
+ ],
+ "description": "Faker is a PHP library that generates fake data for you.",
+ "keywords": [
+ "data",
+ "faker",
+ "fixtures"
+ ],
+ "support": {
+ "issues": "https://github.com/FakerPHP/Faker/issues",
+ "source": "https://github.com/FakerPHP/Faker/tree/v1.23.1"
+ },
+ "time": "2024-01-02T13:46:09+00:00"
+ },
+ {
+ "name": "filp/whoops",
+ "version": "2.15.4",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/filp/whoops.git",
+ "reference": "a139776fa3f5985a50b509f2a02ff0f709d2a546"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/filp/whoops/zipball/a139776fa3f5985a50b509f2a02ff0f709d2a546",
+ "reference": "a139776fa3f5985a50b509f2a02ff0f709d2a546",
+ "shasum": ""
+ },
+ "require": {
+ "php": "^5.5.9 || ^7.0 || ^8.0",
+ "psr/log": "^1.0.1 || ^2.0 || ^3.0"
+ },
+ "require-dev": {
+ "mockery/mockery": "^0.9 || ^1.0",
+ "phpunit/phpunit": "^4.8.36 || ^5.7.27 || ^6.5.14 || ^7.5.20 || ^8.5.8 || ^9.3.3",
+ "symfony/var-dumper": "^2.6 || ^3.0 || ^4.0 || ^5.0"
+ },
+ "suggest": {
+ "symfony/var-dumper": "Pretty print complex values better with var-dumper available",
+ "whoops/soap": "Formats errors as SOAP responses"
+ },
+ "type": "library",
+ "extra": {
+ "branch-alias": {
+ "dev-master": "2.7-dev"
+ }
+ },
+ "autoload": {
+ "psr-4": {
+ "Whoops\\": "src/Whoops/"
+ }
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "authors": [
+ {
+ "name": "Filipe Dobreira",
+ "homepage": "https://github.com/filp",
+ "role": "Developer"
+ }
+ ],
+ "description": "php error handling for cool kids",
+ "homepage": "https://filp.github.io/whoops/",
+ "keywords": [
+ "error",
+ "exception",
+ "handling",
+ "library",
+ "throwable",
+ "whoops"
+ ],
+ "support": {
+ "issues": "https://github.com/filp/whoops/issues",
+ "source": "https://github.com/filp/whoops/tree/2.15.4"
+ },
+ "funding": [
+ {
+ "url": "https://github.com/denis-sokolov",
+ "type": "github"
+ }
+ ],
+ "time": "2023-11-03T12:00:00+00:00"
+ },
+ {
+ "name": "hamcrest/hamcrest-php",
+ "version": "v2.0.1",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/hamcrest/hamcrest-php.git",
+ "reference": "8c3d0a3f6af734494ad8f6fbbee0ba92422859f3"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/hamcrest/hamcrest-php/zipball/8c3d0a3f6af734494ad8f6fbbee0ba92422859f3",
+ "reference": "8c3d0a3f6af734494ad8f6fbbee0ba92422859f3",
+ "shasum": ""
+ },
+ "require": {
+ "php": "^5.3|^7.0|^8.0"
+ },
+ "replace": {
+ "cordoval/hamcrest-php": "*",
+ "davedevelopment/hamcrest-php": "*",
+ "kodova/hamcrest-php": "*"
+ },
+ "require-dev": {
+ "phpunit/php-file-iterator": "^1.4 || ^2.0",
+ "phpunit/phpunit": "^4.8.36 || ^5.7 || ^6.5 || ^7.0"
+ },
+ "type": "library",
+ "extra": {
+ "branch-alias": {
+ "dev-master": "2.1-dev"
+ }
+ },
+ "autoload": {
+ "classmap": [
+ "hamcrest"
+ ]
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "BSD-3-Clause"
+ ],
+ "description": "This is the PHP port of Hamcrest Matchers",
+ "keywords": [
+ "test"
+ ],
+ "support": {
+ "issues": "https://github.com/hamcrest/hamcrest-php/issues",
+ "source": "https://github.com/hamcrest/hamcrest-php/tree/v2.0.1"
+ },
+ "time": "2020-07-09T08:09:16+00:00"
+ },
+ {
+ "name": "laravel/pint",
+ "version": "v1.13.8",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/laravel/pint.git",
+ "reference": "69def89df9e0babc0f0a8bea184804a7d8a9c5c0"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/laravel/pint/zipball/69def89df9e0babc0f0a8bea184804a7d8a9c5c0",
+ "reference": "69def89df9e0babc0f0a8bea184804a7d8a9c5c0",
+ "shasum": ""
+ },
+ "require": {
+ "ext-json": "*",
+ "ext-mbstring": "*",
+ "ext-tokenizer": "*",
+ "ext-xml": "*",
+ "php": "^8.1.0"
+ },
+ "require-dev": {
+ "friendsofphp/php-cs-fixer": "^3.46.0",
+ "illuminate/view": "^10.39.0",
+ "larastan/larastan": "^2.8.1",
+ "laravel-zero/framework": "^10.3.0",
+ "mockery/mockery": "^1.6.7",
+ "nunomaduro/termwind": "^1.15.1",
+ "pestphp/pest": "^2.30.0"
+ },
+ "bin": [
+ "builds/pint"
+ ],
+ "type": "project",
+ "autoload": {
+ "psr-4": {
+ "App\\": "app/",
+ "Database\\Seeders\\": "database/seeders/",
+ "Database\\Factories\\": "database/factories/"
+ }
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "authors": [
+ {
+ "name": "Nuno Maduro",
+ "email": "enunomaduro@gmail.com"
+ }
+ ],
+ "description": "An opinionated code formatter for PHP.",
+ "homepage": "https://laravel.com",
+ "keywords": [
+ "format",
+ "formatter",
+ "lint",
+ "linter",
+ "php"
+ ],
+ "support": {
+ "issues": "https://github.com/laravel/pint/issues",
+ "source": "https://github.com/laravel/pint"
+ },
+ "time": "2024-01-09T18:03:54+00:00"
+ },
+ {
+ "name": "laravel/sail",
+ "version": "v1.27.0",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/laravel/sail.git",
+ "reference": "65a7764af5daadbd122e3b0d67be371d158a9b9a"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/laravel/sail/zipball/65a7764af5daadbd122e3b0d67be371d158a9b9a",
+ "reference": "65a7764af5daadbd122e3b0d67be371d158a9b9a",
+ "shasum": ""
+ },
+ "require": {
+ "illuminate/console": "^9.0|^10.0|^11.0",
+ "illuminate/contracts": "^9.0|^10.0|^11.0",
+ "illuminate/support": "^9.0|^10.0|^11.0",
+ "php": "^8.0",
+ "symfony/yaml": "^6.0|^7.0"
+ },
+ "require-dev": {
+ "orchestra/testbench": "^7.0|^8.0|^9.0",
+ "phpstan/phpstan": "^1.10"
+ },
+ "bin": [
+ "bin/sail"
+ ],
+ "type": "library",
+ "extra": {
+ "branch-alias": {
+ "dev-master": "1.x-dev"
+ },
+ "laravel": {
+ "providers": [
+ "Laravel\\Sail\\SailServiceProvider"
+ ]
+ }
+ },
+ "autoload": {
+ "psr-4": {
+ "Laravel\\Sail\\": "src/"
+ }
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "authors": [
+ {
+ "name": "Taylor Otwell",
+ "email": "taylor@laravel.com"
+ }
+ ],
+ "description": "Docker files for running a basic Laravel application.",
+ "keywords": [
+ "docker",
+ "laravel"
+ ],
+ "support": {
+ "issues": "https://github.com/laravel/sail/issues",
+ "source": "https://github.com/laravel/sail"
+ },
+ "time": "2024-01-03T14:07:34+00:00"
+ },
+ {
+ "name": "mockery/mockery",
+ "version": "1.6.7",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/mockery/mockery.git",
+ "reference": "0cc058854b3195ba21dc6b1f7b1f60f4ef3a9c06"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/mockery/mockery/zipball/0cc058854b3195ba21dc6b1f7b1f60f4ef3a9c06",
+ "reference": "0cc058854b3195ba21dc6b1f7b1f60f4ef3a9c06",
+ "shasum": ""
+ },
+ "require": {
+ "hamcrest/hamcrest-php": "^2.0.1",
+ "lib-pcre": ">=7.0",
+ "php": ">=7.3"
+ },
+ "conflict": {
+ "phpunit/phpunit": "<8.0"
+ },
+ "require-dev": {
+ "phpunit/phpunit": "^8.5 || ^9.6.10",
+ "symplify/easy-coding-standard": "^12.0.8"
+ },
+ "type": "library",
+ "autoload": {
+ "files": [
+ "library/helpers.php",
+ "library/Mockery.php"
+ ],
+ "psr-4": {
+ "Mockery\\": "library/Mockery"
+ }
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "BSD-3-Clause"
+ ],
+ "authors": [
+ {
+ "name": "Pádraic Brady",
+ "email": "padraic.brady@gmail.com",
+ "homepage": "https://github.com/padraic",
+ "role": "Author"
+ },
+ {
+ "name": "Dave Marshall",
+ "email": "dave.marshall@atstsolutions.co.uk",
+ "homepage": "https://davedevelopment.co.uk",
+ "role": "Developer"
+ },
+ {
+ "name": "Nathanael Esayeas",
+ "email": "nathanael.esayeas@protonmail.com",
+ "homepage": "https://github.com/ghostwriter",
+ "role": "Lead Developer"
+ }
+ ],
+ "description": "Mockery is a simple yet flexible PHP mock object framework",
+ "homepage": "https://github.com/mockery/mockery",
+ "keywords": [
+ "BDD",
+ "TDD",
+ "library",
+ "mock",
+ "mock objects",
+ "mockery",
+ "stub",
+ "test",
+ "test double",
+ "testing"
+ ],
+ "support": {
+ "docs": "https://docs.mockery.io/",
+ "issues": "https://github.com/mockery/mockery/issues",
+ "rss": "https://github.com/mockery/mockery/releases.atom",
+ "security": "https://github.com/mockery/mockery/security/advisories",
+ "source": "https://github.com/mockery/mockery"
+ },
+ "time": "2023-12-10T02:24:34+00:00"
+ },
+ {
+ "name": "myclabs/deep-copy",
+ "version": "1.11.1",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/myclabs/DeepCopy.git",
+ "reference": "7284c22080590fb39f2ffa3e9057f10a4ddd0e0c"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/myclabs/DeepCopy/zipball/7284c22080590fb39f2ffa3e9057f10a4ddd0e0c",
+ "reference": "7284c22080590fb39f2ffa3e9057f10a4ddd0e0c",
+ "shasum": ""
+ },
+ "require": {
+ "php": "^7.1 || ^8.0"
+ },
+ "conflict": {
+ "doctrine/collections": "<1.6.8",
+ "doctrine/common": "<2.13.3 || >=3,<3.2.2"
+ },
+ "require-dev": {
+ "doctrine/collections": "^1.6.8",
+ "doctrine/common": "^2.13.3 || ^3.2.2",
+ "phpunit/phpunit": "^7.5.20 || ^8.5.23 || ^9.5.13"
+ },
+ "type": "library",
+ "autoload": {
+ "files": [
+ "src/DeepCopy/deep_copy.php"
+ ],
+ "psr-4": {
+ "DeepCopy\\": "src/DeepCopy/"
+ }
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "description": "Create deep copies (clones) of your objects",
+ "keywords": [
+ "clone",
+ "copy",
+ "duplicate",
+ "object",
+ "object graph"
+ ],
+ "support": {
+ "issues": "https://github.com/myclabs/DeepCopy/issues",
+ "source": "https://github.com/myclabs/DeepCopy/tree/1.11.1"
+ },
+ "funding": [
+ {
+ "url": "https://tidelift.com/funding/github/packagist/myclabs/deep-copy",
+ "type": "tidelift"
+ }
+ ],
+ "time": "2023-03-08T13:26:56+00:00"
+ },
+ {
+ "name": "nunomaduro/collision",
+ "version": "v7.10.0",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/nunomaduro/collision.git",
+ "reference": "49ec67fa7b002712da8526678abd651c09f375b2"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/nunomaduro/collision/zipball/49ec67fa7b002712da8526678abd651c09f375b2",
+ "reference": "49ec67fa7b002712da8526678abd651c09f375b2",
+ "shasum": ""
+ },
+ "require": {
+ "filp/whoops": "^2.15.3",
+ "nunomaduro/termwind": "^1.15.1",
+ "php": "^8.1.0",
+ "symfony/console": "^6.3.4"
+ },
+ "conflict": {
+ "laravel/framework": ">=11.0.0"
+ },
+ "require-dev": {
+ "brianium/paratest": "^7.3.0",
+ "laravel/framework": "^10.28.0",
+ "laravel/pint": "^1.13.3",
+ "laravel/sail": "^1.25.0",
+ "laravel/sanctum": "^3.3.1",
+ "laravel/tinker": "^2.8.2",
+ "nunomaduro/larastan": "^2.6.4",
+ "orchestra/testbench-core": "^8.13.0",
+ "pestphp/pest": "^2.23.2",
+ "phpunit/phpunit": "^10.4.1",
+ "sebastian/environment": "^6.0.1",
+ "spatie/laravel-ignition": "^2.3.1"
+ },
+ "type": "library",
+ "extra": {
+ "laravel": {
+ "providers": [
+ "NunoMaduro\\Collision\\Adapters\\Laravel\\CollisionServiceProvider"
+ ]
+ }
+ },
+ "autoload": {
+ "files": [
+ "./src/Adapters/Phpunit/Autoload.php"
+ ],
+ "psr-4": {
+ "NunoMaduro\\Collision\\": "src/"
+ }
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "authors": [
+ {
+ "name": "Nuno Maduro",
+ "email": "enunomaduro@gmail.com"
+ }
+ ],
+ "description": "Cli error handling for console/command-line PHP applications.",
+ "keywords": [
+ "artisan",
+ "cli",
+ "command-line",
+ "console",
+ "error",
+ "handling",
+ "laravel",
+ "laravel-zero",
+ "php",
+ "symfony"
+ ],
+ "support": {
+ "issues": "https://github.com/nunomaduro/collision/issues",
+ "source": "https://github.com/nunomaduro/collision"
+ },
+ "funding": [
+ {
+ "url": "https://www.paypal.com/paypalme/enunomaduro",
+ "type": "custom"
+ },
+ {
+ "url": "https://github.com/nunomaduro",
+ "type": "github"
+ },
+ {
+ "url": "https://www.patreon.com/nunomaduro",
+ "type": "patreon"
+ }
+ ],
+ "time": "2023-10-11T15:45:01+00:00"
+ },
+ {
+ "name": "phar-io/manifest",
+ "version": "2.0.3",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/phar-io/manifest.git",
+ "reference": "97803eca37d319dfa7826cc2437fc020857acb53"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/phar-io/manifest/zipball/97803eca37d319dfa7826cc2437fc020857acb53",
+ "reference": "97803eca37d319dfa7826cc2437fc020857acb53",
+ "shasum": ""
+ },
+ "require": {
+ "ext-dom": "*",
+ "ext-phar": "*",
+ "ext-xmlwriter": "*",
+ "phar-io/version": "^3.0.1",
+ "php": "^7.2 || ^8.0"
+ },
+ "type": "library",
+ "extra": {
+ "branch-alias": {
+ "dev-master": "2.0.x-dev"
+ }
+ },
+ "autoload": {
+ "classmap": [
+ "src/"
+ ]
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "BSD-3-Clause"
+ ],
+ "authors": [
+ {
+ "name": "Arne Blankerts",
+ "email": "arne@blankerts.de",
+ "role": "Developer"
+ },
+ {
+ "name": "Sebastian Heuer",
+ "email": "sebastian@phpeople.de",
+ "role": "Developer"
+ },
+ {
+ "name": "Sebastian Bergmann",
+ "email": "sebastian@phpunit.de",
+ "role": "Developer"
+ }
+ ],
+ "description": "Component for reading phar.io manifest information from a PHP Archive (PHAR)",
+ "support": {
+ "issues": "https://github.com/phar-io/manifest/issues",
+ "source": "https://github.com/phar-io/manifest/tree/2.0.3"
+ },
+ "time": "2021-07-20T11:28:43+00:00"
+ },
+ {
+ "name": "phar-io/version",
+ "version": "3.2.1",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/phar-io/version.git",
+ "reference": "4f7fd7836c6f332bb2933569e566a0d6c4cbed74"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/phar-io/version/zipball/4f7fd7836c6f332bb2933569e566a0d6c4cbed74",
+ "reference": "4f7fd7836c6f332bb2933569e566a0d6c4cbed74",
+ "shasum": ""
+ },
+ "require": {
+ "php": "^7.2 || ^8.0"
+ },
+ "type": "library",
+ "autoload": {
+ "classmap": [
+ "src/"
+ ]
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "BSD-3-Clause"
+ ],
+ "authors": [
+ {
+ "name": "Arne Blankerts",
+ "email": "arne@blankerts.de",
+ "role": "Developer"
+ },
+ {
+ "name": "Sebastian Heuer",
+ "email": "sebastian@phpeople.de",
+ "role": "Developer"
+ },
+ {
+ "name": "Sebastian Bergmann",
+ "email": "sebastian@phpunit.de",
+ "role": "Developer"
+ }
+ ],
+ "description": "Library for handling version information and constraints",
+ "support": {
+ "issues": "https://github.com/phar-io/version/issues",
+ "source": "https://github.com/phar-io/version/tree/3.2.1"
+ },
+ "time": "2022-02-21T01:04:05+00:00"
+ },
+ {
+ "name": "phpunit/php-code-coverage",
+ "version": "10.1.11",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/sebastianbergmann/php-code-coverage.git",
+ "reference": "78c3b7625965c2513ee96569a4dbb62601784145"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/sebastianbergmann/php-code-coverage/zipball/78c3b7625965c2513ee96569a4dbb62601784145",
+ "reference": "78c3b7625965c2513ee96569a4dbb62601784145",
+ "shasum": ""
+ },
+ "require": {
+ "ext-dom": "*",
+ "ext-libxml": "*",
+ "ext-xmlwriter": "*",
+ "nikic/php-parser": "^4.18 || ^5.0",
+ "php": ">=8.1",
+ "phpunit/php-file-iterator": "^4.0",
+ "phpunit/php-text-template": "^3.0",
+ "sebastian/code-unit-reverse-lookup": "^3.0",
+ "sebastian/complexity": "^3.0",
+ "sebastian/environment": "^6.0",
+ "sebastian/lines-of-code": "^2.0",
+ "sebastian/version": "^4.0",
+ "theseer/tokenizer": "^1.2.0"
+ },
+ "require-dev": {
+ "phpunit/phpunit": "^10.1"
+ },
+ "suggest": {
+ "ext-pcov": "PHP extension that provides line coverage",
+ "ext-xdebug": "PHP extension that provides line coverage as well as branch and path coverage"
+ },
+ "type": "library",
+ "extra": {
+ "branch-alias": {
+ "dev-main": "10.1-dev"
+ }
+ },
+ "autoload": {
+ "classmap": [
+ "src/"
+ ]
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "BSD-3-Clause"
+ ],
+ "authors": [
+ {
+ "name": "Sebastian Bergmann",
+ "email": "sebastian@phpunit.de",
+ "role": "lead"
+ }
+ ],
+ "description": "Library that provides collection, processing, and rendering functionality for PHP code coverage information.",
+ "homepage": "https://github.com/sebastianbergmann/php-code-coverage",
+ "keywords": [
+ "coverage",
+ "testing",
+ "xunit"
+ ],
+ "support": {
+ "issues": "https://github.com/sebastianbergmann/php-code-coverage/issues",
+ "security": "https://github.com/sebastianbergmann/php-code-coverage/security/policy",
+ "source": "https://github.com/sebastianbergmann/php-code-coverage/tree/10.1.11"
+ },
+ "funding": [
+ {
+ "url": "https://github.com/sebastianbergmann",
+ "type": "github"
+ }
+ ],
+ "time": "2023-12-21T15:38:30+00:00"
+ },
+ {
+ "name": "phpunit/php-file-iterator",
+ "version": "4.1.0",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/sebastianbergmann/php-file-iterator.git",
+ "reference": "a95037b6d9e608ba092da1b23931e537cadc3c3c"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/sebastianbergmann/php-file-iterator/zipball/a95037b6d9e608ba092da1b23931e537cadc3c3c",
+ "reference": "a95037b6d9e608ba092da1b23931e537cadc3c3c",
+ "shasum": ""
+ },
+ "require": {
+ "php": ">=8.1"
+ },
+ "require-dev": {
+ "phpunit/phpunit": "^10.0"
+ },
+ "type": "library",
+ "extra": {
+ "branch-alias": {
+ "dev-main": "4.0-dev"
+ }
+ },
+ "autoload": {
+ "classmap": [
+ "src/"
+ ]
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "BSD-3-Clause"
+ ],
+ "authors": [
+ {
+ "name": "Sebastian Bergmann",
+ "email": "sebastian@phpunit.de",
+ "role": "lead"
+ }
+ ],
+ "description": "FilterIterator implementation that filters files based on a list of suffixes.",
+ "homepage": "https://github.com/sebastianbergmann/php-file-iterator/",
+ "keywords": [
+ "filesystem",
+ "iterator"
+ ],
+ "support": {
+ "issues": "https://github.com/sebastianbergmann/php-file-iterator/issues",
+ "security": "https://github.com/sebastianbergmann/php-file-iterator/security/policy",
+ "source": "https://github.com/sebastianbergmann/php-file-iterator/tree/4.1.0"
+ },
+ "funding": [
+ {
+ "url": "https://github.com/sebastianbergmann",
+ "type": "github"
+ }
+ ],
+ "time": "2023-08-31T06:24:48+00:00"
+ },
+ {
+ "name": "phpunit/php-invoker",
+ "version": "4.0.0",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/sebastianbergmann/php-invoker.git",
+ "reference": "f5e568ba02fa5ba0ddd0f618391d5a9ea50b06d7"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/sebastianbergmann/php-invoker/zipball/f5e568ba02fa5ba0ddd0f618391d5a9ea50b06d7",
+ "reference": "f5e568ba02fa5ba0ddd0f618391d5a9ea50b06d7",
+ "shasum": ""
+ },
+ "require": {
+ "php": ">=8.1"
+ },
+ "require-dev": {
+ "ext-pcntl": "*",
+ "phpunit/phpunit": "^10.0"
+ },
+ "suggest": {
+ "ext-pcntl": "*"
+ },
+ "type": "library",
+ "extra": {
+ "branch-alias": {
+ "dev-main": "4.0-dev"
+ }
+ },
+ "autoload": {
+ "classmap": [
+ "src/"
+ ]
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "BSD-3-Clause"
+ ],
+ "authors": [
+ {
+ "name": "Sebastian Bergmann",
+ "email": "sebastian@phpunit.de",
+ "role": "lead"
+ }
+ ],
+ "description": "Invoke callables with a timeout",
+ "homepage": "https://github.com/sebastianbergmann/php-invoker/",
+ "keywords": [
+ "process"
+ ],
+ "support": {
+ "issues": "https://github.com/sebastianbergmann/php-invoker/issues",
+ "source": "https://github.com/sebastianbergmann/php-invoker/tree/4.0.0"
+ },
+ "funding": [
+ {
+ "url": "https://github.com/sebastianbergmann",
+ "type": "github"
+ }
+ ],
+ "time": "2023-02-03T06:56:09+00:00"
+ },
+ {
+ "name": "phpunit/php-text-template",
+ "version": "3.0.1",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/sebastianbergmann/php-text-template.git",
+ "reference": "0c7b06ff49e3d5072f057eb1fa59258bf287a748"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/sebastianbergmann/php-text-template/zipball/0c7b06ff49e3d5072f057eb1fa59258bf287a748",
+ "reference": "0c7b06ff49e3d5072f057eb1fa59258bf287a748",
+ "shasum": ""
+ },
+ "require": {
+ "php": ">=8.1"
+ },
+ "require-dev": {
+ "phpunit/phpunit": "^10.0"
+ },
+ "type": "library",
+ "extra": {
+ "branch-alias": {
+ "dev-main": "3.0-dev"
+ }
+ },
+ "autoload": {
+ "classmap": [
+ "src/"
+ ]
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "BSD-3-Clause"
+ ],
+ "authors": [
+ {
+ "name": "Sebastian Bergmann",
+ "email": "sebastian@phpunit.de",
+ "role": "lead"
+ }
+ ],
+ "description": "Simple template engine.",
+ "homepage": "https://github.com/sebastianbergmann/php-text-template/",
+ "keywords": [
+ "template"
+ ],
+ "support": {
+ "issues": "https://github.com/sebastianbergmann/php-text-template/issues",
+ "security": "https://github.com/sebastianbergmann/php-text-template/security/policy",
+ "source": "https://github.com/sebastianbergmann/php-text-template/tree/3.0.1"
+ },
+ "funding": [
+ {
+ "url": "https://github.com/sebastianbergmann",
+ "type": "github"
+ }
+ ],
+ "time": "2023-08-31T14:07:24+00:00"
+ },
+ {
+ "name": "phpunit/php-timer",
+ "version": "6.0.0",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/sebastianbergmann/php-timer.git",
+ "reference": "e2a2d67966e740530f4a3343fe2e030ffdc1161d"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/sebastianbergmann/php-timer/zipball/e2a2d67966e740530f4a3343fe2e030ffdc1161d",
+ "reference": "e2a2d67966e740530f4a3343fe2e030ffdc1161d",
+ "shasum": ""
+ },
+ "require": {
+ "php": ">=8.1"
+ },
+ "require-dev": {
+ "phpunit/phpunit": "^10.0"
+ },
+ "type": "library",
+ "extra": {
+ "branch-alias": {
+ "dev-main": "6.0-dev"
+ }
+ },
+ "autoload": {
+ "classmap": [
+ "src/"
+ ]
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "BSD-3-Clause"
+ ],
+ "authors": [
+ {
+ "name": "Sebastian Bergmann",
+ "email": "sebastian@phpunit.de",
+ "role": "lead"
+ }
+ ],
+ "description": "Utility class for timing",
+ "homepage": "https://github.com/sebastianbergmann/php-timer/",
+ "keywords": [
+ "timer"
+ ],
+ "support": {
+ "issues": "https://github.com/sebastianbergmann/php-timer/issues",
+ "source": "https://github.com/sebastianbergmann/php-timer/tree/6.0.0"
+ },
+ "funding": [
+ {
+ "url": "https://github.com/sebastianbergmann",
+ "type": "github"
+ }
+ ],
+ "time": "2023-02-03T06:57:52+00:00"
+ },
+ {
+ "name": "phpunit/phpunit",
+ "version": "10.5.5",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/sebastianbergmann/phpunit.git",
+ "reference": "ed21115d505b4b4f7dc7b5651464e19a2c7f7856"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/sebastianbergmann/phpunit/zipball/ed21115d505b4b4f7dc7b5651464e19a2c7f7856",
+ "reference": "ed21115d505b4b4f7dc7b5651464e19a2c7f7856",
+ "shasum": ""
+ },
+ "require": {
+ "ext-dom": "*",
+ "ext-json": "*",
+ "ext-libxml": "*",
+ "ext-mbstring": "*",
+ "ext-xml": "*",
+ "ext-xmlwriter": "*",
+ "myclabs/deep-copy": "^1.10.1",
+ "phar-io/manifest": "^2.0.3",
+ "phar-io/version": "^3.0.2",
+ "php": ">=8.1",
+ "phpunit/php-code-coverage": "^10.1.5",
+ "phpunit/php-file-iterator": "^4.0",
+ "phpunit/php-invoker": "^4.0",
+ "phpunit/php-text-template": "^3.0",
+ "phpunit/php-timer": "^6.0",
+ "sebastian/cli-parser": "^2.0",
+ "sebastian/code-unit": "^2.0",
+ "sebastian/comparator": "^5.0",
+ "sebastian/diff": "^5.0",
+ "sebastian/environment": "^6.0",
+ "sebastian/exporter": "^5.1",
+ "sebastian/global-state": "^6.0.1",
+ "sebastian/object-enumerator": "^5.0",
+ "sebastian/recursion-context": "^5.0",
+ "sebastian/type": "^4.0",
+ "sebastian/version": "^4.0"
+ },
+ "suggest": {
+ "ext-soap": "To be able to generate mocks based on WSDL files"
+ },
+ "bin": [
+ "phpunit"
+ ],
+ "type": "library",
+ "extra": {
+ "branch-alias": {
+ "dev-main": "10.5-dev"
+ }
+ },
+ "autoload": {
+ "files": [
+ "src/Framework/Assert/Functions.php"
+ ],
+ "classmap": [
+ "src/"
+ ]
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "BSD-3-Clause"
+ ],
+ "authors": [
+ {
+ "name": "Sebastian Bergmann",
+ "email": "sebastian@phpunit.de",
+ "role": "lead"
+ }
+ ],
+ "description": "The PHP Unit Testing framework.",
+ "homepage": "https://phpunit.de/",
+ "keywords": [
+ "phpunit",
+ "testing",
+ "xunit"
+ ],
+ "support": {
+ "issues": "https://github.com/sebastianbergmann/phpunit/issues",
+ "security": "https://github.com/sebastianbergmann/phpunit/security/policy",
+ "source": "https://github.com/sebastianbergmann/phpunit/tree/10.5.5"
+ },
+ "funding": [
+ {
+ "url": "https://phpunit.de/sponsors.html",
+ "type": "custom"
+ },
+ {
+ "url": "https://github.com/sebastianbergmann",
+ "type": "github"
+ },
+ {
+ "url": "https://tidelift.com/funding/github/packagist/phpunit/phpunit",
+ "type": "tidelift"
+ }
+ ],
+ "time": "2023-12-27T15:13:52+00:00"
+ },
+ {
+ "name": "sebastian/cli-parser",
+ "version": "2.0.0",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/sebastianbergmann/cli-parser.git",
+ "reference": "efdc130dbbbb8ef0b545a994fd811725c5282cae"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/sebastianbergmann/cli-parser/zipball/efdc130dbbbb8ef0b545a994fd811725c5282cae",
+ "reference": "efdc130dbbbb8ef0b545a994fd811725c5282cae",
+ "shasum": ""
+ },
+ "require": {
+ "php": ">=8.1"
+ },
+ "require-dev": {
+ "phpunit/phpunit": "^10.0"
+ },
+ "type": "library",
+ "extra": {
+ "branch-alias": {
+ "dev-main": "2.0-dev"
+ }
+ },
+ "autoload": {
+ "classmap": [
+ "src/"
+ ]
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "BSD-3-Clause"
+ ],
+ "authors": [
+ {
+ "name": "Sebastian Bergmann",
+ "email": "sebastian@phpunit.de",
+ "role": "lead"
+ }
+ ],
+ "description": "Library for parsing CLI options",
+ "homepage": "https://github.com/sebastianbergmann/cli-parser",
+ "support": {
+ "issues": "https://github.com/sebastianbergmann/cli-parser/issues",
+ "source": "https://github.com/sebastianbergmann/cli-parser/tree/2.0.0"
+ },
+ "funding": [
+ {
+ "url": "https://github.com/sebastianbergmann",
+ "type": "github"
+ }
+ ],
+ "time": "2023-02-03T06:58:15+00:00"
+ },
+ {
+ "name": "sebastian/code-unit",
+ "version": "2.0.0",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/sebastianbergmann/code-unit.git",
+ "reference": "a81fee9eef0b7a76af11d121767abc44c104e503"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/sebastianbergmann/code-unit/zipball/a81fee9eef0b7a76af11d121767abc44c104e503",
+ "reference": "a81fee9eef0b7a76af11d121767abc44c104e503",
+ "shasum": ""
+ },
+ "require": {
+ "php": ">=8.1"
+ },
+ "require-dev": {
+ "phpunit/phpunit": "^10.0"
+ },
+ "type": "library",
+ "extra": {
+ "branch-alias": {
+ "dev-main": "2.0-dev"
+ }
+ },
+ "autoload": {
+ "classmap": [
+ "src/"
+ ]
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "BSD-3-Clause"
+ ],
+ "authors": [
+ {
+ "name": "Sebastian Bergmann",
+ "email": "sebastian@phpunit.de",
+ "role": "lead"
+ }
+ ],
+ "description": "Collection of value objects that represent the PHP code units",
+ "homepage": "https://github.com/sebastianbergmann/code-unit",
+ "support": {
+ "issues": "https://github.com/sebastianbergmann/code-unit/issues",
+ "source": "https://github.com/sebastianbergmann/code-unit/tree/2.0.0"
+ },
+ "funding": [
+ {
+ "url": "https://github.com/sebastianbergmann",
+ "type": "github"
+ }
+ ],
+ "time": "2023-02-03T06:58:43+00:00"
+ },
+ {
+ "name": "sebastian/code-unit-reverse-lookup",
+ "version": "3.0.0",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/sebastianbergmann/code-unit-reverse-lookup.git",
+ "reference": "5e3a687f7d8ae33fb362c5c0743794bbb2420a1d"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/sebastianbergmann/code-unit-reverse-lookup/zipball/5e3a687f7d8ae33fb362c5c0743794bbb2420a1d",
+ "reference": "5e3a687f7d8ae33fb362c5c0743794bbb2420a1d",
+ "shasum": ""
+ },
+ "require": {
+ "php": ">=8.1"
+ },
+ "require-dev": {
+ "phpunit/phpunit": "^10.0"
+ },
+ "type": "library",
+ "extra": {
+ "branch-alias": {
+ "dev-main": "3.0-dev"
+ }
+ },
+ "autoload": {
+ "classmap": [
+ "src/"
+ ]
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "BSD-3-Clause"
+ ],
+ "authors": [
+ {
+ "name": "Sebastian Bergmann",
+ "email": "sebastian@phpunit.de"
+ }
+ ],
+ "description": "Looks up which function or method a line of code belongs to",
+ "homepage": "https://github.com/sebastianbergmann/code-unit-reverse-lookup/",
+ "support": {
+ "issues": "https://github.com/sebastianbergmann/code-unit-reverse-lookup/issues",
+ "source": "https://github.com/sebastianbergmann/code-unit-reverse-lookup/tree/3.0.0"
+ },
+ "funding": [
+ {
+ "url": "https://github.com/sebastianbergmann",
+ "type": "github"
+ }
+ ],
+ "time": "2023-02-03T06:59:15+00:00"
+ },
+ {
+ "name": "sebastian/comparator",
+ "version": "5.0.1",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/sebastianbergmann/comparator.git",
+ "reference": "2db5010a484d53ebf536087a70b4a5423c102372"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/sebastianbergmann/comparator/zipball/2db5010a484d53ebf536087a70b4a5423c102372",
+ "reference": "2db5010a484d53ebf536087a70b4a5423c102372",
+ "shasum": ""
+ },
+ "require": {
+ "ext-dom": "*",
+ "ext-mbstring": "*",
+ "php": ">=8.1",
+ "sebastian/diff": "^5.0",
+ "sebastian/exporter": "^5.0"
+ },
+ "require-dev": {
+ "phpunit/phpunit": "^10.3"
+ },
+ "type": "library",
+ "extra": {
+ "branch-alias": {
+ "dev-main": "5.0-dev"
+ }
+ },
+ "autoload": {
+ "classmap": [
+ "src/"
+ ]
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "BSD-3-Clause"
+ ],
+ "authors": [
+ {
+ "name": "Sebastian Bergmann",
+ "email": "sebastian@phpunit.de"
+ },
+ {
+ "name": "Jeff Welch",
+ "email": "whatthejeff@gmail.com"
+ },
+ {
+ "name": "Volker Dusch",
+ "email": "github@wallbash.com"
+ },
+ {
+ "name": "Bernhard Schussek",
+ "email": "bschussek@2bepublished.at"
+ }
+ ],
+ "description": "Provides the functionality to compare PHP values for equality",
+ "homepage": "https://github.com/sebastianbergmann/comparator",
+ "keywords": [
+ "comparator",
+ "compare",
+ "equality"
+ ],
+ "support": {
+ "issues": "https://github.com/sebastianbergmann/comparator/issues",
+ "security": "https://github.com/sebastianbergmann/comparator/security/policy",
+ "source": "https://github.com/sebastianbergmann/comparator/tree/5.0.1"
+ },
+ "funding": [
+ {
+ "url": "https://github.com/sebastianbergmann",
+ "type": "github"
+ }
+ ],
+ "time": "2023-08-14T13:18:12+00:00"
+ },
+ {
+ "name": "sebastian/complexity",
+ "version": "3.2.0",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/sebastianbergmann/complexity.git",
+ "reference": "68ff824baeae169ec9f2137158ee529584553799"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/sebastianbergmann/complexity/zipball/68ff824baeae169ec9f2137158ee529584553799",
+ "reference": "68ff824baeae169ec9f2137158ee529584553799",
+ "shasum": ""
+ },
+ "require": {
+ "nikic/php-parser": "^4.18 || ^5.0",
+ "php": ">=8.1"
+ },
+ "require-dev": {
+ "phpunit/phpunit": "^10.0"
+ },
+ "type": "library",
+ "extra": {
+ "branch-alias": {
+ "dev-main": "3.2-dev"
+ }
+ },
+ "autoload": {
+ "classmap": [
+ "src/"
+ ]
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "BSD-3-Clause"
+ ],
+ "authors": [
+ {
+ "name": "Sebastian Bergmann",
+ "email": "sebastian@phpunit.de",
+ "role": "lead"
+ }
+ ],
+ "description": "Library for calculating the complexity of PHP code units",
+ "homepage": "https://github.com/sebastianbergmann/complexity",
+ "support": {
+ "issues": "https://github.com/sebastianbergmann/complexity/issues",
+ "security": "https://github.com/sebastianbergmann/complexity/security/policy",
+ "source": "https://github.com/sebastianbergmann/complexity/tree/3.2.0"
+ },
+ "funding": [
+ {
+ "url": "https://github.com/sebastianbergmann",
+ "type": "github"
+ }
+ ],
+ "time": "2023-12-21T08:37:17+00:00"
+ },
+ {
+ "name": "sebastian/diff",
+ "version": "5.1.0",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/sebastianbergmann/diff.git",
+ "reference": "fbf413a49e54f6b9b17e12d900ac7f6101591b7f"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/sebastianbergmann/diff/zipball/fbf413a49e54f6b9b17e12d900ac7f6101591b7f",
+ "reference": "fbf413a49e54f6b9b17e12d900ac7f6101591b7f",
+ "shasum": ""
+ },
+ "require": {
+ "php": ">=8.1"
+ },
+ "require-dev": {
+ "phpunit/phpunit": "^10.0",
+ "symfony/process": "^4.2 || ^5"
+ },
+ "type": "library",
+ "extra": {
+ "branch-alias": {
+ "dev-main": "5.1-dev"
+ }
+ },
+ "autoload": {
+ "classmap": [
+ "src/"
+ ]
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "BSD-3-Clause"
+ ],
+ "authors": [
+ {
+ "name": "Sebastian Bergmann",
+ "email": "sebastian@phpunit.de"
+ },
+ {
+ "name": "Kore Nordmann",
+ "email": "mail@kore-nordmann.de"
+ }
+ ],
+ "description": "Diff implementation",
+ "homepage": "https://github.com/sebastianbergmann/diff",
+ "keywords": [
+ "diff",
+ "udiff",
+ "unidiff",
+ "unified diff"
+ ],
+ "support": {
+ "issues": "https://github.com/sebastianbergmann/diff/issues",
+ "security": "https://github.com/sebastianbergmann/diff/security/policy",
+ "source": "https://github.com/sebastianbergmann/diff/tree/5.1.0"
+ },
+ "funding": [
+ {
+ "url": "https://github.com/sebastianbergmann",
+ "type": "github"
+ }
+ ],
+ "time": "2023-12-22T10:55:06+00:00"
+ },
+ {
+ "name": "sebastian/environment",
+ "version": "6.0.1",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/sebastianbergmann/environment.git",
+ "reference": "43c751b41d74f96cbbd4e07b7aec9675651e2951"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/sebastianbergmann/environment/zipball/43c751b41d74f96cbbd4e07b7aec9675651e2951",
+ "reference": "43c751b41d74f96cbbd4e07b7aec9675651e2951",
+ "shasum": ""
+ },
+ "require": {
+ "php": ">=8.1"
+ },
+ "require-dev": {
+ "phpunit/phpunit": "^10.0"
+ },
+ "suggest": {
+ "ext-posix": "*"
+ },
+ "type": "library",
+ "extra": {
+ "branch-alias": {
+ "dev-main": "6.0-dev"
+ }
+ },
+ "autoload": {
+ "classmap": [
+ "src/"
+ ]
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "BSD-3-Clause"
+ ],
+ "authors": [
+ {
+ "name": "Sebastian Bergmann",
+ "email": "sebastian@phpunit.de"
+ }
+ ],
+ "description": "Provides functionality to handle HHVM/PHP environments",
+ "homepage": "https://github.com/sebastianbergmann/environment",
+ "keywords": [
+ "Xdebug",
+ "environment",
+ "hhvm"
+ ],
+ "support": {
+ "issues": "https://github.com/sebastianbergmann/environment/issues",
+ "security": "https://github.com/sebastianbergmann/environment/security/policy",
+ "source": "https://github.com/sebastianbergmann/environment/tree/6.0.1"
+ },
+ "funding": [
+ {
+ "url": "https://github.com/sebastianbergmann",
+ "type": "github"
+ }
+ ],
+ "time": "2023-04-11T05:39:26+00:00"
+ },
+ {
+ "name": "sebastian/exporter",
+ "version": "5.1.1",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/sebastianbergmann/exporter.git",
+ "reference": "64f51654862e0f5e318db7e9dcc2292c63cdbddc"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/sebastianbergmann/exporter/zipball/64f51654862e0f5e318db7e9dcc2292c63cdbddc",
+ "reference": "64f51654862e0f5e318db7e9dcc2292c63cdbddc",
+ "shasum": ""
+ },
+ "require": {
+ "ext-mbstring": "*",
+ "php": ">=8.1",
+ "sebastian/recursion-context": "^5.0"
+ },
+ "require-dev": {
+ "phpunit/phpunit": "^10.0"
+ },
+ "type": "library",
+ "extra": {
+ "branch-alias": {
+ "dev-main": "5.1-dev"
+ }
+ },
+ "autoload": {
+ "classmap": [
+ "src/"
+ ]
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "BSD-3-Clause"
+ ],
+ "authors": [
+ {
+ "name": "Sebastian Bergmann",
+ "email": "sebastian@phpunit.de"
+ },
+ {
+ "name": "Jeff Welch",
+ "email": "whatthejeff@gmail.com"
+ },
+ {
+ "name": "Volker Dusch",
+ "email": "github@wallbash.com"
+ },
+ {
+ "name": "Adam Harvey",
+ "email": "aharvey@php.net"
+ },
+ {
+ "name": "Bernhard Schussek",
+ "email": "bschussek@gmail.com"
+ }
+ ],
+ "description": "Provides the functionality to export PHP variables for visualization",
+ "homepage": "https://www.github.com/sebastianbergmann/exporter",
+ "keywords": [
+ "export",
+ "exporter"
+ ],
+ "support": {
+ "issues": "https://github.com/sebastianbergmann/exporter/issues",
+ "security": "https://github.com/sebastianbergmann/exporter/security/policy",
+ "source": "https://github.com/sebastianbergmann/exporter/tree/5.1.1"
+ },
+ "funding": [
+ {
+ "url": "https://github.com/sebastianbergmann",
+ "type": "github"
+ }
+ ],
+ "time": "2023-09-24T13:22:09+00:00"
+ },
+ {
+ "name": "sebastian/global-state",
+ "version": "6.0.1",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/sebastianbergmann/global-state.git",
+ "reference": "7ea9ead78f6d380d2a667864c132c2f7b83055e4"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/sebastianbergmann/global-state/zipball/7ea9ead78f6d380d2a667864c132c2f7b83055e4",
+ "reference": "7ea9ead78f6d380d2a667864c132c2f7b83055e4",
+ "shasum": ""
+ },
+ "require": {
+ "php": ">=8.1",
+ "sebastian/object-reflector": "^3.0",
+ "sebastian/recursion-context": "^5.0"
+ },
+ "require-dev": {
+ "ext-dom": "*",
+ "phpunit/phpunit": "^10.0"
+ },
+ "type": "library",
+ "extra": {
+ "branch-alias": {
+ "dev-main": "6.0-dev"
+ }
+ },
+ "autoload": {
+ "classmap": [
+ "src/"
+ ]
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "BSD-3-Clause"
+ ],
+ "authors": [
+ {
+ "name": "Sebastian Bergmann",
+ "email": "sebastian@phpunit.de"
+ }
+ ],
+ "description": "Snapshotting of global state",
+ "homepage": "http://www.github.com/sebastianbergmann/global-state",
+ "keywords": [
+ "global state"
+ ],
+ "support": {
+ "issues": "https://github.com/sebastianbergmann/global-state/issues",
+ "security": "https://github.com/sebastianbergmann/global-state/security/policy",
+ "source": "https://github.com/sebastianbergmann/global-state/tree/6.0.1"
+ },
+ "funding": [
+ {
+ "url": "https://github.com/sebastianbergmann",
+ "type": "github"
+ }
+ ],
+ "time": "2023-07-19T07:19:23+00:00"
+ },
+ {
+ "name": "sebastian/lines-of-code",
+ "version": "2.0.2",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/sebastianbergmann/lines-of-code.git",
+ "reference": "856e7f6a75a84e339195d48c556f23be2ebf75d0"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/sebastianbergmann/lines-of-code/zipball/856e7f6a75a84e339195d48c556f23be2ebf75d0",
+ "reference": "856e7f6a75a84e339195d48c556f23be2ebf75d0",
+ "shasum": ""
+ },
+ "require": {
+ "nikic/php-parser": "^4.18 || ^5.0",
+ "php": ">=8.1"
+ },
+ "require-dev": {
+ "phpunit/phpunit": "^10.0"
+ },
+ "type": "library",
+ "extra": {
+ "branch-alias": {
+ "dev-main": "2.0-dev"
+ }
+ },
+ "autoload": {
+ "classmap": [
+ "src/"
+ ]
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "BSD-3-Clause"
+ ],
+ "authors": [
+ {
+ "name": "Sebastian Bergmann",
+ "email": "sebastian@phpunit.de",
+ "role": "lead"
+ }
+ ],
+ "description": "Library for counting the lines of code in PHP source code",
+ "homepage": "https://github.com/sebastianbergmann/lines-of-code",
+ "support": {
+ "issues": "https://github.com/sebastianbergmann/lines-of-code/issues",
+ "security": "https://github.com/sebastianbergmann/lines-of-code/security/policy",
+ "source": "https://github.com/sebastianbergmann/lines-of-code/tree/2.0.2"
+ },
+ "funding": [
+ {
+ "url": "https://github.com/sebastianbergmann",
+ "type": "github"
+ }
+ ],
+ "time": "2023-12-21T08:38:20+00:00"
+ },
+ {
+ "name": "sebastian/object-enumerator",
+ "version": "5.0.0",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/sebastianbergmann/object-enumerator.git",
+ "reference": "202d0e344a580d7f7d04b3fafce6933e59dae906"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/sebastianbergmann/object-enumerator/zipball/202d0e344a580d7f7d04b3fafce6933e59dae906",
+ "reference": "202d0e344a580d7f7d04b3fafce6933e59dae906",
+ "shasum": ""
+ },
+ "require": {
+ "php": ">=8.1",
+ "sebastian/object-reflector": "^3.0",
+ "sebastian/recursion-context": "^5.0"
+ },
+ "require-dev": {
+ "phpunit/phpunit": "^10.0"
+ },
+ "type": "library",
+ "extra": {
+ "branch-alias": {
+ "dev-main": "5.0-dev"
+ }
+ },
+ "autoload": {
+ "classmap": [
+ "src/"
+ ]
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "BSD-3-Clause"
+ ],
+ "authors": [
+ {
+ "name": "Sebastian Bergmann",
+ "email": "sebastian@phpunit.de"
+ }
+ ],
+ "description": "Traverses array structures and object graphs to enumerate all referenced objects",
+ "homepage": "https://github.com/sebastianbergmann/object-enumerator/",
+ "support": {
+ "issues": "https://github.com/sebastianbergmann/object-enumerator/issues",
+ "source": "https://github.com/sebastianbergmann/object-enumerator/tree/5.0.0"
+ },
+ "funding": [
+ {
+ "url": "https://github.com/sebastianbergmann",
+ "type": "github"
+ }
+ ],
+ "time": "2023-02-03T07:08:32+00:00"
+ },
+ {
+ "name": "sebastian/object-reflector",
+ "version": "3.0.0",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/sebastianbergmann/object-reflector.git",
+ "reference": "24ed13d98130f0e7122df55d06c5c4942a577957"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/sebastianbergmann/object-reflector/zipball/24ed13d98130f0e7122df55d06c5c4942a577957",
+ "reference": "24ed13d98130f0e7122df55d06c5c4942a577957",
+ "shasum": ""
+ },
+ "require": {
+ "php": ">=8.1"
+ },
+ "require-dev": {
+ "phpunit/phpunit": "^10.0"
+ },
+ "type": "library",
+ "extra": {
+ "branch-alias": {
+ "dev-main": "3.0-dev"
+ }
+ },
+ "autoload": {
+ "classmap": [
+ "src/"
+ ]
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "BSD-3-Clause"
+ ],
+ "authors": [
+ {
+ "name": "Sebastian Bergmann",
+ "email": "sebastian@phpunit.de"
+ }
+ ],
+ "description": "Allows reflection of object attributes, including inherited and non-public ones",
+ "homepage": "https://github.com/sebastianbergmann/object-reflector/",
+ "support": {
+ "issues": "https://github.com/sebastianbergmann/object-reflector/issues",
+ "source": "https://github.com/sebastianbergmann/object-reflector/tree/3.0.0"
+ },
+ "funding": [
+ {
+ "url": "https://github.com/sebastianbergmann",
+ "type": "github"
+ }
+ ],
+ "time": "2023-02-03T07:06:18+00:00"
+ },
+ {
+ "name": "sebastian/recursion-context",
+ "version": "5.0.0",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/sebastianbergmann/recursion-context.git",
+ "reference": "05909fb5bc7df4c52992396d0116aed689f93712"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/sebastianbergmann/recursion-context/zipball/05909fb5bc7df4c52992396d0116aed689f93712",
+ "reference": "05909fb5bc7df4c52992396d0116aed689f93712",
+ "shasum": ""
+ },
+ "require": {
+ "php": ">=8.1"
+ },
+ "require-dev": {
+ "phpunit/phpunit": "^10.0"
+ },
+ "type": "library",
+ "extra": {
+ "branch-alias": {
+ "dev-main": "5.0-dev"
+ }
+ },
+ "autoload": {
+ "classmap": [
+ "src/"
+ ]
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "BSD-3-Clause"
+ ],
+ "authors": [
+ {
+ "name": "Sebastian Bergmann",
+ "email": "sebastian@phpunit.de"
+ },
+ {
+ "name": "Jeff Welch",
+ "email": "whatthejeff@gmail.com"
+ },
+ {
+ "name": "Adam Harvey",
+ "email": "aharvey@php.net"
+ }
+ ],
+ "description": "Provides functionality to recursively process PHP variables",
+ "homepage": "https://github.com/sebastianbergmann/recursion-context",
+ "support": {
+ "issues": "https://github.com/sebastianbergmann/recursion-context/issues",
+ "source": "https://github.com/sebastianbergmann/recursion-context/tree/5.0.0"
+ },
+ "funding": [
+ {
+ "url": "https://github.com/sebastianbergmann",
+ "type": "github"
+ }
+ ],
+ "time": "2023-02-03T07:05:40+00:00"
+ },
+ {
+ "name": "sebastian/type",
+ "version": "4.0.0",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/sebastianbergmann/type.git",
+ "reference": "462699a16464c3944eefc02ebdd77882bd3925bf"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/sebastianbergmann/type/zipball/462699a16464c3944eefc02ebdd77882bd3925bf",
+ "reference": "462699a16464c3944eefc02ebdd77882bd3925bf",
+ "shasum": ""
+ },
+ "require": {
+ "php": ">=8.1"
+ },
+ "require-dev": {
+ "phpunit/phpunit": "^10.0"
+ },
+ "type": "library",
+ "extra": {
+ "branch-alias": {
+ "dev-main": "4.0-dev"
+ }
+ },
+ "autoload": {
+ "classmap": [
+ "src/"
+ ]
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "BSD-3-Clause"
+ ],
+ "authors": [
+ {
+ "name": "Sebastian Bergmann",
+ "email": "sebastian@phpunit.de",
+ "role": "lead"
+ }
+ ],
+ "description": "Collection of value objects that represent the types of the PHP type system",
+ "homepage": "https://github.com/sebastianbergmann/type",
+ "support": {
+ "issues": "https://github.com/sebastianbergmann/type/issues",
+ "source": "https://github.com/sebastianbergmann/type/tree/4.0.0"
+ },
+ "funding": [
+ {
+ "url": "https://github.com/sebastianbergmann",
+ "type": "github"
+ }
+ ],
+ "time": "2023-02-03T07:10:45+00:00"
+ },
+ {
+ "name": "sebastian/version",
+ "version": "4.0.1",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/sebastianbergmann/version.git",
+ "reference": "c51fa83a5d8f43f1402e3f32a005e6262244ef17"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/sebastianbergmann/version/zipball/c51fa83a5d8f43f1402e3f32a005e6262244ef17",
+ "reference": "c51fa83a5d8f43f1402e3f32a005e6262244ef17",
+ "shasum": ""
+ },
+ "require": {
+ "php": ">=8.1"
+ },
+ "type": "library",
+ "extra": {
+ "branch-alias": {
+ "dev-main": "4.0-dev"
+ }
+ },
+ "autoload": {
+ "classmap": [
+ "src/"
+ ]
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "BSD-3-Clause"
+ ],
+ "authors": [
+ {
+ "name": "Sebastian Bergmann",
+ "email": "sebastian@phpunit.de",
+ "role": "lead"
+ }
+ ],
+ "description": "Library that helps with managing the version number of Git-hosted PHP projects",
+ "homepage": "https://github.com/sebastianbergmann/version",
+ "support": {
+ "issues": "https://github.com/sebastianbergmann/version/issues",
+ "source": "https://github.com/sebastianbergmann/version/tree/4.0.1"
+ },
+ "funding": [
+ {
+ "url": "https://github.com/sebastianbergmann",
+ "type": "github"
+ }
+ ],
+ "time": "2023-02-07T11:34:05+00:00"
+ },
+ {
+ "name": "spatie/backtrace",
+ "version": "1.5.3",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/spatie/backtrace.git",
+ "reference": "483f76a82964a0431aa836b6ed0edde0c248e3ab"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/spatie/backtrace/zipball/483f76a82964a0431aa836b6ed0edde0c248e3ab",
+ "reference": "483f76a82964a0431aa836b6ed0edde0c248e3ab",
+ "shasum": ""
+ },
+ "require": {
+ "php": "^7.3|^8.0"
+ },
+ "require-dev": {
+ "ext-json": "*",
+ "phpunit/phpunit": "^9.3",
+ "spatie/phpunit-snapshot-assertions": "^4.2",
+ "symfony/var-dumper": "^5.1"
+ },
+ "type": "library",
+ "autoload": {
+ "psr-4": {
+ "Spatie\\Backtrace\\": "src"
+ }
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "authors": [
+ {
+ "name": "Freek Van de Herten",
+ "email": "freek@spatie.be",
+ "homepage": "https://spatie.be",
+ "role": "Developer"
+ }
+ ],
+ "description": "A better backtrace",
+ "homepage": "https://github.com/spatie/backtrace",
+ "keywords": [
+ "Backtrace",
+ "spatie"
+ ],
+ "support": {
+ "source": "https://github.com/spatie/backtrace/tree/1.5.3"
+ },
+ "funding": [
+ {
+ "url": "https://github.com/sponsors/spatie",
+ "type": "github"
+ },
+ {
+ "url": "https://spatie.be/open-source/support-us",
+ "type": "other"
+ }
+ ],
+ "time": "2023-06-28T12:59:17+00:00"
+ },
+ {
+ "name": "spatie/flare-client-php",
+ "version": "1.4.3",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/spatie/flare-client-php.git",
+ "reference": "5db2fdd743c3ede33f2a5367d89ec1a7c9c1d1ec"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/spatie/flare-client-php/zipball/5db2fdd743c3ede33f2a5367d89ec1a7c9c1d1ec",
+ "reference": "5db2fdd743c3ede33f2a5367d89ec1a7c9c1d1ec",
+ "shasum": ""
+ },
+ "require": {
+ "illuminate/pipeline": "^8.0|^9.0|^10.0|^11.0",
+ "nesbot/carbon": "^2.62.1",
+ "php": "^8.0",
+ "spatie/backtrace": "^1.5.2",
+ "symfony/http-foundation": "^5.2|^6.0|^7.0",
+ "symfony/mime": "^5.2|^6.0|^7.0",
+ "symfony/process": "^5.2|^6.0|^7.0",
+ "symfony/var-dumper": "^5.2|^6.0|^7.0"
+ },
+ "require-dev": {
+ "dms/phpunit-arraysubset-asserts": "^0.5.0",
+ "pestphp/pest": "^1.20|^2.0",
+ "phpstan/extension-installer": "^1.1",
+ "phpstan/phpstan-deprecation-rules": "^1.0",
+ "phpstan/phpstan-phpunit": "^1.0",
+ "spatie/phpunit-snapshot-assertions": "^4.0|^5.0"
+ },
+ "type": "library",
+ "extra": {
+ "branch-alias": {
+ "dev-main": "1.3.x-dev"
+ }
+ },
+ "autoload": {
+ "files": [
+ "src/helpers.php"
+ ],
+ "psr-4": {
+ "Spatie\\FlareClient\\": "src"
+ }
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "description": "Send PHP errors to Flare",
+ "homepage": "https://github.com/spatie/flare-client-php",
+ "keywords": [
+ "exception",
+ "flare",
+ "reporting",
+ "spatie"
+ ],
+ "support": {
+ "issues": "https://github.com/spatie/flare-client-php/issues",
+ "source": "https://github.com/spatie/flare-client-php/tree/1.4.3"
+ },
+ "funding": [
+ {
+ "url": "https://github.com/spatie",
+ "type": "github"
+ }
+ ],
+ "time": "2023-10-17T15:54:07+00:00"
+ },
+ {
+ "name": "spatie/ignition",
+ "version": "1.12.0",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/spatie/ignition.git",
+ "reference": "5b6f801c605a593106b623e45ca41496a6e7d56d"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/spatie/ignition/zipball/5b6f801c605a593106b623e45ca41496a6e7d56d",
+ "reference": "5b6f801c605a593106b623e45ca41496a6e7d56d",
+ "shasum": ""
+ },
+ "require": {
+ "ext-json": "*",
+ "ext-mbstring": "*",
+ "php": "^8.0",
+ "spatie/backtrace": "^1.5.3",
+ "spatie/flare-client-php": "^1.4.0",
+ "symfony/console": "^5.4|^6.0|^7.0",
+ "symfony/var-dumper": "^5.4|^6.0|^7.0"
+ },
+ "require-dev": {
+ "illuminate/cache": "^9.52|^10.0|^11.0",
+ "mockery/mockery": "^1.4",
+ "pestphp/pest": "^1.20|^2.0",
+ "phpstan/extension-installer": "^1.1",
+ "phpstan/phpstan-deprecation-rules": "^1.0",
+ "phpstan/phpstan-phpunit": "^1.0",
+ "psr/simple-cache-implementation": "*",
+ "symfony/cache": "^5.4|^6.0|^7.0",
+ "symfony/process": "^5.4|^6.0|^7.0",
+ "vlucas/phpdotenv": "^5.5"
+ },
+ "suggest": {
+ "openai-php/client": "Require get solutions from OpenAI",
+ "simple-cache-implementation": "To cache solutions from OpenAI"
+ },
+ "type": "library",
+ "extra": {
+ "branch-alias": {
+ "dev-main": "1.5.x-dev"
+ }
+ },
+ "autoload": {
+ "psr-4": {
+ "Spatie\\Ignition\\": "src"
+ }
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "authors": [
+ {
+ "name": "Spatie",
+ "email": "info@spatie.be",
+ "role": "Developer"
+ }
+ ],
+ "description": "A beautiful error page for PHP applications.",
+ "homepage": "https://flareapp.io/ignition",
+ "keywords": [
+ "error",
+ "flare",
+ "laravel",
+ "page"
+ ],
+ "support": {
+ "docs": "https://flareapp.io/docs/ignition-for-laravel/introduction",
+ "forum": "https://twitter.com/flareappio",
+ "issues": "https://github.com/spatie/ignition/issues",
+ "source": "https://github.com/spatie/ignition"
+ },
+ "funding": [
+ {
+ "url": "https://github.com/spatie",
+ "type": "github"
+ }
+ ],
+ "time": "2024-01-03T15:49:39+00:00"
+ },
+ {
+ "name": "spatie/laravel-ignition",
+ "version": "2.4.0",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/spatie/laravel-ignition.git",
+ "reference": "b9395ba48d3f30d42092cf6ceff75ed7256cd604"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/spatie/laravel-ignition/zipball/b9395ba48d3f30d42092cf6ceff75ed7256cd604",
+ "reference": "b9395ba48d3f30d42092cf6ceff75ed7256cd604",
+ "shasum": ""
+ },
+ "require": {
+ "ext-curl": "*",
+ "ext-json": "*",
+ "ext-mbstring": "*",
+ "illuminate/support": "^10.0|^11.0",
+ "php": "^8.1",
+ "spatie/flare-client-php": "^1.3.5",
+ "spatie/ignition": "^1.9",
+ "symfony/console": "^6.2.3|^7.0",
+ "symfony/var-dumper": "^6.2.3|^7.0"
+ },
+ "require-dev": {
+ "livewire/livewire": "^2.11|^3.3.5",
+ "mockery/mockery": "^1.5.1",
+ "openai-php/client": "^0.8.1",
+ "orchestra/testbench": "^8.0|^9.0",
+ "pestphp/pest": "^2.30",
+ "phpstan/extension-installer": "^1.2",
+ "phpstan/phpstan-deprecation-rules": "^1.1.1",
+ "phpstan/phpstan-phpunit": "^1.3.3",
+ "vlucas/phpdotenv": "^5.5"
+ },
+ "suggest": {
+ "openai-php/client": "Require get solutions from OpenAI",
+ "psr/simple-cache-implementation": "Needed to cache solutions from OpenAI"
+ },
+ "type": "library",
+ "extra": {
+ "laravel": {
+ "providers": [
+ "Spatie\\LaravelIgnition\\IgnitionServiceProvider"
+ ],
+ "aliases": {
+ "Flare": "Spatie\\LaravelIgnition\\Facades\\Flare"
+ }
+ }
+ },
+ "autoload": {
+ "files": [
+ "src/helpers.php"
+ ],
+ "psr-4": {
+ "Spatie\\LaravelIgnition\\": "src"
+ }
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "authors": [
+ {
+ "name": "Spatie",
+ "email": "info@spatie.be",
+ "role": "Developer"
+ }
+ ],
+ "description": "A beautiful error page for Laravel applications.",
+ "homepage": "https://flareapp.io/ignition",
+ "keywords": [
+ "error",
+ "flare",
+ "laravel",
+ "page"
+ ],
+ "support": {
+ "docs": "https://flareapp.io/docs/ignition-for-laravel/introduction",
+ "forum": "https://twitter.com/flareappio",
+ "issues": "https://github.com/spatie/laravel-ignition/issues",
+ "source": "https://github.com/spatie/laravel-ignition"
+ },
+ "funding": [
+ {
+ "url": "https://github.com/spatie",
+ "type": "github"
+ }
+ ],
+ "time": "2024-01-04T14:51:24+00:00"
+ },
+ {
+ "name": "symfony/yaml",
+ "version": "v7.0.0",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/symfony/yaml.git",
+ "reference": "0055b230c408428b9b5cde7c55659555be5c0278"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/symfony/yaml/zipball/0055b230c408428b9b5cde7c55659555be5c0278",
+ "reference": "0055b230c408428b9b5cde7c55659555be5c0278",
+ "shasum": ""
+ },
+ "require": {
+ "php": ">=8.2",
+ "symfony/polyfill-ctype": "^1.8"
+ },
+ "conflict": {
+ "symfony/console": "<6.4"
+ },
+ "require-dev": {
+ "symfony/console": "^6.4|^7.0"
+ },
+ "bin": [
+ "Resources/bin/yaml-lint"
+ ],
+ "type": "library",
+ "autoload": {
+ "psr-4": {
+ "Symfony\\Component\\Yaml\\": ""
+ },
+ "exclude-from-classmap": [
+ "/Tests/"
+ ]
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "authors": [
+ {
+ "name": "Fabien Potencier",
+ "email": "fabien@symfony.com"
+ },
+ {
+ "name": "Symfony Community",
+ "homepage": "https://symfony.com/contributors"
+ }
+ ],
+ "description": "Loads and dumps YAML files",
+ "homepage": "https://symfony.com",
+ "support": {
+ "source": "https://github.com/symfony/yaml/tree/v7.0.0"
+ },
+ "funding": [
+ {
+ "url": "https://symfony.com/sponsor",
+ "type": "custom"
+ },
+ {
+ "url": "https://github.com/fabpot",
+ "type": "github"
+ },
+ {
+ "url": "https://tidelift.com/funding/github/packagist/symfony/symfony",
+ "type": "tidelift"
+ }
+ ],
+ "time": "2023-11-07T10:26:03+00:00"
+ },
+ {
+ "name": "theseer/tokenizer",
+ "version": "1.2.2",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/theseer/tokenizer.git",
+ "reference": "b2ad5003ca10d4ee50a12da31de12a5774ba6b96"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/theseer/tokenizer/zipball/b2ad5003ca10d4ee50a12da31de12a5774ba6b96",
+ "reference": "b2ad5003ca10d4ee50a12da31de12a5774ba6b96",
+ "shasum": ""
+ },
+ "require": {
+ "ext-dom": "*",
+ "ext-tokenizer": "*",
+ "ext-xmlwriter": "*",
+ "php": "^7.2 || ^8.0"
+ },
+ "type": "library",
+ "autoload": {
+ "classmap": [
+ "src/"
+ ]
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "BSD-3-Clause"
+ ],
+ "authors": [
+ {
+ "name": "Arne Blankerts",
+ "email": "arne@blankerts.de",
+ "role": "Developer"
+ }
+ ],
+ "description": "A small library for converting tokenized PHP source code into XML and potentially other formats",
+ "support": {
+ "issues": "https://github.com/theseer/tokenizer/issues",
+ "source": "https://github.com/theseer/tokenizer/tree/1.2.2"
+ },
+ "funding": [
+ {
+ "url": "https://github.com/theseer",
+ "type": "github"
+ }
+ ],
+ "time": "2023-11-20T00:12:19+00:00"
+ }
+ ],
+ "aliases": [],
+ "minimum-stability": "stable",
+ "stability-flags": [],
+ "prefer-stable": true,
+ "prefer-lowest": false,
+ "platform": {
+ "php": "^8.1"
+ },
+ "platform-dev": [],
+ "plugin-api-version": "2.6.0"
+}
diff --git a/M6/emensamobile/config/app.php b/M6/emensamobile/config/app.php
new file mode 100644
index 0000000..9207160
--- /dev/null
+++ b/M6/emensamobile/config/app.php
@@ -0,0 +1,188 @@
+ env('APP_NAME', 'Laravel'),
+
+ /*
+ |--------------------------------------------------------------------------
+ | Application Environment
+ |--------------------------------------------------------------------------
+ |
+ | This value determines the "environment" your application is currently
+ | running in. This may determine how you prefer to configure various
+ | services the application utilizes. Set this in your ".env" file.
+ |
+ */
+
+ 'env' => env('APP_ENV', 'production'),
+
+ /*
+ |--------------------------------------------------------------------------
+ | Application Debug Mode
+ |--------------------------------------------------------------------------
+ |
+ | When your application is in debug mode, detailed error messages with
+ | stack traces will be shown on every error that occurs within your
+ | application. If disabled, a simple generic error page is shown.
+ |
+ */
+
+ 'debug' => (bool) env('APP_DEBUG', false),
+
+ /*
+ |--------------------------------------------------------------------------
+ | Application URL
+ |--------------------------------------------------------------------------
+ |
+ | This URL is used by the console to properly generate URLs when using
+ | the Artisan command line tool. You should set this to the root of
+ | your application so that it is used when running Artisan tasks.
+ |
+ */
+
+ 'url' => env('APP_URL', 'http://localhost'),
+
+ 'asset_url' => env('ASSET_URL'),
+
+ /*
+ |--------------------------------------------------------------------------
+ | Application Timezone
+ |--------------------------------------------------------------------------
+ |
+ | Here you may specify the default timezone for your application, which
+ | will be used by the PHP date and date-time functions. We have gone
+ | ahead and set this to a sensible default for you out of the box.
+ |
+ */
+
+ 'timezone' => 'UTC',
+
+ /*
+ |--------------------------------------------------------------------------
+ | Application Locale Configuration
+ |--------------------------------------------------------------------------
+ |
+ | The application locale determines the default locale that will be used
+ | by the translation service provider. You are free to set this value
+ | to any of the locales which will be supported by the application.
+ |
+ */
+
+ 'locale' => 'en',
+
+ /*
+ |--------------------------------------------------------------------------
+ | Application Fallback Locale
+ |--------------------------------------------------------------------------
+ |
+ | The fallback locale determines the locale to use when the current one
+ | is not available. You may change the value to correspond to any of
+ | the language folders that are provided through your application.
+ |
+ */
+
+ 'fallback_locale' => 'en',
+
+ /*
+ |--------------------------------------------------------------------------
+ | Faker Locale
+ |--------------------------------------------------------------------------
+ |
+ | This locale will be used by the Faker PHP library when generating fake
+ | data for your database seeds. For example, this will be used to get
+ | localized telephone numbers, street address information and more.
+ |
+ */
+
+ 'faker_locale' => 'en_US',
+
+ /*
+ |--------------------------------------------------------------------------
+ | Encryption Key
+ |--------------------------------------------------------------------------
+ |
+ | This key is used by the Illuminate encrypter service and should be set
+ | to a random, 32 character string, otherwise these encrypted strings
+ | will not be safe. Please do this before deploying an application!
+ |
+ */
+
+ 'key' => env('APP_KEY'),
+
+ 'cipher' => 'AES-256-CBC',
+
+ /*
+ |--------------------------------------------------------------------------
+ | Maintenance Mode Driver
+ |--------------------------------------------------------------------------
+ |
+ | These configuration options determine the driver used to determine and
+ | manage Laravel's "maintenance mode" status. The "cache" driver will
+ | allow maintenance mode to be controlled across multiple machines.
+ |
+ | Supported drivers: "file", "cache"
+ |
+ */
+
+ 'maintenance' => [
+ 'driver' => 'file',
+ // 'store' => 'redis',
+ ],
+
+ /*
+ |--------------------------------------------------------------------------
+ | Autoloaded Service Providers
+ |--------------------------------------------------------------------------
+ |
+ | The service providers listed here will be automatically loaded on the
+ | request to your application. Feel free to add your own services to
+ | this array to grant expanded functionality to your applications.
+ |
+ */
+
+ 'providers' => ServiceProvider::defaultProviders()->merge([
+ /*
+ * Package Service Providers...
+ */
+
+ /*
+ * Application Service Providers...
+ */
+ App\Providers\AppServiceProvider::class,
+ App\Providers\AuthServiceProvider::class,
+ // App\Providers\BroadcastServiceProvider::class,
+ App\Providers\EventServiceProvider::class,
+ App\Providers\RouteServiceProvider::class,
+ ])->toArray(),
+
+ /*
+ |--------------------------------------------------------------------------
+ | Class Aliases
+ |--------------------------------------------------------------------------
+ |
+ | This array of class aliases will be registered when this application
+ | is started. However, feel free to register as many as you wish as
+ | the aliases are "lazy" loaded so they don't hinder performance.
+ |
+ */
+
+ 'aliases' => Facade::defaultAliases()->merge([
+ // 'Example' => App\Facades\Example::class,
+ ])->toArray(),
+
+];
diff --git a/M6/emensamobile/config/auth.php b/M6/emensamobile/config/auth.php
new file mode 100644
index 0000000..9548c15
--- /dev/null
+++ b/M6/emensamobile/config/auth.php
@@ -0,0 +1,115 @@
+ [
+ 'guard' => 'web',
+ 'passwords' => 'users',
+ ],
+
+ /*
+ |--------------------------------------------------------------------------
+ | Authentication Guards
+ |--------------------------------------------------------------------------
+ |
+ | Next, you may define every authentication guard for your application.
+ | Of course, a great default configuration has been defined for you
+ | here which uses session storage and the Eloquent user provider.
+ |
+ | All authentication drivers have a user provider. This defines how the
+ | users are actually retrieved out of your database or other storage
+ | mechanisms used by this application to persist your user's data.
+ |
+ | Supported: "session"
+ |
+ */
+
+ 'guards' => [
+ 'web' => [
+ 'driver' => 'session',
+ 'provider' => 'users',
+ ],
+ ],
+
+ /*
+ |--------------------------------------------------------------------------
+ | User Providers
+ |--------------------------------------------------------------------------
+ |
+ | All authentication drivers have a user provider. This defines how the
+ | users are actually retrieved out of your database or other storage
+ | mechanisms used by this application to persist your user's data.
+ |
+ | If you have multiple user tables or models you may configure multiple
+ | sources which represent each model / table. These sources may then
+ | be assigned to any extra authentication guards you have defined.
+ |
+ | Supported: "database", "eloquent"
+ |
+ */
+
+ 'providers' => [
+ 'users' => [
+ 'driver' => 'eloquent',
+ 'model' => App\Models\User::class,
+ ],
+
+ // 'users' => [
+ // 'driver' => 'database',
+ // 'table' => 'users',
+ // ],
+ ],
+
+ /*
+ |--------------------------------------------------------------------------
+ | Resetting Passwords
+ |--------------------------------------------------------------------------
+ |
+ | You may specify multiple password reset configurations if you have more
+ | than one user table or model in the application and you want to have
+ | separate password reset settings based on the specific user types.
+ |
+ | The expiry time is the number of minutes that each reset token will be
+ | considered valid. This security feature keeps tokens short-lived so
+ | they have less time to be guessed. You may change this as needed.
+ |
+ | The throttle setting is the number of seconds a user must wait before
+ | generating more password reset tokens. This prevents the user from
+ | quickly generating a very large amount of password reset tokens.
+ |
+ */
+
+ 'passwords' => [
+ 'users' => [
+ 'provider' => 'users',
+ 'table' => 'password_reset_tokens',
+ 'expire' => 60,
+ 'throttle' => 60,
+ ],
+ ],
+
+ /*
+ |--------------------------------------------------------------------------
+ | Password Confirmation Timeout
+ |--------------------------------------------------------------------------
+ |
+ | Here you may define the amount of seconds before a password confirmation
+ | times out and the user is prompted to re-enter their password via the
+ | confirmation screen. By default, the timeout lasts for three hours.
+ |
+ */
+
+ 'password_timeout' => 10800,
+
+];
diff --git a/M6/emensamobile/config/broadcasting.php b/M6/emensamobile/config/broadcasting.php
new file mode 100644
index 0000000..2410485
--- /dev/null
+++ b/M6/emensamobile/config/broadcasting.php
@@ -0,0 +1,71 @@
+ env('BROADCAST_DRIVER', 'null'),
+
+ /*
+ |--------------------------------------------------------------------------
+ | Broadcast Connections
+ |--------------------------------------------------------------------------
+ |
+ | Here you may define all of the broadcast connections that will be used
+ | to broadcast events to other systems or over websockets. Samples of
+ | each available type of connection are provided inside this array.
+ |
+ */
+
+ 'connections' => [
+
+ 'pusher' => [
+ 'driver' => 'pusher',
+ 'key' => env('PUSHER_APP_KEY'),
+ 'secret' => env('PUSHER_APP_SECRET'),
+ 'app_id' => env('PUSHER_APP_ID'),
+ 'options' => [
+ 'cluster' => env('PUSHER_APP_CLUSTER'),
+ 'host' => env('PUSHER_HOST') ?: 'api-'.env('PUSHER_APP_CLUSTER', 'mt1').'.pusher.com',
+ 'port' => env('PUSHER_PORT', 443),
+ 'scheme' => env('PUSHER_SCHEME', 'https'),
+ 'encrypted' => true,
+ 'useTLS' => env('PUSHER_SCHEME', 'https') === 'https',
+ ],
+ 'client_options' => [
+ // Guzzle client options: https://docs.guzzlephp.org/en/stable/request-options.html
+ ],
+ ],
+
+ 'ably' => [
+ 'driver' => 'ably',
+ 'key' => env('ABLY_KEY'),
+ ],
+
+ 'redis' => [
+ 'driver' => 'redis',
+ 'connection' => 'default',
+ ],
+
+ 'log' => [
+ 'driver' => 'log',
+ ],
+
+ 'null' => [
+ 'driver' => 'null',
+ ],
+
+ ],
+
+];
diff --git a/M6/emensamobile/config/cache.php b/M6/emensamobile/config/cache.php
new file mode 100644
index 0000000..d4171e2
--- /dev/null
+++ b/M6/emensamobile/config/cache.php
@@ -0,0 +1,111 @@
+ env('CACHE_DRIVER', 'file'),
+
+ /*
+ |--------------------------------------------------------------------------
+ | Cache Stores
+ |--------------------------------------------------------------------------
+ |
+ | Here you may define all of the cache "stores" for your application as
+ | well as their drivers. You may even define multiple stores for the
+ | same cache driver to group types of items stored in your caches.
+ |
+ | Supported drivers: "apc", "array", "database", "file",
+ | "memcached", "redis", "dynamodb", "octane", "null"
+ |
+ */
+
+ 'stores' => [
+
+ 'apc' => [
+ 'driver' => 'apc',
+ ],
+
+ 'array' => [
+ 'driver' => 'array',
+ 'serialize' => false,
+ ],
+
+ 'database' => [
+ 'driver' => 'database',
+ 'table' => 'cache',
+ 'connection' => null,
+ 'lock_connection' => null,
+ ],
+
+ 'file' => [
+ 'driver' => 'file',
+ 'path' => storage_path('framework/cache/data'),
+ 'lock_path' => storage_path('framework/cache/data'),
+ ],
+
+ 'memcached' => [
+ 'driver' => 'memcached',
+ 'persistent_id' => env('MEMCACHED_PERSISTENT_ID'),
+ 'sasl' => [
+ env('MEMCACHED_USERNAME'),
+ env('MEMCACHED_PASSWORD'),
+ ],
+ 'options' => [
+ // Memcached::OPT_CONNECT_TIMEOUT => 2000,
+ ],
+ 'servers' => [
+ [
+ 'host' => env('MEMCACHED_HOST', '127.0.0.1'),
+ 'port' => env('MEMCACHED_PORT', 11211),
+ 'weight' => 100,
+ ],
+ ],
+ ],
+
+ 'redis' => [
+ 'driver' => 'redis',
+ 'connection' => 'cache',
+ 'lock_connection' => 'default',
+ ],
+
+ 'dynamodb' => [
+ 'driver' => 'dynamodb',
+ 'key' => env('AWS_ACCESS_KEY_ID'),
+ 'secret' => env('AWS_SECRET_ACCESS_KEY'),
+ 'region' => env('AWS_DEFAULT_REGION', 'us-east-1'),
+ 'table' => env('DYNAMODB_CACHE_TABLE', 'cache'),
+ 'endpoint' => env('DYNAMODB_ENDPOINT'),
+ ],
+
+ 'octane' => [
+ 'driver' => 'octane',
+ ],
+
+ ],
+
+ /*
+ |--------------------------------------------------------------------------
+ | Cache Key Prefix
+ |--------------------------------------------------------------------------
+ |
+ | When utilizing the APC, database, memcached, Redis, or DynamoDB cache
+ | stores there might be other applications using the same cache. For
+ | that reason, you may prefix every cache key to avoid collisions.
+ |
+ */
+
+ 'prefix' => env('CACHE_PREFIX', Str::slug(env('APP_NAME', 'laravel'), '_').'_cache_'),
+
+];
diff --git a/M6/emensamobile/config/cors.php b/M6/emensamobile/config/cors.php
new file mode 100644
index 0000000..8a39e6d
--- /dev/null
+++ b/M6/emensamobile/config/cors.php
@@ -0,0 +1,34 @@
+ ['api/*', 'sanctum/csrf-cookie'],
+
+ 'allowed_methods' => ['*'],
+
+ 'allowed_origins' => ['*'],
+
+ 'allowed_origins_patterns' => [],
+
+ 'allowed_headers' => ['*'],
+
+ 'exposed_headers' => [],
+
+ 'max_age' => 0,
+
+ 'supports_credentials' => false,
+
+];
diff --git a/M6/emensamobile/config/database.php b/M6/emensamobile/config/database.php
new file mode 100644
index 0000000..f75b298
--- /dev/null
+++ b/M6/emensamobile/config/database.php
@@ -0,0 +1,151 @@
+ env('DB_CONNECTION', 'mysql'),
+
+ /*
+ |--------------------------------------------------------------------------
+ | Database Connections
+ |--------------------------------------------------------------------------
+ |
+ | Here are each of the database connections setup for your application.
+ | Of course, examples of configuring each database platform that is
+ | supported by Laravel is shown below to make development simple.
+ |
+ |
+ | All database work in Laravel is done through the PHP PDO facilities
+ | so make sure you have the driver for your particular database of
+ | choice installed on your machine before you begin development.
+ |
+ */
+
+ 'connections' => [
+
+ 'sqlite' => [
+ 'driver' => 'sqlite',
+ 'url' => env('DATABASE_URL'),
+ 'database' => env('DB_DATABASE', database_path('database.sqlite')),
+ 'prefix' => '',
+ 'foreign_key_constraints' => env('DB_FOREIGN_KEYS', true),
+ ],
+
+ 'mysql' => [
+ 'driver' => 'mysql',
+ 'url' => env('DATABASE_URL'),
+ 'host' => env('DB_HOST', '127.0.0.1'),
+ 'port' => env('DB_PORT', '3306'),
+ 'database' => env('DB_DATABASE', 'emensawerbeseite'),
+ 'username' => env('DB_USERNAME', 'root'),
+ 'password' => env('DB_PASSWORD', 'admin'),
+ 'unix_socket' => env('DB_SOCKET', ''),
+ 'charset' => 'utf8mb4',
+ 'collation' => 'utf8mb4_unicode_ci',
+ 'prefix' => '',
+ 'prefix_indexes' => true,
+ 'strict' => true,
+ 'engine' => null,
+ 'options' => extension_loaded('pdo_mysql') ? array_filter([
+ PDO::MYSQL_ATTR_SSL_CA => env('MYSQL_ATTR_SSL_CA'),
+ ]) : [],
+ ],
+
+ 'pgsql' => [
+ 'driver' => 'pgsql',
+ 'url' => env('DATABASE_URL'),
+ 'host' => env('DB_HOST', '127.0.0.1'),
+ 'port' => env('DB_PORT', '5432'),
+ 'database' => env('DB_DATABASE', 'forge'),
+ 'username' => env('DB_USERNAME', 'forge'),
+ 'password' => env('DB_PASSWORD', ''),
+ 'charset' => 'utf8',
+ 'prefix' => '',
+ 'prefix_indexes' => true,
+ 'search_path' => 'public',
+ 'sslmode' => 'prefer',
+ ],
+
+ 'sqlsrv' => [
+ 'driver' => 'sqlsrv',
+ 'url' => env('DATABASE_URL'),
+ 'host' => env('DB_HOST', 'localhost'),
+ 'port' => env('DB_PORT', '1433'),
+ 'database' => env('DB_DATABASE', 'forge'),
+ 'username' => env('DB_USERNAME', 'forge'),
+ 'password' => env('DB_PASSWORD', ''),
+ 'charset' => 'utf8',
+ 'prefix' => '',
+ 'prefix_indexes' => true,
+ // 'encrypt' => env('DB_ENCRYPT', 'yes'),
+ // 'trust_server_certificate' => env('DB_TRUST_SERVER_CERTIFICATE', 'false'),
+ ],
+
+ ],
+
+ /*
+ |--------------------------------------------------------------------------
+ | Migration Repository Table
+ |--------------------------------------------------------------------------
+ |
+ | This table keeps track of all the migrations that have already run for
+ | your application. Using this information, we can determine which of
+ | the migrations on disk haven't actually been run in the database.
+ |
+ */
+
+ 'migrations' => 'migrations',
+
+ /*
+ |--------------------------------------------------------------------------
+ | Redis Databases
+ |--------------------------------------------------------------------------
+ |
+ | Redis is an open source, fast, and advanced key-value store that also
+ | provides a richer body of commands than a typical key-value system
+ | such as APC or Memcached. Laravel makes it easy to dig right in.
+ |
+ */
+
+ 'redis' => [
+
+ 'client' => env('REDIS_CLIENT', 'phpredis'),
+
+ 'options' => [
+ 'cluster' => env('REDIS_CLUSTER', 'redis'),
+ 'prefix' => env('REDIS_PREFIX', Str::slug(env('APP_NAME', 'laravel'), '_').'_database_'),
+ ],
+
+ 'default' => [
+ 'url' => env('REDIS_URL'),
+ 'host' => env('REDIS_HOST', '127.0.0.1'),
+ 'username' => env('REDIS_USERNAME'),
+ 'password' => env('REDIS_PASSWORD'),
+ 'port' => env('REDIS_PORT', '6379'),
+ 'database' => env('REDIS_DB', '0'),
+ ],
+
+ 'cache' => [
+ 'url' => env('REDIS_URL'),
+ 'host' => env('REDIS_HOST', '127.0.0.1'),
+ 'username' => env('REDIS_USERNAME'),
+ 'password' => env('REDIS_PASSWORD'),
+ 'port' => env('REDIS_PORT', '6379'),
+ 'database' => env('REDIS_CACHE_DB', '1'),
+ ],
+
+ ],
+
+];
diff --git a/M6/emensamobile/config/filesystems.php b/M6/emensamobile/config/filesystems.php
new file mode 100644
index 0000000..e9d9dbd
--- /dev/null
+++ b/M6/emensamobile/config/filesystems.php
@@ -0,0 +1,76 @@
+ env('FILESYSTEM_DISK', 'local'),
+
+ /*
+ |--------------------------------------------------------------------------
+ | Filesystem Disks
+ |--------------------------------------------------------------------------
+ |
+ | Here you may configure as many filesystem "disks" as you wish, and you
+ | may even configure multiple disks of the same driver. Defaults have
+ | been set up for each driver as an example of the required values.
+ |
+ | Supported Drivers: "local", "ftp", "sftp", "s3"
+ |
+ */
+
+ 'disks' => [
+
+ 'local' => [
+ 'driver' => 'local',
+ 'root' => storage_path('app'),
+ 'throw' => false,
+ ],
+
+ 'public' => [
+ 'driver' => 'local',
+ 'root' => storage_path('app/public'),
+ 'url' => env('APP_URL').'/storage',
+ 'visibility' => 'public',
+ 'throw' => false,
+ ],
+
+ 's3' => [
+ 'driver' => 's3',
+ 'key' => env('AWS_ACCESS_KEY_ID'),
+ 'secret' => env('AWS_SECRET_ACCESS_KEY'),
+ 'region' => env('AWS_DEFAULT_REGION'),
+ 'bucket' => env('AWS_BUCKET'),
+ 'url' => env('AWS_URL'),
+ 'endpoint' => env('AWS_ENDPOINT'),
+ 'use_path_style_endpoint' => env('AWS_USE_PATH_STYLE_ENDPOINT', false),
+ 'throw' => false,
+ ],
+
+ ],
+
+ /*
+ |--------------------------------------------------------------------------
+ | Symbolic Links
+ |--------------------------------------------------------------------------
+ |
+ | Here you may configure the symbolic links that will be created when the
+ | `storage:link` Artisan command is executed. The array keys should be
+ | the locations of the links and the values should be their targets.
+ |
+ */
+
+ 'links' => [
+ public_path('storage') => storage_path('app/public'),
+ ],
+
+];
diff --git a/M6/emensamobile/config/hashing.php b/M6/emensamobile/config/hashing.php
new file mode 100644
index 0000000..0e8a0bb
--- /dev/null
+++ b/M6/emensamobile/config/hashing.php
@@ -0,0 +1,54 @@
+ 'bcrypt',
+
+ /*
+ |--------------------------------------------------------------------------
+ | Bcrypt Options
+ |--------------------------------------------------------------------------
+ |
+ | Here you may specify the configuration options that should be used when
+ | passwords are hashed using the Bcrypt algorithm. This will allow you
+ | to control the amount of time it takes to hash the given password.
+ |
+ */
+
+ 'bcrypt' => [
+ 'rounds' => env('BCRYPT_ROUNDS', 12),
+ 'verify' => true,
+ ],
+
+ /*
+ |--------------------------------------------------------------------------
+ | Argon Options
+ |--------------------------------------------------------------------------
+ |
+ | Here you may specify the configuration options that should be used when
+ | passwords are hashed using the Argon algorithm. These will allow you
+ | to control the amount of time it takes to hash the given password.
+ |
+ */
+
+ 'argon' => [
+ 'memory' => 65536,
+ 'threads' => 1,
+ 'time' => 4,
+ 'verify' => true,
+ ],
+
+];
diff --git a/M6/emensamobile/config/logging.php b/M6/emensamobile/config/logging.php
new file mode 100644
index 0000000..c44d276
--- /dev/null
+++ b/M6/emensamobile/config/logging.php
@@ -0,0 +1,131 @@
+ env('LOG_CHANNEL', 'stack'),
+
+ /*
+ |--------------------------------------------------------------------------
+ | Deprecations Log Channel
+ |--------------------------------------------------------------------------
+ |
+ | This option controls the log channel that should be used to log warnings
+ | regarding deprecated PHP and library features. This allows you to get
+ | your application ready for upcoming major versions of dependencies.
+ |
+ */
+
+ 'deprecations' => [
+ 'channel' => env('LOG_DEPRECATIONS_CHANNEL', 'null'),
+ 'trace' => false,
+ ],
+
+ /*
+ |--------------------------------------------------------------------------
+ | Log Channels
+ |--------------------------------------------------------------------------
+ |
+ | Here you may configure the log channels for your application. Out of
+ | the box, Laravel uses the Monolog PHP logging library. This gives
+ | you a variety of powerful log handlers / formatters to utilize.
+ |
+ | Available Drivers: "single", "daily", "slack", "syslog",
+ | "errorlog", "monolog",
+ | "custom", "stack"
+ |
+ */
+
+ 'channels' => [
+ 'stack' => [
+ 'driver' => 'stack',
+ 'channels' => ['single'],
+ 'ignore_exceptions' => false,
+ ],
+
+ 'single' => [
+ 'driver' => 'single',
+ 'path' => storage_path('logs/laravel.log'),
+ 'level' => env('LOG_LEVEL', 'debug'),
+ 'replace_placeholders' => true,
+ ],
+
+ 'daily' => [
+ 'driver' => 'daily',
+ 'path' => storage_path('logs/laravel.log'),
+ 'level' => env('LOG_LEVEL', 'debug'),
+ 'days' => 14,
+ 'replace_placeholders' => true,
+ ],
+
+ 'slack' => [
+ 'driver' => 'slack',
+ 'url' => env('LOG_SLACK_WEBHOOK_URL'),
+ 'username' => 'Laravel Log',
+ 'emoji' => ':boom:',
+ 'level' => env('LOG_LEVEL', 'critical'),
+ 'replace_placeholders' => true,
+ ],
+
+ 'papertrail' => [
+ 'driver' => 'monolog',
+ 'level' => env('LOG_LEVEL', 'debug'),
+ 'handler' => env('LOG_PAPERTRAIL_HANDLER', SyslogUdpHandler::class),
+ 'handler_with' => [
+ 'host' => env('PAPERTRAIL_URL'),
+ 'port' => env('PAPERTRAIL_PORT'),
+ 'connectionString' => 'tls://'.env('PAPERTRAIL_URL').':'.env('PAPERTRAIL_PORT'),
+ ],
+ 'processors' => [PsrLogMessageProcessor::class],
+ ],
+
+ 'stderr' => [
+ 'driver' => 'monolog',
+ 'level' => env('LOG_LEVEL', 'debug'),
+ 'handler' => StreamHandler::class,
+ 'formatter' => env('LOG_STDERR_FORMATTER'),
+ 'with' => [
+ 'stream' => 'php://stderr',
+ ],
+ 'processors' => [PsrLogMessageProcessor::class],
+ ],
+
+ 'syslog' => [
+ 'driver' => 'syslog',
+ 'level' => env('LOG_LEVEL', 'debug'),
+ 'facility' => LOG_USER,
+ 'replace_placeholders' => true,
+ ],
+
+ 'errorlog' => [
+ 'driver' => 'errorlog',
+ 'level' => env('LOG_LEVEL', 'debug'),
+ 'replace_placeholders' => true,
+ ],
+
+ 'null' => [
+ 'driver' => 'monolog',
+ 'handler' => NullHandler::class,
+ ],
+
+ 'emergency' => [
+ 'path' => storage_path('logs/laravel.log'),
+ ],
+ ],
+
+];
diff --git a/M6/emensamobile/config/mail.php b/M6/emensamobile/config/mail.php
new file mode 100644
index 0000000..e894b2e
--- /dev/null
+++ b/M6/emensamobile/config/mail.php
@@ -0,0 +1,134 @@
+ env('MAIL_MAILER', 'smtp'),
+
+ /*
+ |--------------------------------------------------------------------------
+ | Mailer Configurations
+ |--------------------------------------------------------------------------
+ |
+ | Here you may configure all of the mailers used by your application plus
+ | their respective settings. Several examples have been configured for
+ | you and you are free to add your own as your application requires.
+ |
+ | Laravel supports a variety of mail "transport" drivers to be used while
+ | sending an e-mail. You will specify which one you are using for your
+ | mailers below. You are free to add additional mailers as required.
+ |
+ | Supported: "smtp", "sendmail", "mailgun", "ses", "ses-v2",
+ | "postmark", "log", "array", "failover", "roundrobin"
+ |
+ */
+
+ 'mailers' => [
+ 'smtp' => [
+ 'transport' => 'smtp',
+ 'url' => env('MAIL_URL'),
+ 'host' => env('MAIL_HOST', 'smtp.mailgun.org'),
+ 'port' => env('MAIL_PORT', 587),
+ 'encryption' => env('MAIL_ENCRYPTION', 'tls'),
+ 'username' => env('MAIL_USERNAME'),
+ 'password' => env('MAIL_PASSWORD'),
+ 'timeout' => null,
+ 'local_domain' => env('MAIL_EHLO_DOMAIN'),
+ ],
+
+ 'ses' => [
+ 'transport' => 'ses',
+ ],
+
+ 'postmark' => [
+ 'transport' => 'postmark',
+ // 'message_stream_id' => null,
+ // 'client' => [
+ // 'timeout' => 5,
+ // ],
+ ],
+
+ 'mailgun' => [
+ 'transport' => 'mailgun',
+ // 'client' => [
+ // 'timeout' => 5,
+ // ],
+ ],
+
+ 'sendmail' => [
+ 'transport' => 'sendmail',
+ 'path' => env('MAIL_SENDMAIL_PATH', '/usr/sbin/sendmail -bs -i'),
+ ],
+
+ 'log' => [
+ 'transport' => 'log',
+ 'channel' => env('MAIL_LOG_CHANNEL'),
+ ],
+
+ 'array' => [
+ 'transport' => 'array',
+ ],
+
+ 'failover' => [
+ 'transport' => 'failover',
+ 'mailers' => [
+ 'smtp',
+ 'log',
+ ],
+ ],
+
+ 'roundrobin' => [
+ 'transport' => 'roundrobin',
+ 'mailers' => [
+ 'ses',
+ 'postmark',
+ ],
+ ],
+ ],
+
+ /*
+ |--------------------------------------------------------------------------
+ | Global "From" Address
+ |--------------------------------------------------------------------------
+ |
+ | You may wish for all e-mails sent by your application to be sent from
+ | the same address. Here, you may specify a name and address that is
+ | used globally for all e-mails that are sent by your application.
+ |
+ */
+
+ 'from' => [
+ 'address' => env('MAIL_FROM_ADDRESS', 'hello@example.com'),
+ 'name' => env('MAIL_FROM_NAME', 'Example'),
+ ],
+
+ /*
+ |--------------------------------------------------------------------------
+ | Markdown Mail Settings
+ |--------------------------------------------------------------------------
+ |
+ | If you are using Markdown based email rendering, you may configure your
+ | theme and component paths here, allowing you to customize the design
+ | of the emails. Or, you may simply stick with the Laravel defaults!
+ |
+ */
+
+ 'markdown' => [
+ 'theme' => 'default',
+
+ 'paths' => [
+ resource_path('views/vendor/mail'),
+ ],
+ ],
+
+];
diff --git a/M6/emensamobile/config/queue.php b/M6/emensamobile/config/queue.php
new file mode 100644
index 0000000..01c6b05
--- /dev/null
+++ b/M6/emensamobile/config/queue.php
@@ -0,0 +1,109 @@
+ env('QUEUE_CONNECTION', 'sync'),
+
+ /*
+ |--------------------------------------------------------------------------
+ | Queue Connections
+ |--------------------------------------------------------------------------
+ |
+ | Here you may configure the connection information for each server that
+ | is used by your application. A default configuration has been added
+ | for each back-end shipped with Laravel. You are free to add more.
+ |
+ | Drivers: "sync", "database", "beanstalkd", "sqs", "redis", "null"
+ |
+ */
+
+ 'connections' => [
+
+ 'sync' => [
+ 'driver' => 'sync',
+ ],
+
+ 'database' => [
+ 'driver' => 'database',
+ 'table' => 'jobs',
+ 'queue' => 'default',
+ 'retry_after' => 90,
+ 'after_commit' => false,
+ ],
+
+ 'beanstalkd' => [
+ 'driver' => 'beanstalkd',
+ 'host' => 'localhost',
+ 'queue' => 'default',
+ 'retry_after' => 90,
+ 'block_for' => 0,
+ 'after_commit' => false,
+ ],
+
+ 'sqs' => [
+ 'driver' => 'sqs',
+ 'key' => env('AWS_ACCESS_KEY_ID'),
+ 'secret' => env('AWS_SECRET_ACCESS_KEY'),
+ 'prefix' => env('SQS_PREFIX', 'https://sqs.us-east-1.amazonaws.com/your-account-id'),
+ 'queue' => env('SQS_QUEUE', 'default'),
+ 'suffix' => env('SQS_SUFFIX'),
+ 'region' => env('AWS_DEFAULT_REGION', 'us-east-1'),
+ 'after_commit' => false,
+ ],
+
+ 'redis' => [
+ 'driver' => 'redis',
+ 'connection' => 'default',
+ 'queue' => env('REDIS_QUEUE', 'default'),
+ 'retry_after' => 90,
+ 'block_for' => null,
+ 'after_commit' => false,
+ ],
+
+ ],
+
+ /*
+ |--------------------------------------------------------------------------
+ | Job Batching
+ |--------------------------------------------------------------------------
+ |
+ | The following options configure the database and table that store job
+ | batching information. These options can be updated to any database
+ | connection and table which has been defined by your application.
+ |
+ */
+
+ 'batching' => [
+ 'database' => env('DB_CONNECTION', 'mysql'),
+ 'table' => 'job_batches',
+ ],
+
+ /*
+ |--------------------------------------------------------------------------
+ | Failed Queue Jobs
+ |--------------------------------------------------------------------------
+ |
+ | These options configure the behavior of failed queue job logging so you
+ | can control which database and table are used to store the jobs that
+ | have failed. You may change them to any database / table you wish.
+ |
+ */
+
+ 'failed' => [
+ 'driver' => env('QUEUE_FAILED_DRIVER', 'database-uuids'),
+ 'database' => env('DB_CONNECTION', 'mysql'),
+ 'table' => 'failed_jobs',
+ ],
+
+];
diff --git a/M6/emensamobile/config/sanctum.php b/M6/emensamobile/config/sanctum.php
new file mode 100644
index 0000000..35d75b3
--- /dev/null
+++ b/M6/emensamobile/config/sanctum.php
@@ -0,0 +1,83 @@
+ explode(',', env('SANCTUM_STATEFUL_DOMAINS', sprintf(
+ '%s%s',
+ 'localhost,localhost:3000,127.0.0.1,127.0.0.1:8000,::1',
+ Sanctum::currentApplicationUrlWithPort()
+ ))),
+
+ /*
+ |--------------------------------------------------------------------------
+ | Sanctum Guards
+ |--------------------------------------------------------------------------
+ |
+ | This array contains the authentication guards that will be checked when
+ | Sanctum is trying to authenticate a request. If none of these guards
+ | are able to authenticate the request, Sanctum will use the bearer
+ | token that's present on an incoming request for authentication.
+ |
+ */
+
+ 'guard' => ['web'],
+
+ /*
+ |--------------------------------------------------------------------------
+ | Expiration Minutes
+ |--------------------------------------------------------------------------
+ |
+ | This value controls the number of minutes until an issued token will be
+ | considered expired. This will override any values set in the token's
+ | "expires_at" attribute, but first-party sessions are not affected.
+ |
+ */
+
+ 'expiration' => null,
+
+ /*
+ |--------------------------------------------------------------------------
+ | Token Prefix
+ |--------------------------------------------------------------------------
+ |
+ | Sanctum can prefix new tokens in order to take advantage of numerous
+ | security scanning initiatives maintained by open source platforms
+ | that notify developers if they commit tokens into repositories.
+ |
+ | See: https://docs.github.com/en/code-security/secret-scanning/about-secret-scanning
+ |
+ */
+
+ 'token_prefix' => env('SANCTUM_TOKEN_PREFIX', ''),
+
+ /*
+ |--------------------------------------------------------------------------
+ | Sanctum Middleware
+ |--------------------------------------------------------------------------
+ |
+ | When authenticating your first-party SPA with Sanctum you may need to
+ | customize some of the middleware Sanctum uses while processing the
+ | request. You may change the middleware listed below as required.
+ |
+ */
+
+ 'middleware' => [
+ 'authenticate_session' => Laravel\Sanctum\Http\Middleware\AuthenticateSession::class,
+ 'encrypt_cookies' => App\Http\Middleware\EncryptCookies::class,
+ 'verify_csrf_token' => App\Http\Middleware\VerifyCsrfToken::class,
+ ],
+
+];
diff --git a/M6/emensamobile/config/services.php b/M6/emensamobile/config/services.php
new file mode 100644
index 0000000..0ace530
--- /dev/null
+++ b/M6/emensamobile/config/services.php
@@ -0,0 +1,34 @@
+ [
+ 'domain' => env('MAILGUN_DOMAIN'),
+ 'secret' => env('MAILGUN_SECRET'),
+ 'endpoint' => env('MAILGUN_ENDPOINT', 'api.mailgun.net'),
+ 'scheme' => 'https',
+ ],
+
+ 'postmark' => [
+ 'token' => env('POSTMARK_TOKEN'),
+ ],
+
+ 'ses' => [
+ 'key' => env('AWS_ACCESS_KEY_ID'),
+ 'secret' => env('AWS_SECRET_ACCESS_KEY'),
+ 'region' => env('AWS_DEFAULT_REGION', 'us-east-1'),
+ ],
+
+];
diff --git a/M6/emensamobile/config/session.php b/M6/emensamobile/config/session.php
new file mode 100644
index 0000000..e738cb3
--- /dev/null
+++ b/M6/emensamobile/config/session.php
@@ -0,0 +1,214 @@
+ env('SESSION_DRIVER', 'file'),
+
+ /*
+ |--------------------------------------------------------------------------
+ | Session Lifetime
+ |--------------------------------------------------------------------------
+ |
+ | Here you may specify the number of minutes that you wish the session
+ | to be allowed to remain idle before it expires. If you want them
+ | to immediately expire on the browser closing, set that option.
+ |
+ */
+
+ 'lifetime' => env('SESSION_LIFETIME', 120),
+
+ 'expire_on_close' => false,
+
+ /*
+ |--------------------------------------------------------------------------
+ | Session Encryption
+ |--------------------------------------------------------------------------
+ |
+ | This option allows you to easily specify that all of your session data
+ | should be encrypted before it is stored. All encryption will be run
+ | automatically by Laravel and you can use the Session like normal.
+ |
+ */
+
+ 'encrypt' => false,
+
+ /*
+ |--------------------------------------------------------------------------
+ | Session File Location
+ |--------------------------------------------------------------------------
+ |
+ | When using the native session driver, we need a location where session
+ | files may be stored. A default has been set for you but a different
+ | location may be specified. This is only needed for file sessions.
+ |
+ */
+
+ 'files' => storage_path('framework/sessions'),
+
+ /*
+ |--------------------------------------------------------------------------
+ | Session Database Connection
+ |--------------------------------------------------------------------------
+ |
+ | When using the "database" or "redis" session drivers, you may specify a
+ | connection that should be used to manage these sessions. This should
+ | correspond to a connection in your database configuration options.
+ |
+ */
+
+ 'connection' => env('SESSION_CONNECTION'),
+
+ /*
+ |--------------------------------------------------------------------------
+ | Session Database Table
+ |--------------------------------------------------------------------------
+ |
+ | When using the "database" session driver, you may specify the table we
+ | should use to manage the sessions. Of course, a sensible default is
+ | provided for you; however, you are free to change this as needed.
+ |
+ */
+
+ 'table' => 'sessions',
+
+ /*
+ |--------------------------------------------------------------------------
+ | Session Cache Store
+ |--------------------------------------------------------------------------
+ |
+ | While using one of the framework's cache driven session backends you may
+ | list a cache store that should be used for these sessions. This value
+ | must match with one of the application's configured cache "stores".
+ |
+ | Affects: "apc", "dynamodb", "memcached", "redis"
+ |
+ */
+
+ 'store' => env('SESSION_STORE'),
+
+ /*
+ |--------------------------------------------------------------------------
+ | Session Sweeping Lottery
+ |--------------------------------------------------------------------------
+ |
+ | Some session drivers must manually sweep their storage location to get
+ | rid of old sessions from storage. Here are the chances that it will
+ | happen on a given request. By default, the odds are 2 out of 100.
+ |
+ */
+
+ 'lottery' => [2, 100],
+
+ /*
+ |--------------------------------------------------------------------------
+ | Session Cookie Name
+ |--------------------------------------------------------------------------
+ |
+ | Here you may change the name of the cookie used to identify a session
+ | instance by ID. The name specified here will get used every time a
+ | new session cookie is created by the framework for every driver.
+ |
+ */
+
+ 'cookie' => env(
+ 'SESSION_COOKIE',
+ Str::slug(env('APP_NAME', 'laravel'), '_').'_session'
+ ),
+
+ /*
+ |--------------------------------------------------------------------------
+ | Session Cookie Path
+ |--------------------------------------------------------------------------
+ |
+ | The session cookie path determines the path for which the cookie will
+ | be regarded as available. Typically, this will be the root path of
+ | your application but you are free to change this when necessary.
+ |
+ */
+
+ 'path' => '/',
+
+ /*
+ |--------------------------------------------------------------------------
+ | Session Cookie Domain
+ |--------------------------------------------------------------------------
+ |
+ | Here you may change the domain of the cookie used to identify a session
+ | in your application. This will determine which domains the cookie is
+ | available to in your application. A sensible default has been set.
+ |
+ */
+
+ 'domain' => env('SESSION_DOMAIN'),
+
+ /*
+ |--------------------------------------------------------------------------
+ | HTTPS Only Cookies
+ |--------------------------------------------------------------------------
+ |
+ | By setting this option to true, session cookies will only be sent back
+ | to the server if the browser has a HTTPS connection. This will keep
+ | the cookie from being sent to you when it can't be done securely.
+ |
+ */
+
+ 'secure' => env('SESSION_SECURE_COOKIE'),
+
+ /*
+ |--------------------------------------------------------------------------
+ | HTTP Access Only
+ |--------------------------------------------------------------------------
+ |
+ | Setting this value to true will prevent JavaScript from accessing the
+ | value of the cookie and the cookie will only be accessible through
+ | the HTTP protocol. You are free to modify this option if needed.
+ |
+ */
+
+ 'http_only' => true,
+
+ /*
+ |--------------------------------------------------------------------------
+ | Same-Site Cookies
+ |--------------------------------------------------------------------------
+ |
+ | This option determines how your cookies behave when cross-site requests
+ | take place, and can be used to mitigate CSRF attacks. By default, we
+ | will set this value to "lax" since this is a secure default value.
+ |
+ | Supported: "lax", "strict", "none", null
+ |
+ */
+
+ 'same_site' => 'lax',
+
+ /*
+ |--------------------------------------------------------------------------
+ | Partitioned Cookies
+ |--------------------------------------------------------------------------
+ |
+ | Setting this value to true will tie the cookie to the top-level site for
+ | a cross-site context. Partitioned cookies are accepted by the browser
+ | when flagged "secure" and the Same-Site attribute is set to "none".
+ |
+ */
+
+ 'partitioned' => false,
+
+];
diff --git a/M6/emensamobile/config/view.php b/M6/emensamobile/config/view.php
new file mode 100644
index 0000000..22b8a18
--- /dev/null
+++ b/M6/emensamobile/config/view.php
@@ -0,0 +1,36 @@
+ [
+ resource_path('views'),
+ ],
+
+ /*
+ |--------------------------------------------------------------------------
+ | Compiled View Path
+ |--------------------------------------------------------------------------
+ |
+ | This option determines where all the compiled Blade templates will be
+ | stored for your application. Typically, this is within the storage
+ | directory. However, as usual, you are free to change this value.
+ |
+ */
+
+ 'compiled' => env(
+ 'VIEW_COMPILED_PATH',
+ realpath(storage_path('framework/views'))
+ ),
+
+];
diff --git a/M6/emensamobile/database/.gitignore b/M6/emensamobile/database/.gitignore
new file mode 100644
index 0000000..9b19b93
--- /dev/null
+++ b/M6/emensamobile/database/.gitignore
@@ -0,0 +1 @@
+*.sqlite*
diff --git a/M6/emensamobile/database/factories/UserFactory.php b/M6/emensamobile/database/factories/UserFactory.php
new file mode 100644
index 0000000..584104c
--- /dev/null
+++ b/M6/emensamobile/database/factories/UserFactory.php
@@ -0,0 +1,44 @@
+
+ */
+class UserFactory extends Factory
+{
+ /**
+ * The current password being used by the factory.
+ */
+ protected static ?string $password;
+
+ /**
+ * Define the model's default state.
+ *
+ * @return array
+ */
+ public function definition(): array
+ {
+ return [
+ 'name' => fake()->name(),
+ 'email' => fake()->unique()->safeEmail(),
+ 'email_verified_at' => now(),
+ 'password' => static::$password ??= Hash::make('password'),
+ 'remember_token' => Str::random(10),
+ ];
+ }
+
+ /**
+ * Indicate that the model's email address should be unverified.
+ */
+ public function unverified(): static
+ {
+ return $this->state(fn (array $attributes) => [
+ 'email_verified_at' => null,
+ ]);
+ }
+}
diff --git a/M6/emensamobile/database/migrations/2014_10_12_000000_create_users_table.php b/M6/emensamobile/database/migrations/2014_10_12_000000_create_users_table.php
new file mode 100644
index 0000000..444fafb
--- /dev/null
+++ b/M6/emensamobile/database/migrations/2014_10_12_000000_create_users_table.php
@@ -0,0 +1,32 @@
+id();
+ $table->string('name');
+ $table->string('email')->unique();
+ $table->timestamp('email_verified_at')->nullable();
+ $table->string('password');
+ $table->rememberToken();
+ $table->timestamps();
+ });
+ }
+
+ /**
+ * Reverse the migrations.
+ */
+ public function down(): void
+ {
+ Schema::dropIfExists('users');
+ }
+};
diff --git a/M6/emensamobile/database/migrations/2014_10_12_100000_create_password_reset_tokens_table.php b/M6/emensamobile/database/migrations/2014_10_12_100000_create_password_reset_tokens_table.php
new file mode 100644
index 0000000..81a7229
--- /dev/null
+++ b/M6/emensamobile/database/migrations/2014_10_12_100000_create_password_reset_tokens_table.php
@@ -0,0 +1,28 @@
+string('email')->primary();
+ $table->string('token');
+ $table->timestamp('created_at')->nullable();
+ });
+ }
+
+ /**
+ * Reverse the migrations.
+ */
+ public function down(): void
+ {
+ Schema::dropIfExists('password_reset_tokens');
+ }
+};
diff --git a/M6/emensamobile/database/migrations/2019_08_19_000000_create_failed_jobs_table.php b/M6/emensamobile/database/migrations/2019_08_19_000000_create_failed_jobs_table.php
new file mode 100644
index 0000000..249da81
--- /dev/null
+++ b/M6/emensamobile/database/migrations/2019_08_19_000000_create_failed_jobs_table.php
@@ -0,0 +1,32 @@
+id();
+ $table->string('uuid')->unique();
+ $table->text('connection');
+ $table->text('queue');
+ $table->longText('payload');
+ $table->longText('exception');
+ $table->timestamp('failed_at')->useCurrent();
+ });
+ }
+
+ /**
+ * Reverse the migrations.
+ */
+ public function down(): void
+ {
+ Schema::dropIfExists('failed_jobs');
+ }
+};
diff --git a/M6/emensamobile/database/migrations/2019_12_14_000001_create_personal_access_tokens_table.php b/M6/emensamobile/database/migrations/2019_12_14_000001_create_personal_access_tokens_table.php
new file mode 100644
index 0000000..e828ad8
--- /dev/null
+++ b/M6/emensamobile/database/migrations/2019_12_14_000001_create_personal_access_tokens_table.php
@@ -0,0 +1,33 @@
+id();
+ $table->morphs('tokenable');
+ $table->string('name');
+ $table->string('token', 64)->unique();
+ $table->text('abilities')->nullable();
+ $table->timestamp('last_used_at')->nullable();
+ $table->timestamp('expires_at')->nullable();
+ $table->timestamps();
+ });
+ }
+
+ /**
+ * Reverse the migrations.
+ */
+ public function down(): void
+ {
+ Schema::dropIfExists('personal_access_tokens');
+ }
+};
diff --git a/M6/emensamobile/database/seeders/DatabaseSeeder.php b/M6/emensamobile/database/seeders/DatabaseSeeder.php
new file mode 100644
index 0000000..a9f4519
--- /dev/null
+++ b/M6/emensamobile/database/seeders/DatabaseSeeder.php
@@ -0,0 +1,22 @@
+create();
+
+ // \App\Models\User::factory()->create([
+ // 'name' => 'Test User',
+ // 'email' => 'test@example.com',
+ // ]);
+ }
+}
diff --git a/M6/emensamobile/package.json b/M6/emensamobile/package.json
new file mode 100644
index 0000000..56f5ddc
--- /dev/null
+++ b/M6/emensamobile/package.json
@@ -0,0 +1,13 @@
+{
+ "private": true,
+ "type": "module",
+ "scripts": {
+ "dev": "vite",
+ "build": "vite build"
+ },
+ "devDependencies": {
+ "axios": "^1.6.4",
+ "laravel-vite-plugin": "^1.0.0",
+ "vite": "^5.0.0"
+ }
+}
diff --git a/M6/emensamobile/phpunit.xml b/M6/emensamobile/phpunit.xml
new file mode 100644
index 0000000..bc86714
--- /dev/null
+++ b/M6/emensamobile/phpunit.xml
@@ -0,0 +1,32 @@
+
+
+
+
+ tests/Unit
+
+
+ tests/Feature
+
+
+
+
+ app
+
+
+
+
+
diff --git a/M6/emensamobile/public/.htaccess b/M6/emensamobile/public/.htaccess
new file mode 100644
index 0000000..3aec5e2
--- /dev/null
+++ b/M6/emensamobile/public/.htaccess
@@ -0,0 +1,21 @@
+
+
+ Options -MultiViews -Indexes
+
+
+ RewriteEngine On
+
+ # Handle Authorization Header
+ RewriteCond %{HTTP:Authorization} .
+ RewriteRule .* - [E=HTTP_AUTHORIZATION:%{HTTP:Authorization}]
+
+ # Redirect Trailing Slashes If Not A Folder...
+ RewriteCond %{REQUEST_FILENAME} !-d
+ RewriteCond %{REQUEST_URI} (.+)/$
+ RewriteRule ^ %1 [L,R=301]
+
+ # Send Requests To Front Controller...
+ RewriteCond %{REQUEST_FILENAME} !-d
+ RewriteCond %{REQUEST_FILENAME} !-f
+ RewriteRule ^ index.php [L]
+
diff --git a/M6/emensamobile/public/css/app.css b/M6/emensamobile/public/css/app.css
new file mode 100644
index 0000000..e69de29
diff --git a/M6/emensamobile/public/css/style.css b/M6/emensamobile/public/css/style.css
new file mode 100644
index 0000000..de9cc31
--- /dev/null
+++ b/M6/emensamobile/public/css/style.css
@@ -0,0 +1,96 @@
+* {
+ font-family: Arial;
+}
+
+.grid {
+ display: grid;
+ grid-template-columns: 200px auto 200px;
+}
+
+img {
+ width: 100%;
+ height: auto;
+}
+
+.speisen {
+ border: solid;
+ border-collapse: collapse;
+}
+
+.speisen td {
+ border: solid;
+ border-collapse: collapse;
+ border-radius: 4px;
+ padding: 5px;
+ width: auto;
+}
+
+.speisen td:not(:first-of-type) {
+ text-align: center;
+}
+
+.speisen img{
+ width: 100px;
+ height: 100px;
+}
+
+
+p {
+ text-align: justify;
+}
+
+.zahlen {
+ list-style-type: none;
+ display: grid;
+ grid-template-columns: auto auto auto;
+ gap: 10px;
+}
+
+.zahlen p {
+ text-align: center;
+ font-weight: bold;
+}
+
+.formular {
+ display: grid;
+ grid-template-columns: auto auto auto;
+ justify-content: start;
+ gap: 10px;
+}
+
+.wichtig {
+ text-align: center;
+}
+
+.wichtigListe {
+ display: inline-block;
+ text-align: left;
+}
+
+.freude {
+ text-align: center;
+}
+
+footer {
+ border-top: 1px solid;
+}
+
+.fusszeile {
+ padding-top: 20px;
+ padding-bottom: 20px;
+ margin-left: auto;
+ margin-right: auto;
+ border: none;
+}
+
+.fusszeile td:first-child {
+ border-left: none;
+ padding-left: 20px;
+ padding-right: 20px;
+}
+
+.fusszeile td {
+ border-left: 3px solid;
+ padding-left: 20px;
+ padding-right: 20px;
+}
diff --git a/M6/emensamobile/public/favicon.ico b/M6/emensamobile/public/favicon.ico
new file mode 100644
index 0000000..e69de29
diff --git a/M6/emensamobile/public/img/fh-logo.jpg b/M6/emensamobile/public/img/fh-logo.jpg
new file mode 100644
index 0000000..33cf0b4
Binary files /dev/null and b/M6/emensamobile/public/img/fh-logo.jpg differ
diff --git a/M6/emensamobile/public/img/gerichte/00_image_missing.jpg b/M6/emensamobile/public/img/gerichte/00_image_missing.jpg
new file mode 100644
index 0000000..e0e2d2a
Binary files /dev/null and b/M6/emensamobile/public/img/gerichte/00_image_missing.jpg differ
diff --git a/M6/emensamobile/public/img/gerichte/01_bratkartoffel.jpg b/M6/emensamobile/public/img/gerichte/01_bratkartoffel.jpg
new file mode 100644
index 0000000..802b46d
Binary files /dev/null and b/M6/emensamobile/public/img/gerichte/01_bratkartoffel.jpg differ
diff --git a/M6/emensamobile/public/img/gerichte/03_bratkartoffel.jpg b/M6/emensamobile/public/img/gerichte/03_bratkartoffel.jpg
new file mode 100644
index 0000000..e2d8002
Binary files /dev/null and b/M6/emensamobile/public/img/gerichte/03_bratkartoffel.jpg differ
diff --git a/M6/emensamobile/public/img/gerichte/04_tofu.jpg b/M6/emensamobile/public/img/gerichte/04_tofu.jpg
new file mode 100644
index 0000000..c3f0052
Binary files /dev/null and b/M6/emensamobile/public/img/gerichte/04_tofu.jpg differ
diff --git a/M6/emensamobile/public/img/gerichte/06_lasagne.jpg b/M6/emensamobile/public/img/gerichte/06_lasagne.jpg
new file mode 100644
index 0000000..ea291a9
Binary files /dev/null and b/M6/emensamobile/public/img/gerichte/06_lasagne.jpg differ
diff --git a/M6/emensamobile/public/img/gerichte/09_suppe.jpg b/M6/emensamobile/public/img/gerichte/09_suppe.jpg
new file mode 100644
index 0000000..cdff137
Binary files /dev/null and b/M6/emensamobile/public/img/gerichte/09_suppe.jpg differ
diff --git a/M6/emensamobile/public/img/gerichte/10_forelle.jpg b/M6/emensamobile/public/img/gerichte/10_forelle.jpg
new file mode 100644
index 0000000..4a1c439
Binary files /dev/null and b/M6/emensamobile/public/img/gerichte/10_forelle.jpg differ
diff --git a/M6/emensamobile/public/img/gerichte/11_soup.jpg b/M6/emensamobile/public/img/gerichte/11_soup.jpg
new file mode 100644
index 0000000..f7a416d
Binary files /dev/null and b/M6/emensamobile/public/img/gerichte/11_soup.jpg differ
diff --git a/M6/emensamobile/public/img/gerichte/12_kassler.jpg b/M6/emensamobile/public/img/gerichte/12_kassler.jpg
new file mode 100644
index 0000000..cf0e69a
Binary files /dev/null and b/M6/emensamobile/public/img/gerichte/12_kassler.jpg differ
diff --git a/M6/emensamobile/public/img/gerichte/13_reibekuchen.jpg b/M6/emensamobile/public/img/gerichte/13_reibekuchen.jpg
new file mode 100644
index 0000000..0415c0a
Binary files /dev/null and b/M6/emensamobile/public/img/gerichte/13_reibekuchen.jpg differ
diff --git a/M6/emensamobile/public/img/gerichte/15_pilze.jpg b/M6/emensamobile/public/img/gerichte/15_pilze.jpg
new file mode 100644
index 0000000..849594a
Binary files /dev/null and b/M6/emensamobile/public/img/gerichte/15_pilze.jpg differ
diff --git a/M6/emensamobile/public/img/gerichte/17_broetchen.jpg b/M6/emensamobile/public/img/gerichte/17_broetchen.jpg
new file mode 100644
index 0000000..c0656ac
Binary files /dev/null and b/M6/emensamobile/public/img/gerichte/17_broetchen.jpg differ
diff --git a/M6/emensamobile/public/img/gerichte/19_mousse.jpg b/M6/emensamobile/public/img/gerichte/19_mousse.jpg
new file mode 100644
index 0000000..0045cd1
Binary files /dev/null and b/M6/emensamobile/public/img/gerichte/19_mousse.jpg differ
diff --git a/M6/emensamobile/public/img/gerichte/20_suppe.jpg b/M6/emensamobile/public/img/gerichte/20_suppe.jpg
new file mode 100644
index 0000000..1b075da
Binary files /dev/null and b/M6/emensamobile/public/img/gerichte/20_suppe.jpg differ
diff --git a/M6/emensamobile/public/img/gerichte/license.txt b/M6/emensamobile/public/img/gerichte/license.txt
new file mode 100644
index 0000000..0c6b476
--- /dev/null
+++ b/M6/emensamobile/public/img/gerichte/license.txt
@@ -0,0 +1,6 @@
+Grafiken von unsplash.com.
+
+Lizenz:
+https://unsplash.com/license
+
+Letzter Zugriff 31.08.2020
\ No newline at end of file
diff --git a/M6/emensamobile/public/img/mensa21.jpg b/M6/emensamobile/public/img/mensa21.jpg
new file mode 100644
index 0000000..370d0fc
Binary files /dev/null and b/M6/emensamobile/public/img/mensa21.jpg differ
diff --git a/M6/emensamobile/public/img/test.jpg b/M6/emensamobile/public/img/test.jpg
new file mode 100644
index 0000000..4558cd4
Binary files /dev/null and b/M6/emensamobile/public/img/test.jpg differ
diff --git a/M6/emensamobile/public/index.php b/M6/emensamobile/public/index.php
new file mode 100644
index 0000000..1d69f3a
--- /dev/null
+++ b/M6/emensamobile/public/index.php
@@ -0,0 +1,55 @@
+make(Kernel::class);
+
+$response = $kernel->handle(
+ $request = Request::capture()
+)->send();
+
+$kernel->terminate($request, $response);
diff --git a/M6/emensamobile/public/robots.txt b/M6/emensamobile/public/robots.txt
new file mode 100644
index 0000000..eb05362
--- /dev/null
+++ b/M6/emensamobile/public/robots.txt
@@ -0,0 +1,2 @@
+User-agent: *
+Disallow:
diff --git a/M6/emensamobile/resources/css/app.css b/M6/emensamobile/resources/css/app.css
new file mode 100644
index 0000000..e69de29
diff --git a/M6/emensamobile/resources/css/style.css b/M6/emensamobile/resources/css/style.css
new file mode 100644
index 0000000..de9cc31
--- /dev/null
+++ b/M6/emensamobile/resources/css/style.css
@@ -0,0 +1,96 @@
+* {
+ font-family: Arial;
+}
+
+.grid {
+ display: grid;
+ grid-template-columns: 200px auto 200px;
+}
+
+img {
+ width: 100%;
+ height: auto;
+}
+
+.speisen {
+ border: solid;
+ border-collapse: collapse;
+}
+
+.speisen td {
+ border: solid;
+ border-collapse: collapse;
+ border-radius: 4px;
+ padding: 5px;
+ width: auto;
+}
+
+.speisen td:not(:first-of-type) {
+ text-align: center;
+}
+
+.speisen img{
+ width: 100px;
+ height: 100px;
+}
+
+
+p {
+ text-align: justify;
+}
+
+.zahlen {
+ list-style-type: none;
+ display: grid;
+ grid-template-columns: auto auto auto;
+ gap: 10px;
+}
+
+.zahlen p {
+ text-align: center;
+ font-weight: bold;
+}
+
+.formular {
+ display: grid;
+ grid-template-columns: auto auto auto;
+ justify-content: start;
+ gap: 10px;
+}
+
+.wichtig {
+ text-align: center;
+}
+
+.wichtigListe {
+ display: inline-block;
+ text-align: left;
+}
+
+.freude {
+ text-align: center;
+}
+
+footer {
+ border-top: 1px solid;
+}
+
+.fusszeile {
+ padding-top: 20px;
+ padding-bottom: 20px;
+ margin-left: auto;
+ margin-right: auto;
+ border: none;
+}
+
+.fusszeile td:first-child {
+ border-left: none;
+ padding-left: 20px;
+ padding-right: 20px;
+}
+
+.fusszeile td {
+ border-left: 3px solid;
+ padding-left: 20px;
+ padding-right: 20px;
+}
diff --git a/M6/emensamobile/resources/js/app.js b/M6/emensamobile/resources/js/app.js
new file mode 100644
index 0000000..e59d6a0
--- /dev/null
+++ b/M6/emensamobile/resources/js/app.js
@@ -0,0 +1 @@
+import './bootstrap';
diff --git a/M6/emensamobile/resources/js/bootstrap.js b/M6/emensamobile/resources/js/bootstrap.js
new file mode 100644
index 0000000..846d350
--- /dev/null
+++ b/M6/emensamobile/resources/js/bootstrap.js
@@ -0,0 +1,32 @@
+/**
+ * We'll load the axios HTTP library which allows us to easily issue requests
+ * to our Laravel back-end. This library automatically handles sending the
+ * CSRF token as a header based on the value of the "XSRF" token cookie.
+ */
+
+import axios from 'axios';
+window.axios = axios;
+
+window.axios.defaults.headers.common['X-Requested-With'] = 'XMLHttpRequest';
+
+/**
+ * Echo exposes an expressive API for subscribing to channels and listening
+ * for events that are broadcast by Laravel. Echo and event broadcasting
+ * allows your team to easily build robust real-time web applications.
+ */
+
+// import Echo from 'laravel-echo';
+
+// import Pusher from 'pusher-js';
+// window.Pusher = Pusher;
+
+// window.Echo = new Echo({
+// broadcaster: 'pusher',
+// key: import.meta.env.VITE_PUSHER_APP_KEY,
+// cluster: import.meta.env.VITE_PUSHER_APP_CLUSTER ?? 'mt1',
+// wsHost: import.meta.env.VITE_PUSHER_HOST ? import.meta.env.VITE_PUSHER_HOST : `ws-${import.meta.env.VITE_PUSHER_APP_CLUSTER}.pusher.com`,
+// wsPort: import.meta.env.VITE_PUSHER_PORT ?? 80,
+// wssPort: import.meta.env.VITE_PUSHER_PORT ?? 443,
+// forceTLS: (import.meta.env.VITE_PUSHER_SCHEME ?? 'https') === 'https',
+// enabledTransports: ['ws', 'wss'],
+// });
diff --git a/M6/emensamobile/resources/views/anmeldung/anmeldung.blade.php b/M6/emensamobile/resources/views/anmeldung/anmeldung.blade.php
new file mode 100644
index 0000000..761eca9
--- /dev/null
+++ b/M6/emensamobile/resources/views/anmeldung/anmeldung.blade.php
@@ -0,0 +1,31 @@
+@extends("layouts.main_layout", ['title' => "E-Mensa"])
+
+@section("header")
+
+@endsection
+
+@section("nav")
+
+ (c) E-Mensa GmbH
+ Şafak Hazinedar & Robert Joel
+ Impressum
+
+
+@endsection
\ No newline at end of file
diff --git a/M6/emensamobile/resources/views/layouts/layout.blade.php b/M6/emensamobile/resources/views/layouts/layout.blade.php
new file mode 100644
index 0000000..fa03e70
--- /dev/null
+++ b/M6/emensamobile/resources/views/layouts/layout.blade.php
@@ -0,0 +1,23 @@
+
+
+
+
+ E-Mensa Routing Script
+
+
+
+ @yield("cssextra")
+
+
+
+
+{{ $title }}
+
+ @yield("header")
+
+
+
+
+ @yield("body")
+
+
+
+
\ No newline at end of file
diff --git a/M6/emensamobile/resources/views/layouts/main_layout.blade.php b/M6/emensamobile/resources/views/layouts/main_layout.blade.php
new file mode 100644
index 0000000..aba28e5
--- /dev/null
+++ b/M6/emensamobile/resources/views/layouts/main_layout.blade.php
@@ -0,0 +1,30 @@
+
+
+
+
+
+ {{ $title }}
+
+ @yield("header")
+
+
+
+
+@yield("nav")
+
+
+
+ Bitte warten! + +@endsection \ No newline at end of file diff --git a/M6/emensamobile/resources/views/m5_a1/layout_anmeldung.blade.php b/M6/emensamobile/resources/views/m5_a1/layout_anmeldung.blade.php new file mode 100644 index 0000000..c230204 --- /dev/null +++ b/M6/emensamobile/resources/views/m5_a1/layout_anmeldung.blade.php @@ -0,0 +1,21 @@ + + + + +Layout-m5-a1
+
+
+
+ @yield("header")
+
+
+
+ @yield("main")
+
+
+
+
+
+
\ No newline at end of file
diff --git a/M6/emensamobile/resources/views/main/index.blade.php b/M6/emensamobile/resources/views/main/index.blade.php
new file mode 100644
index 0000000..8bb999d
--- /dev/null
+++ b/M6/emensamobile/resources/views/main/index.blade.php
@@ -0,0 +1,113 @@
+@extends("layouts.main_layout", ['title' => "E-Mensa"])
+
+@section("header")
+
+@endsection
+
+@section("nav")
+
+ Gerichte Preis intern Preis extern Bild ";
+
+
+ foreach ($result_sql_gerichte as $row_gerichte) {
+
+ $preisintern = number_format($row_gerichte->preisintern, 2, ',', '.');
+ $preisextern = number_format($row_gerichte->preisextern, 2, ',', '.');
+
+ $bildname = $row_gerichte->bildname;
+
+ if ($bildname == Null) {
+ $bildname = "00_image_missing.jpg";
+ }
+
+ $bildname = "/img/gerichte/" . $bildname;
+
+ $tabelle .= "" . htmlspecialchars($row_gerichte->name) . " " . htmlspecialchars($allergene) . " " . htmlspecialchars($preisintern) . "€ " . htmlspecialchars($preisextern) . "€
+ (c) E-Mensa GmbH
+ Şafak Hazinedar & Robert Joel
+ Impressum
+
+
+@endsection
diff --git a/M6/emensamobile/resources/views/welcome.blade.php b/M6/emensamobile/resources/views/welcome.blade.php
new file mode 100644
index 0000000..6aceacc
--- /dev/null
+++ b/M6/emensamobile/resources/views/welcome.blade.php
@@ -0,0 +1,7 @@
+
+
+
+
+ Moin
+
+
diff --git a/M6/emensamobile/routes/api.php b/M6/emensamobile/routes/api.php
new file mode 100644
index 0000000..889937e
--- /dev/null
+++ b/M6/emensamobile/routes/api.php
@@ -0,0 +1,19 @@
+get('/user', function (Request $request) {
+ return $request->user();
+});
diff --git a/M6/emensamobile/routes/channels.php b/M6/emensamobile/routes/channels.php
new file mode 100644
index 0000000..5d451e1
--- /dev/null
+++ b/M6/emensamobile/routes/channels.php
@@ -0,0 +1,18 @@
+id === (int) $id;
+});
diff --git a/M6/emensamobile/routes/console.php b/M6/emensamobile/routes/console.php
new file mode 100644
index 0000000..e05f4c9
--- /dev/null
+++ b/M6/emensamobile/routes/console.php
@@ -0,0 +1,19 @@
+comment(Inspiring::quote());
+})->purpose('Display an inspiring quote');
diff --git a/M6/emensamobile/routes/web.php b/M6/emensamobile/routes/web.php
new file mode 100644
index 0000000..9f70ced
--- /dev/null
+++ b/M6/emensamobile/routes/web.php
@@ -0,0 +1,25 @@
+make(Kernel::class)->bootstrap();
+
+ return $app;
+ }
+}
diff --git a/M6/emensamobile/tests/Feature/ExampleTest.php b/M6/emensamobile/tests/Feature/ExampleTest.php
new file mode 100644
index 0000000..8364a84
--- /dev/null
+++ b/M6/emensamobile/tests/Feature/ExampleTest.php
@@ -0,0 +1,19 @@
+get('/');
+
+ $response->assertStatus(200);
+ }
+}
diff --git a/M6/emensamobile/tests/TestCase.php b/M6/emensamobile/tests/TestCase.php
new file mode 100644
index 0000000..2932d4a
--- /dev/null
+++ b/M6/emensamobile/tests/TestCase.php
@@ -0,0 +1,10 @@
+assertTrue(true);
+ }
+}
diff --git a/M6/emensamobile/vite.config.js b/M6/emensamobile/vite.config.js
new file mode 100644
index 0000000..421b569
--- /dev/null
+++ b/M6/emensamobile/vite.config.js
@@ -0,0 +1,11 @@
+import { defineConfig } from 'vite';
+import laravel from 'laravel-vite-plugin';
+
+export default defineConfig({
+ plugins: [
+ laravel({
+ input: ['resources/css/app.css', 'resources/js/app.js'],
+ refresh: true,
+ }),
+ ],
+});
diff --git a/M6/vendor/autoload.php b/M6/vendor/autoload.php
new file mode 100644
index 0000000..b9bd78e
--- /dev/null
+++ b/M6/vendor/autoload.php
@@ -0,0 +1,25 @@
+
+ * Jordi Boggiano
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Composer\Autoload;
+
+/**
+ * ClassLoader implements a PSR-0, PSR-4 and classmap class loader.
+ *
+ * $loader = new \Composer\Autoload\ClassLoader();
+ *
+ * // register classes with namespaces
+ * $loader->add('Symfony\Component', __DIR__.'/component');
+ * $loader->add('Symfony', __DIR__.'/framework');
+ *
+ * // activate the autoloader
+ * $loader->register();
+ *
+ * // to enable searching the include path (eg. for PEAR packages)
+ * $loader->setUseIncludePath(true);
+ *
+ * In this example, if you try to use a class in the Symfony\Component
+ * namespace or one of its children (Symfony\Component\Console for instance),
+ * the autoloader will first look for the class under the component/
+ * directory, and it will then fallback to the framework/ directory if not
+ * found before giving up.
+ *
+ * This class is loosely based on the Symfony UniversalClassLoader.
+ *
+ * @author Fabien Potencier
+ * @author Jordi Boggiano
+ * @see https://www.php-fig.org/psr/psr-0/
+ * @see https://www.php-fig.org/psr/psr-4/
+ */
+class ClassLoader
+{
+ /** @var \Closure(string):void */
+ private static $includeFile;
+
+ /** @var string|null */
+ private $vendorDir;
+
+ // PSR-4
+ /**
+ * @var array>
+ */
+ private $prefixLengthsPsr4 = array();
+ /**
+ * @var array>
+ */
+ private $prefixDirsPsr4 = array();
+ /**
+ * @var list
+ */
+ private $fallbackDirsPsr4 = array();
+
+ // PSR-0
+ /**
+ * List of PSR-0 prefixes
+ *
+ * Structured as array('F (first letter)' => array('Foo\Bar (full prefix)' => array('path', 'path2')))
+ *
+ * @var array>>
+ */
+ private $prefixesPsr0 = array();
+ /**
+ * @var list
+ */
+ private $fallbackDirsPsr0 = array();
+
+ /** @var bool */
+ private $useIncludePath = false;
+
+ /**
+ * @var array
+ */
+ private $classMap = array();
+
+ /** @var bool */
+ private $classMapAuthoritative = false;
+
+ /**
+ * @var array
+ */
+ private $missingClasses = array();
+
+ /** @var string|null */
+ private $apcuPrefix;
+
+ /**
+ * @var array
+ */
+ private static $registeredLoaders = array();
+
+ /**
+ * @param string|null $vendorDir
+ */
+ public function __construct($vendorDir = null)
+ {
+ $this->vendorDir = $vendorDir;
+ self::initializeIncludeClosure();
+ }
+
+ /**
+ * @return array>
+ */
+ public function getPrefixes()
+ {
+ if (!empty($this->prefixesPsr0)) {
+ return call_user_func_array('array_merge', array_values($this->prefixesPsr0));
+ }
+
+ return array();
+ }
+
+ /**
+ * @return array>
+ */
+ public function getPrefixesPsr4()
+ {
+ return $this->prefixDirsPsr4;
+ }
+
+ /**
+ * @return list
+ */
+ public function getFallbackDirs()
+ {
+ return $this->fallbackDirsPsr0;
+ }
+
+ /**
+ * @return list
+ */
+ public function getFallbackDirsPsr4()
+ {
+ return $this->fallbackDirsPsr4;
+ }
+
+ /**
+ * @return array Array of classname => path
+ */
+ public function getClassMap()
+ {
+ return $this->classMap;
+ }
+
+ /**
+ * @param array $classMap Class to filename map
+ *
+ * @return void
+ */
+ public function addClassMap(array $classMap)
+ {
+ if ($this->classMap) {
+ $this->classMap = array_merge($this->classMap, $classMap);
+ } else {
+ $this->classMap = $classMap;
+ }
+ }
+
+ /**
+ * Registers a set of PSR-0 directories for a given prefix, either
+ * appending or prepending to the ones previously set for this prefix.
+ *
+ * @param string $prefix The prefix
+ * @param list|string $paths The PSR-0 root directories
+ * @param bool $prepend Whether to prepend the directories
+ *
+ * @return void
+ */
+ public function add($prefix, $paths, $prepend = false)
+ {
+ $paths = (array) $paths;
+ if (!$prefix) {
+ if ($prepend) {
+ $this->fallbackDirsPsr0 = array_merge(
+ $paths,
+ $this->fallbackDirsPsr0
+ );
+ } else {
+ $this->fallbackDirsPsr0 = array_merge(
+ $this->fallbackDirsPsr0,
+ $paths
+ );
+ }
+
+ return;
+ }
+
+ $first = $prefix[0];
+ if (!isset($this->prefixesPsr0[$first][$prefix])) {
+ $this->prefixesPsr0[$first][$prefix] = $paths;
+
+ return;
+ }
+ if ($prepend) {
+ $this->prefixesPsr0[$first][$prefix] = array_merge(
+ $paths,
+ $this->prefixesPsr0[$first][$prefix]
+ );
+ } else {
+ $this->prefixesPsr0[$first][$prefix] = array_merge(
+ $this->prefixesPsr0[$first][$prefix],
+ $paths
+ );
+ }
+ }
+
+ /**
+ * Registers a set of PSR-4 directories for a given namespace, either
+ * appending or prepending to the ones previously set for this namespace.
+ *
+ * @param string $prefix The prefix/namespace, with trailing '\\'
+ * @param list|string $paths The PSR-4 base directories
+ * @param bool $prepend Whether to prepend the directories
+ *
+ * @throws \InvalidArgumentException
+ *
+ * @return void
+ */
+ public function addPsr4($prefix, $paths, $prepend = false)
+ {
+ $paths = (array) $paths;
+ if (!$prefix) {
+ // Register directories for the root namespace.
+ if ($prepend) {
+ $this->fallbackDirsPsr4 = array_merge(
+ $paths,
+ $this->fallbackDirsPsr4
+ );
+ } else {
+ $this->fallbackDirsPsr4 = array_merge(
+ $this->fallbackDirsPsr4,
+ $paths
+ );
+ }
+ } elseif (!isset($this->prefixDirsPsr4[$prefix])) {
+ // Register directories for a new namespace.
+ $length = strlen($prefix);
+ if ('\\' !== $prefix[$length - 1]) {
+ throw new \InvalidArgumentException("A non-empty PSR-4 prefix must end with a namespace separator.");
+ }
+ $this->prefixLengthsPsr4[$prefix[0]][$prefix] = $length;
+ $this->prefixDirsPsr4[$prefix] = $paths;
+ } elseif ($prepend) {
+ // Prepend directories for an already registered namespace.
+ $this->prefixDirsPsr4[$prefix] = array_merge(
+ $paths,
+ $this->prefixDirsPsr4[$prefix]
+ );
+ } else {
+ // Append directories for an already registered namespace.
+ $this->prefixDirsPsr4[$prefix] = array_merge(
+ $this->prefixDirsPsr4[$prefix],
+ $paths
+ );
+ }
+ }
+
+ /**
+ * Registers a set of PSR-0 directories for a given prefix,
+ * replacing any others previously set for this prefix.
+ *
+ * @param string $prefix The prefix
+ * @param list|string $paths The PSR-0 base directories
+ *
+ * @return void
+ */
+ public function set($prefix, $paths)
+ {
+ if (!$prefix) {
+ $this->fallbackDirsPsr0 = (array) $paths;
+ } else {
+ $this->prefixesPsr0[$prefix[0]][$prefix] = (array) $paths;
+ }
+ }
+
+ /**
+ * Registers a set of PSR-4 directories for a given namespace,
+ * replacing any others previously set for this namespace.
+ *
+ * @param string $prefix The prefix/namespace, with trailing '\\'
+ * @param list|string $paths The PSR-4 base directories
+ *
+ * @throws \InvalidArgumentException
+ *
+ * @return void
+ */
+ public function setPsr4($prefix, $paths)
+ {
+ if (!$prefix) {
+ $this->fallbackDirsPsr4 = (array) $paths;
+ } else {
+ $length = strlen($prefix);
+ if ('\\' !== $prefix[$length - 1]) {
+ throw new \InvalidArgumentException("A non-empty PSR-4 prefix must end with a namespace separator.");
+ }
+ $this->prefixLengthsPsr4[$prefix[0]][$prefix] = $length;
+ $this->prefixDirsPsr4[$prefix] = (array) $paths;
+ }
+ }
+
+ /**
+ * Turns on searching the include path for class files.
+ *
+ * @param bool $useIncludePath
+ *
+ * @return void
+ */
+ public function setUseIncludePath($useIncludePath)
+ {
+ $this->useIncludePath = $useIncludePath;
+ }
+
+ /**
+ * Can be used to check if the autoloader uses the include path to check
+ * for classes.
+ *
+ * @return bool
+ */
+ public function getUseIncludePath()
+ {
+ return $this->useIncludePath;
+ }
+
+ /**
+ * Turns off searching the prefix and fallback directories for classes
+ * that have not been registered with the class map.
+ *
+ * @param bool $classMapAuthoritative
+ *
+ * @return void
+ */
+ public function setClassMapAuthoritative($classMapAuthoritative)
+ {
+ $this->classMapAuthoritative = $classMapAuthoritative;
+ }
+
+ /**
+ * Should class lookup fail if not found in the current class map?
+ *
+ * @return bool
+ */
+ public function isClassMapAuthoritative()
+ {
+ return $this->classMapAuthoritative;
+ }
+
+ /**
+ * APCu prefix to use to cache found/not-found classes, if the extension is enabled.
+ *
+ * @param string|null $apcuPrefix
+ *
+ * @return void
+ */
+ public function setApcuPrefix($apcuPrefix)
+ {
+ $this->apcuPrefix = function_exists('apcu_fetch') && filter_var(ini_get('apc.enabled'), FILTER_VALIDATE_BOOLEAN) ? $apcuPrefix : null;
+ }
+
+ /**
+ * The APCu prefix in use, or null if APCu caching is not enabled.
+ *
+ * @return string|null
+ */
+ public function getApcuPrefix()
+ {
+ return $this->apcuPrefix;
+ }
+
+ /**
+ * Registers this instance as an autoloader.
+ *
+ * @param bool $prepend Whether to prepend the autoloader or not
+ *
+ * @return void
+ */
+ public function register($prepend = false)
+ {
+ spl_autoload_register(array($this, 'loadClass'), true, $prepend);
+
+ if (null === $this->vendorDir) {
+ return;
+ }
+
+ if ($prepend) {
+ self::$registeredLoaders = array($this->vendorDir => $this) + self::$registeredLoaders;
+ } else {
+ unset(self::$registeredLoaders[$this->vendorDir]);
+ self::$registeredLoaders[$this->vendorDir] = $this;
+ }
+ }
+
+ /**
+ * Unregisters this instance as an autoloader.
+ *
+ * @return void
+ */
+ public function unregister()
+ {
+ spl_autoload_unregister(array($this, 'loadClass'));
+
+ if (null !== $this->vendorDir) {
+ unset(self::$registeredLoaders[$this->vendorDir]);
+ }
+ }
+
+ /**
+ * Loads the given class or interface.
+ *
+ * @param string $class The name of the class
+ * @return true|null True if loaded, null otherwise
+ */
+ public function loadClass($class)
+ {
+ if ($file = $this->findFile($class)) {
+ $includeFile = self::$includeFile;
+ $includeFile($file);
+
+ return true;
+ }
+
+ return null;
+ }
+
+ /**
+ * Finds the path to the file where the class is defined.
+ *
+ * @param string $class The name of the class
+ *
+ * @return string|false The path if found, false otherwise
+ */
+ public function findFile($class)
+ {
+ // class map lookup
+ if (isset($this->classMap[$class])) {
+ return $this->classMap[$class];
+ }
+ if ($this->classMapAuthoritative || isset($this->missingClasses[$class])) {
+ return false;
+ }
+ if (null !== $this->apcuPrefix) {
+ $file = apcu_fetch($this->apcuPrefix.$class, $hit);
+ if ($hit) {
+ return $file;
+ }
+ }
+
+ $file = $this->findFileWithExtension($class, '.php');
+
+ // Search for Hack files if we are running on HHVM
+ if (false === $file && defined('HHVM_VERSION')) {
+ $file = $this->findFileWithExtension($class, '.hh');
+ }
+
+ if (null !== $this->apcuPrefix) {
+ apcu_add($this->apcuPrefix.$class, $file);
+ }
+
+ if (false === $file) {
+ // Remember that this class does not exist.
+ $this->missingClasses[$class] = true;
+ }
+
+ return $file;
+ }
+
+ /**
+ * Returns the currently registered loaders keyed by their corresponding vendor directories.
+ *
+ * @return array
+ */
+ public static function getRegisteredLoaders()
+ {
+ return self::$registeredLoaders;
+ }
+
+ /**
+ * @param string $class
+ * @param string $ext
+ * @return string|false
+ */
+ private function findFileWithExtension($class, $ext)
+ {
+ // PSR-4 lookup
+ $logicalPathPsr4 = strtr($class, '\\', DIRECTORY_SEPARATOR) . $ext;
+
+ $first = $class[0];
+ if (isset($this->prefixLengthsPsr4[$first])) {
+ $subPath = $class;
+ while (false !== $lastPos = strrpos($subPath, '\\')) {
+ $subPath = substr($subPath, 0, $lastPos);
+ $search = $subPath . '\\';
+ if (isset($this->prefixDirsPsr4[$search])) {
+ $pathEnd = DIRECTORY_SEPARATOR . substr($logicalPathPsr4, $lastPos + 1);
+ foreach ($this->prefixDirsPsr4[$search] as $dir) {
+ if (file_exists($file = $dir . $pathEnd)) {
+ return $file;
+ }
+ }
+ }
+ }
+ }
+
+ // PSR-4 fallback dirs
+ foreach ($this->fallbackDirsPsr4 as $dir) {
+ if (file_exists($file = $dir . DIRECTORY_SEPARATOR . $logicalPathPsr4)) {
+ return $file;
+ }
+ }
+
+ // PSR-0 lookup
+ if (false !== $pos = strrpos($class, '\\')) {
+ // namespaced class name
+ $logicalPathPsr0 = substr($logicalPathPsr4, 0, $pos + 1)
+ . strtr(substr($logicalPathPsr4, $pos + 1), '_', DIRECTORY_SEPARATOR);
+ } else {
+ // PEAR-like class name
+ $logicalPathPsr0 = strtr($class, '_', DIRECTORY_SEPARATOR) . $ext;
+ }
+
+ if (isset($this->prefixesPsr0[$first])) {
+ foreach ($this->prefixesPsr0[$first] as $prefix => $dirs) {
+ if (0 === strpos($class, $prefix)) {
+ foreach ($dirs as $dir) {
+ if (file_exists($file = $dir . DIRECTORY_SEPARATOR . $logicalPathPsr0)) {
+ return $file;
+ }
+ }
+ }
+ }
+ }
+
+ // PSR-0 fallback dirs
+ foreach ($this->fallbackDirsPsr0 as $dir) {
+ if (file_exists($file = $dir . DIRECTORY_SEPARATOR . $logicalPathPsr0)) {
+ return $file;
+ }
+ }
+
+ // PSR-0 include paths.
+ if ($this->useIncludePath && $file = stream_resolve_include_path($logicalPathPsr0)) {
+ return $file;
+ }
+
+ return false;
+ }
+
+ /**
+ * @return void
+ */
+ private static function initializeIncludeClosure()
+ {
+ if (self::$includeFile !== null) {
+ return;
+ }
+
+ /**
+ * Scope isolated include.
+ *
+ * Prevents access to $this/self from included files.
+ *
+ * @param string $file
+ * @return void
+ */
+ self::$includeFile = \Closure::bind(static function($file) {
+ include $file;
+ }, null, null);
+ }
+}
diff --git a/M6/vendor/composer/InstalledVersions.php b/M6/vendor/composer/InstalledVersions.php
new file mode 100644
index 0000000..51e734a
--- /dev/null
+++ b/M6/vendor/composer/InstalledVersions.php
@@ -0,0 +1,359 @@
+
+ * Jordi Boggiano
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Composer;
+
+use Composer\Autoload\ClassLoader;
+use Composer\Semver\VersionParser;
+
+/**
+ * This class is copied in every Composer installed project and available to all
+ *
+ * See also https://getcomposer.org/doc/07-runtime.md#installed-versions
+ *
+ * To require its presence, you can require `composer-runtime-api ^2.0`
+ *
+ * @final
+ */
+class InstalledVersions
+{
+ /**
+ * @var mixed[]|null
+ * @psalm-var array{root: array{name: string, pretty_version: string, version: string, reference: string|null, type: string, install_path: string, aliases: string[], dev: bool}, versions: array}|array{}|null
+ */
+ private static $installed;
+
+ /**
+ * @var bool|null
+ */
+ private static $canGetVendors;
+
+ /**
+ * @var array[]
+ * @psalm-var array}>
+ */
+ private static $installedByVendor = array();
+
+ /**
+ * Returns a list of all package names which are present, either by being installed, replaced or provided
+ *
+ * @return string[]
+ * @psalm-return list
+ */
+ public static function getInstalledPackages()
+ {
+ $packages = array();
+ foreach (self::getInstalled() as $installed) {
+ $packages[] = array_keys($installed['versions']);
+ }
+
+ if (1 === \count($packages)) {
+ return $packages[0];
+ }
+
+ return array_keys(array_flip(\call_user_func_array('array_merge', $packages)));
+ }
+
+ /**
+ * Returns a list of all package names with a specific type e.g. 'library'
+ *
+ * @param string $type
+ * @return string[]
+ * @psalm-return list
+ */
+ public static function getInstalledPackagesByType($type)
+ {
+ $packagesByType = array();
+
+ foreach (self::getInstalled() as $installed) {
+ foreach ($installed['versions'] as $name => $package) {
+ if (isset($package['type']) && $package['type'] === $type) {
+ $packagesByType[] = $name;
+ }
+ }
+ }
+
+ return $packagesByType;
+ }
+
+ /**
+ * Checks whether the given package is installed
+ *
+ * This also returns true if the package name is provided or replaced by another package
+ *
+ * @param string $packageName
+ * @param bool $includeDevRequirements
+ * @return bool
+ */
+ public static function isInstalled($packageName, $includeDevRequirements = true)
+ {
+ foreach (self::getInstalled() as $installed) {
+ if (isset($installed['versions'][$packageName])) {
+ return $includeDevRequirements || !isset($installed['versions'][$packageName]['dev_requirement']) || $installed['versions'][$packageName]['dev_requirement'] === false;
+ }
+ }
+
+ return false;
+ }
+
+ /**
+ * Checks whether the given package satisfies a version constraint
+ *
+ * e.g. If you want to know whether version 2.3+ of package foo/bar is installed, you would call:
+ *
+ * Composer\InstalledVersions::satisfies(new VersionParser, 'foo/bar', '^2.3')
+ *
+ * @param VersionParser $parser Install composer/semver to have access to this class and functionality
+ * @param string $packageName
+ * @param string|null $constraint A version constraint to check for, if you pass one you have to make sure composer/semver is required by your package
+ * @return bool
+ */
+ public static function satisfies(VersionParser $parser, $packageName, $constraint)
+ {
+ $constraint = $parser->parseConstraints((string) $constraint);
+ $provided = $parser->parseConstraints(self::getVersionRanges($packageName));
+
+ return $provided->matches($constraint);
+ }
+
+ /**
+ * Returns a version constraint representing all the range(s) which are installed for a given package
+ *
+ * It is easier to use this via isInstalled() with the $constraint argument if you need to check
+ * whether a given version of a package is installed, and not just whether it exists
+ *
+ * @param string $packageName
+ * @return string Version constraint usable with composer/semver
+ */
+ public static function getVersionRanges($packageName)
+ {
+ foreach (self::getInstalled() as $installed) {
+ if (!isset($installed['versions'][$packageName])) {
+ continue;
+ }
+
+ $ranges = array();
+ if (isset($installed['versions'][$packageName]['pretty_version'])) {
+ $ranges[] = $installed['versions'][$packageName]['pretty_version'];
+ }
+ if (array_key_exists('aliases', $installed['versions'][$packageName])) {
+ $ranges = array_merge($ranges, $installed['versions'][$packageName]['aliases']);
+ }
+ if (array_key_exists('replaced', $installed['versions'][$packageName])) {
+ $ranges = array_merge($ranges, $installed['versions'][$packageName]['replaced']);
+ }
+ if (array_key_exists('provided', $installed['versions'][$packageName])) {
+ $ranges = array_merge($ranges, $installed['versions'][$packageName]['provided']);
+ }
+
+ return implode(' || ', $ranges);
+ }
+
+ throw new \OutOfBoundsException('Package "' . $packageName . '" is not installed');
+ }
+
+ /**
+ * @param string $packageName
+ * @return string|null If the package is being replaced or provided but is not really installed, null will be returned as version, use satisfies or getVersionRanges if you need to know if a given version is present
+ */
+ public static function getVersion($packageName)
+ {
+ foreach (self::getInstalled() as $installed) {
+ if (!isset($installed['versions'][$packageName])) {
+ continue;
+ }
+
+ if (!isset($installed['versions'][$packageName]['version'])) {
+ return null;
+ }
+
+ return $installed['versions'][$packageName]['version'];
+ }
+
+ throw new \OutOfBoundsException('Package "' . $packageName . '" is not installed');
+ }
+
+ /**
+ * @param string $packageName
+ * @return string|null If the package is being replaced or provided but is not really installed, null will be returned as version, use satisfies or getVersionRanges if you need to know if a given version is present
+ */
+ public static function getPrettyVersion($packageName)
+ {
+ foreach (self::getInstalled() as $installed) {
+ if (!isset($installed['versions'][$packageName])) {
+ continue;
+ }
+
+ if (!isset($installed['versions'][$packageName]['pretty_version'])) {
+ return null;
+ }
+
+ return $installed['versions'][$packageName]['pretty_version'];
+ }
+
+ throw new \OutOfBoundsException('Package "' . $packageName . '" is not installed');
+ }
+
+ /**
+ * @param string $packageName
+ * @return string|null If the package is being replaced or provided but is not really installed, null will be returned as reference
+ */
+ public static function getReference($packageName)
+ {
+ foreach (self::getInstalled() as $installed) {
+ if (!isset($installed['versions'][$packageName])) {
+ continue;
+ }
+
+ if (!isset($installed['versions'][$packageName]['reference'])) {
+ return null;
+ }
+
+ return $installed['versions'][$packageName]['reference'];
+ }
+
+ throw new \OutOfBoundsException('Package "' . $packageName . '" is not installed');
+ }
+
+ /**
+ * @param string $packageName
+ * @return string|null If the package is being replaced or provided but is not really installed, null will be returned as install path. Packages of type metapackages also have a null install path.
+ */
+ public static function getInstallPath($packageName)
+ {
+ foreach (self::getInstalled() as $installed) {
+ if (!isset($installed['versions'][$packageName])) {
+ continue;
+ }
+
+ return isset($installed['versions'][$packageName]['install_path']) ? $installed['versions'][$packageName]['install_path'] : null;
+ }
+
+ throw new \OutOfBoundsException('Package "' . $packageName . '" is not installed');
+ }
+
+ /**
+ * @return array
+ * @psalm-return array{name: string, pretty_version: string, version: string, reference: string|null, type: string, install_path: string, aliases: string[], dev: bool}
+ */
+ public static function getRootPackage()
+ {
+ $installed = self::getInstalled();
+
+ return $installed[0]['root'];
+ }
+
+ /**
+ * Returns the raw installed.php data for custom implementations
+ *
+ * @deprecated Use getAllRawData() instead which returns all datasets for all autoloaders present in the process. getRawData only returns the first dataset loaded, which may not be what you expect.
+ * @return array[]
+ * @psalm-return array{root: array{name: string, pretty_version: string, version: string, reference: string|null, type: string, install_path: string, aliases: string[], dev: bool}, versions: array}
+ */
+ public static function getRawData()
+ {
+ @trigger_error('getRawData only returns the first dataset loaded, which may not be what you expect. Use getAllRawData() instead which returns all datasets for all autoloaders present in the process.', E_USER_DEPRECATED);
+
+ if (null === self::$installed) {
+ // only require the installed.php file if this file is loaded from its dumped location,
+ // and not from its source location in the composer/composer package, see https://github.com/composer/composer/issues/9937
+ if (substr(__DIR__, -8, 1) !== 'C') {
+ self::$installed = include __DIR__ . '/installed.php';
+ } else {
+ self::$installed = array();
+ }
+ }
+
+ return self::$installed;
+ }
+
+ /**
+ * Returns the raw data of all installed.php which are currently loaded for custom implementations
+ *
+ * @return array[]
+ * @psalm-return list}>
+ */
+ public static function getAllRawData()
+ {
+ return self::getInstalled();
+ }
+
+ /**
+ * Lets you reload the static array from another file
+ *
+ * This is only useful for complex integrations in which a project needs to use
+ * this class but then also needs to execute another project's autoloader in process,
+ * and wants to ensure both projects have access to their version of installed.php.
+ *
+ * A typical case would be PHPUnit, where it would need to make sure it reads all
+ * the data it needs from this class, then call reload() with
+ * `require $CWD/vendor/composer/installed.php` (or similar) as input to make sure
+ * the project in which it runs can then also use this class safely, without
+ * interference between PHPUnit's dependencies and the project's dependencies.
+ *
+ * @param array[] $data A vendor/composer/installed.php data set
+ * @return void
+ *
+ * @psalm-param array{root: array{name: string, pretty_version: string, version: string, reference: string|null, type: string, install_path: string, aliases: string[], dev: bool}, versions: array} $data
+ */
+ public static function reload($data)
+ {
+ self::$installed = $data;
+ self::$installedByVendor = array();
+ }
+
+ /**
+ * @return array[]
+ * @psalm-return list}>
+ */
+ private static function getInstalled()
+ {
+ if (null === self::$canGetVendors) {
+ self::$canGetVendors = method_exists('Composer\Autoload\ClassLoader', 'getRegisteredLoaders');
+ }
+
+ $installed = array();
+
+ if (self::$canGetVendors) {
+ foreach (ClassLoader::getRegisteredLoaders() as $vendorDir => $loader) {
+ if (isset(self::$installedByVendor[$vendorDir])) {
+ $installed[] = self::$installedByVendor[$vendorDir];
+ } elseif (is_file($vendorDir.'/composer/installed.php')) {
+ /** @var array{root: array{name: string, pretty_version: string, version: string, reference: string|null, type: string, install_path: string, aliases: string[], dev: bool}, versions: array} $required */
+ $required = require $vendorDir.'/composer/installed.php';
+ $installed[] = self::$installedByVendor[$vendorDir] = $required;
+ if (null === self::$installed && strtr($vendorDir.'/composer', '\\', '/') === strtr(__DIR__, '\\', '/')) {
+ self::$installed = $installed[count($installed) - 1];
+ }
+ }
+ }
+ }
+
+ if (null === self::$installed) {
+ // only require the installed.php file if this file is loaded from its dumped location,
+ // and not from its source location in the composer/composer package, see https://github.com/composer/composer/issues/9937
+ if (substr(__DIR__, -8, 1) !== 'C') {
+ /** @var array{root: array{name: string, pretty_version: string, version: string, reference: string|null, type: string, install_path: string, aliases: string[], dev: bool}, versions: array} $required */
+ $required = require __DIR__ . '/installed.php';
+ self::$installed = $required;
+ } else {
+ self::$installed = array();
+ }
+ }
+
+ if (self::$installed !== array()) {
+ $installed[] = self::$installed;
+ }
+
+ return $installed;
+ }
+}
diff --git a/M6/vendor/composer/LICENSE b/M6/vendor/composer/LICENSE
new file mode 100644
index 0000000..f27399a
--- /dev/null
+++ b/M6/vendor/composer/LICENSE
@@ -0,0 +1,21 @@
+
+Copyright (c) Nils Adermann, Jordi Boggiano
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is furnished
+to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all
+copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
+THE SOFTWARE.
+
diff --git a/M6/vendor/composer/autoload_classmap.php b/M6/vendor/composer/autoload_classmap.php
new file mode 100644
index 0000000..0fb0a2c
--- /dev/null
+++ b/M6/vendor/composer/autoload_classmap.php
@@ -0,0 +1,10 @@
+ $vendorDir . '/composer/InstalledVersions.php',
+);
diff --git a/M6/vendor/composer/autoload_namespaces.php b/M6/vendor/composer/autoload_namespaces.php
new file mode 100644
index 0000000..15a2ff3
--- /dev/null
+++ b/M6/vendor/composer/autoload_namespaces.php
@@ -0,0 +1,9 @@
+ array($vendorDir . '/psr/log/src'),
+ 'Monolog\\' => array($vendorDir . '/monolog/monolog/src/Monolog'),
+);
diff --git a/M6/vendor/composer/autoload_real.php b/M6/vendor/composer/autoload_real.php
new file mode 100644
index 0000000..8d4499e
--- /dev/null
+++ b/M6/vendor/composer/autoload_real.php
@@ -0,0 +1,38 @@
+register(true);
+
+ return $loader;
+ }
+}
diff --git a/M6/vendor/composer/autoload_static.php b/M6/vendor/composer/autoload_static.php
new file mode 100644
index 0000000..545b8b1
--- /dev/null
+++ b/M6/vendor/composer/autoload_static.php
@@ -0,0 +1,44 @@
+
+ array (
+ 'Psr\\Log\\' => 8,
+ ),
+ 'M' =>
+ array (
+ 'Monolog\\' => 8,
+ ),
+ );
+
+ public static $prefixDirsPsr4 = array (
+ 'Psr\\Log\\' =>
+ array (
+ 0 => __DIR__ . '/..' . '/psr/log/src',
+ ),
+ 'Monolog\\' =>
+ array (
+ 0 => __DIR__ . '/..' . '/monolog/monolog/src/Monolog',
+ ),
+ );
+
+ public static $classMap = array (
+ 'Composer\\InstalledVersions' => __DIR__ . '/..' . '/composer/InstalledVersions.php',
+ );
+
+ public static function getInitializer(ClassLoader $loader)
+ {
+ return \Closure::bind(function () use ($loader) {
+ $loader->prefixLengthsPsr4 = ComposerStaticInit5fb11b17f197f0ced40d3e3229b5dfe5::$prefixLengthsPsr4;
+ $loader->prefixDirsPsr4 = ComposerStaticInit5fb11b17f197f0ced40d3e3229b5dfe5::$prefixDirsPsr4;
+ $loader->classMap = ComposerStaticInit5fb11b17f197f0ced40d3e3229b5dfe5::$classMap;
+
+ }, null, ClassLoader::class);
+ }
+}
diff --git a/M6/vendor/composer/installed.json b/M6/vendor/composer/installed.json
new file mode 100644
index 0000000..c518883
--- /dev/null
+++ b/M6/vendor/composer/installed.json
@@ -0,0 +1,163 @@
+{
+ "packages": [
+ {
+ "name": "monolog/monolog",
+ "version": "3.5.0",
+ "version_normalized": "3.5.0.0",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/Seldaek/monolog.git",
+ "reference": "c915e2634718dbc8a4a15c61b0e62e7a44e14448"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/Seldaek/monolog/zipball/c915e2634718dbc8a4a15c61b0e62e7a44e14448",
+ "reference": "c915e2634718dbc8a4a15c61b0e62e7a44e14448",
+ "shasum": ""
+ },
+ "require": {
+ "php": ">=8.1",
+ "psr/log": "^2.0 || ^3.0"
+ },
+ "provide": {
+ "psr/log-implementation": "3.0.0"
+ },
+ "require-dev": {
+ "aws/aws-sdk-php": "^3.0",
+ "doctrine/couchdb": "~1.0@dev",
+ "elasticsearch/elasticsearch": "^7 || ^8",
+ "ext-json": "*",
+ "graylog2/gelf-php": "^1.4.2 || ^2.0",
+ "guzzlehttp/guzzle": "^7.4.5",
+ "guzzlehttp/psr7": "^2.2",
+ "mongodb/mongodb": "^1.8",
+ "php-amqplib/php-amqplib": "~2.4 || ^3",
+ "phpstan/phpstan": "^1.9",
+ "phpstan/phpstan-deprecation-rules": "^1.0",
+ "phpstan/phpstan-strict-rules": "^1.4",
+ "phpunit/phpunit": "^10.1",
+ "predis/predis": "^1.1 || ^2",
+ "ruflin/elastica": "^7",
+ "symfony/mailer": "^5.4 || ^6",
+ "symfony/mime": "^5.4 || ^6"
+ },
+ "suggest": {
+ "aws/aws-sdk-php": "Allow sending log messages to AWS services like DynamoDB",
+ "doctrine/couchdb": "Allow sending log messages to a CouchDB server",
+ "elasticsearch/elasticsearch": "Allow sending log messages to an Elasticsearch server via official client",
+ "ext-amqp": "Allow sending log messages to an AMQP server (1.0+ required)",
+ "ext-curl": "Required to send log messages using the IFTTTHandler, the LogglyHandler, the SendGridHandler, the SlackWebhookHandler or the TelegramBotHandler",
+ "ext-mbstring": "Allow to work properly with unicode symbols",
+ "ext-mongodb": "Allow sending log messages to a MongoDB server (via driver)",
+ "ext-openssl": "Required to send log messages using SSL",
+ "ext-sockets": "Allow sending log messages to a Syslog server (via UDP driver)",
+ "graylog2/gelf-php": "Allow sending log messages to a GrayLog2 server",
+ "mongodb/mongodb": "Allow sending log messages to a MongoDB server (via library)",
+ "php-amqplib/php-amqplib": "Allow sending log messages to an AMQP server using php-amqplib",
+ "rollbar/rollbar": "Allow sending log messages to Rollbar",
+ "ruflin/elastica": "Allow sending log messages to an Elastic Search server"
+ },
+ "time": "2023-10-27T15:32:31+00:00",
+ "type": "library",
+ "extra": {
+ "branch-alias": {
+ "dev-main": "3.x-dev"
+ }
+ },
+ "installation-source": "source",
+ "autoload": {
+ "psr-4": {
+ "Monolog\\": "src/Monolog"
+ }
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "authors": [
+ {
+ "name": "Jordi Boggiano",
+ "email": "j.boggiano@seld.be",
+ "homepage": "https://seld.be"
+ }
+ ],
+ "description": "Sends your logs to files, sockets, inboxes, databases and various web services",
+ "homepage": "https://github.com/Seldaek/monolog",
+ "keywords": [
+ "log",
+ "logging",
+ "psr-3"
+ ],
+ "support": {
+ "issues": "https://github.com/Seldaek/monolog/issues",
+ "source": "https://github.com/Seldaek/monolog/tree/3.5.0"
+ },
+ "funding": [
+ {
+ "url": "https://github.com/Seldaek",
+ "type": "github"
+ },
+ {
+ "url": "https://tidelift.com/funding/github/packagist/monolog/monolog",
+ "type": "tidelift"
+ }
+ ],
+ "install-path": "../monolog/monolog"
+ },
+ {
+ "name": "psr/log",
+ "version": "3.0.0",
+ "version_normalized": "3.0.0.0",
+ "source": {
+ "type": "git",
+ "url": "https://github.com/php-fig/log.git",
+ "reference": "fe5ea303b0887d5caefd3d431c3e61ad47037001"
+ },
+ "dist": {
+ "type": "zip",
+ "url": "https://api.github.com/repos/php-fig/log/zipball/fe5ea303b0887d5caefd3d431c3e61ad47037001",
+ "reference": "fe5ea303b0887d5caefd3d431c3e61ad47037001",
+ "shasum": ""
+ },
+ "require": {
+ "php": ">=8.0.0"
+ },
+ "time": "2021-07-14T16:46:02+00:00",
+ "type": "library",
+ "extra": {
+ "branch-alias": {
+ "dev-master": "3.x-dev"
+ }
+ },
+ "installation-source": "source",
+ "autoload": {
+ "psr-4": {
+ "Psr\\Log\\": "src"
+ }
+ },
+ "notification-url": "https://packagist.org/downloads/",
+ "license": [
+ "MIT"
+ ],
+ "authors": [
+ {
+ "name": "PHP-FIG",
+ "homepage": "https://www.php-fig.org/"
+ }
+ ],
+ "description": "Common interface for logging libraries",
+ "homepage": "https://github.com/php-fig/log",
+ "keywords": [
+ "log",
+ "psr",
+ "psr-3"
+ ],
+ "support": {
+ "source": "https://github.com/php-fig/log/tree/3.0.0"
+ },
+ "install-path": "../psr/log"
+ }
+ ],
+ "dev": true,
+ "dev-package-names": []
+}
diff --git a/M6/vendor/composer/installed.php b/M6/vendor/composer/installed.php
new file mode 100644
index 0000000..d56ffc5
--- /dev/null
+++ b/M6/vendor/composer/installed.php
@@ -0,0 +1,47 @@
+ array(
+ 'name' => '__root__',
+ 'pretty_version' => 'dev-main',
+ 'version' => 'dev-main',
+ 'reference' => 'aa921725c9c2f33a570d442d9549fdb9ebad6611',
+ 'type' => 'library',
+ 'install_path' => __DIR__ . '/../../',
+ 'aliases' => array(),
+ 'dev' => true,
+ ),
+ 'versions' => array(
+ '__root__' => array(
+ 'pretty_version' => 'dev-main',
+ 'version' => 'dev-main',
+ 'reference' => 'aa921725c9c2f33a570d442d9549fdb9ebad6611',
+ 'type' => 'library',
+ 'install_path' => __DIR__ . '/../../',
+ 'aliases' => array(),
+ 'dev_requirement' => false,
+ ),
+ 'monolog/monolog' => array(
+ 'pretty_version' => '3.5.0',
+ 'version' => '3.5.0.0',
+ 'reference' => 'c915e2634718dbc8a4a15c61b0e62e7a44e14448',
+ 'type' => 'library',
+ 'install_path' => __DIR__ . '/../monolog/monolog',
+ 'aliases' => array(),
+ 'dev_requirement' => false,
+ ),
+ 'psr/log' => array(
+ 'pretty_version' => '3.0.0',
+ 'version' => '3.0.0.0',
+ 'reference' => 'fe5ea303b0887d5caefd3d431c3e61ad47037001',
+ 'type' => 'library',
+ 'install_path' => __DIR__ . '/../psr/log',
+ 'aliases' => array(),
+ 'dev_requirement' => false,
+ ),
+ 'psr/log-implementation' => array(
+ 'dev_requirement' => false,
+ 'provided' => array(
+ 0 => '3.0.0',
+ ),
+ ),
+ ),
+);
diff --git a/M6/vendor/composer/platform_check.php b/M6/vendor/composer/platform_check.php
new file mode 100644
index 0000000..4c3a5d6
--- /dev/null
+++ b/M6/vendor/composer/platform_check.php
@@ -0,0 +1,26 @@
+= 80100)) {
+ $issues[] = 'Your Composer dependencies require a PHP version ">= 8.1.0". You are running ' . PHP_VERSION . '.';
+}
+
+if ($issues) {
+ if (!headers_sent()) {
+ header('HTTP/1.1 500 Internal Server Error');
+ }
+ if (!ini_get('display_errors')) {
+ if (PHP_SAPI === 'cli' || PHP_SAPI === 'phpdbg') {
+ fwrite(STDERR, 'Composer detected issues in your platform:' . PHP_EOL.PHP_EOL . implode(PHP_EOL, $issues) . PHP_EOL.PHP_EOL);
+ } elseif (!headers_sent()) {
+ echo 'Composer detected issues in your platform:' . PHP_EOL.PHP_EOL . str_replace('You are running '.PHP_VERSION.'.', '', implode(PHP_EOL, $issues)) . PHP_EOL.PHP_EOL;
+ }
+ }
+ trigger_error(
+ 'Composer detected issues in your platform: ' . implode(' ', $issues),
+ E_USER_ERROR
+ );
+}
diff --git a/composer.phar b/composer.phar
new file mode 100644
index 0000000..4723b1b
Binary files /dev/null and b/composer.phar differ
+
+@endsection
+
+@section("footer")
+
+
+
+
+
+
+ This is a blade view showing phpinfo();
+ + +@php +phpinfo(); +@endphp \ No newline at end of file diff --git a/M6/emensa/views/demo/dbdata.blade.php b/M6/emensa/views/demo/dbdata.blade.php new file mode 100644 index 0000000..06e0b05 --- /dev/null +++ b/M6/emensa/views/demo/dbdata.blade.php @@ -0,0 +1,32 @@ + + + + +Es gab ein Problem mit der Datenbankverbindung
+Fehlermeldung
+ {{$data['beschreibung']}}
+
+@else
+
+
+ Daten aus der Datenbank der Tabelle: Gerichte
+Der Controller inkludiert das benötigte Model (gerichte.php in diesem Fall)
+ und ruft die benötigte Funktion db_gerichte_select_all() zum Laden der Daten auf
-
+ @forelse($data as $a)
+
- {{$a['name']}} + @empty +
- Keine Daten vorhanden. + @endforelse +
+
+@endsection
+
+@section("cssextra")
+
+@endsection
+
+@section("jsextra")
+
+@endsection
\ No newline at end of file
diff --git a/M6/emensa/views/demo/requestdata.blade.php b/M6/emensa/views/demo/requestdata.blade.php
new file mode 100644
index 0000000..496af1b
--- /dev/null
+++ b/M6/emensa/views/demo/requestdata.blade.php
@@ -0,0 +1,24 @@
+Demo für {{ $name }}
+Kurze Übersicht, wie die Arbeit mit dem Router und der Blade View-Engine funktioniert.
+ +Router
+Der Router nimmt den Request entgegen und zerlegt ihn in die einzelnen Teile der URI. Wichtig ist hier vor + allem der Pfad und der Querystring.
+Wenn der Pfad in der Routenkonfiguration (\$config Array aus der Datei
+ routes/web.php) gefunden wird, lädt der Router die angegebene Klasse.
Funktionsweise
+Im vorliegenden Beispiel sehen Sie diese Seite ...
+-
+
- weil der Pfad in der Routenkonfiguration gefunden wurde +
- und dort 'DemoController@howto' hinterlegt ist +
- und im Ordner controllers/ die Datei
DemoController.phpgefunden werden konnte +
+ - und mit ihr ein Objekt des Typs DemoController instanziiert werden konnte +
- und dieses Objekt die Funktion (Action) howto() ausgeführt hat +
Sie sehen: da muss einiges stimmen und vieles davon ist Konvention.
+Querystrings und Pfadsegmente
+Die Actions in den Controller-Klassen sollen per Konvention immer ein RequestData Objekt
+ entgegennehmen. Beispiel: howto(RequestData \$rd)
Dieses RequestData Objekt wird durch den Router befüllt, wenn Daten in der URL extrahiert werden konnten.
+Daten finden sich URLs...
+ +-
+
-
+
+ im Querystring
+
Beispiel: rufen Sie diese mit +{{strtolower(explode('/',$_SERVER["SERVER_PROTOCOL"])[0])}}://{{$_SERVER["HTTP_HOST"]}}/demo?bgcolor=fefbd8&name=Remmy+ auf, werden bgcolor undnamemitsamt Werten als Query Array +$rd->query) übergeben +
+
Probieren Sie es aus ;)
+ @if(count($rd->args)) +Argumente dieses Aufrufs:
+ + @forelse($rd->args as $a) +{{$a}}
+ @empty
+ Keine weiteren Argumente im Request
+ @endforelse + @endif + @if(count($rd->query)) +Daten aus der Query dieses Aufrufs:
+
+ @forelse($rd->query as $k => $v)
+ $rd->query['{{$k}}']={{$v}}
+ @empty
+ Keine Querydaten
+ @endforelse
+ Blade
+Blade muss installiert sein. + Die Installation ist bereits geschehen und die Bibliothek liegt unter /vendor. +
+Daten übergeben und View rendern
+Bei der Verwendung der View-Engine gelten einige Konventionen:
+ Die Dateien müssen <viewname>.blade.php heißen und im Ordner views liegen.
+
Sie können der View dann Daten mitgeben, indem Sie alle Daten in ein Array schreiben und dieses dann + übergeben.
+Beispiel:
+
+ view("viewtest",
+ array(
+ "texts"=>$textArray,
+ "persona"=>$persona,
+ "rd"=>$rd
+ )); // öffnet ../views/viewtest.blade.php
+ RequestData
+ +@if(count($rd->getData())) +combined request data
+
+ {{print_r($rd->getData(),1)}}
+
+@else
+ this request contained zero parameters
+@endif + +@if(count($rd->getGetData())) +GET request data
+ {{print_r($rd->getGetData(),1)}}
+
+@endif
+
+@if(count($rd->getPostData()))
+ POST request data
+ {{print_r($rd->getPostData(),1)}}
+
+@endif
\ No newline at end of file
diff --git a/M6/emensa/views/examples/m4_7a_queryparameter.blade.php b/M6/emensa/views/examples/m4_7a_queryparameter.blade.php
new file mode 100644
index 0000000..c094999
--- /dev/null
+++ b/M6/emensa/views/examples/m4_7a_queryparameter.blade.php
@@ -0,0 +1,13 @@
+
+
+
+
+ Es gab ein Problem mit der Datenbankverbindung
+Fehlermeldung
+ {{$data['beschreibung']}}
+
+@else
+
+
+ Daten aus der Datenbank der Tabelle: Kategorien
+ +-
+ @forelse($data as $a)
+ @if($zweites)
- {{$a['name']}} + @else +
- {{$a['name']}} + @endif + @empty +
- Keine Daten vorhanden. + @endforelse +
Es gab ein Problem mit der Datenbankverbindung
+Fehlermeldung
+ {{$data['beschreibung']}}
+
+@else
+
+ Daten aus der Datenbank der Tabelle: Kategorien
+ +-
+ @forelse($data as $a)
+ @if(!empty($a['name']))
+
- {{$a['name']}} + @endif + + @empty +
- Es sind keine Gerichte vorhanden + @endforelse +
Page 1
+@endsection + +@section("footer") +Footer of Page 1
+@endsection \ No newline at end of file diff --git a/M6/emensa/views/examples/pages/m4_7d_page_2.blade.php b/M6/emensa/views/examples/pages/m4_7d_page_2.blade.php new file mode 100644 index 0000000..920a59a --- /dev/null +++ b/M6/emensa/views/examples/pages/m4_7d_page_2.blade.php @@ -0,0 +1,13 @@ +@extends(".layouts.m4_7d_layout",['title' => "Page 2"]) + +@section("header") + +@endsection + +@section("body") +Page 2
+@endsection + +@section("footer") +Footer of Page 2
+@endsection \ No newline at end of file diff --git a/M6/emensa/views/home.blade.php b/M6/emensa/views/home.blade.php new file mode 100644 index 0000000..474d713 --- /dev/null +++ b/M6/emensa/views/home.blade.php @@ -0,0 +1,34 @@ +@extends("layouts.layout") + +@section("content") +Hauptseite E-Mensa
+
+
+
+
+@yield("jsextra")
+
+
+
diff --git a/M6/emensa/views/layouts/m4_7d_layout.blade.php b/M6/emensa/views/layouts/m4_7d_layout.blade.php
new file mode 100644
index 0000000..2ae864d
--- /dev/null
+++ b/M6/emensa/views/layouts/m4_7d_layout.blade.php
@@ -0,0 +1,21 @@
+
+
+
+
+
+
+ @yield("content")
+
++
+
+
+
+
+
\ No newline at end of file
diff --git a/M6/emensa/views/m5_a1/abmeldung.blade.php b/M6/emensa/views/m5_a1/abmeldung.blade.php
new file mode 100644
index 0000000..c3044c8
--- /dev/null
+++ b/M6/emensa/views/m5_a1/abmeldung.blade.php
@@ -0,0 +1,11 @@
+@extends("m5_a1.layout_anmeldung")
+
+@section("main")
+
+ @if(!isset($_SESSION['name']))
+
+
+
+ @endif
+
+@endsection
\ No newline at end of file
diff --git a/M6/emensa/views/m5_a1/anmeldung.blade.php b/M6/emensa/views/m5_a1/anmeldung.blade.php
new file mode 100644
index 0000000..4e39a2e
--- /dev/null
+++ b/M6/emensa/views/m5_a1/anmeldung.blade.php
@@ -0,0 +1,23 @@
+@extends("m5_a1.layout_anmeldung")
+
+@section("main")
+
+
+
+ @if(!isset($anmeldung)) Bitte anmelden!
+ @elseif ($anmeldung == 1)
+ {{ session_start() }}
+ Anmeldung erlaubt!
+ @else Es ist ein Fehler aufgetretten!
+ @endif
+
+@endsection
\ No newline at end of file
diff --git a/M6/emensa/views/m5_a1/anmeldung_nichtkorrekt.blade.php b/M6/emensa/views/m5_a1/anmeldung_nichtkorrekt.blade.php
new file mode 100644
index 0000000..4e39a2e
--- /dev/null
+++ b/M6/emensa/views/m5_a1/anmeldung_nichtkorrekt.blade.php
@@ -0,0 +1,23 @@
+@extends("m5_a1.layout_anmeldung")
+
+@section("main")
+
+
+
+ @if(!isset($anmeldung)) Bitte anmelden!
+ @elseif ($anmeldung == 1)
+ {{ session_start() }}
+ Anmeldung erlaubt!
+ @else Es ist ein Fehler aufgetretten!
+ @endif
+
+@endsection
\ No newline at end of file
diff --git a/M6/emensa/views/m5_a1/anmeldung_verifizieren.blade.php b/M6/emensa/views/m5_a1/anmeldung_verifizieren.blade.php
new file mode 100644
index 0000000..bebb978
--- /dev/null
+++ b/M6/emensa/views/m5_a1/anmeldung_verifizieren.blade.php
@@ -0,0 +1,50 @@
+@extends("m5_a1.layout_anmeldung")
+
+@section("main")
+
+ @if($anmeldung == 1)
+
+
+
+
+ @else
+
+
+
+
+ @endif
+
+
+@yield("text")
+
+@yield("gerichte")
+
+
+
+ + Bitte warten! + +@endsection \ No newline at end of file diff --git a/M6/emensa/views/m5_a1/layout_anmeldung.blade.php b/M6/emensa/views/m5_a1/layout_anmeldung.blade.php new file mode 100644 index 0000000..c230204 --- /dev/null +++ b/M6/emensa/views/m5_a1/layout_anmeldung.blade.php @@ -0,0 +1,21 @@ + + + + +
+
+
+@endsection
+
+@section("text")
+
+
+
+
+
+
+
+
+ Bald gibt es auch Essen online ;)
+Lorem ipsum dolor sit amet, consetetur sadipscing elitr, sed diam nonumy eirmod tempor invidunt ut labore et + dolore magna aliquyam erat, sed diam voluptua. At vero eos et accusam et justo duo dolores et ea rebum. Stet + clita kasd gubergren, no sea takimata sanctus est Lorem ipsum dolor sit amet. Lorem ipsum dolor sit amet, + consetetur sadipscing elitr, sed diam nonumy eirmod tempor invidunt ut labore et dolore magna aliquyam erat, + sed diam voluptua. At vero eos et accusam et justo duo dolores et ea rebum. Stet clita kasd gubergren, no + sea takimata sanctus est Lorem ipsum dolor sit amet.
+Köstlichkeiten die Sie erwarten
+ +@endsection + +@section("gerichte") + + + @if (isset($data['error'])) +Es gab ein Problem mit der Datenbankverbindung
+Fehlermeldung
+ {{$data['beschreibung']}}
+
+ @else
+ Nicht implementiert
+Sie haben eine Action aufgerufen, die zu dieser View führt.
+Vervollständigen Sie die Action, sodass die Aufgabe erfüllt wird.
+@endsection \ No newline at end of file diff --git a/M6/emensamobile/.editorconfig b/M6/emensamobile/.editorconfig new file mode 100644 index 0000000..8f0de65 --- /dev/null +++ b/M6/emensamobile/.editorconfig @@ -0,0 +1,18 @@ +root = true + +[*] +charset = utf-8 +end_of_line = lf +indent_size = 4 +indent_style = space +insert_final_newline = true +trim_trailing_whitespace = true + +[*.md] +trim_trailing_whitespace = false + +[*.{yml,yaml}] +indent_size = 2 + +[docker-compose.yml] +indent_size = 4 diff --git a/M6/emensamobile/.env.example b/M6/emensamobile/.env.example new file mode 100644 index 0000000..ea0665b --- /dev/null +++ b/M6/emensamobile/.env.example @@ -0,0 +1,59 @@ +APP_NAME=Laravel +APP_ENV=local +APP_KEY= +APP_DEBUG=true +APP_URL=http://localhost + +LOG_CHANNEL=stack +LOG_DEPRECATIONS_CHANNEL=null +LOG_LEVEL=debug + +DB_CONNECTION=mysql +DB_HOST=127.0.0.1 +DB_PORT=3306 +DB_DATABASE=laravel +DB_USERNAME=root +DB_PASSWORD= + +BROADCAST_DRIVER=log +CACHE_DRIVER=file +FILESYSTEM_DISK=local +QUEUE_CONNECTION=sync +SESSION_DRIVER=file +SESSION_LIFETIME=120 + +MEMCACHED_HOST=127.0.0.1 + +REDIS_HOST=127.0.0.1 +REDIS_PASSWORD=null +REDIS_PORT=6379 + +MAIL_MAILER=smtp +MAIL_HOST=mailpit +MAIL_PORT=1025 +MAIL_USERNAME=null +MAIL_PASSWORD=null +MAIL_ENCRYPTION=null +MAIL_FROM_ADDRESS="hello@example.com" +MAIL_FROM_NAME="${APP_NAME}" + +AWS_ACCESS_KEY_ID= +AWS_SECRET_ACCESS_KEY= +AWS_DEFAULT_REGION=us-east-1 +AWS_BUCKET= +AWS_USE_PATH_STYLE_ENDPOINT=false + +PUSHER_APP_ID= +PUSHER_APP_KEY= +PUSHER_APP_SECRET= +PUSHER_HOST= +PUSHER_PORT=443 +PUSHER_SCHEME=https +PUSHER_APP_CLUSTER=mt1 + +VITE_APP_NAME="${APP_NAME}" +VITE_PUSHER_APP_KEY="${PUSHER_APP_KEY}" +VITE_PUSHER_HOST="${PUSHER_HOST}" +VITE_PUSHER_PORT="${PUSHER_PORT}" +VITE_PUSHER_SCHEME="${PUSHER_SCHEME}" +VITE_PUSHER_APP_CLUSTER="${PUSHER_APP_CLUSTER}" diff --git a/M6/emensamobile/.gitattributes b/M6/emensamobile/.gitattributes new file mode 100644 index 0000000..fcb21d3 --- /dev/null +++ b/M6/emensamobile/.gitattributes @@ -0,0 +1,11 @@ +* text=auto eol=lf + +*.blade.php diff=html +*.css diff=css +*.html diff=html +*.md diff=markdown +*.php diff=php + +/.github export-ignore +CHANGELOG.md export-ignore +.styleci.yml export-ignore diff --git a/M6/emensamobile/.gitignore b/M6/emensamobile/.gitignore new file mode 100644 index 0000000..7fe978f --- /dev/null +++ b/M6/emensamobile/.gitignore @@ -0,0 +1,19 @@ +/.phpunit.cache +/node_modules +/public/build +/public/hot +/public/storage +/storage/*.key +/vendor +.env +.env.backup +.env.production +.phpunit.result.cache +Homestead.json +Homestead.yaml +auth.json +npm-debug.log +yarn-error.log +/.fleet +/.idea +/.vscode diff --git a/M6/emensamobile/README.md b/M6/emensamobile/README.md new file mode 100644 index 0000000..1824fc1 --- /dev/null +++ b/M6/emensamobile/README.md @@ -0,0 +1,66 @@ +
+
+
+
+@endsection
+
+@section("footer")
+
+
+
+
+
+
+
+
+
+@yield("jsextra")
+
+
+
diff --git a/M6/emensamobile/resources/views/layouts/m4_7d_layout.blade.php b/M6/emensamobile/resources/views/layouts/m4_7d_layout.blade.php
new file mode 100644
index 0000000..2ae864d
--- /dev/null
+++ b/M6/emensamobile/resources/views/layouts/m4_7d_layout.blade.php
@@ -0,0 +1,21 @@
+
+
+
+
+
+
+ @yield("content")
+
++
+
+
+
+
+
\ No newline at end of file
diff --git a/M6/emensamobile/resources/views/m5_a1/abmeldung.blade.php b/M6/emensamobile/resources/views/m5_a1/abmeldung.blade.php
new file mode 100644
index 0000000..c3044c8
--- /dev/null
+++ b/M6/emensamobile/resources/views/m5_a1/abmeldung.blade.php
@@ -0,0 +1,11 @@
+@extends("m5_a1.layout_anmeldung")
+
+@section("main")
+
+ @if(!isset($_SESSION['name']))
+
+
+
+ @endif
+
+@endsection
\ No newline at end of file
diff --git a/M6/emensamobile/resources/views/m5_a1/anmeldung.blade.php b/M6/emensamobile/resources/views/m5_a1/anmeldung.blade.php
new file mode 100644
index 0000000..4e39a2e
--- /dev/null
+++ b/M6/emensamobile/resources/views/m5_a1/anmeldung.blade.php
@@ -0,0 +1,23 @@
+@extends("m5_a1.layout_anmeldung")
+
+@section("main")
+
+
+
+ @if(!isset($anmeldung)) Bitte anmelden!
+ @elseif ($anmeldung == 1)
+ {{ session_start() }}
+ Anmeldung erlaubt!
+ @else Es ist ein Fehler aufgetretten!
+ @endif
+
+@endsection
\ No newline at end of file
diff --git a/M6/emensamobile/resources/views/m5_a1/anmeldung_nichtkorrekt.blade.php b/M6/emensamobile/resources/views/m5_a1/anmeldung_nichtkorrekt.blade.php
new file mode 100644
index 0000000..4e39a2e
--- /dev/null
+++ b/M6/emensamobile/resources/views/m5_a1/anmeldung_nichtkorrekt.blade.php
@@ -0,0 +1,23 @@
+@extends("m5_a1.layout_anmeldung")
+
+@section("main")
+
+
+
+ @if(!isset($anmeldung)) Bitte anmelden!
+ @elseif ($anmeldung == 1)
+ {{ session_start() }}
+ Anmeldung erlaubt!
+ @else Es ist ein Fehler aufgetretten!
+ @endif
+
+@endsection
\ No newline at end of file
diff --git a/M6/emensamobile/resources/views/m5_a1/anmeldung_verifizieren.blade.php b/M6/emensamobile/resources/views/m5_a1/anmeldung_verifizieren.blade.php
new file mode 100644
index 0000000..bebb978
--- /dev/null
+++ b/M6/emensamobile/resources/views/m5_a1/anmeldung_verifizieren.blade.php
@@ -0,0 +1,50 @@
+@extends("m5_a1.layout_anmeldung")
+
+@section("main")
+
+ @if($anmeldung == 1)
+
+
+
+
+ @else
+
+
+
+
+ @endif
+
+
+@yield("text")
+
+@yield("gerichte")
+
+
+
+ + Bitte warten! + +@endsection \ No newline at end of file diff --git a/M6/emensamobile/resources/views/m5_a1/layout_anmeldung.blade.php b/M6/emensamobile/resources/views/m5_a1/layout_anmeldung.blade.php new file mode 100644 index 0000000..c230204 --- /dev/null +++ b/M6/emensamobile/resources/views/m5_a1/layout_anmeldung.blade.php @@ -0,0 +1,21 @@ + + + + +
+
+
+@endsection
+
+@section("text")
+
+
+
+
+
+
+
+
+ Bald gibt es auch Essen online ;)
+Lorem ipsum dolor sit amet, consetetur sadipscing elitr, sed diam nonumy eirmod tempor invidunt ut labore et + dolore magna aliquyam erat, sed diam voluptua. At vero eos et accusam et justo duo dolores et ea rebum. Stet + clita kasd gubergren, no sea takimata sanctus est Lorem ipsum dolor sit amet. Lorem ipsum dolor sit amet, + consetetur sadipscing elitr, sed diam nonumy eirmod tempor invidunt ut labore et dolore magna aliquyam erat, + sed diam voluptua. At vero eos et accusam et justo duo dolores et ea rebum. Stet clita kasd gubergren, no + sea takimata sanctus est Lorem ipsum dolor sit amet.
+Köstlichkeiten die Sie erwarten
+ +@endsection + +@section("gerichte") + + + @if (isset($data['error'])) +Es gab ein Problem mit der Datenbankverbindung
+Fehlermeldung
+ {{$data['beschreibung']}}
+
+ @else
+